--- a/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpclienthandler.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpclienthandler.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -1004,6 +1004,7 @@
// Transaction is still alive - ask its connection manager to cancel it.
MHttpRequest& request = static_cast<CHttpRequestComposer&>(aTransaction.TxData());
MHttpResponse& response = static_cast<CHttpResponseParser&>(aTransaction.RxData());
+ response.FlushBodyDataIfNotRead();
manager->CancelSubmission(request, response);
// Connection is now cancelled - remove the connection manager from the
--- a/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpresponseparser.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpresponseparser.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -792,4 +792,18 @@
User::Invariant();
}
-
+void CHttpResponseParser::FlushBodyDataIfNotRead()
+{
+ // Message is completed but the client is not yet read the complete body data
+ // and we are cancelling. So we need to clear the parsed body data as another
+ // request would have been sent via the connection. The flushing of the body
+ // data is needed to make the connection manager to read further response from the
+ // socket otherwise it hangs. See the error:
+
+ // Note: This function should be called from CancelTransactionHook and only in the
+ // case of client cancelling the transaction. ie; using RHTTPTransaction::Cancel();
+ if(MessageComplete() && iBodyParts.Count() > 0)
+ {
+ iBodyParts.Reset(); // Reset the body array.
+ }
+}
--- a/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpresponseparser.h Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerpluginsandutils/httpprotocolplugins/httpclient/chttpresponseparser.h Wed Mar 31 22:32:15 2010 +0300
@@ -63,6 +63,7 @@
virtual void OnResponseReceiveTimeOut ();
virtual TInt ReceiveTimeOutValue ();
TBool ResponseInformational ();
+ virtual void FlushBodyDataIfNotRead();
private: // methods from MHttpMessageParserObserver
--- a/applayerpluginsandutils/httpprotocolplugins/httpclient/mhttpresponse.h Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerpluginsandutils/httpprotocolplugins/httpclient/mhttpresponse.h Wed Mar 31 22:32:15 2010 +0300
@@ -42,6 +42,8 @@
virtual void FailTransactionL() = 0;
virtual TBool ResponseInformational () =0;
+
+ virtual void FlushBodyDataIfNotRead() =0;
};
--- a/applayerprotocols/httpservice/EABI/httpserviceu.def Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/EABI/httpserviceu.def Wed Mar 31 22:32:15 2010 +0300
@@ -91,4 +91,10 @@
_ZTV22CHttpClientTransaction @ 90 NONAME
_ZTV26CHttpClientTransactionImpl @ 91 NONAME
_ZN12CHttpService17SetAuthenticationEP26MHTTPServiceAuthentication @ 92 NONAME
+ _ZN12CHttpService21HttpNetworkConnectionEv @ 93 NONAME
+ _ZN22CHttpNetworkConnection4StopEv @ 94 NONAME
+ _ZN22CHttpNetworkConnection5StartE15TCommDbConnPrefi @ 95 NONAME
+ _ZN22CHttpNetworkConnection5StartEv @ 96 NONAME
+ _ZTI22CHttpNetworkConnection @ 97 NONAME
+ _ZTV22CHttpNetworkConnection @ 98 NONAME
--- a/applayerprotocols/httpservice/bwins/httpserviceU.def Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/bwins/httpserviceU.def Wed Mar 31 22:32:15 2010 +0300
@@ -65,4 +65,8 @@
?Parameter@THttpHeaderElementIterator@@QBE?AVTHttpHeaderParamIterator@@XZ @ 64 NONAME ; class THttpHeaderParamIterator THttpHeaderElementIterator::Parameter(void) const
?Notify@THttpContentSourceOp@@QAEXABVTDesC8@@H@Z @ 65 NONAME ; void THttpContentSourceOp::Notify(class TDesC8 const &, int)
?SetAuthentication@CHttpService@@QAEHPAVMHTTPServiceAuthentication@@@Z @ 66 NONAME ; int CHttpService::SetAuthentication(class MHTTPServiceAuthentication *)
+ ?Start@CHttpNetworkConnection@@QAEHVTCommDbConnPref@@H@Z @ 67 NONAME ; int CHttpNetworkConnection::Start(class TCommDbConnPref, int)
+ ?HttpNetworkConnection@CHttpService@@QAEPAVCHttpNetworkConnection@@XZ @ 68 NONAME ; class CHttpNetworkConnection * CHttpService::HttpNetworkConnection(void)
+ ?Stop@CHttpNetworkConnection@@QAEXXZ @ 69 NONAME ; void CHttpNetworkConnection::Stop(void)
+ ?Start@CHttpNetworkConnection@@QAEHXZ @ 70 NONAME ; int CHttpNetworkConnection::Start(void)
--- a/applayerprotocols/httpservice/group/bld.inf Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/group/bld.inf Wed Mar 31 22:32:15 2010 +0300
@@ -36,6 +36,7 @@
../inc/chttpclienttransaction.h SYMBIAN_MW_LAYER_PUBLIC_EXPORT_PATH(chttpclienttransaction.h)
../inc/httpservice.h SYMBIAN_MW_LAYER_PUBLIC_EXPORT_PATH(httpservice.h)
../inc/mhttpserviceauthentication.h SYMBIAN_MW_LAYER_PUBLIC_EXPORT_PATH(mhttpserviceauthentication.h)
+../inc/chttpnetworkconnectioninfo.h SYMBIAN_MW_LAYER_PUBLIC_EXPORT_PATH(chttpnetworkconnectioninfo.h)
// rom definition file
--- a/applayerprotocols/httpservice/group/httpservice.mmp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/group/httpservice.mmp Wed Mar 31 22:32:15 2010 +0300
@@ -44,7 +44,7 @@
SOURCE chttpclienttransaction.cpp
SOURCE httpheaderiter.cpp
SOURCE httpclientutils.cpp chttpclienttransactionimpl.cpp
-SOURCE chttpdatasender.cpp chttpdatareceiver.cpp chttpcontentreader.cpp chttpcontentwriter.cpp chttpclientauthentication.cpp
+SOURCE chttpdatasender.cpp chttpdatareceiver.cpp chttpcontentreader.cpp chttpcontentwriter.cpp chttpclientauthentication.cpp chttpnetworkconnectioninfo.cpp CConnectionMonitor.cpp
LIBRARY euser.lib
LIBRARY http.lib
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/applayerprotocols/httpservice/inc/cconnectionmonitor.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,45 @@
+// Copyright (c) 2003-2010 Nokia Corporation and/or its subsidiary(-ies).
+// All rights reserved.
+// This component and the accompanying materials are made available
+// under the terms of "Eclipse Public License v1.0"
+// which accompanies this distribution, and is available
+// at the URL "http://www.eclipse.org/legal/epl-v10.html".
+//
+// Initial Contributors:
+// Nokia Corporation - initial contribution.
+//
+// Contributors:
+//
+// Description:
+//
+#ifndef CCONNECTIONMONITOR_H_
+#define CCONNECTIONMONITOR_H_
+class CHttpNetworkConnection;
+
+NONSHARABLE_CLASS ( CConnectionMonitor ): public CActive
+ {
+ friend class CHttpNetworkConnection;
+ public:
+ static CConnectionMonitor* NewL( CHttpNetworkConnection* aNetworkConn );
+ static CConnectionMonitor* NewLC(CHttpNetworkConnection* aNetworkConn );
+ ~CConnectionMonitor();
+ void HandleConnectionEvent(TInt aEvent);
+
+
+ protected: // from CActive
+ void DoCancel();
+ void RunL();
+
+ private:
+ CConnectionMonitor( CHttpNetworkConnection* aNetworkConn );
+ void ConstructL();
+ RConnection Connection() ;
+
+ private:
+ TNifProgressBuf iProgress;
+ CHttpNetworkConnection* iNetworkConnInfo;
+
+
+ };
+
+#endif /* CCONNECTIONMONITOR_H_ */
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/applayerprotocols/httpservice/inc/chttpnetworkconnectioninfo.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,71 @@
+// Copyright (c) 2003-2010 Nokia Corporation and/or its subsidiary(-ies).
+// All rights reserved.
+// This component and the accompanying materials are made available
+// under the terms of "Eclipse Public License v1.0"
+// which accompanies this distribution, and is available
+// at the URL "http://www.eclipse.org/legal/epl-v10.html".
+//
+// Initial Contributors:
+// Nokia Corporation - initial contribution.
+//
+// Contributors:
+//
+// Description:
+//
+
+#ifndef CHTTPNETWORKCONNECTIONINFO_H_
+#define CHTTPNETWORKCONNECTIONINFO_H_
+
+#include <commdbconnpref.h>
+#include <es_sock.h>
+#include "chttpservice.h"
+
+
+class CConnectionMonitor;
+
+class CHttpNetworkConnection: public CBase
+ {
+ friend class CHttpClientTransactionImpl;
+ friend class CConnectionMonitor;
+ friend class CHttpService;
+
+ public:
+ static CHttpNetworkConnection* New();
+ IMPORT_C TInt Start();//start on default connection
+ IMPORT_C TInt Start(TCommDbConnPref aConnPref, TBool aAttachType=EFalse);
+
+ IMPORT_C void Stop();
+
+
+
+ private:
+ TInt SetupConnection();
+ void AssociateConnectionWithHttpSession();
+ void HandleConnectionEvent(TInt aEvent); //Called whenever there is a connection event
+ void SetHttpService(CHttpService* aService);
+ RConnection Connection()
+ {
+ return iConnInfo->iConnection;
+ }
+ CHttpNetworkConnection();
+ void ConstructL();
+
+ ~CHttpNetworkConnection();
+
+
+ private:
+ class CConnectionInfo: public CBase
+ {
+ public:
+ TBool iConnectionStatus;
+ TBool iAttach;
+ TCommDbConnPref iConnPref;
+ RConnection iConnection;
+ RSocketServ iSocketServ;
+ };
+ CConnectionMonitor* iConnectionMonitor;
+ CConnectionInfo* iConnInfo;
+ CHttpService* iHttpService;
+ };
+
+#endif /* CHTTPNETWORKCONNECTIONINFO_H_ */
--- a/applayerprotocols/httpservice/inc/chttpservice.h Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/inc/chttpservice.h Wed Mar 31 22:32:15 2010 +0300
@@ -20,7 +20,7 @@
#include <http.h>
#include <in_sock.h>
#include "httpheaderiter.h"
-
+class CHttpNetworkConnection;
/**
* CHttpService represent a handle to the HTTP service instance for a set of client
* HTTP transactions[a request and its equivalent response]. The application can
@@ -36,6 +36,7 @@
class CHttpService : public CBase
{
friend class CHttpClientTransactionImpl;
+ friend class CHttpNetworkConnection;
public:
IMPORT_C static CHttpService* NewL();
@@ -57,6 +58,8 @@
IMPORT_C TInt SetAuthentication(MHTTPServiceAuthentication* aCallback);
+ IMPORT_C CHttpNetworkConnection* HttpNetworkConnection();
+
private:
CHttpService();
void ConstructL();
--- a/applayerprotocols/httpservice/inc/httpservice.h Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/inc/httpservice.h Wed Mar 31 22:32:15 2010 +0300
@@ -24,5 +24,6 @@
#include <thttpheadervaluevariant.h>
#include <chttpclienttransaction.h>
#include <mhttpserviceauthentication.h>
+#include <chttpnetworkconnectioninfo.h>
#endif // __MHTTPDATARECIVER_H__
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/applayerprotocols/httpservice/src/cconnectionmonitor.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,141 @@
+// Copyright (c) 2003-2010 Nokia Corporation and/or its subsidiary(-ies).
+// All rights reserved.
+// This component and the accompanying materials are made available
+// under the terms of "Eclipse Public License v1.0"
+// which accompanies this distribution, and is available
+// at the URL "http://www.eclipse.org/legal/epl-v10.html".
+//
+// Initial Contributors:
+// Nokia Corporation - initial contribution.
+//
+// Contributors:
+//
+// Description:
+//
+#include <commdbconnpref.h>
+#include <es_sock.h>
+#include "CConnectionMonitor.h"
+#include "chttpnetworkconnectioninfo.h"
+
+CConnectionMonitor* CConnectionMonitor::NewL(CHttpNetworkConnection* aNetworkConn )
+ {
+ CConnectionMonitor* self = NewLC( aNetworkConn );
+ CleanupStack::Pop( self );
+ return self;
+ }
+
+CConnectionMonitor* CConnectionMonitor::NewLC( CHttpNetworkConnection* aNetworkConn )
+ {
+ CConnectionMonitor* self = new (ELeave) CConnectionMonitor( aNetworkConn );
+ CleanupStack::PushL( self );
+ self->ConstructL();
+ return self;
+ }
+
+CConnectionMonitor::CConnectionMonitor( CHttpNetworkConnection* aNetworkConnInfo )
+: CActive(CActive::EPriorityStandard)
+ {
+ iNetworkConnInfo = aNetworkConnInfo;
+ CActiveScheduler::Add(this);
+ }
+
+CConnectionMonitor::~CConnectionMonitor()
+ {
+ Cancel();
+ }
+
+RConnection CConnectionMonitor::Connection()
+ {
+ return iNetworkConnInfo->Connection();
+ }
+
+void CConnectionMonitor::ConstructL()
+ {
+ iNetworkConnInfo->Connection().ProgressNotification(iProgress, iStatus);
+ SetActive();
+ }
+
+void CConnectionMonitor::DoCancel()
+ {
+ iNetworkConnInfo->Connection().CancelProgressNotification();
+ }
+
+void CConnectionMonitor::RunL()
+ {
+
+
+ switch ( iProgress().iStage )
+ {
+
+ // Connection closed
+ case KConnectionClosed:
+ case KLinkLayerClosed:
+ if (iNetworkConnInfo)
+ {
+ iNetworkConnInfo->HandleConnectionEvent( iProgress().iStage );
+ }
+ break;
+
+ case KConnectionUninitialised:
+ break;
+
+ case KStartingSelection:
+ break;
+
+ case KFinishedSelection:
+ if (iProgress().iError == KErrNone)
+ {
+ // The user successfully selected an IAP to be used
+ }
+ else
+ {
+ // The user pressed e.g. "Cancel" and did not select an IAP
+ }
+ break;
+
+ case KConnectionFailure:
+ break;
+
+ // Prepearing connection (e.g. dialing)
+ case KPsdStartingConfiguration:
+ case KPsdFinishedConfiguration:
+ case KCsdFinishedDialling:
+ case KCsdScanningScript:
+ case KCsdGettingLoginInfo:
+ case KCsdGotLoginInfo:
+ break;
+
+ // Creating connection (e.g. GPRS activation)
+ case KCsdStartingConnect:
+ case KCsdFinishedConnect:
+ break;
+
+ // Starting log in
+ case KCsdStartingLogIn:
+ break;
+
+ // Finished login
+ case KCsdFinishedLogIn:
+ break;
+
+ // Connection open
+ case KConnectionOpen:
+ case KLinkLayerOpen:
+ break;
+
+ // Connection blocked or suspended
+ case KDataTransferTemporarilyBlocked:
+ break;
+
+ // Hangup or GRPS deactivation
+ case KConnectionStartingClose:
+ break;
+
+ // Unhandled state
+ default:
+ break;
+ }
+
+ Connection().ProgressNotification(iProgress, iStatus);
+ SetActive();
+ }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/applayerprotocols/httpservice/src/chttpnetworkconnectioninfo.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,204 @@
+// Copyright (c) 2003-2010 Nokia Corporation and/or its subsidiary(-ies).
+// All rights reserved.
+// This component and the accompanying materials are made available
+// under the terms of "Eclipse Public License v1.0"
+// which accompanies this distribution, and is available
+// at the URL "http://www.eclipse.org/legal/epl-v10.html".
+//
+// Initial Contributors:
+// Nokia Corporation - initial contribution.
+//
+// Contributors:
+//
+// Description:
+//
+#include <httpservice.h>
+#include <es_enum.h>
+#include "CConnectionMonitor.h"
+
+
+CHttpNetworkConnection::CHttpNetworkConnection()
+ {
+ }
+
+CHttpNetworkConnection::~CHttpNetworkConnection()
+ {
+ if (iConnInfo)
+ {
+ iConnInfo->iConnection.Close();
+ iConnInfo->iSocketServ.Close();
+ delete iConnInfo;
+ }
+ if (iConnectionMonitor)
+ {
+ delete iConnectionMonitor;
+ }
+ }
+CHttpNetworkConnection* CHttpNetworkConnection::New( )
+ {
+ CHttpNetworkConnection* self = new (ELeave) CHttpNetworkConnection() ;
+ self->ConstructL();
+ return self;
+ }
+
+void CHttpNetworkConnection::ConstructL()
+ {
+ iConnInfo = new (ELeave) CConnectionInfo();
+ }
+
+void CHttpNetworkConnection::SetHttpService(CHttpService *aService)
+ {
+ iHttpService = aService;
+ }
+
+/**
+ * Start the network connection for HTTP transactions.
+ * Default connection prefernces will be used.
+ *
+ * @return KErrNone if connection opening is successful, otherwise relevant errors.
+ */
+EXPORT_C TInt CHttpNetworkConnection::Start()
+ {
+ TRequestStatus requestStatus;
+ TInt status;
+ if (! iConnInfo->iConnectionStatus)
+ {
+ status = SetupConnection();
+ if (status == KErrNone)
+ {
+ iConnInfo->iConnection.Start( requestStatus);
+ User::WaitForRequest(requestStatus);
+ status = requestStatus.Int();
+ }
+ }
+ else
+ {
+ status = KErrAlreadyExists;
+ }
+ if (status == KErrNone)
+ {
+ AssociateConnectionWithHttpSession();
+ }
+ return status;
+ }
+
+/**
+ * Start the network connection for HTTP transactions.
+ *
+ * @param aConnPref - connection prefernces can be specified.
+ * @param aAttachType - EFalse
+ *
+ * @return KErrNoMemory incase of failure otherwise KErrNone for success
+ *
+ */
+EXPORT_C TInt CHttpNetworkConnection::Start(TCommDbConnPref aConnPref, TBool aAttachType)
+ {
+ TInt status;
+ iConnInfo->iConnPref = aConnPref;
+
+ if (aAttachType && !iConnInfo->iConnectionStatus )
+ {
+ TUint count;
+ TConnectionInfoBuf connInfoPckg;
+
+ status = SetupConnection();
+
+ if ( status == KErrNone && iConnInfo->iConnection.EnumerateConnections(count) == KErrNone )
+ {
+ for (TUint i=1; i<=count; i++)
+ {
+ // Note GetConnectionInfo expects 1-based index
+ if ( iConnInfo->iConnection.GetConnectionInfo( i, connInfoPckg ) == KErrNone )
+ {
+ if ( connInfoPckg().iIapId == iConnInfo->iConnPref.IapId() )
+ {
+ status= iConnInfo->iConnection.Attach(iConnInfo->iConnPref, RConnection::EAttachTypeNormal);
+ return status;
+ }
+ }
+ }
+ }
+ return KErrNotFound;
+ }
+ else
+ {
+ if (!iConnInfo->iConnectionStatus)
+ {
+ status = SetupConnection();
+ if (status == KErrNone)
+ {
+ TRequestStatus requestStatus;
+ iConnInfo->iConnection.Start(iConnInfo->iConnPref,requestStatus);
+ User::WaitForRequest(requestStatus);
+ status = requestStatus.Int();
+ }
+
+ }
+ else
+ {
+ status = KErrAlreadyExists;
+ }
+ if (status == KErrNone)
+ {
+ AssociateConnectionWithHttpSession();
+ }
+
+ return status;
+ }
+ }
+
+
+/**
+ * To Stop the network connection
+ *
+ */
+EXPORT_C void CHttpNetworkConnection::Stop()
+ {
+ if (iConnInfo->iConnectionStatus)
+ {
+ iConnInfo->iConnectionStatus = EFalse;
+ iConnInfo->iConnection.Close();
+ iConnInfo->iSocketServ.Close();
+ }
+ }
+
+void CHttpNetworkConnection::AssociateConnectionWithHttpSession()
+ {
+ RStringPool strP = iHttpService->Session().StringPool();
+ RHTTPConnectionInfo connInfo = iHttpService->Session().ConnectionInfo();
+ connInfo.SetProperty(strP.StringF(HTTP::EHttpSocketServ,RHTTPSession::GetTable()), THTTPHdrVal(iConnInfo->iSocketServ.Handle()));
+ TInt connPtr = reinterpret_cast<TInt>(&(iConnInfo->iConnection));
+ connInfo.SetProperty(strP.StringF(HTTP::EHttpSocketConnection,RHTTPSession::GetTable()), THTTPHdrVal(connPtr));
+ }
+
+TInt CHttpNetworkConnection::SetupConnection()
+ {
+ TInt status = KErrAlreadyExists;
+ if (!iConnInfo->iConnectionStatus )
+ {
+ status = iConnInfo->iSocketServ.Connect() ;
+ if (status == KErrNone)
+ {
+ status = iConnInfo->iConnection.Open ( iConnInfo->iSocketServ ) ;
+ if (status != KErrNone)
+ {
+ iConnInfo->iSocketServ.Close();
+ }
+ else
+ {
+ iConnectionMonitor = CConnectionMonitor::NewL(this);
+ iConnInfo->iConnectionStatus = ETrue;
+ }
+ }
+ }
+ return status;
+ }
+
+void CHttpNetworkConnection::HandleConnectionEvent(TInt aError)
+ {
+ if (aError == KLinkLayerClosed || aError == KLinkLayerClosed)
+ {
+ iConnInfo->iConnectionStatus = EFalse;
+ }
+ }
+
--- a/applayerprotocols/httpservice/src/chttpservice.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/src/chttpservice.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -17,6 +17,7 @@
#include "httpclientutils.h"
#include "chttpclientauthentication.h"
#include "mhttpserviceauthentication.h"
+#include "chttpnetworkconnectioninfo.h"
const TInt KMaxNoOfConnections = 6;
const TInt KMaxTransToPipeline = 5;
@@ -247,3 +248,9 @@
SetMaxTransactionsToPipeline(KMaxTransToPipeline);
}
+EXPORT_C CHttpNetworkConnection* CHttpService::HttpNetworkConnection()
+ {
+ CHttpNetworkConnection *httpNetworkConn = CHttpNetworkConnection::New();
+ httpNetworkConn->SetHttpService(this);
+ return httpNetworkConn;
+ }
--- a/applayerprotocols/httpservice/test/group/httpservicetest.mmp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/test/group/httpservicetest.mmp Wed Mar 31 22:32:15 2010 +0300
@@ -59,5 +59,5 @@
LIBRARY efsrv.lib
LIBRARY httptestutils.lib
LIBRARY esock.lib insock.lib
-
+LIBRARY commdb.lib
SMPSAFE
--- a/applayerprotocols/httpservice/test/httpservicetest/ctesthttpclientstep.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/test/httpservicetest/ctesthttpclientstep.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -1,4 +1,4 @@
-// Copyright (c) 2003-2009 Nokia Corporation and/or its subsidiary(-ies).
+// Copyright (c) 2003-2010 Nokia Corporation and/or its subsidiary(-ies).
// All rights reserved.
