--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/imgtools/sisutils/src/sis2iby.cpp Mon May 10 19:54:49 2010 +0100
@@ -0,0 +1,682 @@
+/*
+* Copyright (c) 2008-2009 Nokia Corporation and/or its subsidiary(-ies).
+* All rights reserved.
+* This component and the accompanying materials are made available
+* under the terms of the License "Eclipse Public License v1.0"
+* which accompanies this distribution, and is available
+* at the URL "http://www.eclipse.org/legal/epl-v10.html".
+*
+* Initial Contributors:
+* Nokia Corporation - initial contribution.
+*
+* Contributors:
+*
+* Description:
+*
+*/
+
+
+#include "sisutils.h"
+#include "sis2iby.h"
+
+/**
+Constructor: Sis2Iby class
+Initilize the parameters to data members.
+
+@internalComponent
+@released
+
+@param aFile - SIS file name
+*/
+Sis2Iby::Sis2Iby(char* aFile) : SisUtils(aFile)
+{
+}
+
+/**
+Destructor: Sis2Iby class
+Deallocates the memory for data members
+
+@internalComponent
+@released
+*/
+Sis2Iby::~Sis2Iby()
+{
+ PKGFILE_MAP::iterator begin = iPkgFileMap.begin();
+ PKGFILE_MAP::iterator end = iPkgFileMap.end();
+ while(begin != end)
+ {
+ PPKGPARSER ptemp = 0;
+ ptemp = (*begin).second;
+
+ if(ptemp)
+ delete ptemp;
+ ++begin;
+ }
+ iPkgFileMap.clear();
+}
+
+/**
+ProcessSisFile: Processes the input sis file
+ Invoke the DUMPSIS tool to extract the sis file contents
+ Creates package parser object for each of the package file
+
+@internalComponent
+@released
+*/
+void Sis2Iby::ProcessSisFile()
+{
+ TUint32 retStatus = STAT_SUCCESS;
+ String sisFile = SisFileName();
+
+ if(IsVerboseMode())
+ {
+ std::cout << "Processing " << (char*)sisFile.data() << std::endl;
+ }
+
+ if(IsFileExist(sisFile))
+ {
+ retStatus = InvokeExtractTool(sisFile);
+
+ switch(retStatus)
+ {
+ case STAT_SUCCESS:
+ {
+ UpdatePkgFileMap(iExtractPath, sisFile);
+ }
+ break;
+ case STAT_FAILURE:
+ {
+ throw SisUtilsException((char*)sisFile.data(), const_cast<char *>("Failed to extract SIS file"));
+ }
+ }
+ }
+ else
+ throw SisUtilsException((char*)sisFile.data(), const_cast<char *>("File not found"));
+}
+
+/**
+GenerateOutput: Generates IBY for each of the package file
+
+@internalComponent
+@released
+*/
+void Sis2Iby::GenerateOutput()
+{
+ PKGFILE_MAP::iterator begin = iPkgFileMap.begin();
+ PKGFILE_MAP::iterator end = iPkgFileMap.end();
+ while(begin != end)
+ {
+ GenerateIby((*begin).first, (*begin).second);
+ ++begin;
+ }
+}
+
+/**
+GenerateOutput: Generates IBY file for the given package file
+
+@internalComponent
+@released
+
+@param aPkgFile - package file name
+@param aParser - corresponding package file reader object
+*/
+void Sis2Iby::GenerateIby(String aPkgFile, PPKGPARSER aParser)
+{
+ String ibyFile = iOutputPath;
+
+ AppendFileName(ibyFile, aPkgFile);
+ ibyFile.append(".iby");
+
+ if( !MakeDirectory(iOutputPath) )
+ throw SisUtilsException((char*)iOutputPath.data(), const_cast<char *>("Failed to create path"));
+
+ if(IsVerboseMode())
+ {
+ std::cout << "Generating IBY file " << (char*)ibyFile.data() << std::endl;
+ }
+
+ ibyHandle.open((char*)ibyFile.data(),(std::ios::out));
+
+ if(!ibyHandle.good())
+ {
+ throw SisUtilsException((char*)ibyFile.data(), const_cast<char *>("Failed to create IBY file"));
+ }
+
+ // Generating Header
+ MakeFullPath(aPkgFile);
+ ibyHandle << "\n// Generated IBY file for the package file: ";
+ ibyHandle << aPkgFile;
+