// This component and the accompanying materials are made available
// under the terms of "Eclipse Public License v1.0"
@@ -19,10 +19,12 @@
#include "ctestclienthttppost.h"
#include <escapeutils.h>
#include <thttphdrval.h>
+#include <commdbconnpref.h>
#include "httptestutils.h"
#include "clocaltestserver.h"
#include "chttpclienttestparams.h"
#include "ctesthttpserviceauthentication.h"
+#include "chttpnetworkconnectioninfo.h"
_LIT(KTestCaseName, "TestCaseName");
_LIT8(KUserAgent, "HTTP Client API Test");
@@ -50,14 +52,21 @@
// TEF virtuals
TVerdict CTestHttpClientStep::doTestStepPreambleL()
{
+ TInt status;
iActiveScheduler = new (ELeave) CActiveScheduler();
CActiveScheduler::Install(iActiveScheduler);
iTestParamArray = new(ELeave) CHttpClientTestParamArray;
iTestUtils = CHTTPTestUtils::NewL(KTestHttpClientAPITestTitle());
- iTestUtils->InitCommsL();
+
iTestServer = CLocalTestServer::NewL(*iTestUtils, *this, *iTestParamArray);
iHttpClient = CHttpService::NewL();
+ TCommDbConnPref connPref;
+ connPref.SetDialogPreference(ECommDbDialogPrefDoNotPrompt);
+ connPref.SetIapId(1);
+ connPref.SetNetId(0);
+ iHttpConnInfo = iHttpClient->HttpNetworkConnection();
+ status = iHttpConnInfo->Start();
THttpHeaderValueVariant variant(KUserAgent());
if(iHttpClient->AddRequestHeader(HTTP::EUserAgent, variant))
{
@@ -134,12 +143,10 @@
{
iHttpTrans->SetNoRetry();
}
-
if(param->ResponseTimeoutEnable())
{
iHttpTrans->SetResponseTimeout(10);
}
-
const RPointerArray<CHeaderInfo>& info = param->RequestHeaderInfos();
for(TInt i = 0; i < info.Count(); ++i)
{
@@ -169,7 +176,7 @@
THTTPHdrVal::TQConv q(value);
TInt val2 = q;
THttpHeaderValueVariant variant2(val2);
- // Set the header with the param
+ /// Set the header with the param
iHttpTrans->AddRequestHeader(headerName, variant, paramName, variant2);
}
}
--- a/applayerprotocols/httpservice/test/httpservicetest/ctesthttpclientstep.h Mon Mar 15 12:42:40 2010 +0200
+++ b/applayerprotocols/httpservice/test/httpservicetest/ctesthttpclientstep.h Wed Mar 31 22:32:15 2010 +0300
@@ -26,6 +26,7 @@
class CLocalTestServer;
class CHTTPTestUtils;
class CHttpClientTestParamArray;
+class CHttpNetworkConnection;
class CTestHttpServiceAuthentication;
class CTestHttpClientStep : public CTestStep, public MLocalTestServerObserver
@@ -50,6 +51,7 @@
CLocalTestServer* iTestServer;
CHttpClientTestParamArray* iTestParamArray;
CTestHttpServiceAuthentication* iTestHttpServiceAuthentication;
+ CHttpNetworkConnection* iHttpConnInfo;
};
#endif // __CTESTHTTPCLIENTSTEP_H__
--- a/brdo.layers.sysdef.xml Mon Mar 15 12:42:40 2010 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,26 +0,0 @@
-<?xml version="1.0"?>
-<!DOCTYPE SystemDefinition SYSTEM "sysdef_1_4_0.dtd"
- [ <!ENTITY layer_real_source_path "sf/mw/netprotocols" > ]>
-
-<SystemDefinition name="netprotocols" schema="1.4.0">
- <systemModel>
- <layer name="mw_layer">
- <module name="netprotocols_plat">
- <unit unitID="cookie_manager_api" name="cookie_manager_api" bldFile="&layer_real_source_path;/netprotocols_plat/cookie_manager_api/group" mrp=""/>
- <unit unitID="http_cache_mgr_api" name="http_cache_mgr_api" bldFile="&layer_real_source_path;/netprotocols_plat/http_cache_mgr_api/group" mrp=""/>
- <unit unitID="http_filters_api" name="http_filters_api" bldFile="&layer_real_source_path;/netprotocols_plat/http_filters_api/group" mrp=""/>
- </module>
- <module name="httpfilters">
- <unit unitID="cookie" name="cookie" bldFile="&layer_real_source_path;/httpfilters/cookie/group" mrp=""/>
- <unit unitID="deflatefilter" name="deflatefilter" bldFile="&layer_real_source_path;/httpfilters/deflatefilter/group" mrp=""/>
- <unit unitID="httpfilteracceptheader" name="httpfilteracceptheader" bldFile="&layer_real_source_path;/httpfilters/httpfilteracceptheader/group" mrp=""/>
- <unit unitID="httpfilterauthentication" name="httpfilterauthentication" bldFile="&layer_real_source_path;/httpfilters/httpfilterauthentication/group" mrp=""/>
- <unit unitID="httpfiltercommon" name="httpfiltercommon" bldFile="&layer_real_source_path;/httpfilters/httpfiltercommon/group" mrp=""/>
- <unit unitID="httpfilterconnhandler" name="httpfilterconnhandler" bldFile="&layer_real_source_path;/httpfilters/httpfilterconnhandler/group" mrp=""/>
- <unit unitID="httpfilteriop" name="httpfilteriop" bldFile="&layer_real_source_path;/httpfilters/httpfilteriop/group" mrp=""/>
- <unit unitID="httpfilterproxy" name="httpfilterproxy" bldFile="&layer_real_source_path;/httpfilters/httpfilterproxy/group" mrp=""/>
- <unit unitID="uaproffilter" name="uaproffilter" bldFile="&layer_real_source_path;/httpfilters/uaproffilter/group" mrp=""/>
- </module>
- </layer>
- </systemModel>
-</SystemDefinition>
--- a/httpfilters/cookie/BWinsCw/COOKIEMANAGERU_EKA2U.def Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/BWinsCw/COOKIEMANAGERU_EKA2U.def Wed Mar 31 22:32:15 2010 +0300
@@ -11,4 +11,9 @@
?SetAttribute@CCookie@@QAEHW4TCookieAttributeName@1@ABVTHTTPHdrVal@@@Z @ 10 NONAME ; int CCookie::SetAttribute(enum CCookie::TCookieAttributeName, class THTTPHdrVal const &)
?StartCookieServer@@YAHPAX@Z @ 11 NONAME ; int StartCookieServer(void *)
?StoreCookie@RCookieManager@@QAEHABVCCookie@@ABVTUriC8@@@Z @ 12 NONAME ; int RCookieManager::StoreCookie(class CCookie const &, class TUriC8 const &)
- ?SetAppUidL@RCookieManager@@QAEHABK@Z @ 13 NONAME ; int RCookieManager::SetAppUidL(unsigned long const &)
\ No newline at end of file
+ ?SetAppUidL@RCookieManager@@QAEHABK@Z @ 13 NONAME ; int RCookieManager::SetAppUidL(unsigned long const &)
+ ?ClearAllAppUidCookies@RCookieManager@@QAEHABK@Z @ 14 NONAME ; int RCookieManager::ClearAllAppUidCookies(unsigned long const &)
+ ?Close@RCookieManager@@QAEXXZ @ 15 NONAME ; void RCookieManager::Close(void)
+ ?GetCookiesL@RCookieManager@@QAEXABVTDesC8@@AAV?$RPointerArray@VCCookie@@@@AAHAAK@Z @ 16 NONAME ; void RCookieManager::GetCookiesL(class TDesC8 const &, class RPointerArray<class CCookie> &, int &, unsigned long &)
+ ?StoreCookie@RCookieManager@@QAEHABVCCookie@@ABVTUriC8@@AAK@Z @ 17 NONAME ; int RCookieManager::StoreCookie(class CCookie const &, class TUriC8 const &, unsigned long &)
+
--- a/httpfilters/cookie/EABI/COOKIEMANAGERU_EKA2U.def Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/EABI/COOKIEMANAGERU_EKA2U.def Wed Mar 31 22:32:15 2010 +0300
@@ -16,4 +16,9 @@
_ZNK7CCookie9AttributeENS_20TCookieAttributeNameER11THTTPHdrVal @ 15 NONAME
_ZTI7CCookie @ 16 NONAME ; #<TI>#
_ZTV7CCookie @ 17 NONAME ; #<VT>#
- _ZN14RCookieManager10SetAppUidLERKm @ 18 NONAME
\ No newline at end of file
+ _ZN14RCookieManager10SetAppUidLERKm @ 18 NONAME
+ _ZN14RCookieManager11GetCookiesLERK6TDesC8R13RPointerArrayI7CCookieERiRm @ 19 NONAME
+ _ZN14RCookieManager11StoreCookieERK7CCookieRK6TUriC8Rm @ 20 NONAME
+ _ZN14RCookieManager21ClearAllAppUidCookiesERKm @ 21 NONAME
+ _ZN14RCookieManager5CloseEv @ 22 NONAME
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/EABI/cookiemanageru.def Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,24 @@
+EXPORTS
+ _Z17StartCookieServerPv @ 1 NONAME
+ _ZN14RCookieManager10SetAppUidLERKm @ 2 NONAME
+ _ZN14RCookieManager11GetCookiesLERK6TDesC8R13RPointerArrayI7CCookieERi @ 3 NONAME
+ _ZN14RCookieManager11GetCookiesLERK6TDesC8R13RPointerArrayI7CCookieERiRm @ 4 NONAME
+ _ZN14RCookieManager11StoreCookieERK7CCookieRK6TUriC8 @ 5 NONAME
+ _ZN14RCookieManager11StoreCookieERK7CCookieRK6TUriC8Rm @ 6 NONAME
+ _ZN14RCookieManager12ClearCookiesERi @ 7 NONAME
+ _ZN14RCookieManager21ClearAllAppUidCookiesERKm @ 8 NONAME
+ _ZN14RCookieManager5CloseEv @ 9 NONAME
+ _ZN14RCookieManager7ConnectEv @ 10 NONAME
+ _ZN14RCookieManagerC1E11RStringPool @ 11 NONAME
+ _ZN14RCookieManagerC2E11RStringPool @ 12 NONAME
+ _ZN7CCookie12SetAttributeENS_20TCookieAttributeNameERK11THTTPHdrVal @ 13 NONAME
+ _ZN7CCookie4NewLE11RStringPool @ 14 NONAME
+ _ZN7CCookie4NewLE12RHTTPHeadersi8RStringF11RStringPoolRK6TUriC8 @ 15 NONAME
+ _ZN7CCookieD0Ev @ 16 NONAME
+ _ZN7CCookieD1Ev @ 17 NONAME
+ _ZN7CCookieD2Ev @ 18 NONAME
+ _ZNK7CCookie13AddToRequestLE12RHTTPHeadersi @ 19 NONAME
+ _ZNK7CCookie9AttributeENS_20TCookieAttributeNameER11THTTPHdrVal @ 20 NONAME
+ _ZTI7CCookie @ 21 NONAME ; #<TI>#
+ _ZTV7CCookie @ 22 NONAME ; #<VT>#
+
--- a/httpfilters/cookie/FilterSrc/CookieFilter.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/FilterSrc/CookieFilter.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -34,6 +34,9 @@
_LIT8(KEmpty, "");
_LIT8( KCookieUsage, "CookiesEnabled" );
_LIT8( KAppUid, "Appuid" );
+_LIT8( KHttpConnectMethod, "CONNECT");
+_LIT8( KSecureHttpScheme, "https://");
+const TInt KSecureHttpSchemeLength = 8;
// ---------------------------------------------------------
// CCookieFilter::InstallFilterL
@@ -248,8 +251,21 @@
TBool cookie2Reqd = EFalse;
RPointerArray<CCookie> cookies(20);
+ HBufC8* requestUriBuf( NULL );
TPtrC8 requestUri( aTransaction.Request().URI().UriDes() );
-
+ TPtrC8 requestMethod( aTransaction.Request().Method().DesC() );
+ if( (requestMethod.CompareF(KHttpConnectMethod) == 0) && (requestUri.Left(KSecureHttpSchemeLength).CompareF(KSecureHttpScheme) == 0))
+ {
+ // if we are performing an HTTP CONNECT to create tunnel for original https:// request, we
+ // should not include secure cookies in this HTTP request since they will be in clear text.
+ // to ensure that Cookie manager does not add these into cookie array, change scheme so
+ // it appears as non-secure transaction
+ requestUriBuf = requestUri.Alloc();
+ CleanupStack::PushL(requestUriBuf);
+ TPtr8 requestUriPtr = requestUriBuf->Des();
+ requestUriPtr.Delete(4, 1); // remove char in pos 4 to change https:// to http://
+ requestUri.Set(requestUriPtr);
+ }
TBool ret;
RStringF appuid = iStringPool.OpenFStringL( KAppUid );
THTTPHdrVal hdrVal;
@@ -260,10 +276,14 @@
{
appuidValue = hdrVal.Int();
}
- iCookieManager.SetAppUidL(appuidValue);
+ //iCookieManager.SetAppUidL(appuidValue);
appuid.Close();
- iCookieManager.GetCookiesL( requestUri, cookies, cookie2Reqd );
+ iCookieManager.GetCookiesL( requestUri, cookies, cookie2Reqd,appuidValue );
+ if( requestUriBuf )
+ {
+ CleanupStack::PopAndDestroy( requestUriBuf );
+ }
TInt numCookies = cookies.Count();
for ( TInt ii = 0; ii < numCookies; ++ii )
@@ -343,11 +363,11 @@
{
appuidValue = hdrVal.Int();
}
- iCookieManager.SetAppUidL(appuidValue);
+ //iCookieManager.SetAppUidL(appuidValue);
appuid.Close();
User::LeaveIfError( iCookieManager.StoreCookie( *cookie,
- requestUri ) );
+ requestUri,appuidValue ) );
CleanupStack::PopAndDestroy(); // cookie
}
--- a/httpfilters/cookie/Group/CookieManager.mmp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/Group/CookieManager.mmp Wed Mar 31 22:32:15 2010 +0300
@@ -21,10 +21,11 @@
TARGET cookiemanager.dll
TARGETTYPE DLL
+UID 0x1000008D 0x101F852F
+
CAPABILITY CAP_GENERAL_DLL
-UID 0x1000008D 0x101F852F
MW_LAYER_SYSTEMINCLUDE
@@ -42,7 +43,9 @@
SOURCE CookieManagerSession.cpp
SOURCE CookieManagerClient.cpp
SOURCE CookieManagerStart.cpp
-SOURCE CookieServerPanic.cpp
+SOURCE CookieServerPanic.cpp
+SOURCE CookieGroupData.cpp CookieGroupDataArray.cpp GroupIdInfoArray.cpp
+SOURCE CookieClientDataArray.cpp CookieClientData.cpp
// IMPORTED LIBRARIES
@@ -50,6 +53,7 @@
LIBRARY EUSER.LIB HTTP.LIB BAFL.LIB
LIBRARY INETPROTUTIL.LIB efsrv.lib
LIBRARY SysUtil.lib
+LIBRARY XmlEngineDOM.lib
#if defined(ARMCC)
DEFFILE ../EABI/COOKIEMANAGERU_EKA2.def
--- a/httpfilters/cookie/Group/bld.inf Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/Group/bld.inf Wed Mar 31 22:32:15 2010 +0300
@@ -25,6 +25,10 @@
PRJ_EXPORTS
+../data/CookieGroup.xml /epoc32/data/z/private/101F8530/CookieGroup.xml
+
+
+
// iby
../Rom/CookieFilter.iby CORE_MW_LAYER_IBY_EXPORT_PATH(CookieFilter.iby)
../Rom/CookieManager.iby CORE_MW_LAYER_IBY_EXPORT_PATH(CookieManager.iby)
--- a/httpfilters/cookie/ManagerInc/CookieArray.h Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerInc/CookieArray.h Wed Mar 31 22:32:15 2010 +0300
@@ -87,6 +87,8 @@
*/
TInt GetCookies( const TDesC8& aRequestUri,
RPointerArray<CCookie>& aCookies );
+ TInt GetCookies( const TDesC8& aRequestUri,
+ RPointerArray<CCookie>& aCookies, TBool& iFound );
/**
*
@@ -123,6 +125,7 @@
RPointerArray<CCookie>& CookieArray();
+ void ReserveL( TInt aNumberOfCookies );
private : // internal method for cookie comparison
/**
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerInc/CookieClientData.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,135 @@
+/*
+ * CookieClientData.h
+ *
+ * Created on: Dec 28, 2009
+ * Author: mohanti
+ */
+
+#ifndef COOKIECLIENTDATA_H_
+#define COOKIECLIENTDATA_H_
+
+//System Includes
+#include <e32base.h>
+
+//Forward Declaration
+class CCookieArray;
+class CCookie;
+
+//THis class holds the client side cookies of a specific Client
+NONSHARABLE_CLASS( CCookieClientData ):public CBase
+ {
+public:
+ /**Constructor
+ */
+ static CCookieClientData* NewL(TUint32 aGroupId);
+
+ /**Constructor
+ */
+ static CCookieClientData* NewLC(TUint32 aGroupId);
+
+ static CCookieClientData* NewL(TUint32 aGroupId, TUint32 aWidgetUid, TBool aCookieSharableFlag = EFalse, TBool aInitFlag = EFalse);
+
+ static CCookieClientData* NewLC(TUint32 aGroupId, TUint32 aWidgetUid, TBool aCookieSharableFlag, TBool aInitFlag);
+ /**Standard Constructor
+ */
+ void ConstructL();
+
+ /**Standard Destructor
+ */
+ ~CCookieClientData();
+
+ /** Cookie Array Handle
+ * @return returns the pointer of CookieArray object.
+ */
+ CCookieArray* CookieArray();
+
+ /** Stores the CCookie objects for a specific Uri .
+ @param aCookie Indicates the Cookie Objects to be Stored
+ @param aRequestUri Indicates the Uri for which cookie Objects needs to be Stored
+ @param aIndex
+ @return void
+1 */
+ void StorePersistentCookieL( const CCookie* aCookie, const TDesC8& aRequestUri, const TInt aIndex = -1 );
+
+ /** Stores the CCookie objects for a specific Uri in Client Address Space.
+ @param aCookie Indicates the Cookie object to be stored.
+ @param aUri Indicates the Uri for which the Cookie Information need to be stored.
+ @return void .
+
+ */
+ void StoreCookieAtClientSideL( const CCookie* aCookie,const TDesC8& aUri );
+
+ /** Finds the CCookie objects for a specific Uri in Client Address Space
+ @param aRequestUri Indicates the Uri for which Cookie info is required
+ @param aCookies Reference to an array of Cookie objects for a uri after completion of the method.
+ @param aFound Indiacates whether cookie info for a requested Uri is present or not in the Client address space or not.
+ @return .
+ */
+ TInt GetClientSideCookies( const TDesC8& aRequestUri,RPointerArray<CCookie>& aCookies,TBool& aCookieFound ) const;
+ /*Setting the AppUid
+ * @param aAppUid Appuid to be set in case of Widgets running in the same process
+ */
+ void SetAppUid(TUint32 aAppUid );
+
+ /** Number of CCookie objects present in Array.
+ * @return Number of Cookie objects present in the array
+ */
+ TInt Count()const;
+
+ /* Sets appuid
+ * @param aWidgetUid indicates appuid of the widget
+ */
+ inline void SetWidgetUid(TUint32 aWidgetUid ){iWidgetUid = aWidgetUid;}
+ /*Sets Cookie Sharable flag
+ * @param aCookieSharableFlag indicates whether cookie sharing is allowed or not
+ */
+ inline void SetCookieCookieSharableFlag(TBool aCookieSharableFlag){iCookieSharableFlag = aCookieSharableFlag;}
+
+ /*Sets the initailization flag once the initialization of CCookieClientData object has been completed
+ * @param aInitFlag indicates initialization flag
+ */
+ inline void SetInitFlag(TBool aInitFlag){iInitFlag = aInitFlag;}
+
+ /*Gets Cookie Sharable flag
+ * @return iCookieSharableFlag indicates Cookie Sharable flag
+ */
+ inline const TBool& GetCookieSharableFlag(){return iCookieSharableFlag;}
+
+ /*Gets Initialization flag
+ * @return iInitFlag indicates initialization flag for CCookieClientData object
+ */
+ inline const TBool& GetInitFlag(){return iInitFlag;}
+
+ /*Gets Groupid of the CCookieClientData object
+ * @return iGroupId indicates group id of CCookieClientData object
+ */
+ inline const TUint32& GetGroupId(){return iGroupId;}
+
+ /*Gets AppUid in case of WRT Widget
+ * @return iWidgetUid indicates appuid of the WRT Widget
+ */
+ inline const TUint32& GetWidgetUid(){return iWidgetUid;}
+protected:
+private:
+ /*Constructor
+ *
+ */
+ CCookieClientData(TUint32 aGroupId);
+ /*Constructor
+ *
+ */
+ CCookieClientData(TUint32 aGroupId, TUint32 aWidgetUid, TBool aCookieSharableFlag, TBool aInitFlag);
+public:
+protected:
+
+private:
+ TBool iInitFlag;
+ TBool iCookieSharableFlag;
+ TUint32 iGroupId;
+ //Appuid of client in case of secure WRT Widget
+ TUint32 iWidgetUid;
+ CCookieArray* iCookieArray;
+ };
+
+
+#endif /* COOKIECLIENTDATA_H_ */
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerInc/CookieClientDataArray.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,126 @@
+/*
+ * CookieClientDataArray.h
+ *
+ * Created on: Dec 18, 2009
+ * Author: mohanti
+ */
+
+#ifndef COOKIECLIENTDATAARRAY_H_
+#define COOKIECLIENTDATAARRAY_H_
+
+//System Includes
+
+//User Includes
+
+//Forward Class Declaration
+class CCookieClientData;
+class CCookieArray;
+
+//This class holds an array of CCookieClientdata objects.
+//This a singleton class and is allocated in the Thread local storage(TLS)
+
+NONSHARABLE_CLASS( CCookieClientDataArray ):public CBase
+ {
+public:
+
+ /* Constructor
+ *
+ */
+ static CCookieClientDataArray* GetInstance();
+
+ /* Reference Count method
+ *
+ */
+ inline void Ref(){++iRefCount;}
+
+ /*Dereference count method and will delete the CCookieClientDataArray object once the iRefCount is zero
+ *
+ */
+ void DeRef();
+
+ /* Destructor
+ *
+ */
+ ~CCookieClientDataArray();
+
+ /* Constructor
+ *
+ */
+ CCookieClientDataArray();
+
+ /* Finds the address of CCookieClientData object from the array based on group id and appuid
+ * @param aGroupId Indicates group id
+ * @param aWidgetUid Indicates appuid
+ */
+ CCookieClientData* Find(const TUint32& aGroupId,const TUint32& aWidgetUid);
+
+ /* Finds the Index of CCookieClientData object from the array based on group id and appuid
+ * @param aGroupId Indicates Group Id
+ * @param aWidgetUid Indicates Appuid
+ * @param aIndex On return of the method,it indicates the index no where the intended
+ * CCookieClientData Object is present
+ */
+ TInt FindIndex(const TUint32& aGroupId, const TUint32& aWidgetUid,TInt& aIndex );
+
+ /* Adding CCookieClientData object in to the array.
+ * @param aCookieClientData Indiactes the address of CCookieClientData Object
+ */
+ void AddClientGroupDataL(CCookieClientData* aCookieClientData);
+
+ /* Returns the CCookieClientData object from the array based on index no.
+ * @param aIndex Indiactes index no.
+ */
+ CCookieClientData* At(TInt aIndex) const;
+
+ /* Subscripting operator
+ *
+ */
+ CCookieClientData* operator[](TInt aIndex) const;
+
+ /* Returns the no of CCookieClientData object in the array
+ *
+ */
+ TInt Count()const;
+
+ /* Returns the cookiearray from the array based on the index no.
+ * @param aIndex indeicates the index no
+ */
+ CCookieArray* CookieArray(TInt aIndex);
+
+ /* Removes a CCookieClientData object from the array based on index no.
+ *
+ */
+ void Remove(TInt aIndex);
+
+ /* Compresses the array
+ *
+ */
+ void Compress();
+
+ /* Deletes a CCookieClientData object from the array based on appuid
+ * @param aAppUid Indicates appuid of a Secure Widget.
+ */
+ TInt DestroyClientData(const TUint32 aAppUid);
+protected:
+
+private:
+ /* Constructor
+ *
+ */
+ CCookieClientDataArray(const CCookieClientDataArray&);
+
+ /* Assignment operator
+ *
+ */
+ CCookieClientDataArray& operator=(const CCookieClientDataArray&);
+public:
+
+protected:
+
+private:
+ TInt iRefCount;
+ RPointerArray<CCookieClientData>* iCookieClientData;
+ };
+
+
+#endif /* COOKIECLIENTDATAARRAY_H_ */
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerInc/CookieGroupData.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,182 @@
+/*
+ * CCookieGroupData.h
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+
+#ifndef COOKIEGROUPDATA_H_
+#define COOKIEGROUPDATA_H_
+
+//System Includes
+#include <stringpool.h>
+#include <f32file.h>
+#include <e32def.h>
+#include <e32base.h>
+#include <e32cmn.h>
+
+//Forward Class declaration
+class CCookieArray;
+class CCookie;
+class TCookiePacker;
+
+//Constants
+
+const TInt KCookieMaxFileNameLength = 256;
+
+/** Class to store the Cookie Data based on secure id and appuid
+*/
+
+NONSHARABLE_CLASS( CCookieGroupData ):public CBase
+ {
+public:
+ /**Constructor.
+ *
+ * @param aGroupId identifies the secure id of a client request
+ * @param aAppUid identifies the Appuid sets in the transaction property of a client request
+ * @return instance of CCookieGroupData
+ */
+ static CCookieGroupData* NewL(TUint32 aGroupId,const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag = EFalse );
+
+ /**Constructor.
+ *
+ * @param aGroupId identifies the secure id of a client request
+ * @param aAppUid identifies the Appuid sets in the transaction property of a client request
+ * @return instance of CCookieGroupData
+ */
+ static CCookieGroupData* NewLC(TUint32 aGroupId,const RArray<TUint32>& aAppuid,TBool aCookieSharableFlag = EFalse);
+
+
+ /**Standard destructor.
+ */
+ ~CCookieGroupData();
+
+ /**
+ * @return Instance of CCookieArray object.
+ */
+ CCookieArray* CookieArray();
+
+ /**
+ * @return GroupId
+ */
+ inline const TUint32 GetGroupId(){return iGroupId;}
+
+ /* Gets Shared uid based on index no.
+ *@param aIndex Indicates index no.
+ * @return AppUid
+ */
+ TUint32 GetSharedUid(TInt aIndex);
+
+ /*Gets Cookie Sharable Flag
+ * @return iCookieSharableFlag indicates sharable flag
+ */
+ inline TBool GetCookieSharableFlag(){return iCookieSharableFlag;}
+
+ /*Returns appuid based on index no
+ *
+ */
+ TUint32 At(TInt aIndex) const;
+
+ /* Subscripting Operator
+ *
+ */
+ TUint32 operator[](TInt aIndex) const;
+
+ /**
+ * Store a cookie in a persistent way. We take over the ownership
+ * of the cookie.
+ * If the cookie exists, that is, there is already a cookie whose NAME
+ * attribute is the same, then the new cookie supersedes the old when :
+ * - the old and new Domain attribute value compare equal (case-
+ * insensitive),
+ * - the old and new Path attribute values string-compare equal
+ * (case-sensitive).
+ * However, if the Max-Age attribute is zero, then the old and new cookies
+ * are discarded.
+ * @param aCookie The cookie to be stored.
+ * @param aRequestUri The current HTTP request-URI.
+ * @param aIndex Cookie is inserted at the position of existing cookie, and exisiting cookie is removed.
+ */
+ void StorePersistentCookieL( CCookie* aCookie, const TDesC8& aRequestUri, const TInt aIndex = -1 );
+
+
+ //void StorePersistentCookieL( CCookie* aCookie,const TDesC8& aRequestUri,const TInt aIndex );
+
+ /**Reads the Cookie related info specific for a group for a file.
+ *
+ * @return KErrNotFound in case of File not found from the path
+ * KErrNoMemory in case no Memory
+ * KErrNone Incase of successful reading of the cookie info from the file.
+ */
+ TInt ReadCookiesFromFile();
+
+ /**
+ * @return KErrNone if Succesfully Writes the Cookie info in to the file.
+ */
+ TInt WriteCookiesToFile();
+
+ /**All the cookies will be deleted from the memory as well as from the file for a group.
+ * @return the number of files deleted.
+ */
+ TInt ClearAllCookies();
+
+ /** Returns the Number of Cookie objects present for a group
+ * @return Numaaber of Cookie Objects
+ */
+ TInt Count()const;
+
+ /* Return Filename
+ * @return returns the Filename
+ */
+ const TDesC& GetFileName() const;
+
+ /** Sets Filename
+ *
+ * @param aAppUid Indicates appuid
+ * @param aSecureId Indicates Client Id
+ * @return void
+ */
+ void SetFileName(TUint32& aAppUid,TUint32& aSecureId);
+
+ /* Constructor
+ *
+ */
+ void ConstructL(const RArray<TUint32>& aAppuid);
+
+ /*Total Appuids
+ *
+ */
+ TInt TotalAppUid();
+protected:
+private:
+ /*Constructor
+ * aGroupId Indicates group Id
+ * aCookieSharableFlag CookieSharable Flag
+ */
+ CCookieGroupData(TUint32 aGroupId, TBool aCookieSharableFlag = EFalse);
+
+ /* Check Diskspace available before saving the cookies in to File System
+ * @param
+ * @param
+ * @param
+ * @return
+ */
+ TBool CheckDiskSpace( RFs& aFileSystem, const TDesC& aFileName ) const;
+
+public:
+
+protected:
+
+private:
+ CCookieArray* iCookieArray;
+ HBufC* iCookieFileName;
+ RStringPool iStringPool;
+ TCookiePacker* iCookiePacker;
+ RFs iFs;
+ TUint32 iGroupId;
+ TBool iCookieSharableFlag;
+ RArray<TUint32> iSharedUid;
+ //TUint32 iAppUid;
+ };
+
+#endif /* COOKIEGROUPDATA_H_ */
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerInc/CookieGroupDataArray.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,140 @@
+/*
+ * CCookieGroupDataArray.h
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+
+#ifndef CCOOKIEGROUPDATAARRAY_H_
+#define CCOOKIEGROUPDATAARRAY_H_
+//System Include
+
+//User Includes
+
+//Forward Declaration
+class CCookieGroupData;
+class CGroupIdArray;
+class CCookieArray;
+class CCookie;
+
+/*This class is used to hold an array of CCookieGroupData objects.
+ *
+ */
+NONSHARABLE_CLASS( CCookieGroupDataArray ):public CBase
+ {
+public:
+
+ /* Constructor
+ *
+ */
+ static CCookieGroupDataArray* NewL();
+
+ /* Constructor
+ *
+ */
+ static CCookieGroupDataArray* NewLC();
+
+ /* Destructor
+ *
+ */
+ ~CCookieGroupDataArray();
+
+
+ /*Gets CCookieGroupData object index in the array based on Group Id and appuid
+ * @param aGroupId Indicates group id
+ * @param aAppUid Indicates appuid
+ * @param aCookieSharable On return of this method it holds the Cookie Sharable
+ * status for the CCookieGroupData Object
+ * @param aIndex On return of this method it holds the Index value of the CCookieGroupData Object
+ * in the array
+ */
+ void GetGroupDataIndexL(TUint32 aGroupId,TUint32 aAppUid,TBool& aCookieSharable, TInt& aIndex);
+
+ /* Find the Index value of the CCookieGroupData Object based on Group Id
+ * @param aGroupId Indicates Group Id
+ * @param aIndex Indicates the Index value
+ */
+ TInt FindIndex(TUint32 aGroupId,TInt& aIndex );
+
+ /*Find the Index value of the CCookieGroupData Object based on Group Id and appuid
+ * @param aGroupId Indicates group Id
+ * @param aAppUid Indicates appuid
+ * @aIndex On return of this method,it indicates the index value of CCookieGroupData object.
+ */
+ TInt FindIndex(TUint32 aGroupId,TUint32 aAppUid,TInt& aIndex );
+
+ /* Gets the address of CCookieGroupData object from the array based on the index value.
+ * @param aIndex Indicates the index value
+ */
+ CCookieGroupData* GetGroupData(TInt aIndex);
+
+ /* Adding CCookieGroupData object in to the array
+ * @param address of CCookieGroupData object
+ */
+ void AddGroupDataL(CCookieGroupData* aCookieGroupData);
+
+ /* Getting the address of CCookieGroupData object based on index value
+ *
+ */
+ CCookieGroupData* At(TInt aIndex) const;
+
+ /* Subscripting Operator
+ *
+ */
+ CCookieGroupData* operator[](TInt aIndex) const;
+
+ /* Return the number of CCookieGroupData objects from the array.
+ *
+ */
+ TInt Count()const;
+
+ /* Returns the address of CCookieArray object based on Index Value
+ *
+ */
+ CCookieArray* CookieArray(TInt aIndex);
+
+ /**
+ * Get the relevant cookies for a transaction
+ * @param aRequestUri The URI of the current HTTP request.
+ * @param aCookies An array which will be filled with the cookies
+ * for aTransaction based on the index value.
+ * @param aIndex Indiactes Index Value.
+ */
+ TInt GetCookies( const TDesC8& aRequestUri,RPointerArray<CCookie>& aCookies,TInt aIndex ) const;
+
+ /* Removes CCookieGroupData object from the array based on Index value.
+ * @param aIndex Indicates index value.
+ */
+ void Remove(TInt aIndex);
+
+ /* Compreses the Array
+ *
+ */
+ void Compress();
+
+ /* Destroys a CCookieGroupData object from the array based on Group id
+ *
+ */
+ TInt DestroyGroupData(TUint32 aGroupId);
+
+protected:
+private:
+
+ /* Constructor
+ *
+ */
+ void ConstructL();
+
+ /*Constructor
+ *
+ */
+ CCookieGroupDataArray();
+public:
+
+protected:
+
+private:
+ RPointerArray<CCookieGroupData>* iCookieGroupData;
+ };
+
+#endif /* CCOOKIEGROUPDATAARRAY_H_ */
--- a/httpfilters/cookie/ManagerInc/CookieLogger.h Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerInc/CookieLogger.h Wed Mar 31 22:32:15 2010 +0300
@@ -39,6 +39,7 @@
ECookieArray = 0x00000010, ///< Log CCookieArray activity.
EServerStart = 0x00000020, ///< Log server start-up activity.
EClientConnect = 0x00000040, ///< Log client connecting activity.
+ ECookie = 0x00000080, ///< Log CCookie activity.
ELogAll = 0xFFFFFFFF ///< Log all.
};
--- a/httpfilters/cookie/ManagerInc/CookieManagerServer.h Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerInc/CookieManagerServer.h Wed Mar 31 22:32:15 2010 +0300
@@ -25,15 +25,19 @@
#include <http.h>
#include <f32file.h>
#include <e32def.h>
+#include <stringpool.h>
// Opcodes used in message passing between client and server
enum TCookieServerRqst
{
EStoreCookie,
- EClearAllCookies,
+ EClearAllCookies,
EGetCookieSize,
EGetCookies,
- ESetAppUid
+ ESetAppUid,
+ EDestroyCookies,
+ EGetCookieSharableFlag,
+ EClearAppUidCookies
};
// FORWARD DECLARATIONS
@@ -43,7 +47,9 @@
class CCookieTimer;
class CCookieManagerSession;
class TCookiePacker;
-
+class CCookieGroupDataArray;
+class CGroupIdArray;
+class TXmlEngElement;
// CLASS DECLARATIONS
/**
@@ -83,7 +89,7 @@
* Clears all cookies
* @return The number of cookies removed
*/
- TInt ClearAllCookies();
+ //TInt ClearAllCookies();
/**
* Returns a pointer to the stringpool we currently use.
@@ -94,7 +100,7 @@
/**
* Returns a poitner for the persistent cookies we currently have.
*/
- CCookieArray* CookieArray();
+ //CCookieArray* CookieArray();
/**
@@ -112,24 +118,69 @@
* @param aRequestUri The current HTTP request-URI.
* @param aIndex Cookie is inserted at the position of existing cookie, and exisiting cookie is removed.
*/
- void StorePersistentCookieL( CCookie* aCookie, const TDesC8& aRequestUri, const TInt aIndex = -1 );
+ //void StorePersistentCookieL( CCookie* aCookie, const TDesC8& aRequestUri, const TInt aIndex = -1 );
/**
*
*/
- TInt GetCookies( const TDesC8& aRequestUri,
- RPointerArray<CCookie>& aCookies ) const;
+// TInt GetCookies( const TDesC8& aRequestUri,
+// RPointerArray<CCookie>& aCookies ) const;
/**
*Sets the File Name of the Cookie File using AppUid
*@param aFileName The AppUid of the Application
*/
- void SetFileName(TUint32& aAppUid);
+ //void SetFileName(TUint32& aAppUid);
/**
*@return the File Name of the Cookie file
*/
TDesC& GetFileName() const;
+
+ /* Loading the group specific info from CookieGroupData.xml file
+ *
+ */
+ TInt LoadGroupDataFromFileL( RFs& aFileSession );
+
+ /* Parsing the Xml elements
+ *
+ */
+ void ParseElement( TXmlEngElement& aElement );
+
+ /*
+ *
+ */
+ CCookieArray* CookieArray( TInt aIndex );
+
+ /*
+ *
+ */
+ CCookieGroupDataArray* CookieGroupDataArray();
+
+ /**
+ * Get the relevant cookies for a transaction
+ * @param aRequestUri The URI of the current HTTP request.
+ * @param aCookies An array which will be filled with the cookies
+ * for aTransaction based on the index value.
+ * @param aIndex Indiactes Index Value.
+ */
+ TInt GetCookies( const TDesC8& aRequestUri, RPointerArray<CCookie>& aCookies, TInt aIndex ) const;
+
+ /*
+ *
+ */
+ CGroupIdArray* GroupIdArray();
+
+ /*Changes Hexadecimal value to Decimal Value
+ *
+ */
+ TInt ChangeToDecimal( TDes8& aBuf,TUint32& aUid );
+
+ /* Extracting the attribute information from parsed xml element
+ *
+ */
+ void SettingAttribute(TDesC8& aAttr, TDesC8& aVal,TUint32& aGroupId
+ , RArray<TUint32>& aSharedAppUidArray, TBool& aCookieSharableFlag );
private:
/**
@@ -162,7 +213,7 @@
* content we can process it by calling ParseCookiesFromBufferL method.
* @return The error code indicating the type of failure.
*/
- TInt ReadCookiesFromFile();
+ //TInt ReadCookiesFromFile();
/**
@@ -173,7 +224,7 @@
* cookie, but it may not neccessarily be true for ALL cookies.
* @return The error code indicating the type of failure.
*/
- TInt WriteCookiesToFile();
+ //TInt WriteCookiesToFile();
private:
TUint32 iSessionCount;
@@ -181,17 +232,18 @@
CCookieTimer* iCloseTimer;
- HBufC* iCookieFileName;
-
- RFs iFs;
- CCookieArray* iPersistentCookies; // new-style
+ //HBufC* iCookieFileName;
+ //RFs iFs;
+ //CCookieArray* iPersistentCookies; // new-style
RStringPool iStringPool;
// As we open our string pool only in ConstructL we cannot instantiate the
// cookie packer in the constructor :(
TCookiePacker* iCookiePacker;
-
+ CCookieGroupDataArray* iCookieGroupDataArray;
+ CGroupIdArray* iGroupIdArray;
+
};
--- a/httpfilters/cookie/ManagerInc/CookieManagerSession.h Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerInc/CookieManagerSession.h Wed Mar 31 22:32:15 2010 +0300
@@ -77,27 +77,37 @@
private : // internal methods
- /**
+ /**Clear all Cookies from file system belongs to a Client
*
*/
TInt ClearAllCookies( const RMessage2& aMessage );
+ /** Clear all Cookies from File System based on appuid
+ *
+ */
+ TInt ClearAllAppUidCookies( const RMessage2& aMessage );
+
/**
*
*/
TInt DoClearAllCookies( const RMessage2& aMessage );
- /**
+ /**
+ *
+ */
+ TInt DoClearAllAppUidCookies( const RMessage2& aMessage );
+
+ /**Gets Cookie Size for a Url
*
*/
TInt DoGetCookieSize( const RMessage2& aMessage );
- /**
+ /** Gets Cookie info for a Url
*
*/
TInt DoGetCookies( const RMessage2& aMessage );
- /**
+ /**Stores cookie info for a specific url.
*
*/
void DoStoreCookieL( const RMessage2& aMessage );
@@ -122,12 +132,31 @@
*
*/
TInt StoreCookie( const RMessage2& aMessage );
-
-
- /**
+
+ /**Sets the appuid for a request
*
*/
TInt SetAppUidL(const RMessage2& aMessage );
+
+ /*Delets cookie from Server memory and writes the cookie Info in to a file
+ *
+ */
+ TInt DestroyCookies( const RMessage2& aMessage );
+
+ /*
+ *
+ */
+ TInt DoDestroyCookies( const RMessage2& aMessage );
+
+ /*
+ *
+ */
+ TInt GetCookieSharableFlag( const RMessage2& aMessage );
+
+ /*
+ *
+ */
+ TInt DoGetCookieSharableFlag( const RMessage2& aMessage );
private:
CCookieManagerServer& iCookieServer;
@@ -144,8 +173,6 @@
// The size of the temporary cookie list in bytes
TInt iGetCookieListSize;
-
-// CCookieArray* iTransientCookies;
};
#endif //__COOKIEMANAGER_SESSION_H__
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerInc/GroupIdInfoArray.h Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,113 @@
+/*
+ * CGroupIdInfoArray.h
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+
+#ifndef GROUPIDINFOARRAY_H_
+#define GROUPIDINFOARRAY_H_
+//System Includes
+#include <e32base.h>
+#include <e32def.h>
+#include <e32cmn.h>
+//User Includes
+
+//Constants
+
+/*This class is used to hold group related info present in the xml file
+ *
+ */
+NONSHARABLE_CLASS( CGroupIdInfo ):public CBase
+ {
+ public:
+ /*Constructor
+ *
+ */
+ static CGroupIdInfo* NewL(TUint32 aGroupId, const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag = EFalse );
+
+ /*Constructor
+ *
+ */
+ static CGroupIdInfo* NewLC(TUint32 aGroupId, const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag = EFalse );
+
+ /*Standard Constructor
+ *
+ */
+ CGroupIdInfo( TUint32 aGroupId,TBool aCookieSharableFlag = EFalse );
+
+ /*Standard Destructor
+ *
+ */
+ ~CGroupIdInfo();
+
+ /*
+ *
+ */
+ TInt GetGroupName(TUint32 aSecureId,TUint32& aGroupId);
+
+ /*
+ *
+ */
+ void AddClientL(TUint32 aClientId);
+
+ /*
+ *
+ */
+ TUint32 At(TInt aIndex) const;
+
+ /*
+ *
+ */
+ TUint32 operator[](TInt aIndex) const;
+
+ /*
+ *
+ */
+ const TUint32& GetGroupId();
+ TBool GetCookieSharableFlag();
+ TBool IsThisPartOfSharedGroup( TUint32& aClientId );
+ protected :
+ private:
+
+ /*
+ *
+ */
+ void ConstructL(const RArray<TUint32>& aAppuid);
+ public:
+ protected:
+
+ private:
+ TBool iCookieSharableFlag;
+ TUint32 iGroupId;
+ //TUint32 iSecureId;
+ RArray<TUint32> iAppUid;//List of application uid with which Group Info is shared
+ };
+
+/*This class is used to hold an array of CGroupIdInfo objects
+ *
+ */
+
+NONSHARABLE_CLASS( CGroupIdArray ): public CBase
+ {
+ public:
+ static CGroupIdArray* NewL();
+ static CGroupIdArray* NewLC();
+ void ConstructL();
+ ~CGroupIdArray();
+ protected:
+ private:
+ CGroupIdArray();
+ public:
+ TInt Count();
+ CGroupIdInfo& At(TInt aIndex) const;
+ CGroupIdInfo& operator[](TInt aIndex) const;
+ void AddGroupIdL(CGroupIdInfo* aCGroupIdInfo);
+ TInt GetGroupId(TUint32 aClientId,TUint32& aGroupId);
+ TInt GetGroupId(TUint32 aClientId,TUint32& aGroupId,TBool& aCookieSharableFlag);
+ protected:
+ private:
+ RPointerArray<CGroupIdInfo>* iGroupIdInfoArray;
+ };
+
+#endif /* GROUPIDINFOARRAY_H_ */
--- a/httpfilters/cookie/ManagerSrc/Cookie.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/Cookie.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -26,6 +26,7 @@
// User includes
#include "cookie.h"
+#include "cookielogger.h"
#include "CookieCommonConstants.h"
@@ -55,7 +56,97 @@
_LIT8( KLocalMonthNames, "Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec" );
+#ifdef __TEST_COOKIE_LOG__
+static void LogCookieAttribute( const CCookie& aCookie, const RStringPool& aPool, TInt aId, const TDesC8& aTextName, CCookie::TCookieAttributeName aAttributeName )
+ {
+ _LIT(KDateFormat,"%D%M%Y%/0%1%/1%2%/2%3%/3 %:0%H%:1%T%:2%S.%C%:3");
+ THTTPHdrVal fieldVal;
+ const TInt attribErr = aCookie.Attribute( aAttributeName, fieldVal );
+ if ( attribErr == KErrNone )
+ {
+ switch ( fieldVal.Type() )
+ {
+ case THTTPHdrVal::KTIntVal:
+ CLOG( ( ECookie, 0, _L8( "{%3d} [Int] %S = (%d)"), aId, &aTextName, fieldVal.Int() ) );
+ break;
+
+ case THTTPHdrVal::KStrFVal:
+ {
+ RStringF fieldValStr = aPool.StringF( fieldVal.StrF() );
+ const TDesC8& fieldValDesC = fieldValStr.DesC();
+ CLOG( ( ECookie, 0, _L8( "{%3d} [StrF] %S = (%S)"), aId, &aTextName, &fieldValDesC ) );
+ }
+ break;
+
+ case THTTPHdrVal::KStrVal:
+ {
+ RString fieldValStr = aPool.String( fieldVal.Str() );
+ const TDesC8& fieldValDesC = fieldValStr.DesC();
+ CLOG( ( ECookie, 0, _L8( "{%3d} [Str] %S = (%S)"), aId, &aTextName, &fieldValDesC ) );
+ }
+ break;
+
+ case THTTPHdrVal::KDateVal:
+ {
+ TDateTime date = fieldVal.DateTime();
+ TBuf<40> dateTimeString;
+ TTime t( date );
+ TRAP_IGNORE( t.FormatL( dateTimeString, KDateFormat ) );
+ TBuf8<40> dateTimeString8;
+ dateTimeString8.Copy( dateTimeString );
+ CLOG( ( ECookie, 0, _L8( "{%3d} [Date] %S = (%S)"), aId, &aTextName, &dateTimeString8 ) );
+ }
+ break;
+
+ default:
+ CLOG(( ECookie, 0, _L8("{%3d} [????] %S = (%d)"), aId, &aTextName, fieldVal.Type() ));
+ break;
+ }
+ }
+ else
+ {
+ //CLOG( ( ECookie, 0, _L8( "{%3d} LogCookie - absent: %S"), aId, &aTextName ) );
+ }
+ }
+#endif
+
+// ---------------------------------------------------------
+// CCookie::Log
+// ---------------------------------------------------------
+//
+void CCookie::Log( TInt aAssociatedId ) const
+ {
+ TInt associateId = aAssociatedId;
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Log() - Associate Id:%d"), associateId ) );
+#ifdef __TEST_COOKIE_LOG__
+ const TInt count = iAttributes.Count();
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Log() - %d attributes..."), count ) );
+ for( TInt i=0; i<count; i++ )
+ {
+ // Calculating/fetching size is enough to generate usable logs
+ const TCookieAttribute& attrib = iAttributes[ i ];
+ const TInt size = attrib.Size();
+ }
+
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Name"), CCookie::EName );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Value"), CCookie::EValue );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Domain"), CCookie::EDomain );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Path"), CCookie::EPath );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Date"), CCookie::EDate );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Version"), CCookie::EVersion );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Expires"), CCookie::EExpires );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("MaxAge"), CCookie::EMaxAge );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Discard"), CCookie::EDiscard );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Port"), CCookie::EPort );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Secure"), CCookie::ESecure );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Comment"), CCookie::EComment );
+ LogCookieAttribute( *this, iStringPool, aAssociatedId, _L8("Comment URI"), CCookie::ECommentURI );
+ CLOG( ( ECookie, 0, _L( "{%3d} fromCookie2: %d, fromNetscapeVersion: %d"), aAssociatedId, FromCookie2(), FromNetscapeVersion() ) );
+ CLOG( ( ECookie, 0, _L( "{%3d} expired: %d, persists: %d, unknownVer: %d"), aAssociatedId, Expired(), Persistent(), IsUnknownVersion() ) );
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Log() - %d attributes..."), count ) );
+#endif
+ }
// ---------------------------------------------------------
@@ -86,6 +177,18 @@
{
return new (ELeave) CCookie( aStringPool );
}
+// ---------------------------------------------------------
+// CCookie::NewL
+// ---------------------------------------------------------
+//
+CCookie* CCookie::CloneL( const CCookie& aCopy )
+ {
+ CCookie* self = new(ELeave) CCookie( aCopy.iStringPool );
+ CleanupStack::PushL( self );
+ self->CopyFromL( aCopy );
+ CleanupStack::Pop( self );
+ return self;
+ }
// ---------------------------------------------------------
@@ -96,12 +199,15 @@
{
// go through each attribute closing any attribute strings
TInt numAttributes = iAttributes.Count();
+ Log();
+ CLOG( ( ECookie, 0, _L( "-> CCookie::~CCookie - this: 0x%08x, numAttributes: %d"), this, numAttributes ) );
for ( TInt ii = 0; ii < numAttributes; ++ii )
{
iAttributes[ii].Close();
}
iAttributes.Close();
+ CLOG( ( ECookie, 0, _L( "<- CCookie::~CCookie - this: 0x%08x, count: %d"), this, numAttributes ) );
}
@@ -111,6 +217,7 @@
//
void CCookie::AddDefaultPathL( const TUriC8& aUri )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::AddDefaultPathL") ) );
// RFC2965 : Defaults to the path of the request URL that generated the
// Set-Cookie2 response, up to and including the right-most /.