+ // Language Supported
+ WriteLanguages(aParser);
+
+ // Package Header
+ WritePackageHeader(aParser);
+
+ // Install options list
+ WriteInstallOptions(aParser);
+
+ // Package Body
+ WritePackageBody(aParser);
+
+ ibyHandle.close();
+}
+
+/**
+InvokeExtractTool: Invokes the SIS file extraction tool and returns the status
+
+@internalComponent
+@released
+
+@param sisFile - SIS file name
+*/
+TUint32 Sis2Iby::InvokeExtractTool(String sisFile)
+{
+ String cmdLine;
+
+ cmdLine.append(SISEXTRACT_TOOL_NAME SISEXTRACT_TOOL_DEFOPT);
+
+ AppendFileName(iExtractPath, sisFile);
+
+ cmdLine.append(SISEXTRACT_TOOL_EXTOPT);
+ cmdLine.append("\"" + iExtractPath + "\" ");
+ cmdLine.append(sisFile);
+
+ if(IsVerboseMode())
+ {
+ std::cout << "Executing " << (char*)cmdLine.data() << std::endl;
+ }
+
+ return RunCommand(cmdLine);
+}
+
+/**
+UpdatePkgFileMap: Update the package file map by getting the embedded sis file list from the parser object
+
+@internalComponent
+@released
+
+@param aPath - Extract path
+@param aFile - SIS file name
+*/
+void Sis2Iby::UpdatePkgFileMap(String aPath, String aFile)
+{
+ String pkgFileName;
+ std::list<String> sisList;
+
+ // main pkg file
+ pkgFileName = aPath;
+ AppendFileName(pkgFileName, aFile);
+ pkgFileName.append(".pkg");
+
+ // create an instance for the pkg file parser
+ // get the embedded sis file list
+ // add each as pkg file into the list
+ pkgParser = 0;
+ if( IsFileExist(pkgFileName) )
+ {
+ pkgParser = new PkgParser(pkgFileName);
+
+ if(pkgParser)
+ {
+ pkgParser->ParsePkgFile();
+
+ iPkgFileMap[pkgFileName] = pkgParser;
+
+ pkgParser->GetEmbeddedSisList(sisList);
+ SISFILE_LIST::iterator begin = sisList.begin();
+ SISFILE_LIST::iterator end = sisList.end();
+
+ while(begin != end)
+ {
+ String currPath = aPath;
+
+ currPath.append(PATHSEPARATOR);
+ GetFileName((*begin), currPath);
+ UpdatePkgFileMap(currPath, (*begin));
+
+ ++begin;
+ }
+ }
+ else
+ throw SisUtilsException((char*)pkgFileName.data(), const_cast<char *>("Could not create parser object"));
+ }
+ else
+ throw SisUtilsException(const_cast<char *>(pkgFileName.data()),
+ const_cast<char *>("File not found"));
+}
+
+/**
+WriteLanguages: Writes language section in the IBY file
+
+@internalComponent
+@released
+
+@param aParser - Package file parser object
+*/
+void Sis2Iby::WriteLanguages(PPKGPARSER aParser)
+{
+ LANGUAGE_LIST lanMap;
+ PLANG_LIST langCode;
+
+ aParser->GetLanguageList(lanMap);
+ ibyHandle << "\n// Languages: ";
+
+ LANGUAGE_LIST::iterator begin = lanMap.begin();
+ LANGUAGE_LIST::iterator end = lanMap.end();
+
+ while(begin != end)
+ {
+ langCode = (*begin);
+
+ ibyHandle << " " << langCode->langName;
+ ibyHandle << "(" << langCode->langCode;
+
+ if(langCode->dialectCode)
+ {
+ ibyHandle << "-" << langCode->dialectCode;
+ }
+ ibyHandle << ")";
+
+ ++begin;
+ }
+}
+
+/**
+WritePackageHeader: Writes package header section in the IBY file
+
+@internalComponent
+@released
+
+@param aParser - Package file parser object
+*/
+void Sis2Iby::WritePackageHeader(PPKGPARSER aParser)
+{
+ PKG_HEADER pkgHeader;
+ std::list<String> pkgList;
+ std::ostringstream str;
+
+ aParser->GetHeader(pkgHeader);
+
+ ibyHandle << "\n// Header: ";
+
+ pkgList = pkgHeader.pkgNameList;
+ while(pkgList.size())
+ {
+ ibyHandle << "\"" << pkgList.front() << "\" ";
+ pkgList.pop_front();
+ }
+
+ str << "(0x" << std::setbase(16) << pkgHeader.pkgUid << ")";