// Note : there is a contradiction as we must not include the right-most /
@@ -139,6 +246,7 @@
THTTPHdrVal defPathVal( defPath );
SetAttribute( EPath, defPathVal, ETrue );// ignore the result
defPath.Close();
+ CLOG( ( ECookie, 0, _L( "<- CCookie::AddDefaultPathL") ) );
}
// ---------------------------------------------------------
@@ -148,6 +256,7 @@
EXPORT_C void CCookie::AddToRequestL( RHTTPHeaders aRequestHeaders,
TInt aPartIndex ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::AddToRequestL") ) );
const TStringTable& commonStringTable = RHTTPSession::GetTable();
// We're writing out the "Cookie:" string
@@ -169,15 +278,17 @@
}
else
{
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - version is missing! - iSetCookie2: %d"), iSetCookie2 ) );
if ( iSetCookie2 )
{
// if this is a new-style cookie (it is from a Set-Cookie2 header),
// then it must have a Version attribute.
// TBD : or should we insert a '$Version=1' string instead?
+ CLOG( ( ECookie, 0, _L( "<- CCookie::AddToRequestL - KErrCorrupt!") ) );
User::Leave( KErrCorrupt );
}
}
-
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - adding name...") ) );
// We're writing out the NAME attribute - it is a serious error if this
// attribute is missing
User::LeaveIfError( Attribute( CCookie::EName, hVal ) );
@@ -187,6 +298,7 @@
hVal,
aPartIndex );
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - adding value...") ) );
// We're writing out the VALUE attribute - it is a serious error if this
// attribute is missing
User::LeaveIfError( Attribute( CCookie::EValue, hVal ) );
@@ -201,6 +313,7 @@
// Writing out Domain attribute
if ( Attribute( CCookie::EDomain, hVal ) == KErrNone && hVal.StrF().DesC().Length() > 0 )
{
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - adding domain...") ) );
aRequestHeaders.SetParamL( cookieString,
iStringPool.StringF( HTTP::EDomain,
commonStringTable ),
@@ -211,6 +324,7 @@
// Writing out Path attribute
if ( Attribute( CCookie::EPath, hVal ) == KErrNone )
{
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - adding path...") ) );
aRequestHeaders.SetParamL( cookieString,
iStringPool.StringF( HTTP::EPath,
commonStringTable ),
@@ -221,12 +335,14 @@
// Writing out Port attribute
if ( Attribute( CCookie::EPort, hVal ) == KErrNone )
{
+ CLOG( ( ECookie, 0, _L( "CCookie::AddToRequestL - adding port...") ) );
aRequestHeaders.SetParamL( cookieString,
iStringPool.StringF( HTTP::ECookiePort,
commonStringTable ),
hVal,
aPartIndex );
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::AddToRequestL") ) );
}
@@ -238,13 +354,15 @@
( CCookie::TCookieAttributeName aAttributeName,
THTTPHdrVal& aAttributeVal) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Attribute") ) );
TCookieAttribute attribute;
if ( FindAttribute( aAttributeName, attribute ) != KErrNotFound )
{
aAttributeVal = attribute.Value();
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Attribute") ) );
return KErrNone;
}
-
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Attribute") ) );
return KErrNotFound;
}
@@ -270,14 +388,16 @@
THTTPHdrVal& aAttributeVal,
TBool& aDefaulted ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Attribute ") ) );
TCookieAttribute attribute;
if ( FindAttribute( aAttributeName, attribute ) != KErrNotFound )
{
aAttributeVal = attribute.Value();
aDefaulted = attribute.Defaulted();
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Attribute KErrNone") ) );
return KErrNone;
}
-
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Attribute KErrNotFound") ) );
return KErrNotFound;
}
@@ -290,6 +410,7 @@
const THTTPHdrVal& aAttributeVal,
TBool aDefaulted )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::SetAttribute") ) );
TInt result( KErrNone );
TCookieAttribute attribute;
@@ -315,6 +436,7 @@
newAttribute.Close();
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::SetAttribute result: %d"),result ) );
return result;
}
@@ -324,71 +446,99 @@
//
void CCookie::CopyFromL( const CCookie& aCopyFrom )
{
- THTTPHdrVal attributevalue;
- TBool aDefaulted( EFalse );
-
- if ( aCopyFrom.Attribute( EName, attributevalue, aDefaulted ) != KErrNotFound )
+ CLOG( ( ECookie, 0, _L( "-> CCookie::CopyFromL ") ) );
+ THTTPHdrVal attributevalue;
+ TBool defaulted( EFalse );
+ if ( aCopyFrom.Attribute( EName, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EName, attributevalue, aDefaulted );
- }
-
- if ( aCopyFrom.Attribute( EValue, attributevalue, aDefaulted ) != KErrNotFound )
- {
- SetAttribute( EValue, attributevalue, aDefaulted );
+ if ( attributevalue.Type() != THTTPHdrVal::KStrVal )
+ {
+ RString correctedStringType = iStringPool.OpenStringL( attributevalue.StrF().DesC() );
+ attributevalue.SetStr( correctedStringType );
+ SetAttribute( EName, attributevalue, defaulted );
+ correctedStringType.Close();
+ const TPtrC8 pVal( attributevalue.Str().DesC() );
+ CLOG( ( ECookie, 0, _L8( "CCookie::CopyFromL - attribute EName Value : %S" ), &pVal ) );
+ }
+ else
+ {
+ SetAttribute( EName, attributevalue, defaulted );
+ }
}
- if ( aCopyFrom.Attribute( EComment, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EValue, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EComment, attributevalue, aDefaulted );
+ if ( attributevalue.Type() != THTTPHdrVal::KStrVal )
+ {
+ RString correctedStringType = iStringPool.OpenStringL( attributevalue.StrF().DesC() );
+ attributevalue.SetStr( correctedStringType );
+ SetAttribute( EValue, attributevalue, defaulted );
+ correctedStringType.Close();
+ const TPtrC8 pVal( attributevalue.Str().DesC() );
+ CLOG( ( ECookie, 0, _L8( "CCookie::CopyFromL - attribute EValue value: %S" ), &pVal ) );
+ }
+ else
+ {
+ SetAttribute( EValue, attributevalue, defaulted );
+ }
+ }
+ if ( aCopyFrom.Attribute( EComment, attributevalue, defaulted ) != KErrNotFound )
+ {
+ SetAttribute( EComment, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( ECommentURI, attributevalue, aDefaulted ) != KErrNotFound )
- {
- SetAttribute( ECommentURI, attributevalue, aDefaulted );
- }
-
- if ( aCopyFrom.Attribute( EDiscard, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( ECommentURI, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EDiscard, attributevalue, aDefaulted );
- }
-
- if ( aCopyFrom.Attribute( EDomain, attributevalue, aDefaulted ) != KErrNotFound )
- {
- SetAttribute( EDomain, attributevalue, aDefaulted );
+ SetAttribute( ECommentURI, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( EMaxAge, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EDiscard, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EMaxAge, attributevalue, aDefaulted );
+ SetAttribute( EDiscard, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( EPath, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EDomain, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EPath, attributevalue, aDefaulted );
+ SetAttribute( EDomain, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( EPort, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EMaxAge, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EPort, attributevalue, aDefaulted );
+ SetAttribute( EMaxAge, attributevalue, defaulted );
+ }
+
+ if ( aCopyFrom.Attribute( EPath, attributevalue, defaulted ) != KErrNotFound )
+ {
+ SetAttribute( EPath, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( ESecure, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EPort, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( ESecure, attributevalue, aDefaulted );
+ SetAttribute( EPort, attributevalue, defaulted );
+ }
+
+ if ( aCopyFrom.Attribute( ESecure, attributevalue, defaulted ) != KErrNotFound )
+ {
+ SetAttribute( ESecure, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( EVersion, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EVersion, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EVersion, attributevalue, aDefaulted );
+ SetAttribute( EVersion, attributevalue, defaulted );
}
- if ( aCopyFrom.Attribute( EExpires, attributevalue, aDefaulted ) != KErrNotFound )
+ if ( aCopyFrom.Attribute( EExpires, attributevalue, defaulted ) != KErrNotFound )
{
- SetAttribute( EExpires, attributevalue, aDefaulted );
+ SetAttribute( EExpires, attributevalue, defaulted );
}
- SetCookie2( aCopyFrom.FromCookie2() );
-
+ //SetCookie2( aCopyFrom.FromCookie2() );
+ // Other properties
+ iSetCookie2 = aCopyFrom.iSetCookie2;
+ iNetscape = aCopyFrom.iNetscape;
+ iSize = aCopyFrom.iSize;
+ iReceivedTime = aCopyFrom.iReceivedTime;
+ CLOG( ( ECookie, 0, _L( "<- CCookie::CopyFromL ") ) );
}
@@ -411,6 +561,7 @@
//
TBool CCookie::Expired() const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Expired ") ) );
// the cookie has expired if:
// 1. it's Age > Max-Age
// 2. current_date > expires
@@ -479,6 +630,7 @@
}
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Expired retval : %d"),retval ) );
return retval;
}
// ---------------------------------------------------------
@@ -487,7 +639,7 @@
//
TPtrC8 CCookie::RemoveQuotes( const TDesC8& aDes )
{
-
+ CLOG( ( ECookie, 0, _L( "-> CCookie::RemoveQuotes ") ) );
TInt firstChar = 0; // position of the first character
TInt lastChar = aDes.Length() - 1; // position of the last character
TPtrC8 result;
@@ -518,7 +670,7 @@
result.Set( aDes.Mid( firstChar, lastChar - firstChar + 1 ) );
}
}
-
+ CLOG( ( ECookie, 0, _L( "<- CCookie::RemoveQuotes result : %d "),result ) );
return result;
}
@@ -530,6 +682,7 @@
//
TBool CCookie::ExpiredNetscapeL( THTTPHdrVal aAttrVal) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::ExpiredNetscapeL ") ) );
TBool retval( EFalse );
TPtrC8 datePtr8( aAttrVal.StrF().DesC() );
TInt dateLen( datePtr8.Length() );
@@ -736,6 +889,7 @@
retval = ETrue;
}
CleanupStack::PopAndDestroy( cleanupNum ); // temp1, temp2, desDate, desTime
+ CLOG( ( ECookie, 0, _L( "<- CCookie::ExpiredNetscapeL retval : %d "),retval ) );
return retval;
}
@@ -749,6 +903,7 @@
const TInt aTokenCount,
TInt* aTokens ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::FindTokens ") ) );
TLex8 lex = aString;
TChar ch;
TInt tokenCount( 0 ), ii;
@@ -762,6 +917,7 @@
aTokens[tokenCount++] = lex.Offset()-1;
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::FindTokens tokenCount : %d"),tokenCount ) );
return tokenCount;
}
@@ -771,6 +927,7 @@
//
TBool CCookie::Persistent() const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Persistent ") ) );
TBool result( EFalse );
THTTPHdrVal attrVal;
@@ -818,6 +975,7 @@
}
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Persistent result : %d"),result ) );
return result;
}
@@ -827,6 +985,7 @@
//
TBool CCookie::IsUnknownVersion() const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::IsUnknownVersion ") ) );
TBool unknownVersion( EFalse );
THTTPHdrVal attrVal;
if( Attribute( CCookie::EVersion, attrVal ) != KErrNotFound )
@@ -836,6 +995,7 @@
unknownVersion = ETrue;
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::IsUnknownVersion unknownVersion : %d"),unknownVersion ) );
return unknownVersion;
}
@@ -846,7 +1006,9 @@
CCookie::CCookie( RStringPool aStringPool )
: iStringPool( aStringPool ), iSetCookie2( EFalse ), iNetscape( EFalse )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::CCookie ") ) );
iReceivedTime.UniversalTime();
+ CLOG( ( ECookie, 0, _L( "<- CCookie::CCookie ") ) );
}
@@ -857,6 +1019,7 @@
void CCookie::ConstructL( RHTTPHeaders aRequestHeaders, TInt aPartIndex,
RStringF aFieldName, const TUriC8& aUri )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::ConstructL ") ) );
const TStringTable& commonStringTable = RHTTPSession::GetTable();
// Determining if this object is constructed from a Set-Cookie2 HTTP header
@@ -1160,6 +1323,7 @@
}
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::ConstructL ") ) );
}
@@ -1171,16 +1335,18 @@
TInt CCookie::FindAttribute( TCookieAttributeName aAttributeName,
TCookieAttribute& aAttribute ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::FindAttribute ") ) );
const TInt numAttributes = iAttributes.Count();
for ( TInt index = 0; index < numAttributes; ++index )
{
if ( iAttributes[index].Name() == aAttributeName )
{
aAttribute = iAttributes[index];
+ CLOG( ( ECookie, 0, _L( "<- CCookie::FindAttribute index : %d"),index ) );
return index;
}
}
-
+ CLOG( ( ECookie, 0, _L( "<- CCookie::FindAttribute KErrNotFound") ) );
return KErrNotFound;
}
@@ -1190,11 +1356,13 @@
//
void CCookie::RemoveAttribute( TInt aIndex )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::RemoveAttribute aIndex : %d"),aIndex ) );
iSize -= ( KCookieAttributePrefixLength + iAttributes[ aIndex ].Size() +
KCookieAttributeDefaultedLength +
KCookieAttributeFoundLength );
iAttributes[ aIndex ].Close();
iAttributes.Remove( aIndex );
+ CLOG( ( ECookie, 0, _L( "<- CCookie::RemoveAttribute aIndex : %d"),aIndex ) );
}
// ---------------------------------------------------------
@@ -1203,12 +1371,14 @@
//
void CCookie::RemoveAttribute( TCookieAttributeName aAttributeName )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::RemoveAttribute - name: %d"), aAttributeName ) );
TCookieAttribute attribute;
TInt index( FindAttribute( aAttributeName, attribute ) );
if( index != KErrNotFound )
{
RemoveAttribute( index );
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::RemoveAttribute - name: %d, index: %d"), aAttributeName, index ) );
}
// ---------------------------------------------------------
@@ -1218,6 +1388,7 @@
TInt CCookie::GetLocalOffset( HBufC8* aDate, TInt& aHour,
TInt& aMinute, TInt& aLength ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::GetLocalOffset ") ) );
TInt retval( 0 );
TInt pos(0);
// TInt fwspos(0);
@@ -1309,6 +1480,7 @@
lex1.Val( aMinute );
CleanupStack::PopAndDestroy( temp ); // temp
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::GetLocalOffset retval : %d "),retval ) );
return retval;
}
@@ -1321,9 +1493,11 @@
//
TInt CCookie::GetMilitaryOffset( HBufC8* /*aDate*/, TInt& aHour ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::GetMilitaryOffset ") ) );
// TODO: Add military timezone handling here...
TInt retval( KErrNotFound );
aHour = 0;
+ CLOG( ( ECookie, 0, _L( "<- CCookie::GetMilitaryOffset retval : %d "),retval ) );
return retval;
}
@@ -1336,6 +1510,7 @@
TInt CCookie::GetTimeZone( HBufC8* aDate, TInt& aHour,
TInt& aLength ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::GetTimeZone ") ) );
TInt retval( 0 );
TInt zonepos = aDate->Find( KUT() );
if ( zonepos != KErrNotFound )
@@ -1424,7 +1599,7 @@
// get the length
aLength = aDate->Length() - zonepos;
}
-
+ CLOG( ( ECookie, 0, _L( "<- CCookie::GetTimeZone retval :%d "),retval ) );
return retval;
}
@@ -1436,6 +1611,7 @@
//
HBufC8* CCookie::GetCleanedDateTimeLC( HBufC8* aDate ) const
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::GetCleanedDateTimeLC ") ) );
// as http time might contain a "DayOfWeek," optional part
// which is not understood by the parser, we need to
// remove it
@@ -1502,6 +1678,7 @@
*result = temp->Left( temp->Length() - length);
// return ( temp->Left( temp->Length() - length).AllocLC() );
CleanupStack::PopAndDestroy( temp );
+ CLOG( ( ECookie, 0, _L( "-> CCookie::GetCleanedDateTimeLC result : %d"),result ) );
return result;
}
@@ -1520,6 +1697,7 @@
: iName( aName ),
iDefaulted( aDefaulted )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute") ) );
iValue = aHdrVal.Copy();
@@ -1528,28 +1706,34 @@
case THTTPHdrVal::KTIntVal :
{
iSize = sizeof( TInt );
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute iSize :%d "),iSize ) );
break;
}
case THTTPHdrVal::KStrVal :
{
iSize = iValue.Str().DesC().Length();
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute iSize :%d "),iSize ) );
break;
}
case THTTPHdrVal::KDateVal :
{
iSize = sizeof( TDateTime );
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute iSize :%d "),iSize ) );
break;
}
case THTTPHdrVal::KStrFVal :
{
iSize = iValue.StrF().DesC().Length();
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute iSize :%d "),iSize ) );
break;
}
default : // THTTPHdrVal::KNoType
{
iSize = 0;
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute iSize :%d "),iSize ) );
}
}
+ CLOG( ( ECookie, 0, _L( "<- CCookie::TCookieAttribute ") ) );
}
@@ -1559,6 +1743,8 @@
//
CCookie::TCookieAttribute::TCookieAttribute()
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::TCookieAttribute ") ) );
+ CLOG( ( ECookie, 0, _L( "<- CCookie::TCookieAttribute ") ) );
}
@@ -1568,18 +1754,22 @@
//
void CCookie::TCookieAttribute::Close()
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Close ") ) );
THTTPHdrVal::THTTPValType type = iValue.Type();
if ( type == THTTPHdrVal::KStrVal )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Close KStrVal") ) );
iValue.Str().Close();
}
else if ( type == THTTPHdrVal::KStrFVal )
{
+ CLOG( ( ECookie, 0, _L( "-> CCookie::Close KStrFVal") ) );
iValue.StrF().Close();
}
// TBD : iValue = THTTPHdrVal();?
iSize = 0;
+ CLOG( ( ECookie, 0, _L( "<- CCookie::Close ") ) );
}
--- a/httpfilters/cookie/ManagerSrc/CookieArray.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/CookieArray.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -1027,3 +1027,84 @@
Remove( 0 );
};
}
+// ---------------------------------------------------------
+// CCookieArray::ReserveL
+// ---------------------------------------------------------
+//
+void CCookieArray::ReserveL( TInt aNumberOfCookies )
+ {
+ iCookies.ReserveL( aNumberOfCookies );
+ }
+// ---------------------------------------------------------
+// CCookieArray::GetCookies
+// ---------------------------------------------------------
+//
+TInt CCookieArray::GetCookies( const TDesC8& aRequestUri,
+ RPointerArray<CCookie>& aCookies, TBool& aFound )// harendra: aFound is redundant
+ {
+ CLOG( ( ECookieArray, 0,
+ _L( "-> CCookieArray::GetCookies for an URI" ) ) );
+ TUriParser8 uriParser;
+ TInt err = uriParser.Parse( aRequestUri );
+ if ( !err )
+ {
+ // first get the details of the current requestUri,
+ // that is, Domain, Path and port
+ TPtrC8 requestPath( uriParser.IsPresent( EUriPath ) ?
+ uriParser.Extract( EUriPath ) : KNullDesC8() );
+ TPtrC8 requestDomain( uriParser.IsPresent( EUriHost ) ?
+ uriParser.Extract( EUriHost ) : KNullDesC8() );
+ TPtrC8 requestPort( uriParser.IsPresent( EUriPort ) ?
+ uriParser.Extract( EUriPort ) : KCookieDefaultRequestPort() );
+ TPtrC8 requestScheme( uriParser.IsPresent( EUriScheme ) ?
+ uriParser.Extract( EUriScheme ) : KNullDesC8() );
+
+ // now check the existing cookies
+ // remove expired ones first, if there are any
+ RemoveExpired();
+ // and finally, find the cookies...
+ TInt count = iCookies.Count();
+ for ( TInt i = 0; i < count && err == KErrNone; i++ )
+ {
+ // Does the cookie have Path attribute?
+ TPtrC8 cookiePath;
+ if ( !GetFoldedCookieAttr( *iCookies[i],
+ CCookie::EPath,
+ cookiePath ) )
+ {
+ continue;
+ }
+
+ // Does the cookie have Domain attribute?
+ TPtrC8 cookieDomain;
+ if ( !GetFoldedCookieAttr( *iCookies[i],
+ CCookie::EDomain,
+ cookieDomain ) )
+ {
+ continue;
+ }
+
+ TPtrC8 cookiePort;
+ GetFoldedCookiePortAttr( *iCookies[i], cookiePort );
+
+ if ( PathMatch( requestPath, cookiePath ) &&
+ DomainMatch( requestDomain, cookieDomain, ETrue ) &&
+ PortMatch( requestPort, cookiePort ) &&
+ SecureMatch( requestScheme, *iCookies[i] ) )
+ {
+ CCookie* clone = CCookie::CloneL( *iCookies[i] );
+ CleanupStack::PushL( clone );
+ err = aCookies.Append(clone);
+ CleanupStack::Pop(clone);
+ aFound = ETrue;
+ }
+ }
+ aCookies.Sort( TLinearOrder<CCookie> (CCookieArray::CompareCookiesPath) );
+ }
+
+
+
+ CLOG( ( ECookieArray, 0,
+ _L( "<- CCookieArray::GetCookies for an URI" ) ) );
+ return err;
+ }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerSrc/CookieClientData.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,192 @@
+/*
+ * CookieClientData.cpp
+ *
+ * Created on: Dec 28, 2009
+ * Author: mohanti
+ */
+//User Includes
+#include "CookieClientdata.h"
+#include "Cookie.h"
+#include "CookieArray.h"
+#include "cookielogger.h"
+
+
+// ---------------------------------------------------------
+// CCookieGroupData::NewL
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientData::NewL(TUint32 aGroupId)
+ {
+ CCookieClientData* self = CCookieClientData::NewLC(aGroupId);
+ CleanupStack::Pop();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieClientData::NewLC
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientData::NewLC(TUint32 aGroupId)
+ {
+ CCookieClientData* self = new (ELeave) CCookieClientData(aGroupId);
+ CleanupStack::PushL(self);
+ self->ConstructL();
+ return self;
+ }
+// ---------------------------------------------------------
+// CCookieGroupData::NewL
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientData::NewL(TUint32 aGroupId,TUint32 aWidgetUid,TBool aCookieSharableFlag, TBool aInitFlag)
+ {
+ CCookieClientData* self = CCookieClientData::NewLC(aGroupId, aWidgetUid, aCookieSharableFlag, aInitFlag);
+ CleanupStack::Pop();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieClientData::NewLC
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientData::NewLC(TUint32 aGroupId,TUint32 aWidgetUid,TBool aCookieSharableFlag, TBool aInitFlag)
+ {
+ CCookieClientData* self = new (ELeave) CCookieClientData(aGroupId, aWidgetUid, aCookieSharableFlag, aInitFlag);
+ CleanupStack::PushL(self);
+ self->ConstructL();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieClientData::CCookieClientData
+// ---------------------------------------------------------
+//
+CCookieClientData::CCookieClientData(TUint32 aGroupId,TUint32 aWidgetUid ,TBool aCookieSharableFlag , TBool aInitFlag)
+:iInitFlag(aInitFlag),iCookieSharableFlag(aCookieSharableFlag),iGroupId(aGroupId),iWidgetUid(aWidgetUid)
+ {
+
+ }
+// ---------------------------------------------------------
+// CCookieClientData::CCookieClientData
+// ---------------------------------------------------------
+//
+CCookieClientData::CCookieClientData(TUint32 aGroupId):iInitFlag(EFalse),iCookieSharableFlag(EFalse),iGroupId(aGroupId),iWidgetUid(0)
+ {
+
+ }
+// ---------------------------------------------------------
+// CCookieGroupData::ConstructL
+// ---------------------------------------------------------
+//
+void CCookieClientData::ConstructL()
+ {
+ iCookieArray = new (ELeave) CCookieArray;
+ }
+
+// ---------------------------------------------------------
+// CCookieClientData::~CCookieClientData
+// ---------------------------------------------------------
+//
+CCookieClientData::~CCookieClientData()
+ {
+ CLOG(( EClient, 0, _L("-> CCookieClientData::~CCookieClientData iCookieArray: 0x%08x"), iCookieArray ));
+ delete iCookieArray;
+ iCookieArray = NULL;
+ CLOG(( EClient, 0, _L("<- CCookieClientData::~CCookieClientData") ));
+ }
+
+// ---------------------------------------------------------
+// CCookieClientData::StorePersistentCookieL
+// ---------------------------------------------------------
+//
+void CCookieClientData::StorePersistentCookieL( const CCookie* aCookie,
+ const TDesC8& aRequestUri,
+ const TInt aIndex )
+ {
+ CLOG(( EClient, 0, _L("-> RCookieManager::StorePersistentCookieL") ));
+ if (aIndex == -1)
+ {
+ iCookieArray->AddL( aCookie, aRequestUri);
+ }
+ else
+ {
+ iCookieArray->InsertL( aCookie, aIndex);
+ }
+ CLOG(( EClient, 0, _L("<- RCookieManager::StorePersistentCookieL") ));
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::StoreCookieAtClientSideL
+// ---------------------------------------------------------
+//
+void CCookieClientData::StoreCookieAtClientSideL(const CCookie* aCookie,const TDesC8& aUri )
+ {
+ CLOG(( EClient, 0, _L("-> RCookieManager::StoreCookieAtClientSideL: aUri:%S"), &aUri ));
+ //Creates a clone of the passed cookie objects as the ownership of this object is held by Clint of Cookie Manager Dll
+
+ CCookie* clone = CCookie::CloneL( *aCookie );
+ CleanupStack::PushL( clone );
+
+ TInt index(0);
+ CCookieArray* perscookiearray = CookieArray();
+ if ( perscookiearray->DoesAlreadyExists( clone, index ) )
+ { // must overwrite !!!
+ // but first add the new one if needed
+ // just not to give a chance of beeing lost...
+ // persistence of the cookie will be handled on
+ // saving all cookies to disk
+ perscookiearray->MakeRoomForInsertIfNeededL(clone, aUri, index);
+ if(index >=0)
+ {
+ // insert cookie at valid index
+ //iCookieClientData->StorePersistentCookieL(aCookie,aUri,index);
+ StorePersistentCookieL(clone,aUri,index);
+ //iCookieClientData->StorePersistentCookieL( aCookie, aUri, index );
+ // remove the old cookie
+ perscookiearray->Remove( index + 1 );
+ }
+ else
+ { // invalid index means old cookie has been deleted in the process of making room
+ // append the new cookie to the end of array
+ //iCookieClientData->StorePersistentCookieL( aCookie, aUri );
+ StorePersistentCookieL( clone, aUri );
+ }
+ }
+ else
+ { // it is not in the array yet, add it now
+ //iCookieClientData->StorePersistentCookieL( aCookie, aUri );
+ StorePersistentCookieL( clone, aUri );
+ }
+ // Cookie supervisor API takes immediate ownership of both cookie and array
+ CleanupStack::Pop(clone);
+ CLOG(( EClient, 0, _L("<- RCookieManager::StoreCookieAtClientSideL") ));
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::Count
+// ---------------------------------------------------------
+//
+TInt CCookieClientData::Count()const
+ {
+ return iCookieArray->Count();
+ }
+
+// ---------------------------------------------------------
+
+// ---------------------------------------------------------
+// CCookieGroupData::GetClientSideCookies
+// ---------------------------------------------------------
+//
+TInt CCookieClientData::GetClientSideCookies(const TDesC8& aRequestUri,RPointerArray<CCookie>& aCookies,TBool& aCookieFound )const
+ {
+ return iCookieArray->GetCookies(aRequestUri,aCookies,aCookieFound);
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::CookieArray
+// ---------------------------------------------------------
+//
+CCookieArray* CCookieClientData::CookieArray()
+ {
+ return iCookieArray;
+ }
+//EOF
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerSrc/CookieClientDataArray.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,255 @@
+/*
+ * CookieClientDataArray.cpp
+ *
+ * Created on: Dec 18, 2009
+ * Author: mohanti
+ */
+
+//System Includes
+#include <e32cmn.h>
+#include <e32base.h>
+#include <e32std.h>
+
+//User Includes
+#include "CookieClientDataArray.h"
+#include "CookieManagerClient.h"
+#include "CookieArray.h"
+#include "CookieLogger.h"
+#include "CookieClientData.h"
+
+//Constatnts
+const TInt KCookieArrayGranularity = 10;
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::GetInstance
+// ---------------------------------------------------------
+//
+CCookieClientDataArray* CCookieClientDataArray::GetInstance()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::GetInstance" ) ) );
+ CCookieClientDataArray *clientInstance = static_cast<CCookieClientDataArray*> (Dll::Tls());
+ if (!clientInstance)
+ {
+ clientInstance = new (ELeave) CCookieClientDataArray();
+ Dll::SetTls(clientInstance);
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::GetInstance instance = %x" ),clientInstance ) );
+ return clientInstance;
+ }
+// ---------------------------------------------------------
+// CCookieClientDataArray::DeRef
+// ---------------------------------------------------------
+//
+void CCookieClientDataArray::DeRef()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::Deref" ) ) );
+ --iRefCount;
+ if (iRefCount <= 0)
+ {
+ delete iCookieClientData;
+ iCookieClientData = NULL;
+ Dll::SetTls(0);
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Deref deletes iCookieClientData" ) ) );
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Deref" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieClientDataArray::ConstructL
+// ---------------------------------------------------------
+//
+CCookieClientDataArray::CCookieClientDataArray():iRefCount(0)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::ConstructL" ) ) );
+ iCookieClientData = new (ELeave) RPointerArray<CCookieClientData>(KCookieArrayGranularity);
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::ConstructL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::~CCookieClientDataArray
+// ---------------------------------------------------------
+//
+CCookieClientDataArray::~CCookieClientDataArray()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::~CCookieClientDataArray" ) ) );
+ if(iCookieClientData && iCookieClientData->Count())
+ {
+ iCookieClientData->ResetAndDestroy();
+ iCookieClientData->Close();
+ //delete iCookieClientData;
+ iCookieClientData = NULL;
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::~CCookieClientDataArray" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::Count
+// ---------------------------------------------------------
+//
+TInt CCookieClientDataArray::Count()const
+ {
+ if (iCookieClientData)
+ return iCookieClientData->Count();
+ else
+ return 0;
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::Compress
+// ---------------------------------------------------------
+//
+void CCookieClientDataArray::AddClientGroupDataL(CCookieClientData* aCookieClientData)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::AddGroupDataL" ) ) );
+ iCookieClientData->AppendL(aCookieClientData);
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::AddGroupDataL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::Compress
+// ---------------------------------------------------------
+//
+void CCookieClientDataArray::Compress()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::Compress" ) ) );
+ iCookieClientData->Compress();
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Compress" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::operator[]
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientDataArray::operator[](TInt aIndex) const
+ {
+ return (*iCookieClientData)[aIndex];
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::At
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientDataArray::At(TInt aIndex) const
+ {
+ return (*iCookieClientData)[ aIndex ];
+ }
+// ---------------------------------------------------------
+// CCookieClientDataArray::Find
+// ---------------------------------------------------------
+//
+CCookieClientData* CCookieClientDataArray::Find(const TUint32& aGroupId, const TUint32& aWidgetUid )
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::Find GroupId = %x, WidgetUid = %x" ),aGroupId,aWidgetUid ) );
+ TInt total = Count();
+ TBool WidgetUidFound = EFalse;
+ TInt index = 0;
+ for ( TInt i = 0;i<total;i++ )
+ {
+ if (At(i)->GetGroupId()== aGroupId && (At(i)->GetCookieSharableFlag()))
+ {
+ WidgetUidFound = ETrue;
+ index = i;
+ break;
+ }
+ else if (At(i)->GetGroupId()== aGroupId && !(At(i)->GetCookieSharableFlag())
+ && (At(i)->GetWidgetUid()== aWidgetUid))
+ {
+ WidgetUidFound = ETrue;
+ index = i;
+ break;
+ }
+ }
+ if ( WidgetUidFound )
+ {
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Find found with index = %d" ),index ) );
+ return At(index);
+ }
+ else
+ {
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Find not found " ) ) );
+ return NULL;
+ }
+ }
+// ---------------------------------------------------------
+// CCookieClientDataArray::FindIndex
+// ---------------------------------------------------------
+//
+TInt CCookieClientDataArray::FindIndex(const TUint32& aGroupId, const TUint32& aWidgetUid,TInt& aIndex )
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::FindIndex GroupId = %x,WidgetUid = %x" )
+ ,aGroupId,aWidgetUid ) );
+ TInt total = Count();
+ TBool WidgetUidFound = EFalse;
+ TInt index = 0;
+ for ( TInt i = 0;i<total;i++ )
+ {
+ if (At(i)->GetGroupId()== aGroupId && (At(i)->GetCookieSharableFlag()))
+ {
+ WidgetUidFound = ETrue;
+ index = i;
+ break;
+ }
+ else if (At(i)->GetGroupId()== aGroupId && !(At(i)->GetCookieSharableFlag())
+ && (At(i)->GetWidgetUid()== aWidgetUid))
+ {
+ WidgetUidFound = ETrue;
+ index = i;
+ break;
+ }
+ }
+ if ( WidgetUidFound )
+ {
+ aIndex = index;
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::FindIndex found with index = %d" ),index ) );
+ return KErrNone;
+ }
+ else
+ {
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::FindIndex not found " ) ) );
+ return KErrNotFound;
+ }
+ }
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::CookieArray
+// ---------------------------------------------------------
+//
+CCookieArray* CCookieClientDataArray::CookieArray(TInt aIndex)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::CookieArray Index =%d" ),aIndex ) );
+ CCookieClientData* cookieclientdata = At(aIndex);
+ return cookieclientdata->CookieArray();
+ }
+
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::Remove
+// ---------------------------------------------------------
+//
+void CCookieClientDataArray::Remove(TInt aIndex)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::Remove %d" ), aIndex ) );
+ delete (*iCookieClientData)[ aIndex ];
+ iCookieClientData->Remove(aIndex);
+ iCookieClientData->Compress();
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::Remove " )) );
+ }
+
+
+// ---------------------------------------------------------
+// CCookieClientDataArray::DestroyGroupData
+// ---------------------------------------------------------
+//
+TInt CCookieClientDataArray::DestroyClientData(const TUint32 aAppUid)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieClientDataArray::DestroyClientData" ) ) );
+ TUint32 groupid = RProcess().SecureId().iId;
+ TInt index = -1;
+ TInt err = FindIndex(groupid,aAppUid,index);
+ if ( err == KErrNone )
+ {
+ Remove(index);
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieClientDataArray::DestroyClientData removed index = %d" ),index ) );
+ return err;
+ }
+//EOF
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerSrc/CookieGroupData.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,457 @@
+/*
+ * CCookieGroupData.cpp
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+
+//System Includes
+#include <e32base.h>
+#include <SysUtil.h>
+#include <e32cmn.h>
+
+//User Includes
+#include "CookieGroupData.h"
+#include "CookieArray.h"
+#include "CookieIPC.h"
+#include "CookieLogger.h"
+//Constants
+
+// Literals
+_LIT( KDefaultCookieFolder, "C:\\Private\\" );
+_LIT( KDefaultCookieFile, "\\Cookies" );
+_LIT( KDefaultExtension, ".dat");
+_LIT( KUnderScore, "_");
+
+//Member Functions
+
+// ---------------------------------------------------------
+// CCookieGroupData::NewL
+// ---------------------------------------------------------
+//
+CCookieGroupData* CCookieGroupData::NewL(TUint32 aGroupId, const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::NewL" ) ) );
+
+ CCookieGroupData* self = CCookieGroupData::NewLC(aGroupId,aAppuid,aCookieSharableFlag);
+ CleanupStack::Pop();
+
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::NewL" ) ) );
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::NewLC
+// ---------------------------------------------------------
+//
+CCookieGroupData* CCookieGroupData::NewLC(TUint32 aGroupId,const RArray<TUint32>& aAppuid,TBool aCookieSharableFlag)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::NewLC" ) ) );
+
+ CCookieGroupData* self = new (ELeave) CCookieGroupData(aGroupId,aCookieSharableFlag);
+ CleanupStack::PushL(self);
+ self->ConstructL(aAppuid);
+
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::NewLC:" ) ) );
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::CCookieGroupData
+// ---------------------------------------------------------
+//
+CCookieGroupData::CCookieGroupData(TUint32 aGroupId, TBool aCookieSharableFlag)
+ :iGroupId(aGroupId),iCookieSharableFlag(aCookieSharableFlag)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::CCookieGroupData:" ) ) );
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::CCookieGroupData:" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::CookieArray
+// ---------------------------------------------------------
+//
+CCookieArray* CCookieGroupData::CookieArray()
+ {
+ return iCookieArray;
+ }
+TInt CCookieGroupData::TotalAppUid()
+ {
+ return iSharedUid.Count();
+ }
+// ---------------------------------------------------------
+// CCookieGroupData::~CCookieGroupData
+// ---------------------------------------------------------
+//
+CCookieGroupData::~CCookieGroupData()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::~CCookieGroupData:" ) ) );
+
+ WriteCookiesToFile();
+ delete iCookieArray;
+ delete iCookieFileName;
+ iStringPool.Close();
+ delete iCookiePacker;
+ iFs.Close();
+ iSharedUid.Close();
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::~CCookieGroupData:" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::StorePersistentCookieL
+// ---------------------------------------------------------
+//
+void CCookieGroupData::StorePersistentCookieL( CCookie* aCookie,
+ const TDesC8& aRequestUri,
+ const TInt aIndex )
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::StorePersistentCookieL:aRequestUri = %S" ), &aRequestUri) );
+
+ if (aIndex == -1)
+ {
+ iCookieArray->AddL( aCookie, aRequestUri);
+ }
+ else
+ {
+ iCookieArray->InsertL( aCookie, aIndex);
+ }
+
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::StorePersistentCookieL:" ) ) );
+
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::Count
+// ---------------------------------------------------------
+//
+TInt CCookieGroupData::Count()const
+ {
+ return iCookieArray->Count();
+ }
+
+TUint32 CCookieGroupData::operator[](TInt aIndex) const
+ {
+ return (iSharedUid[aIndex]);
+ }
+
+// ---------------------------------------------------------
+// CGroupIdInfo::At
+// ---------------------------------------------------------
+//
+TUint32 CCookieGroupData::At(TInt aIndex) const
+ {
+ return (iSharedUid[ aIndex ]);
+ }
+
+// ---------------------------------------------------------
+// CGroupIdInfo::GetSharedUid
+// ---------------------------------------------------------
+//
+TUint32 CCookieGroupData::GetSharedUid(TInt aIndex)
+ {
+ return At(aIndex);
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::ConstructL
+// ---------------------------------------------------------
+//
+void CCookieGroupData::ConstructL(const RArray<TUint32>& aAppuid)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::ConstructL:" ) ) );
+ TInt count = aAppuid.Count();
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::count = %d" ), count ) );
+ for(TInt i=0; i<count; i++)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::aAppuid[%d] = %x " ), aAppuid[i] ) );
+ iSharedUid.AppendL(aAppuid[i]);
+ }
+ iCookieArray = new (ELeave) CCookieArray;
+ iStringPool.OpenL();
+ iCookiePacker = new (ELeave) TCookiePacker( iStringPool );
+ iCookieFileName = HBufC::NewL( KCookieMaxFileNameLength );
+
+ TPtr fileName( iCookieFileName->Des() );
+ fileName.Copy( KDefaultCookieFolder );
+ //fileName.AppendNum( iGroupId, EHex );
+ fileName.AppendNum( RProcess().SecureId(), EHex );
+ TBuf<KMaxFileName> buf(KDefaultCookieFile);
+ buf.Append(KUnderScore);
+ buf.AppendNum(iGroupId,EHex);
+ //For Widget case file name shobe becookie_<sid>_<appuid>.dat
+ if(!iCookieSharableFlag && iSharedUid[0]!=0)
+ {
+ buf.Append(KUnderScore);
+ buf.AppendNum(iSharedUid[0],EHex);
+ }
+ fileName.Append(buf);
+ fileName.Append(KDefaultExtension);
+ if ( iFs.Connect() == KErrNone )
+ {
+ ReadCookiesFromFile();
+ }
+
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData:::ConstructL:" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::ReadCookiesFromFile
+// ---------------------------------------------------------
+//
+TInt CCookieGroupData::ReadCookiesFromFile()
+ {
+ CLOG( ( EServer, 0,_L( "-> CCookieGroupData::ReadCookiesFromFile" ) ) );
+
+ TInt err;
+ if ( iCookieFileName->Length() != 0 )
+ {
+// RFs iFs;
+// User::LeaveIfError(iFs.Connect());
+ RFile file;
+ err = file.Open( iFs, *iCookieFileName,
+ EFileShareExclusive | EFileStream | EFileRead );
+ if ( err == KErrNone ) // the file does exist and could be opened
+ {
+ TInt size;
+ err = file.Size( size );
+ if ( err == KErrNone ) // size query was successful
+ {
+ HBufC8* fileBuffer = HBufC8::New( size );
+ if ( fileBuffer )// there was enough memory for fileBuffer
+ {
+ TPtr8 fileBufferDes( fileBuffer->Des() );
+ err = file.Read( fileBufferDes );
+ if ( err == KErrNone )
+ {
+ // unfortunately this method might leave, because
+ // it allocates memory for cookies dynamically
+ TRAP( err,
+ iCookiePacker->UnpackCookiesFromBufferL
+ ( *fileBuffer, iCookieArray->CookieArray() ) );
+ if ( err != KErrNone )
+ {
+ delete fileBuffer;
+ file.Close();
+ iFs.Delete(*iCookieFileName); //Delete file.
+ //iFs.Close();
+ return KErrNotFound;
+ }
+ }
+
+ delete fileBuffer;
+ }
+ else
+ {
+ err = KErrNoMemory;
+ }
+ }
+
+ file.Close();
+ //iFs.Close();
+ }
+ }
+ else // if iCookieFileName->Length() == 0
+ {
+ err = KErrNotFound;
+ }
+
+ CLOG( ( EServer, 0,_L( "<- CCookieGroupData::ReadCookiesFromFile, errcode%d"), err ) );
+
+ return err;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::WriteCookiesToFile
+// ---------------------------------------------------------
+//
+TInt CCookieGroupData::WriteCookiesToFile()
+ {
+ CLOG( ( EServer, 0,_L( "-> CCookieGroupData::WriteCookiesToFile" ) ) );
+// RFs iFs;
+// User::LeaveIfError(iFs.Connect());
+
+ TInt err(KErrNone);
+ if ( !iCookieArray->Count() )
+ {
+ CLOG( ( EServer, 0,_L( "<- CCookieGroupData::WriteCookiesToFile, errcode%d" ), KErrNone ));
+
+ // delete cookie file
+ err = iFs.Delete( *iCookieFileName );
+ return err;
+ }
+
+ if ( iCookieFileName->Length() != 0 )
+ {
+ if ( CheckDiskSpace( iFs, *iCookieFileName ) )
+ {
+ iFs.CreatePrivatePath( EDriveC );
+ RFile file;
+ iFs.MkDirAll(*iCookieFileName);
+ err = file.Replace( iFs, *iCookieFileName,
+ EFileShareExclusive | EFileStream | EFileWrite );
+ if ( err == KErrNone )
+ {
+ // get the maximum length of cookies
+ TInt cookieCount( iCookieArray->Count() );
+ TInt size( 0 );
+ TInt maxSize( 0 );
+ for( TInt i = 0; i < cookieCount; i++ )
+ {
+ if ( (*iCookieArray)[i]->Persistent() &&
+ !(*iCookieArray)[i]->Expired() )
+ {
+ size = (*iCookieArray)[i]->Size( EFalse );
+ if( size > maxSize )
+ {
+ maxSize = size;
+ }
+ }
+ }
+ maxSize++;
+ CLOG( ( EServer, 0, _L("maxSize: %d"), maxSize ) );
+ // allocate buffer for it
+ HBufC8* fileBuffer = HBufC8::New( maxSize );
+ if ( fileBuffer )
+ {
+ TPtr8 fileBufferDes = fileBuffer->Des();
+
+ // we ignore a possible packing or file writing error
+ // in this loop as these kinds of errors are not fatal
+ // and may not reappear during the next iteration
+ for ( TInt i = 0; i < cookieCount; i++ )
+ {
+ if ( (*iCookieArray)[i]->Persistent() &&
+ !(*iCookieArray)[i]->Expired() )
+ {
+ fileBufferDes.SetLength(0);
+
+ // use CliPackCookie as SrvPackCookie will
+ // suppress the defaulted domain attribute...