+
+ ibyHandle << str.str();
+}
+
+/**
+WriteInstallOptions: Writes install option section in the IBY file
+
+@internalComponent
+@released
+
+@param aParser - Package file parser object
+*/
+void Sis2Iby::WriteInstallOptions(PPKGPARSER aParser)
+{
+ std::list<String> optList;
+ String ibyName;
+
+ aParser->GetInstallOptions(optList);
+ SISFILE_LIST::iterator begin = optList.begin();
+ SISFILE_LIST::iterator end = optList.end();
+
+ if(begin != end)
+ {
+ ibyHandle << "\n// Install Options: ";
+ }
+
+ while(begin != end)
+ {
+ ibyHandle << " \"" << (*begin) << "\"";
+ ++begin;
+ }
+}
+
+/**
+InsertTabs: Inserts spaces for indentation in the output IBY file
+
+@internalComponent
+@released
+
+@param num - num of spaces to be inserted
+*/
+void Sis2Iby::InsertTabs(int num)
+{
+ ibyHandle << "\n";
+ while(num--)
+ {
+ ibyHandle << " ";
+ }
+}
+
+/**
+WritePackageBody: Writes package body details in the IBY file
+
+@internalComponent
+@released
+
+@param aParser - Package file parser object
+*/
+void Sis2Iby::WritePackageBody(PPKGPARSER aParser)
+{
+ CMDBLOCK_LIST cmdList;
+ PCMD_BLOCK cmd;
+ int pad = 0;
+
+ ibyHandle << "\n\n";
+ aParser->GetCommandList(cmdList);
+
+ CMDBLOCK_LIST::iterator begin = cmdList.begin();
+ CMDBLOCK_LIST::iterator end = cmdList.end();
+
+ while(begin != end)
+ {
+ cmd = (*begin);
+
+ switch(cmd->cmdType)
+ {
+ case IF:
+ {
+ InsertTabs(pad);
+ ibyHandle << "#if " << cmd->cmdExpression;
+ pad++;
+ }
+ break;
+ case ELSEIF:
+ {
+ InsertTabs(pad-1);
+ ibyHandle << "#elif " << cmd->cmdExpression;
+ }
+ break;
+ case ELSE:
+ {
+ InsertTabs(pad-1);
+ ibyHandle << "#else";
+ }
+ break;
+ case ENDIF:
+ {
+ --pad;
+ InsertTabs(pad);
+ ibyHandle << "#endif";
+ }
+ break;
+ case INSTALLFILE:
+ {
+ WriteInstallFileList(cmd->iInstallFileList, aParser, pad);
+ }
+ break;
+ case PACKAGE:
+ {
+ InsertTabs(pad);
+ ibyHandle << "#include " << "\"" << cmd->cmdExpression << "\"";
+ }
+ break;
+ }
+
+ ++begin;
+ }
+}
+
+/**
+WriteFileInclusion: Writes installable file details in the IBY file
+
+@internalComponent
+@released
+
+@param aSrcFile - Name of the source file
+@param aDestFile - Name of the destination file
+@param aPkgName - Name of the package file
+*/
+void Sis2Iby::WriteFileInclusion(String aSrcFile, String aDestFile, String aPkgName, int pad)
+{
+ NormaliseSourceFile(aSrcFile, aPkgName);
+
+ InsertTabs(pad);
+ if(IsValidE32Image(aSrcFile))
+ {
+ ibyHandle << "file = ";
+ }
+ else
+ {
+ ibyHandle << "data = ";
+ }
+
+ ibyHandle << aSrcFile << " ";
+ NormaliseDestFile(aDestFile);
+ ibyHandle << aDestFile;
+}
+
+/**
+WriteInstallFileList: Writes installable file details in the IBY file
+
+@internalComponent
+@released
+
+@param aFileList - Installable file list structure
+@param aParser - Package file parser object
+@param pad - Number of spaces for indentation purpose
+*/
+void Sis2Iby::WriteInstallFileList(PINSTALLFILE_LIST aFileList, PPKGPARSER aParser, int pad)
+{
+ WriteFileInclusion(aFileList->srcFiles.front(), aFileList->destFile, aParser->GetPkgFileName(), pad);
+}
+
+/**
+AppendFileName: Appends file name to the given path
+
+@internalComponent
+@released
+
+@param aPath - Source path
+@param aFile - File name
+*/
+void Sis2Iby::AppendFileName(String& aPath, String aFile)
+{
+ TUint pos = 0;
+
+ TrimQuotes(aPath);
+ TrimQuotes(aFile);
+
+ pos = aPath.rfind(PATHSEPARATOR);