+ err = iCookiePacker->CliPackCookie( fileBufferDes,
+ (*(*iCookieArray)[i]) );
+
+ if ( err == KErrNone )
+ {
+ err = file.Write( *fileBuffer );
+ }
+ }
+ }
+
+ delete fileBuffer;
+ }
+ else
+ {
+ err = KErrNoMemory;
+ }
+
+ file.Close();
+ //iFs.Close();
+ }
+ }
+ else // there is not enough disk space
+ {
+ err = KErrDiskFull;
+ }
+ }
+ else // if ( iCookieFileName->Length() == 0 )
+ {
+ err = KErrNotFound;
+ }
+
+ CLOG( ( EServer, 0,
+ _L( "<- CCookieGroupData::WriteCookiesToFile, errcode%d" ), err ) );
+
+ return err;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::CheckDiskSpace
+// ---------------------------------------------------------
+//
+TBool CCookieGroupData::CheckDiskSpace( RFs& aFileSystem,
+ const TDesC& aFileName ) const
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::CheckDiskSpace:" ) ) );
+
+ TInt err;
+ TParse parse;
+ err = parse.SetNoWild( aFileName, NULL, NULL );
+ if ( err == KErrNone )
+ {
+ // This is in the form : drive-letter: (letter + semi-colon)
+ TBuf<2> driveBuf( parse.Drive() );
+ TCharF driveLetter( driveBuf[0] );
+ TCharF driveALetter( 'A' );
+ TDriveNumber driveNum = (TDriveNumber)( (TUint)(driveLetter) -
+ (TUint)(driveALetter) );
+
+ TBool noSpace = EFalse;
+ TRAP( err, noSpace = SysUtil::DiskSpaceBelowCriticalLevelL
+ ( &aFileSystem, KCookieMaxFileLength, driveNum ) );
+ if ( err == KErrNone && noSpace )
+ {
+ err = KErrDiskFull;
+ }
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::CheckDiskSpace:" ) ) );
+
+ return ( err == KErrNone ? ETrue : EFalse );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::ClearCookies
+// ---------------------------------------------------------
+//
+TInt CCookieGroupData::ClearAllCookies()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData::ClearAllCookies:" ) ) );
+
+ TInt count = iCookieArray->ClearAllCookies();
+ iFs.Delete( *iCookieFileName );
+
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::ClearAllCookies:count = %d " ), count ) );
+ return count;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::GetFileName
+// ---------------------------------------------------------
+//
+const TDesC& CCookieGroupData::GetFileName() const
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupData:::GetFileName" ) ) );
+
+ if ( iCookieFileName )
+ {
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::GetFileName:iCookieFileName = %S" ), &iCookieFileName ) );
+ return *iCookieFileName;
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::GetFileName:iCookieFileName = %S" ), &iCookieFileName ) );
+ return KNullDesC();
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupData::SetFileName
+// ---------------------------------------------------------
+//
+void CCookieGroupData::SetFileName(TUint32& aAppUid,TUint32& aSecureId)
+ {
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::SetFileName" ) ) );
+ *iCookieFileName = KNullDesC;
+ TPtr fileName( iCookieFileName->Des() );
+ fileName.Copy( KDefaultCookieFolder );
+ fileName.AppendNum( RProcess().SecureId(), EHex );
+ TBuf<KMaxFileName> buf(KDefaultCookieFile);
+ buf.Append(KUnderScore);
+ buf.AppendNum(aSecureId,EHex);
+ //For Widget case file name shobe becookie_<sid>_<appuid>.dat
+ if(!iCookieSharableFlag && iSharedUid[0]!=0)
+ {
+ buf.Append(KUnderScore);
+ buf.AppendNum(aAppUid,EHex);
+ }
+ fileName.Append(buf);
+ fileName.Append(KDefaultExtension);
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupData::SetFileName" ) ) );
+ }
+//eof
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerSrc/CookieGroupDataArray.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,336 @@
+/*
+ * CCookieGroupDataArray.cpp
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+//System Includes
+#include <e32cmn.h>
+#include <e32base.h>
+
+//User Includes
+#include "CookieGroupDataArray.h"
+#include "CookieGroupData.h"
+#include "GroupIdInfoArray.h"
+#include "CookieArray.h"
+#include "CookieLogger.h"
+
+//Constatnts
+const TInt KCookieArrayGranularity = 10;
+
+
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewL
+// ---------------------------------------------------------
+//
+
+CCookieGroupDataArray* CCookieGroupDataArray::NewL()
+ {
+ CCookieGroupDataArray* self = CCookieGroupDataArray::NewLC();
+ CleanupStack::Pop();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewLC
+// ---------------------------------------------------------
+//
+
+CCookieGroupDataArray* CCookieGroupDataArray::NewLC()
+ {
+ CCookieGroupDataArray* self = new (ELeave) CCookieGroupDataArray();
+ CleanupStack::PushL(self);
+ self->ConstructL();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::ConstructL
+// ---------------------------------------------------------
+//
+
+void CCookieGroupDataArray::ConstructL()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::ConstructL" ) ) );
+ iCookieGroupData = new (ELeave) RPointerArray<CCookieGroupData>(KCookieArrayGranularity);
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::ConstructL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::CCookieGroupDataArray
+// ---------------------------------------------------------
+//
+
+CCookieGroupDataArray::CCookieGroupDataArray()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::CCookieGroupDataArray" ) ) );
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::CCookieGroupDataArray" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::~CCookieGroupDataArray
+// ---------------------------------------------------------
+//
+
+CCookieGroupDataArray::~CCookieGroupDataArray()
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::~CCookieGroupDataArray" ) ) );
+ if(iCookieGroupData && Count())
+ {
+ iCookieGroupData->ResetAndDestroy();
+ iCookieGroupData->Close();
+ //delete iCookieGroupData;
+ iCookieGroupData = NULL;
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::~CCookieGroupDataArray" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::Count
+// ---------------------------------------------------------
+//
+TInt CCookieGroupDataArray::Count()const
+ {
+ return iCookieGroupData->Count();
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::FindIndex
+// ---------------------------------------------------------
+//
+TInt CCookieGroupDataArray::FindIndex(TUint32 aGroupId,TInt& aIndex )
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::FindIndex aGroupId = %x" ), aGroupId ) );
+ TInt count = Count();
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::count = %d" ), count ) );
+ for(TInt i=0;i<count;i++)
+ {
+ CCookieGroupData* p = At(i);
+ if( p->GetGroupId() == aGroupId)
+ {
+ aIndex=i;
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::FindIndex found for GroupId %x with Index = %d" )
+ , aGroupId,aIndex ) );
+ return KErrNone;
+ }
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::FindIndex NotFound for GroupId %x with Index = %d" )
+ , aGroupId ,aIndex) );
+ return KErrNotFound;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::FindIndex
+// ---------------------------------------------------------
+//
+TInt CCookieGroupDataArray::FindIndex(TUint32 aGroupId,TUint32 aAppUid,TInt& aIndex )
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::FindIndex aGroupId = %x,aAppUid = %x" ), aGroupId, aAppUid ) );
+ TInt count = Count();
+ for(TInt i=0;i<count;i++)
+ {
+ CCookieGroupData* p = At(i);
+ TInt appCount = p->TotalAppUid();
+ TInt appUidFound(EFalse);
+ if( p->GetGroupId() == aGroupId)
+ {
+ for(TInt j=0; j<appCount; j++)
+ {
+ if (p->GetSharedUid(j)== aAppUid)
+ appUidFound = ETrue;
+ break;
+ }
+ if (appUidFound)
+ {
+ aIndex=i;
+ return KErrNone;
+ }
+ }
+ }
+ return KErrNotFound;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::Compress
+// ---------------------------------------------------------
+//
+void CCookieGroupDataArray::AddGroupDataL(CCookieGroupData* aCcookieGroupData)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::AddGroupDataL" ) ) );
+ iCookieGroupData->AppendL(aCcookieGroupData);
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::AddGroupDataL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::Compress
+// ---------------------------------------------------------
+//
+void CCookieGroupDataArray::Compress()
+ {
+ iCookieGroupData->Compress();
+ }
+
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::operator[]
+// ---------------------------------------------------------
+//
+CCookieGroupData* CCookieGroupDataArray::operator[](TInt aIndex) const
+ {
+ return (*iCookieGroupData)[aIndex];
+ }
+
+ // ---------------------------------------------------------
+ // CCookieGroupDataArray::GetGroupData
+ // ---------------------------------------------------------
+ //
+CCookieGroupData* CCookieGroupDataArray::At(TInt aIndex) const
+ {
+ return (*iCookieGroupData)[ aIndex ];
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetGroupData
+// ---------------------------------------------------------
+//
+CCookieGroupData* CCookieGroupDataArray::GetGroupData(TInt aIndex)
+ {
+ return(At(aIndex));
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetGroupDataIndexL
+// ---------------------------------------------------------
+//
+void CCookieGroupDataArray::GetGroupDataIndexL(TUint32 aGroupId,TUint32 aAppUid,TBool& aCookieSharableFlag, TInt& aIndex)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::GetGroupDataIndexL aGroupId = %x, aAppUid = %x" ), aGroupId, aAppUid ) );
+ TInt count = Count();
+ TBool found(EFalse);
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::GetGroupDataIndexL count = %d" ), count ) );
+ if ( count == 0 )
+ {
+ RArray<TUint32> appUidArray(1);
+ appUidArray.Append(aAppUid);
+ CCookieGroupData* cookiegroupdata = CCookieGroupData::NewL(aGroupId,appUidArray,aCookieSharableFlag);
+ CleanupStack::PushL( cookiegroupdata );
+ AddGroupDataL(cookiegroupdata);
+ aIndex = 0;
+ CleanupStack::Pop(cookiegroupdata);
+ appUidArray.Close();
+ } else {
+
+ TInt totalappUid = iCookieGroupData->Count();
+ for ( TInt i=0; i<count; i++ )
+ {
+ CCookieGroupData* cookiegroupdata = At(i);
+ if ( cookiegroupdata->GetGroupId() == aGroupId && !(cookiegroupdata->GetCookieSharableFlag()) )
+ {
+ found = ETrue;
+ aIndex = i;
+ break;
+ }else if (cookiegroupdata->GetGroupId() == aGroupId && (cookiegroupdata->GetCookieSharableFlag()))
+ {
+ TBool groupMatch(ETrue);
+ TBool sharedUidMatch(EFalse);
+ TInt total = cookiegroupdata->TotalAppUid();
+ for(TInt j=0;j<total;j++)
+ {
+ if (cookiegroupdata->GetSharedUid(j)== aAppUid)
+ {
+ sharedUidMatch = ETrue;
+ break;
+ }
+ }
+ if (groupMatch || sharedUidMatch)
+ {
+ found = ETrue;
+ aIndex = i;
+ break;
+ }
+ }
+
+
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::GetGroupDataIndexL aGroupId %x and aAppUid %x found at index %d" ), aGroupId, aAppUid, aIndex ) );
+ }
+ }
+ if(!found)
+ {
+ RArray<TUint32> appUidArray(1);
+ appUidArray.Append(aAppUid);
+ CCookieGroupData* cookiegroupdata = CCookieGroupData::NewL(aGroupId, appUidArray, aCookieSharableFlag);
+ CleanupStack::PushL( cookiegroupdata );
+ AddGroupDataL(cookiegroupdata);
+ TInt total = Count();
+ aIndex = total-1;
+ CleanupStack::Pop(cookiegroupdata);
+ appUidArray.Close();
+ }
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::GetGroupDataIndexL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::CookieArray
+// ---------------------------------------------------------
+//
+CCookieArray* CCookieGroupDataArray::CookieArray(TInt aIndex)
+ {
+ CCookieGroupData* cookiegroupdata = At(aIndex);
+ return cookiegroupdata->CookieArray();
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetCookies
+// ---------------------------------------------------------
+//
+TInt CCookieGroupDataArray::GetCookies( const TDesC8& aRequestUri,
+ RPointerArray<CCookie>& aCookies,TInt aIndex ) const
+ {
+ CCookieArray* cookieArray = At(aIndex)->CookieArray();
+ return cookieArray->GetCookies( aRequestUri, aCookies );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::Remove
+// ---------------------------------------------------------
+//
+void CCookieGroupDataArray::Remove(TInt aIndex)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray:: Remove %d" ), aIndex ) );
+ delete (*iCookieGroupData)[ aIndex ];
+ iCookieGroupData->Remove(aIndex);
+ iCookieGroupData->Compress();
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::Remove " ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::DestroyGroupData
+// ---------------------------------------------------------
+//
+TInt CCookieGroupDataArray::DestroyGroupData(TUint32 aGroupId)
+ {
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::DestroyGroupData aGroupId = %x" ), aGroupId ) );
+ TInt count = Count();
+ CLOG( ( EClient, 0, _L( "-> CCookieGroupDataArray::DestroyGroupData count = %d" ), count ) );
+ if (count == 0)
+ {
+ return KErrNotFound;
+ }
+
+ TBool found(EFalse);
+ for (TInt i=0; i<count; i++)
+ {
+ CCookieGroupData* cookiegroupdata = At(i);
+ if ( cookiegroupdata->GetGroupId() == aGroupId)
+ {
+ found = ETrue;
+ Remove(i);
+ --i;
+ --count;
+ CLOG( ( EClient, 0, _L( "<- CCookieGroupDataArray::DestroyGroupData aGroupId = %x removed from Array" ), aGroupId ) );
+ }
+ }
+ if ( found )
+ return KErrNone;
+ else
+ return KErrNotFound;
+ }
--- a/httpfilters/cookie/ManagerSrc/CookieManagerClient.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/CookieManagerClient.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -23,6 +23,7 @@
// User includes
#include "cookie.h"
+#include "CookieArray.h"
#include "cookieipc.h"
#include "CookieCommonConstants.h"
#include "CookieLogger.h"
@@ -30,9 +31,9 @@
#include "CookieManagerServer.h"
#include "CookieManagerStart.h"
#include "CookieServerDef.h"
-
+#include "CookieClientDataArray.h"
+#include "CookieClientData.h"
// CONSTANTS
-
// TBD : do we have to set limits to the number of cookies at all?
// Possible answer : as we store cookies in an RPointerArray that has a
// restriction on the number of elements (max. 640 can be stored in an RArray
@@ -80,7 +81,7 @@
EXPORT_C TInt RCookieManager::Connect()
{
CLOG( ( EClientConnect, 0, _L( "-> RCookieManager::Connect" ) ) );
-
+ CCookieClientDataArray::GetInstance()->Ref();
TInt error = KErrNone;
RProcess server;
error = server.Create( KCookieServerExe, TPtr( NULL, 0 ),
@@ -116,7 +117,7 @@
}
// ---------------------------------------------------------
-// RCookieManager::GetCookies
+// RCookieManager::DoGetCookies
// ---------------------------------------------------------
//
TInt RCookieManager::DoGetCookies( TDes8& aBuffer ) const
@@ -125,25 +126,53 @@
}
// ---------------------------------------------------------
-// RCookieManager::GetCookieSize
+// RCookieManager::GetCookieSharableFlagFromServer
+// ---------------------------------------------------------
+//
+TInt RCookieManager::GetCookieSharableFlagFromServer(TBool& aCookieSharableFlag )const
+ {
+ TPckg<TBool> cookieSharableFlag(aCookieSharableFlag);
+ return SendReceive( EGetCookieSharableFlag, TIpcArgs( &cookieSharableFlag ) );
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::DoGetCookieSize
// ---------------------------------------------------------
//
TInt RCookieManager::DoGetCookieSize( const TDesC8& aRequestUri,
- TPckg<TInt>& aPkgSize ) const
+ TPckg<TInt>& aPkgSize,TDesC& aAppuidPtr ) const
{
- return SendReceive( EGetCookieSize, TIpcArgs( aRequestUri.Length(),
+ return SendReceive( EGetCookieSize, TIpcArgs( &aAppuidPtr,aRequestUri.Length(),
&aRequestUri, &aPkgSize ) );
}
+// ---------------------------------------------------------
+// RCookieManager::DestroyCookiesFromMemory
+// ---------------------------------------------------------
+//
+TInt RCookieManager::DestroyCookiesFromMemory( TInt& aDeleteStatus )
+ {
+ CLOG(( EClient, 0, _L("-> RCookieManager::DestroyCookies") ));
+
+ TPckg<TInt> pkgStatus( aDeleteStatus );
+ TInt ret = SendReceive( EDestroyCookies, TIpcArgs( &pkgStatus ) ) ;
+
+ CLOG(( EClient, 0,
+ _L("<- RCookieManager::DestroyCookies cleared %d cookies, errcode%d"),
+ aDeleteStatus, ret ) );
+
+ return ret;
+
+ }
// ---------------------------------------------------------
// RCookieManager::DoStoreCookie
// ---------------------------------------------------------
//
TInt RCookieManager::DoStoreCookie( const TDesC8& aPackedCookie,
- const TDesC8& aUri ) const
+ const TDesC8& aUri,TDesC& aAppUidPtr ) const
{
return SendReceive( EStoreCookie, TIpcArgs( aPackedCookie.Length(),
- &aPackedCookie, aUri.Length(), &aUri ) );
+ &aPackedCookie, &aUri,&aAppUidPtr ) );
}
// ---------------------------------------------------------
@@ -155,13 +184,30 @@
TBool& aCookie2Reqd )
{
CLOG( ( EClient, 0, _L( "-> RCookieManager::GetCookiesL" ) ) );
+ TBool cookiefound(EFalse);
+ CCookieClientDataArray* cookieclientdataarray = CCookieClientDataArray::GetInstance();
+ if(cookieclientdataarray) // redundant check
+ {
+ TInt clientarraycount = cookieclientdataarray->Count();
+ if ( clientarraycount!=0 )
+ {
+ TInt clerr = GetClientSideCookies(aUri,aCookies,cookiefound,0);
+ }
+ }
+ if(!cookiefound)
+ {
aCookie2Reqd = EFalse;
TInt size = 0;
TPckg<TInt> pkgSize( size );
- User::LeaveIfError( DoGetCookieSize( aUri, pkgSize ) );
-
+ //Appuid value only takes 8 chars
+ HBufC* appbuf = HBufC::New(8);
+ TPtr ptr(appbuf->Des());
+ TUint32 appUid(0);
+ ptr.AppendNum(appUid,EHex);
+ User::LeaveIfError( DoGetCookieSize( aUri, pkgSize,ptr ) );
+ delete appbuf;
if ( size )
{
HBufC8* buf = HBufC8::NewLC( size );
@@ -196,7 +242,7 @@
CleanupStack::PopAndDestroy(); // buf
}
-
+ }
CLOG( ( EClient, 0, _L( "<- RCookieManager::GetCookiesL" ) ) );
}
@@ -223,7 +269,14 @@
err = iCookiePacker.CliPackCookie( bufDes, aCookie );
if ( !err )
{
- err = DoStoreCookie( *buf, aUri.UriDes() );
+ //Appuid value only takes 8 chars
+ HBufC* appbuf = HBufC::New(8); // harendra: 8 chars needed
+ TPtr ptr(appbuf->Des());
+ TUint32 appUid(0);
+ ptr.AppendNum(appUid,EHex);
+ err = DoStoreCookie( *buf, aUri.UriDes(),ptr );
+ delete appbuf;
+ //err = DoStoreCookie( *buf, aUri.UriDes() );
}
delete buf;
@@ -253,13 +306,30 @@
}
// ---------------------------------------------------------
-// RCookieManager::SetAppUidL
+// RCookieManager::SetAppUidL This method is no longer being
+// used in CookieFilter.As this method is exported so in order
+// to provide backward compatibilty this API implementation is changed
// ---------------------------------------------------------
//
EXPORT_C TInt RCookieManager::SetAppUidL( const TUint32& aAppUid )
{
CLOG(( EClient, 0, _L("->RCookieManager::SetAppUid") ));
- HBufC* buf = HBufC::NewLC(128);
+ TUint32 groupid = RProcess().SecureId().iId;
+ CCookieClientData* cookieclientdata = CCookieClientDataArray::GetInstance()->Find(groupid, const_cast<TUint32&> (aAppUid));
+ if(cookieclientdata)
+ {
+ cookieclientdata->SetWidgetUid(aAppUid);
+ }
+ else
+ {
+ TBool cookieSharableFlag(EFalse);
+ TInt err = GetCookieSharableFlagFromServer(cookieSharableFlag);
+ CCookieClientData* cookieclientdata = CCookieClientData::NewL(groupid, aAppUid, cookieSharableFlag,ETrue);
+ cookieclientdata->SetInitFlag(ETrue);
+ CCookieClientDataArray::GetInstance()->AddClientGroupDataL(cookieclientdata);
+ }
+ //Appuid value only takes 8 chars
+ HBufC* buf = HBufC::NewLC(8);
TPtr ptr(buf->Des());
ptr.AppendNum(aAppUid,EHex);
TInt error = SendReceive(ESetAppUid,TIpcArgs(ptr.Length(),&ptr));
@@ -267,4 +337,255 @@
CLOG(( EClient, 0, _L("<-RCookieManager::SetAppUid") ));
return error;
}
+// ---------------------------------------------------------
+// RCookieManager::Close
+// ---------------------------------------------------------
+//
+
+EXPORT_C void RCookieManager::Close()
+ {
+ CLOG(( EClient, 0, _L("-> RCookieManager::Close") ));
+ CCookieClientDataArray::GetInstance()->DeRef();
+ TInt deletestatus =0;
+ DestroyCookiesFromMemory(deletestatus);
+ CLOG(( EClient, 0, _L("-> RCookieManager::Close deletestatus = %d"), deletestatus ));
+ RSessionBase::Close();
+ CLOG(( EClient, 0, _L("<- RCookieManager::Close") ));
+ }
+// ---------------------------------------------------------
+// RCookieManager::StoreCookie Newly Added
+// ---------------------------------------------------------
+//
+EXPORT_C TInt RCookieManager::StoreCookie( const CCookie& aCookie,
+ const TUriC8& aUri,TUint32& aAppUid )
+ {
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::StoreCookie" ) ) );
+ StoreCookieAtClientSide(&aCookie,aUri.UriDes(),aAppUid);
+ TInt err;
+
+ TInt cookieSize = aCookie.Size( EFalse );
+ HBufC8* buf = HBufC8::New( cookieSize );
+ if ( buf )
+ {
+ CLOG( ( EClient, 0,
+ _L( "RCookieManager::StoreCookie, cookie size:%d" ),
+ cookieSize ) );
+
+ TPtr8 bufDes( buf->Des() );
+ err = iCookiePacker.CliPackCookie( bufDes, aCookie );
+
+ if ( !err )
+ {
+ //Appuid value only takes 8 chars
+ HBufC* appbuf = HBufC::New(8);
+ TPtr ptr(appbuf->Des());
+ ptr.AppendNum(aAppUid,EHex);
+ err = DoStoreCookie( *buf, aUri.UriDes(),ptr );
+ delete appbuf;
+ }
+
+ delete buf;
+ }
+ else
+ {
+ err = KErrNoMemory;
+ }
+
+ CLOG( ( EClient, 0,
+ _L( "<- RCookieManager::StoreCookie errcode%d" ), err ) );
+
+ return err;
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::GetCookiesL Newly Added
+// ---------------------------------------------------------
+//
+EXPORT_C void RCookieManager::GetCookiesL( const TDesC8& aUri,
+ RPointerArray<CCookie>& aCookies,
+ TBool& aCookie2Reqd,TUint32& aAppUid )
+ {
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::GetCookiesL" ) ) );
+ TBool cookiefound(EFalse);
+ CCookieClientDataArray* cookieclientdataarray = CCookieClientDataArray::GetInstance();
+ if(cookieclientdataarray)
+ {
+ TInt clientarraycount = cookieclientdataarray->Count();
+ if (clientarraycount == 0)
+ {
+ TUint32 groupid = RProcess().SecureId().iId;
+ TBool cookieSharableFlag(EFalse);
+ TInt err = GetCookieSharableFlagFromServer(cookieSharableFlag);
+ CCookieClientData* cookieclientdata = CCookieClientData::NewL(groupid, aAppUid, cookieSharableFlag,ETrue);
+ cookieclientdata->SetInitFlag(ETrue);
+ cookieclientdataarray->AddClientGroupDataL(cookieclientdata);
+ }
+ else
+ {
+
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::GetClientSideCookies:" ) ) );
+ //Gets the Cookie objects for aUri in case it is present
+ //TInt clerr = cookieclientdata->GetClientSideCookies(aUri,aCookies,cookiefound);
+ TInt clerr = GetClientSideCookies(aUri,aCookies,cookiefound,aAppUid);
+ CLOG( ( EClient, 0, _L( "RCookieManager::GetClientSideCookies:cookiefound = %d" ), cookiefound ) );
+
+ }
+ }
+ if(!cookiefound)
+ {
+ aCookie2Reqd = EFalse;
+ //Appuid value only takes 8 chars
+ HBufC* appuidbuf = HBufC::NewL(8);
+ TPtr ptr(appuidbuf->Des());
+ ptr.AppendNum(aAppUid,EHex);
+ TInt size = 0;
+ TPckg<TInt> pkgSize( size );
+ User::LeaveIfError( DoGetCookieSize( aUri, pkgSize, ptr ) );
+ delete appuidbuf;
+ if ( size )
+ {
+ HBufC8* buf = HBufC8::NewLC( size );
+
+ TPtr8 des( buf->Des() );
+ User::LeaveIfError( DoGetCookies( des ) );
+
+ // it seems this is the only place where we cannot avoid leaving
+ // ==> we allocate memory for cookies when we fill up the cookie array.
+ iCookiePacker.UnpackCookiesFromBufferL( *buf, aCookies );
+
+ TInt count = aCookies.Count();
+ for(TInt j=0; j<count; j++)
+ {
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::StoreClientSideCookies: aUri=%S" ), &aUri ) );
+ //cookieclientdata->StoreCookieAtClientSide( aCookies[j],aUri );
+ StoreCookieAtClientSide( aCookies[j],aUri,aAppUid );
+ }
+ TInt i = 0;
+ TBool anyCookie2( EFalse );
+ TBool anyUnknownVersion( EFalse );
+ for ( ; i < count; i++ )
+ {
+ if ( aCookies[i]->FromCookie2() )
+ {
+ anyCookie2 = ETrue;
+ anyUnknownVersion |= aCookies[i]->IsUnknownVersion();
+ }
+ }
+
+ // if there were no new-style cookies or a new version info is detected
+ // then we have to send an extra cookie header indicating that we're
+ // able to process new-style cookies
+ if ( !anyCookie2 || anyUnknownVersion )
+ {
+ aCookie2Reqd = ETrue;
+ }
+
+ CleanupStack::PopAndDestroy(); // buf
+ }
+ }
+ CLOG( ( EClient, 0, _L( "<- RCookieManager::GetCookiesL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::Close for Widget related destruction during
+//uninstallation process of a widget
+// ---------------------------------------------------------
+//
+EXPORT_C TInt RCookieManager::ClearAllAppUidCookies(const TUint32& aAppUid)
+ {
+ CLOG(( EClient, 0, _L("-> RCookieManager::ClearCookies") ));
+ //Client side cookie deletion specific to a appuid
+ CCookieClientDataArray::GetInstance()->DestroyClientData(aAppUid);
+ //Server side Cookie deletion specific to a appuid
+ //Appuid value only takes 8 chars
+ HBufC* buf = HBufC::NewLC(8);
+ TPtr ptr(buf->Des());
+ ptr.AppendNum(aAppUid,EHex);
+ TInt error = SendReceive(EClearAppUidCookies,TIpcArgs(ptr.Length(),&ptr));
+ CleanupStack::PopAndDestroy();
+ return error;
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::StoreCookieAtClientSide
+// ---------------------------------------------------------
+//
+void RCookieManager::StoreCookieAtClientSide( const CCookie* aCookie, const TDesC8& aUri,TUint32 aWidgetUid )
+ {
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::StoreCookieAtClientSide" ) ) );
+ TUint32 groupid = RProcess().SecureId().iId;
+ CCookieClientDataArray* cookieclientdataarray = CCookieClientDataArray::GetInstance();
+ TInt count = cookieclientdataarray->Count();
+ TInt itemIndex =0;
+ for(TInt i=0; i<count; i++)
+ {
+ if (cookieclientdataarray->At(i)->GetGroupId() == groupid
+ && cookieclientdataarray->At(i)->GetCookieSharableFlag())
+ {
+ itemIndex = i;
+ break;
+ }
+ else if(cookieclientdataarray->At(i)->GetGroupId() == groupid
+ && !(cookieclientdataarray->At(i)->GetCookieSharableFlag())
+ && cookieclientdataarray->At(i)->GetWidgetUid() == aWidgetUid)
+ {
+ itemIndex = i;
+ break;
+ }
+ }
+ CCookieClientData* cookieclientdata = cookieclientdataarray->At(itemIndex);
+ cookieclientdata->StoreCookieAtClientSideL(aCookie,aUri);
+ CLOG( ( EClient, 0, _L( "<- RCookieManager::StoreCookieAtClientSide" ) ) );
+ }
+
+// ---------------------------------------------------------
+// RCookieManager::GetClientSideCookies
+// ---------------------------------------------------------
+//
+TInt RCookieManager::GetClientSideCookies( const TDesC8& aRequestUri,RPointerArray<CCookie>& aCookies
+ ,TBool& aCookieFound, TUint32 aWidgetUid )
+ {
+ CLOG( ( EClient, 0, _L( "-> RCookieManager::GetClientSideCookies" ) ) );
+ TUint32 groupid = RProcess().SecureId().iId;
+ //TInt itemIndex =0;
+ CCookieClientData* cookieclientdata = NULL;
+ CCookieClientDataArray* cookieclientdataarray = CCookieClientDataArray::GetInstance();
+ TInt count = cookieclientdataarray->Count();
+ if (count == 0)
+ {
+ TBool cookieSharableFlag(EFalse);
+ TInt err = GetCookieSharableFlagFromServer(cookieSharableFlag);
+ cookieclientdata = CCookieClientData::NewL(groupid, aWidgetUid, cookieSharableFlag,ETrue);
+ cookieclientdata->SetInitFlag(ETrue);
+ cookieclientdataarray->AddClientGroupDataL(cookieclientdata);
+ } else
+ {
+ //harendra: move this for loop in CCookieClientDataArray::Find(), it should index or object
+ cookieclientdata = cookieclientdataarray->Find(groupid, aWidgetUid);
+ }
+ if(cookieclientdata)
+ {
+ if(!cookieclientdata->GetInitFlag())
+ {
+ TBool cookieSharableFlag(EFalse);
+ TInt err = GetCookieSharableFlagFromServer(cookieSharableFlag);
+ cookieclientdata->SetCookieCookieSharableFlag(cookieSharableFlag);
+ }
+ //cookieclientdata->SetInitFlag(ETrue);
+ return cookieclientdata->GetClientSideCookies( aRequestUri,aCookies, aCookieFound );
+ } else
+ {
+ TBool cookieSharableFlag(EFalse);
+ TInt err = GetCookieSharableFlagFromServer(cookieSharableFlag);
+ if(err == KErrNone)
+ {
+ CCookieClientData* cookieclientdata
+ = CCookieClientData::NewL(groupid, aWidgetUid, cookieSharableFlag,ETrue);
+ cookieclientdataarray->AddClientGroupDataL(cookieclientdata);
+ }
+ }
+ CLOG( ( EClient, 0, _L( "<- RCookieManager::GetClientSideCookies" ) ) );
+ return KErrNone;
+ }
+
// End of file
--- a/httpfilters/cookie/ManagerSrc/CookieManagerServer.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/CookieManagerServer.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -22,6 +22,14 @@
#include <e32std.h>
#include <sysutil.h>
+#include <BAUTILS.H>
+#include <XmlEngDOMImplementation.h>
+#include <xmlengdocument.h>
+#include <xmlengdomparser.h>
+#include <xmlengattr.h>
+#include <xmlengnodelist.h>
+#include <xmlengelement.h>
+
// #include <thttphdrval.h>
// User includes
@@ -32,6 +40,9 @@
#include "CookieManagerServer.h"
#include "CookieManagerSession.h"
#include "CookieServerDef.h"
+#include "CookieGroupDataArray.h"
+#include "GroupIdInfoArray.h"
+#include "CookieGroupData.h"
// CONSTANTS
@@ -50,7 +61,7 @@
#endif
// This means 128 characters, considering Unicode
-const TInt KCookieMaxFileNameLength = 256;
+//const TInt KCookieMaxFileNameLength = 256;
// Maximum file length
//const TInt KCookieMaxFileLength = 204800; // 200 kilobytes
@@ -58,12 +69,20 @@
// Literals
_LIT( KDefaultCookieFolder, "C:\\Private\\" );
+_LIT( KDefaultCookieXmlFolder, "Z:\\Private\\" );
_LIT( KDefaultCookieFile, "\\Cookies" );
_LIT( KDefaultExtension, ".dat");
_LIT( KUnderScore, "_");
+_LIT8(KHexDel,"0x");
+_LIT( KDefaultCookieGroupFile, "\\CookieGroup.xml" );
+_LIT8(KGroupId,"id");
+_LIT8(KUid3,"uid3");
+_LIT8(KCookieSharable,"cookie_apps_share");
+_LIT8(KGroupName,"name");
+_LIT8(KOff,"off");
// capability checking structures
-const TUint cookieServerPolicyRangeCount = 6;
+const TUint cookieServerPolicyRangeCount = 9;
// server messages
const TInt cookieServerPolicyRanges[ cookieServerPolicyRangeCount ] =
@@ -73,7 +92,10 @@
2, // EGetCookieSize
3, // EGetCookies
4, // ESetAppUid
- 5
+ 5, //EDestroyCookies
+ 6, //EGetCookieSharableFlag
+ 7, //EClearAppUidCookies
+ 8
};
// connection between messages and events
@@ -84,6 +106,9 @@
1, // EGetCookieSize
1, // EGetCookies
0, // ESetAppUid
+ 0, // EDestroyCookies
+ 0, //EGetCookieSharableFlag
+ 0, //EClearAppUidCookies
CPolicyServer::ENotSupported // applies all out of range requests
};
@@ -131,22 +156,28 @@
iStringPool.OpenL();
- iCookiePacker = new (ELeave) TCookiePacker( iStringPool );
-
- iCookieFileName = HBufC::NewL( KCookieMaxFileNameLength );
-
- iPersistentCookies = new (ELeave) CCookieArray;
-
- TPtr fileName( iCookieFileName->Des() );
+ //iCookiePacker = new (ELeave) TCookiePacker( iStringPool );
+ iCookieGroupDataArray = CCookieGroupDataArray::NewL();
+ iGroupIdArray = CGroupIdArray::NewL();
- fileName.Copy( KDefaultCookieFolder );
- fileName.AppendNum( RProcess().SecureId(), EHex );
- fileName.Append( KDefaultCookieFile );
- fileName.Append( KDefaultExtension );
-
+ RFs iFs;
if ( iFs.Connect() == KErrNone ) // we could connect to the file server
- ReadCookiesFromFile();
-
+ {
+ TBuf<60> groupfilePath(KNullDesC);
+ groupfilePath.Copy( KDefaultCookieXmlFolder );
+ groupfilePath.AppendNum( RProcess().SecureId(), EHex );
+ groupfilePath.Append( KDefaultCookieGroupFile );
+ if ( BaflUtils::FileExists( iFs, groupfilePath ) )
+ {
+ TRAPD(ret, LoadGroupDataFromFileL(iFs) );
+ if( ret != KErrNone )
+ {
+ CLOG( ( EServer, 0, _L( "CCookieManagerServer::ConstructL: Loading Group data Failed" ) ) );
+ //Do Nothing
+ }
+ }
+ iFs.Close();
+ }
StartL( KCookieServerName );
CLOG( ( EServer, 0, _L( "<- CCookieManagerServer::ConstructL" ) ) );
@@ -180,20 +211,26 @@
//
CCookieManagerServer::~CCookieManagerServer()
{
+ CLOG( ( EServer, 0, _L( "-> CCookieManagerServer::~CCookieManagerServer" ) ) );
iServerClosing = ETrue;
- delete iPersistentCookies;
+ // delete iPersistentCookies;
- delete iCookieFileName;
+ //delete iCookieFileName;
- iFs.Close();
+ //iFs.Close();
iStringPool.Close();
-
- delete iCookiePacker;
+// delete iCookiePacker;
+ if(iCookieGroupDataArray)
+ {
+ delete iCookieGroupDataArray;
+ iCookieGroupDataArray = NULL;
+ }
+ delete iGroupIdArray;
delete iCloseTimer;
- CLOG( ( EServer, 0, _L( "CCookieManagerServer::~CCookieManagerServer") ) );
+ CLOG( ( EServer, 0, _L( "<-CCookieManagerServer::~CCookieManagerServer") ) );
CLOG( ( EServer, 0, _L( "*****************" ) ) );
}
@@ -277,199 +314,17 @@
// e.g. 1 minute before doing so as starting a server is expensive
// in many ways.
CLOG( ( EServer, 0, _L( "Closing Server" ) ) );
- iPersistentCookies->RemoveNonPersistent();
+ //iPersistentCookies->RemoveNonPersistent();
iCloseTimer->After( KCookieCloseTime );
//just write cookies back to the file when browser is closed,
//no need wait till cookie server is shutdown.
- WriteCookiesToFile();
+ //WriteCookiesToFile();
}
CLOG( ( EServer, 0, _L( "<- CCookieManagerServer::CloseSession" ) ) );
}
-// ---------------------------------------------------------
-// CCookieManagerServer::ReadCookiesFromFile
-// ---------------------------------------------------------
-//
-TInt CCookieManagerServer::ReadCookiesFromFile()
- {
- CLOG( ( EServer, 0,
- _L( "-> CCookieManagerServer::ReadCookiesFromFile" ) ) );
-
- TInt err;
- if ( iCookieFileName->Length() != 0 )
- {
- RFile file;
- err = file.Open( iFs, *iCookieFileName,
- EFileShareExclusive | EFileStream | EFileRead );
- if ( err == KErrNone ) // the file does exist and could be opened
- {
- TInt size;
- err = file.Size( size );
- if ( err == KErrNone ) // size query was successful
- {
- HBufC8* fileBuffer = HBufC8::New( size );
- if ( fileBuffer )// there was enough memory for fileBuffer
- {
- TPtr8 fileBufferDes( fileBuffer->Des() );
- err = file.Read( fileBufferDes );
- if ( err == KErrNone )
- {
- // unfortunately this method might leave, because
- // it allocates memory for cookies dynamically
- TRAP( err,
- iCookiePacker->UnpackCookiesFromBufferL
- ( *fileBuffer, iPersistentCookies->CookieArray() ) );
- if ( err != KErrNone )
- {
- delete fileBuffer;
- file.Close();
- iFs.Delete(*iCookieFileName); //Delete file.
- return KErrNotFound;
- }
- }
-
- delete fileBuffer;
- }
- else
- {
- err = KErrNoMemory;
- }
- }
-
- file.Close();
- }
- }
- else // if iCookieFileName->Length() == 0
- {
- err = KErrNotFound;
- }
-
- CLOG( ( EServer, 0,
- _L( "<- CCookieManagerServer::ReadCookiesFromFile, errcode%d"),
- err ) );
-
- return err;
- }
-
-// ---------------------------------------------------------
-// CCookieManagerServer::WriteCookiesToFile
-// ---------------------------------------------------------
-//
-TInt CCookieManagerServer::WriteCookiesToFile()
- {
- CLOG( ( EServer, 0,
- _L( "-> CCookieManagerServer::WriteCookiesToFile" ) ) );
-
- TInt err(KErrNone);
- if ( !iPersistentCookies->Count() )
- {
- CLOG( ( EServer, 0,
- _L( "<- CCookieManagerServer::WriteCookiesToFile, errcode%d" ),
- KErrNone ));
-
- // delete cookie file
- err = iFs.Delete( *iCookieFileName );
- return err;
- }
-
- if ( iCookieFileName->Length() != 0 )
- {
- if ( CheckDiskSpace( iFs, *iCookieFileName ) )
- {
- iFs.CreatePrivatePath( EDriveC );
- RFile file;
- iFs.MkDirAll(*iCookieFileName);
- err = file.Replace( iFs, *iCookieFileName,
- EFileShareExclusive | EFileStream | EFileWrite );
- if ( err == KErrNone )
- {
- // get the maximum length of cookies
- TInt cookieCount( iPersistentCookies->Count() );
- TInt size( 0 );
- TInt maxSize( 0 );
- for( TInt i = 0; i < cookieCount; i++ )
- {
- if ( (*iPersistentCookies)[i]->Persistent() &&
- !(*iPersistentCookies)[i]->Expired() )
- {
- size = (*iPersistentCookies)[i]->Size( EFalse );
- if( size > maxSize )
- {
- maxSize = size;
- }
- }
- }
- maxSize++;
- CLOG( ( EServer, 0, _L("maxSize: %d"), maxSize ) );
- // allocate buffer for it
- HBufC8* fileBuffer = HBufC8::New( maxSize );
- if ( fileBuffer )
- {
- TPtr8 fileBufferDes = fileBuffer->Des();
-
- // we ignore a possible packing or file writing error
- // in this loop as these kinds of errors are not fatal
- // and may not reappear during the next iteration
- for ( TInt i = 0; i < cookieCount; i++ )
- {
- if ( (*iPersistentCookies)[i]->Persistent() &&
- !(*iPersistentCookies)[i]->Expired() )
- {
- fileBufferDes.SetLength(0);
-
- // use CliPackCookie as SrvPackCookie will
- // suppress the defaulted domain attribute...
- err = iCookiePacker->CliPackCookie( fileBufferDes,
- (*(*iPersistentCookies)[i]) );
-
- if ( err == KErrNone )
- {
- err = file.Write( *fileBuffer );
- }
- }
- }
-
- delete fileBuffer;
- }
- else
- {
- err = KErrNoMemory;
- }
-
- file.Close();
- }
- }
- else // there is not enough disk space
- {
- err = KErrDiskFull;
- }
- }
- else // if ( iCookieFileName->Length() == 0 )
- {
- err = KErrNotFound;
- }
-
- CLOG( ( EServer, 0,
- _L( "<- CCookieManagerServer::WriteCookiesToFile, errcode%d" ), err ) );
-
- return err;
- }
-
-// ---------------------------------------------------------
-// CCookieManagerServer::ClearCookies
-// ---------------------------------------------------------
-//
-TInt CCookieManagerServer::ClearAllCookies()
- {
- TInt count = iPersistentCookies->ClearAllCookies();
-
- // delete cookie file, just for sure
- // this is done also in destructor
- iFs.Delete( *iCookieFileName );
- return count;
- }
// ---------------------------------------------------------
// CCookieManagerServer::StringPool
@@ -485,73 +340,40 @@
// CCookieManagerServer::CookieArray
// ---------------------------------------------------------
//
-CCookieArray* CCookieManagerServer::CookieArray()
+CCookieArray* CCookieManagerServer::CookieArray(TInt aIndex)
{
- return iPersistentCookies;
+ return iCookieGroupDataArray->CookieArray(aIndex);
+ }
+
+
+// ---------------------------------------------------------
+// CCookieManagerServer::CookieGroupDataArray
+// ---------------------------------------------------------
+//
+CCookieGroupDataArray* CCookieManagerServer::CookieGroupDataArray()
+ {
+ return iCookieGroupDataArray;
}
// ---------------------------------------------------------
-// CCookieManagerServer::StorePersistentCookie
+// CCookieManagerServer::GroupIdArray
// ---------------------------------------------------------
//
-void CCookieManagerServer::StorePersistentCookieL( CCookie* aCookie,
- const TDesC8& aRequestUri,
- const TInt aIndex )
- {
- if (aIndex == -1)
- {
- iPersistentCookies->AddL( aCookie, aRequestUri);
- }
- else
- {
- iPersistentCookies->InsertL( aCookie, aIndex);
- }
+CGroupIdArray* CCookieManagerServer::GroupIdArray()
+ {
+ return iGroupIdArray;
}
-
// ---------------------------------------------------------
// CCookieManagerServer::GetCookies
// ---------------------------------------------------------
//
TInt CCookieManagerServer::GetCookies( const TDesC8& aRequestUri,
- RPointerArray<CCookie>& aCookies ) const
+ RPointerArray<CCookie>& aCookies,TInt aIndex ) const
{
- return iPersistentCookies->GetCookies( aRequestUri, aCookies );
+ return iCookieGroupDataArray->GetCookies( aRequestUri, aCookies, aIndex);
}
-// ---------------------------------------------------------
-// CCookieManagerServer::SetFileName
-// ---------------------------------------------------------
-//
-void CCookieManagerServer::SetFileName(TUint32& aAppUid)
- {
- *iCookieFileName = KNullDesC;
- TPtr fileName( iCookieFileName->Des() );
- fileName.Copy( KDefaultCookieFolder );
- fileName.AppendNum( RProcess().SecureId(), EHex );
- TBuf<KMaxFileName> buf(KDefaultCookieFile);
- if(aAppUid)
- {
- buf.Append(KUnderScore);
- buf.AppendNum(aAppUid,EHex);
- }
- fileName.Append(buf);
- fileName.Append(KDefaultExtension);
- //just write cookies back to the file before clearallcookies
- WriteCookiesToFile();
- //Delete the cookie list as we are going to read from File
- iPersistentCookies->ClearAllCookies() ;
- ReadCookiesFromFile();
- }
-
-// ---------------------------------------------------------
-// CCookieManagerServer::GetFileName
-// ---------------------------------------------------------
-//
-TDesC& CCookieManagerServer::GetFileName() const
- {
- return *iCookieFileName;
- }
//**********************************
// CCookieTimer
@@ -600,3 +422,154 @@
return self;
}
+// ---------------------------------------------------------
+// CCookieTimer::LoadGroupDataFromFileL
+// ---------------------------------------------------------
+//
+TInt CCookieManagerServer::LoadGroupDataFromFileL( RFs& afileSession )
+ {
+ CLOG( ( EServer, 0, _L( "-> CCookieManagerServer::LoadGroupDataFromFileL" ) ) );
+ TBuf<60> groupfile(KNullDesC);
+ groupfile.Copy( KDefaultCookieXmlFolder );
+ groupfile.AppendNum( RProcess().SecureId(), EHex );
+ groupfile.Append( KDefaultCookieGroupFile );
+ RXmlEngDOMImplementation DOM_impl;
+ DOM_impl.OpenL();
+ RXmlEngDocument doc;
+ RXmlEngDOMParser parser;
+ TInt error = parser.Open( DOM_impl );
+
+ if (error == KErrNone)
+ {
+
+
+ TRAPD( err, doc = parser.ParseFileL( afileSession, groupfile ) );
+ if ( ! err )
+ {
+ TXmlEngNode node;
+ TXmlEngElement element;
+ RXmlEngNodeList<TXmlEngElement> nodelist1;
+ RXmlEngNodeList<TXmlEngElement> nodelist2;
+ node = doc.DocumentElement();
+ node.AsElement().GetChildElements(nodelist1);
+ CleanupClosePushL(nodelist1);
+ CleanupClosePushL(nodelist2);
+
+ while ( nodelist1.HasNext() ) //Parent Node
+ {
+ element = nodelist1.Next();
+ element.GetChildElements(nodelist2);
+ TPtrC8 name = element.Name();
+ RArray<TUint32> sharedAppUidArray(5);
+ TUint32 groupId = 0;
+ TBool cookieSharableFlag;
+ TBool entryHasAttributes = element.HasAttributes();
+ if ( entryHasAttributes )
+ {
+ RXmlEngNodeList<TXmlEngAttr> attributeList;
+ element.GetAttributes(attributeList);
+ CleanupClosePushL(attributeList);
+ while ( attributeList.HasNext() )
+ {
+ TXmlEngAttr attr = attributeList.Next();
+ TPtrC8 attrName = attr.Name();
+ TPtrC8 attrData = attr.Value();
+ SettingAttribute(attrName,attrData,groupId,sharedAppUidArray,cookieSharableFlag );
+ }
+ CleanupStack::PopAndDestroy(); //attributeList
+ }
+ while( nodelist2.HasNext() )//Child Node
+ {
+ element = nodelist2.Next();
+ if ( ! element.IsNull() )
+ {
+ TPtrC8 name = element.Name();
+ TBool hasAttributes = element.HasAttributes();
+ RXmlEngNodeList<TXmlEngAttr> attributeList;
+ element.GetAttributes(attributeList);
+ TInt count = attributeList.Count();
+ CleanupClosePushL(attributeList);
+ while ( attributeList.HasNext() )
+ {
+ TXmlEngAttr attr = attributeList.Next();
+ TPtrC8 attrName = attr.Name();
+ TPtrC8 attrData = attr.Value();
+ SettingAttribute(attrName,attrData,groupId,sharedAppUidArray,cookieSharableFlag );
+ }
+ CleanupStack::PopAndDestroy(); //attributeList
+ }
+ }
+ CGroupIdInfo* groupIdInfo = CGroupIdInfo::NewL( groupId, sharedAppUidArray, cookieSharableFlag );
+ CleanupStack::PushL( groupIdInfo );
+ iGroupIdArray->AddGroupIdL( groupIdInfo );
+ CleanupStack::Pop( groupIdInfo );
+ CCookieGroupData* cookieGroupData = CCookieGroupData::NewL(groupId,sharedAppUidArray,cookieSharableFlag);
+ CleanupStack::PushL( groupIdInfo );
+ iCookieGroupDataArray->AddGroupDataL(cookieGroupData);
+ CleanupStack::Pop( groupIdInfo );
+ sharedAppUidArray.Close();
+ }
+ CleanupStack::PopAndDestroy(); //nodelist2
+ CleanupStack::PopAndDestroy(); //nodelist1
+ }
+ }
+ doc.Close();
+ parser.Close();
+ DOM_impl.Close();
+ CLOG( ( EServer, 0, _L( "<- CCookieManagerServer::LoadGroupDataFromFileL" ) ) );
+ return KErrNone;
+ }
+
+// ---------------------------------------------------------
+// CCookieTimer::SettingAttribute
+// ---------------------------------------------------------
+//
+void CCookieManagerServer::SettingAttribute(TDesC8& attrName, TDesC8& attrData,TUint32& aGroupId
+ , RArray<TUint32>& aSharedAppUidArray, TBool& aCookieSharableFlag )
+ {
+ CLOG( ( EServer, 0, _L( "-> CCookieManagerServer::SettingAttribute" ) ) );
+ TBuf8<100> groupname(KNullDesC8);
+ TBuf8<100> bufGroupId(KNullDesC8);
+ TBuf8<100> bufSharedAppUidName(KNullDesC8);
+ TUint32 sharedAppUid = 0;
+ if ( ! attrName.CompareF(KGroupName))
+ {
+ groupname.Copy(attrData);
+ } else if ( ! attrName.CompareF(KGroupId))
+ {
+ bufGroupId.Copy(attrData);
+ TInt err = ChangeToDecimal(bufGroupId, aGroupId);
+
+ }else if ( ! attrName.CompareF(KUid3))
+ {
+ bufSharedAppUidName.Copy(attrData);
+ TInt err = ChangeToDecimal(bufSharedAppUidName, sharedAppUid);
+ if (err == KErrNone)
+ aSharedAppUidArray.AppendL(sharedAppUid);
+
+ } else if (! attrName.CompareF(KCookieSharable))
+ {
+ if ( !attrData.CompareF(KOff) )
+ aCookieSharableFlag = EFalse;
+ else
+ aCookieSharableFlag = ETrue;
+ }