+ if(pos == String::npos)
+ {
+ aPath.append(PATHSEPARATOR);
+ }
+
+ if(pos < (aPath.length()-1))
+ {
+ aPath.append(PATHSEPARATOR);
+ }
+
+ GetFileName(aFile, aPath);
+ return;
+}
+
+/**
+GetFileName: Returns the base file name
+
+@internalComponent
+@released
+
+@param aName - Input file name
+@param aFile - Output parameter to hold the return value
+*/
+void Sis2Iby::GetFileName(String aName, String& aFile)
+{
+ TUint spos = 0, epos = 0;
+
+ spos = aName.rfind(PATHSEPARATOR);
+ if(spos != String::npos)
+ {
+ spos += 1;
+ }
+ else
+ {
+ spos = 0;
+ }
+
+ epos = aName.rfind(".");
+ if(epos == String::npos)
+ {
+ epos = aName.size();
+ }
+
+ aFile.append(aName.substr(spos, (epos-spos)));
+}
+
+/**
+MakeFullPath: Returns the absolute path of the given file
+
+@internalComponent
+@released
+
+@param aFile - Input file name
+*/
+void Sis2Iby::MakeFullPath(String& aFile)
+{
+#ifdef WIN32
+ char fPath[_MAX_PATH];
+
+ if( _fullpath(fPath, (char*)aFile.data(), _MAX_PATH) != NULL )
+ {
+ aFile.assign(fPath);
+ }
+#else
+ char fPath[FILENAME_MAX];
+ if (realpath(aFile.c_str(),fPath))
+ {
+ aFile.assign(fPath);
+ }
+
+#endif
+ return;
+}
+
+/**
+NormaliseSourceFile: Normalise the source file with its absolute path
+
+@internalComponent
+@released
+
+@param aFile - Input file name
+@param aPkgFile - Package file path
+*/
+void Sis2Iby::NormaliseSourceFile(String& aFile, String aPkgFile)
+{
+ String result;
+ TUint pos = 0;
+
+ pos = aPkgFile.rfind(PATHSEPARATOR);
+ if(pos != String::npos)
+ {
+ result = aPkgFile.substr(0,pos);
+ }
+ else
+ {
+ result = ".";
+ }
+
+ result.append(PATHSEPARATOR);
+ result.append(aFile);
+
+ MakeFullPath(result);
+
+ aFile = "\"" + result + "\"";
+}
+
+/**
+NormaliseDestFile: Normalise the destination file
+
+@internalComponent
+@released
+
+@param aFile - Input file name
+*/
+void Sis2Iby::NormaliseDestFile(String& aFile)
+{
+ TUint pos = 0;
+
+ /** Comment by KunXu to fix DEF122540 on 18 Jun 2008
+ pos = aFile.find("$:");
+ if(pos != String::npos)
+ {
+ aFile.replace(pos, 2, "");
+ }
+
+ pos = aFile.find("!:");
+ if(pos != String::npos)
+ {
+ aFile.replace(pos, 2, "");
+ }
+ **/
+
+ /** Add by KunXu to fix DEF122540 on 18 Jun 2008 **/
+ /** Ignore any drive indication in the filename to generate an iby file **/
+ /** Begin **/
+ pos = aFile.find(":");
+ if (1 == pos)
+ {
+ char chFirst = aFile[0];
+ if ('$' == chFirst || '!' == chFirst || (chFirst >='a' && chFirst <='z') || (chFirst >='A' && chFirst <='Z'))
+ {
+ aFile.replace(0, 2, "");
+ }
+ }
+ /** End **/
+
+ aFile = "\"" + aFile + "\"";
+}
+
+/**
+IsValidE32Image: Checks whether the given file is E32 image
+
+@internalComponent
+@released
+
+@param aFile - Input file name
+*/
+TBool Sis2Iby::IsValidE32Image(String aFile)
+{
+ std::ifstream aIfs;
+ TInt8 aSig[5];
+ TUint32 e32SigOffset = 0x10, fileSize = 0;
+ TBool validE32 = EFalse;
+
+ TrimQuotes(aFile);
+
+ aIfs.open(aFile.c_str(), std::ios::in | std::ios::binary);
+
+ if( !aIfs.is_open() )
+ {
+ throw SisUtilsException(const_cast<char *>(aFile.data()),
+ const_cast<char *>("Cannot open file"));
+ }
+
+ aIfs.seekg(0,std::ios::end);
+ fileSize = aIfs.tellg();
+ if(fileSize > 20)
+ {
+ aIfs.seekg(e32SigOffset,std::ios::beg);
+ aIfs.read((char*)aSig, 4);
+ aSig[4] = '\0';
+
+ if(!strcmp((char*)aSig, "EPOC"))
+ {
+ validE32 = ETrue;
+ }
+ }
+
+ aIfs.close();
+
+ return validE32;
+}