+ CLOG( ( EServer, 0, _L( "<- CCookieManagerServer::SettingAttribute" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieTimer::ChangeToDecimal
+// ---------------------------------------------------------
+//
+TInt CCookieManagerServer::ChangeToDecimal( TDes8& aBuf,TUint32& aUid )
+ {
+ CLOG( ( EServer, 0, _L( "-> CCookieManagerServer::ChangeToDecimal" ) ) );
+ TBuf8<100> tempBuf;
+ TPtrC8 tempPtr = aBuf.Mid( KHexDel().Length());
+ tempBuf.Copy(tempPtr);
+ TLex8 lex(tempBuf);
+ TInt ret = lex.Val(aUid,EHex);
+ CLOG( ( EServer, 0, _L( "<- CCookieManagerServer::ChangeToDecimal" ) ) );
+ return ret;
+ }
+//EOF
--- a/httpfilters/cookie/ManagerSrc/CookieManagerSession.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/CookieManagerSession.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -30,7 +30,9 @@
#include "CookieManagerSession.h"
#include "CookieServerDef.h"
-
+#include "CookieGroupDataArray.h"
+#include "CookieGroupData.h"
+#include "GroupIdInfoArray.h"
// ---------------------------------------------------------
// CCookieManagerSession::CCookieManagerSession
@@ -118,22 +120,185 @@
TInt err = DoClearAllCookies( aMessage );
CLOG( ( EServerSession, 0,
- _L( "-> CCookieManagerSession::ClearAllCookies" ) ) );
+ _L( "<- CCookieManagerSession::ClearAllCookies" ) ) );
+
+ return err;
+ }
+// ---------------------------------------------------------
+// CCookieManagerSession::ClearAllCookies
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::ClearAllAppUidCookies( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::ClearAllAppUidCookies" ) ) );
+
+ TInt err = DoClearAllAppUidCookies( aMessage );
+
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::ClearAllAppUidCookies" ) ) );
return err;
}
+// ---------------------------------------------------------
+// CCookieManagerSession::DestroyCookies
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::DestroyCookies( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DestroyCookies" ) ) );
+
+ TInt err = DoDestroyCookies( aMessage );
+
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::DestroyCookies" ) ) );
+
+ return err;
+ }
+// ---------------------------------------------------------
+// CCookieManagerSession::GetCookieSharableFlag
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::GetCookieSharableFlag( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::GetCookieSharableFlag" ) ) );
+
+ TInt err = DoGetCookieSharableFlag( aMessage );
+
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::GetCookieSharableFlag" ) ) );
+
+ return err;
+ }
// ---------------------------------------------------------
+// CCookieManagerSession::DoGetCookieSharableFlag
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::DoGetCookieSharableFlag( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DoGetCookieSharableFlag" ) ) );
+ TUint32 secureId = aMessage.SecureId().iId;
+ TBool cookiesharableflag(EFalse);
+ TInt count = iCookieServer.CookieGroupDataArray()->Count();
+ CCookieGroupDataArray* cookiegroupdataarray = iCookieServer.CookieGroupDataArray();
+ for (TInt i=0; i<count; i++)
+ {
+ if (cookiegroupdataarray->At(i)->GetGroupId()== secureId )
+ {
+ cookiesharableflag = cookiegroupdataarray->At(i)->GetCookieSharableFlag();
+ break;
+ }
+ else
+ {
+ TInt shared = cookiegroupdataarray->At(i)->TotalAppUid();
+ for (TInt j=0;j<shared;j++)
+ {
+ if (cookiegroupdataarray->At(i)->GetSharedUid(j)== secureId)
+ {
+ cookiesharableflag = cookiegroupdataarray->At(i)->GetCookieSharableFlag();
+ break;
+ }
+ }
+ }
+
+ }
+ TPckg<TBool> iFlag(cookiesharableflag);
+ CLOG( ( EServerSession, 0,_L( "<- CCookieManagerSession::DoGetCookieSharableFlag cookiesharableflag = %d" )
+ , cookiesharableflag ) );
+
+ return aMessage.Write( 0, iFlag );
+
+
+ }
+//----------------------------------------------------------
// CCookieManagerSession::DoClearAllCookies
// ---------------------------------------------------------
//
TInt CCookieManagerSession::DoClearAllCookies( const RMessage2& aMessage )
{
- TPckg<TInt> count( iCookieServer.ClearAllCookies() );
- return aMessage.Write( 0, count );
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DoClearAllCookies" ) ) );
+
+ TUint32 secureId = aMessage.SecureId().iId;
+ TInt groupDataIndex =0;
+
+ if(iCookieServer.CookieGroupDataArray()->Count())
+ {
+ TInt err = iCookieServer.CookieGroupDataArray()->FindIndex(secureId, groupDataIndex);
+ if ( err == KErrNone )
+ {
+ CCookieGroupData* cookiegroupdata = iCookieServer.CookieGroupDataArray()->At(groupDataIndex);
+ TPckg<TInt>count(cookiegroupdata->ClearAllCookies());
+ iCookieServer.CookieGroupDataArray()->Remove(groupDataIndex);
+ return aMessage.Write( 0, count );
+ }
+ }
+ TPckg<TInt>count2(0);
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::DoClearAllCookies" ) ) );
+ return aMessage.Write( 0, count2 );
}
+//----------------------------------------------------------
+// CCookieManagerSession::DoClearAllAppUidCookies
+// For deleting cookies belongs to a specific appuid during
+// uninstallation process of a widget
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::DoClearAllAppUidCookies( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DoClearAllAppUidCookies" ) ) );
+
+ TUint32 secureId = aMessage.SecureId().iId;
+ TInt groupDataIndex =-1;
+
+ //READ FROM MESSAGE
+ HBufC* packedAppUidBuf = HBufC::NewLC( aMessage.Int0() );
+ TPtr packedAppUidPtr( packedAppUidBuf->Des() );
+ aMessage.ReadL( 1, packedAppUidPtr );
+ TLex lex(packedAppUidPtr);
+ TUint32 appUid(0);
+ TInt ret = lex.Val(appUid,EHex);
+
+ if(iCookieServer.CookieGroupDataArray()->Count())
+ {
+ TInt err = iCookieServer.CookieGroupDataArray()->FindIndex(secureId,appUid,groupDataIndex);
+ if ( err == KErrNone )
+ {
+ CCookieGroupData* cookiegroupdata = iCookieServer.CookieGroupDataArray()->At(groupDataIndex);
+ TPckg<TInt>count(cookiegroupdata->ClearAllCookies());
+ iCookieServer.CookieGroupDataArray()->Remove(groupDataIndex);
+ return aMessage.Write( 0, count );
+ }
+ }
+ TPckg<TInt>count2(0);
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::DoClearAllAppUidCookies" ) ) );
+ return aMessage.Write( 0, count2 );
+ }
+
+// ---------------------------------------------------------
+// CCookieManagerSession::DoDestroyCookies
+// ---------------------------------------------------------
+//
+TInt CCookieManagerSession::DoDestroyCookies( const RMessage2& aMessage )
+ {
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DoDestroyCookies" ) ) );
+
+ TUint32 secureId = aMessage.SecureId().iId;
+ TInt err = iCookieServer.CookieGroupDataArray()->DestroyGroupData(secureId);
+ TPckg<TInt>status(err);
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::DoDestroyCookies err = %d" ),err ) );
+ return aMessage.Write( 0, status );
+ }
// ---------------------------------------------------------
// CCookieManagerSession::DoGetCookieSize
@@ -141,8 +306,27 @@
//
TInt CCookieManagerSession::DoGetCookieSize( const RMessage2& aMessage )
{
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::DoGetCookieSize" ) ) );
+
TInt err = KErrNone;
-
+ HBufC* CookieBuf = HBufC::NewL(128);
+ TPtr CookiePtr( CookieBuf->Des() );
+ aMessage.ReadL( 0, CookiePtr );
+ TLex lex(CookiePtr);
+ TUint32 appUid(0);
+ TInt ret = lex.Val(appUid,EHex);
+ delete CookieBuf;
+ TUint32 secureId = aMessage.SecureId().iId;
+ TUint32 groupId=0;
+ TBool cookieSharable(EFalse);
+ TInt retstatus = iCookieServer.GroupIdArray()->GetGroupId(secureId,groupId, cookieSharable);
+ if( groupId && retstatus != KErrNotFound )
+ {
+ secureId = groupId;
+ }
+ TInt groupDataIndex =0;
+ iCookieServer.CookieGroupDataArray()->GetGroupDataIndexL(secureId,appUid,cookieSharable,groupDataIndex);
if ( iGetCookieList.Count() || iGetCookieListSize )
{
iGetCookieList.Reset();
@@ -151,19 +335,19 @@
else
{
// read in the size of the URI in bytes
- TInt uriSize = aMessage.Int0();
+ TInt uriSize = aMessage.Int1();
HBufC8* uriBuf = HBufC8::New( uriSize );
if ( uriBuf )
{
// read in the URI
TPtr8 uriDes( uriBuf->Des() );
- err = aMessage.Read( 1, uriDes );
+ err = aMessage.Read( 2, uriDes );
if ( err == KErrNone )
{
// fill the cookie array with the appropriate cookies :
// both from the server (persistent cookies) and from our local
// cookie list (transient cookies)
- err = iCookieServer.GetCookies( uriDes, iGetCookieList );
+ err = iCookieServer.GetCookies( uriDes, iGetCookieList,groupDataIndex );
if ( err == KErrNone )
{
/*
@@ -182,7 +366,7 @@
// writing back the result - the number of bytes to be copied
TPckg<TInt> pkgSize( iGetCookieListSize );
- err = aMessage.Write( 2, pkgSize );
+ err = aMessage.Write( 3, pkgSize );
}
}
@@ -193,7 +377,8 @@
err = KErrNoMemory;
}
}
-
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::DoGetCookieSize err = %d" ),err ) );
return err;
}
@@ -266,7 +451,26 @@
{
CLOG( ( EServerSession, 0,
_L( "-> CCookieManagerSession::DoStoreCookie ") ) );
-
+ HBufC* cookiebuf = HBufC::NewL(128);
+ TPtr cookiePtr( cookiebuf->Des() );
+ aMessage.ReadL( 3, cookiePtr );
+ TLex lex(cookiePtr);
+ TUint32 appUid(0);
+ TInt ret = lex.Val(appUid,EHex);
+ delete cookiebuf;
+ //Get THe Secure ID
+ TUint32 secureId = aMessage.SecureId().iId;
+ TInt groupDataIndex =0;
+ TUint32 groupId=0;
+ TBool cookieSharableFlag(EFalse);
+ TInt retstatus = iCookieServer.GroupIdArray()->GetGroupId(secureId,groupId, cookieSharableFlag);
+ if( groupId && retstatus != KErrNotFound )
+ {
+ secureId = groupId;
+ }
+ iCookieServer.CookieGroupDataArray()->GetGroupDataIndexL(secureId,appUid, cookieSharableFlag,groupDataIndex);
+ CCookieGroupData* cookiegroupdata = iCookieServer.CookieGroupDataArray()->At(groupDataIndex);
+ //iGrDataArray->GetGroupDataIndexL(secureId, groupDataIndex);
HBufC8* packedCookieBuf = HBufC8::NewLC( aMessage.Int0() );
TPtr8 packedCookiePtr( packedCookieBuf->Des() );
aMessage.ReadL( 1, packedCookiePtr );
@@ -282,15 +486,20 @@
if( err == KErrNone )
{
// aMessage.Int2() == request-URI length
- HBufC8* uriBuf = HBufC8::NewLC( aMessage.Int2() );
+ //Hrdcoded value has taken as 4 slots has already been occupied and
+ //there is no way to pass the uri length from client to Server
+ //this length is sufficient enough to accomodate a uri.
+
+ HBufC8* uriBuf = HBufC8::NewLC(500);
TPtr8 uriPtr( uriBuf->Des() );
- aMessage.ReadL( 3, uriPtr );
+ aMessage.ReadL( 2, uriPtr );
// first need to check if it is present in the array as it must
// overwrite already existing cookies...
TInt index(0);
- CCookieArray* perscookiearray = iCookieServer.CookieArray();
+ //CCookieArray* perscookiearray = iCookieServer.CookieArray();
+ CCookieArray* perscookiearray = iCookieServer.CookieArray(groupDataIndex);
if ( perscookiearray->DoesAlreadyExists( cookie, index ) )
{ // must overwrite !!!
// but first add the new one if needed
@@ -301,19 +510,19 @@
if(index >=0)
{
// insert cookie at valid index
- iCookieServer.StorePersistentCookieL( cookie, *uriBuf, index );
+ cookiegroupdata->StorePersistentCookieL( cookie, *uriBuf, index );
// remove the old cookie
perscookiearray->Remove( index + 1 );
}
else
{ // invalid index means old cookie has been deleted in the process of making room
// append the new cookie to the end of array
- iCookieServer.StorePersistentCookieL( cookie, *uriBuf );
+ cookiegroupdata->StorePersistentCookieL( cookie, *uriBuf );
}
}
else
{ // it is not in the array yet, add it now
- iCookieServer.StorePersistentCookieL( cookie, *uriBuf );
+ cookiegroupdata->StorePersistentCookieL( cookie, *uriBuf );
}
CleanupStack::PopAndDestroy( uriBuf );
@@ -467,7 +676,41 @@
aMessage.Complete(result);
break;
}
- default :
+ case EDestroyCookies :
+ {
+ if ( result == KErrNone )
+ {
+ result = DestroyCookies( aMessage );
+ }
+
+ aMessage.Complete( result );
+
+ break;
+ }
+ case EGetCookieSharableFlag :
+ {
+ if ( result == KErrNone )
+ {
+ result = GetCookieSharableFlag( aMessage );
+ }
+
+ aMessage.Complete( result );
+
+ break;
+ }
+ case EClearAppUidCookies :
+ {
+ if ( result == KErrNone )
+ {
+ result = ClearAllAppUidCookies( aMessage );
+ }
+
+ aMessage.Complete( result );
+
+ break;
+ }
+
+ default :
PanicClient( aMessage, ECookieBadRequest );
break;
}
@@ -502,29 +745,25 @@
//
TInt CCookieManagerSession::SetAppUidL(const RMessage2& aMessage )
{
- TInt ret(KErrNone);
- //READ FROM MESSAGE
+ CLOG( ( EServerSession, 0,
+ _L( "-> CCookieManagerSession::SetAppUidL" ) ) );
+ TInt ret(KErrNone);
+ //READ FROM MESSAGE
HBufC* packedCookieBuf = HBufC::NewLC( aMessage.Int0() );
TPtr packedCookiePtr( packedCookieBuf->Des() );
aMessage.ReadL( 1, packedCookiePtr );
TLex lex(packedCookiePtr);
TUint32 appUid(0);
ret = lex.Val(appUid,EHex);
+ TUint32 secureId = aMessage.SecureId().iId;
+ TInt groupDataIndex =0;
+ //iCookieServer.CookieGroupDataArray()->GetGroupDataIndexL(secureId,appUid,groupDataIndex);
+ CCookieGroupData* cookiegroupdata = iCookieServer.CookieGroupDataArray()->At(groupDataIndex);
+ cookiegroupdata->SetFileName(appUid,secureId);
+ CleanupStack::PopAndDestroy(packedCookieBuf);
+ CLOG( ( EServerSession, 0,
+ _L( "<- CCookieManagerSession::SetAppUidL" ) ) );
- //Extract Appuid from File Name
- TPtrC buf = iCookieServer.GetFileName();
- TInt len = buf.LocateReverse('_');
- TPtrC ptr(iCookieServer.GetFileName().Mid(len+1));
- TInt len1 = ptr.LocateReverse('.');
- TPtrC ptr1(ptr.Left(len1));
- if(!packedCookiePtr.Compare(ptr1) || (len == KErrNotFound && !appUid ))
- {
- //Already the Same File
- CleanupStack::PopAndDestroy(packedCookieBuf);
- return ret;
- }
- iCookieServer.SetFileName(appUid);
- CleanupStack::PopAndDestroy(packedCookieBuf);
return ret;
}
// End of file
--- a/httpfilters/cookie/ManagerSrc/CookieManagerStart.cpp Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/ManagerSrc/CookieManagerStart.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -42,7 +42,7 @@
CLOG( ( EServerStart, 0, _L( "*****************" ) ) );
CLOG( ( EServerStart, 0, _L( "-> StartCookieServerStart" ) ) );
- __UHEAP_MARK;
+ //__UHEAP_MARK;
TBuf<32> name( KCookieServerThreadName );
@@ -96,7 +96,7 @@
delete cleanup;
}
- __UHEAP_MARKEND;
+ //__UHEAP_MARKEND;
CLOG( ( EServerStart, 0, _L( "<- StartCookieServerStart err%d" ),
result ) );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/ManagerSrc/GroupIdInfoArray.cpp Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,312 @@
+/*
+ * CGroupIdInfoArray.cpp
+ *
+ * Created on: Nov 24, 2009
+ * Author: mohanti
+ */
+//System Includes
+
+//User Includes
+#include "GroupIdInfoArray.h"
+#include "CookieLogger.h"
+
+//Constatnts
+
+const TInt KGroupArrayGranularity = 10;
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewL
+// ---------------------------------------------------------
+//
+
+CGroupIdInfo* CGroupIdInfo::NewL( TUint32 aGroupId, const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag )
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::NewL aGroupId = %x, CookieSharableFlag = %x" )
+ ,aGroupId,aCookieSharableFlag ) );
+ CGroupIdInfo* self = CGroupIdInfo::NewLC(aGroupId, aAppuid, aCookieSharableFlag);
+ CleanupStack::Pop();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewLC
+// ---------------------------------------------------------
+//
+
+CGroupIdInfo* CGroupIdInfo::NewLC(TUint32 aGroupId, const RArray<TUint32>& aAppuid, TBool aCookieSharableFlag)
+ {
+ CGroupIdInfo* self = new (ELeave) CGroupIdInfo( aGroupId, aCookieSharableFlag );
+ CleanupStack::PushL(self);
+ self->ConstructL(aAppuid);
+ return self;
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewLC
+// ---------------------------------------------------------
+//
+
+CGroupIdInfo::~CGroupIdInfo()
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::~CGroupIdInfo" ) ) );
+ iAppUid.Close();
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::~CGroupIdInfo" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewLC
+// ---------------------------------------------------------
+//
+
+void CGroupIdInfo::ConstructL(const RArray<TUint32>& aAppuid)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::ConstructL" ) ) );
+ TInt count = aAppuid.Count();
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::count = %d" ), count ) );
+ for(TInt i=0; i<count; i++)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::aAppuid[%d] = %x " ), aAppuid[i] ) );
+ iAppUid.AppendL(aAppuid[i]);
+ }
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::ConstructL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::CGroupIdInfo
+// ---------------------------------------------------------
+//
+
+CGroupIdInfo::CGroupIdInfo( TUint32 aGroupId,TBool aCookieSharableFlag ):iCookieSharableFlag( aCookieSharableFlag ), iGroupId(aGroupId)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::CGroupIdInfo" ) ) );
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::CGroupIdInfo" ) ) );
+ }
+TBool CGroupIdInfo::GetCookieSharableFlag()
+ {
+ return iCookieSharableFlag;
+ }
+// ---------------------------------------------------------
+// CGroupIdInfo::GetGroupName
+// ---------------------------------------------------------
+//
+
+TInt CGroupIdInfo::GetGroupName(TUint32 aSecureId,TUint32& aGroupId)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::GetGroupName aSecureId = %x,aGroupId = %x" )
+ , aSecureId, aGroupId ) );
+ if(aSecureId == iGroupId)
+ {
+ aGroupId = iGroupId;
+ return KErrNone;
+ }
+ else
+ {
+ return KErrNotFound;
+ }
+ }
+TBool CGroupIdInfo::IsThisPartOfSharedGroup( TUint32& aClientId )
+ {
+ TBool found(EFalse);
+ if(!GetCookieSharableFlag())
+ return EFalse;
+ TInt count = iAppUid.Count();
+ for (TInt i=0;i<count;i++)
+ {
+ if ( aClientId == At(i) )
+ {
+ found = ETrue;
+ CLOG( ( EClient, 0, _L( "-> CGroupIdInfo::IsThisPartOfSharedGroup aClientId %x is Part of Group " ), aClientId ) );
+ break;
+ }
+ }
+ return found;
+ }
+// ---------------------------------------------------------
+// CGroupIdInfo::AddClientL
+// ---------------------------------------------------------
+//
+
+void CGroupIdInfo::AddClientL(TUint32 aClientId)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::AddClientL aClientId %x" ), aClientId ) );
+ iAppUid.AppendL(aClientId);
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::AddClientL aClientId %x" ) ) );
+ }
+// ---------------------------------------------------------
+// CGroupIdInfo::operator[]
+// ---------------------------------------------------------
+//
+
+TUint32 CGroupIdInfo::operator[](TInt aIndex) const
+ {
+ return (iAppUid[aIndex]);
+ }
+
+// ---------------------------------------------------------
+// CGroupIdInfo::At
+// ---------------------------------------------------------
+//
+
+TUint32 CGroupIdInfo::At(TInt aIndex) const
+ {
+ return (iAppUid[ aIndex ]);
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetSecureId
+// ---------------------------------------------------------
+//
+const TUint32& CGroupIdInfo::GetGroupId()
+ {
+ return iGroupId;
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewL
+// ---------------------------------------------------------
+//
+
+CGroupIdArray* CGroupIdArray::NewL()
+ {
+ CGroupIdArray* self = CGroupIdArray::NewLC();
+ CleanupStack::Pop();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::NewLC
+// ---------------------------------------------------------
+//
+
+CGroupIdArray* CGroupIdArray::NewLC()
+ {
+ CGroupIdArray* self = new (ELeave) CGroupIdArray();
+ CleanupStack::PushL(self);
+ self->ConstructL();
+ return self;
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::CGroupIdArray
+// ---------------------------------------------------------
+//
+CGroupIdArray::CGroupIdArray()
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::CGroupIdArray" ) ) );
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::CGroupIdArray" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::~CGroupIdArray
+// ---------------------------------------------------------
+//
+
+CGroupIdArray::~CGroupIdArray()
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::~CGroupIdArray" ) ) );
+ if(iGroupIdInfoArray && Count())
+ {
+ iGroupIdInfoArray->ResetAndDestroy();
+ iGroupIdInfoArray->Close();
+ //delete iGroupIdInfoArray;
+ iGroupIdInfoArray = NULL;
+ }
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::~CGroupIdArray" ) ) );
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::ConstructL
+// ---------------------------------------------------------
+//
+void CGroupIdArray::ConstructL()
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::ConstructL" ) ) );
+ iGroupIdInfoArray = new (ELeave) RPointerArray<CGroupIdInfo>(KGroupArrayGranularity);
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::ConstructL" ) ) );
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::AddGroupIdL
+// ---------------------------------------------------------
+//
+
+void CGroupIdArray::AddGroupIdL(CGroupIdInfo* aCGroupIdInfo)
+ {
+ return iGroupIdInfoArray->AppendL(aCGroupIdInfo);
+ }
+
+// ---------------------------------------------------------
+// CGroupIdArray::operator[]
+// ---------------------------------------------------------
+//
+CGroupIdInfo& CGroupIdArray::operator[](TInt aIndex) const
+ {
+ return *(*iGroupIdInfoArray)[aIndex];
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::At
+// ---------------------------------------------------------
+//
+CGroupIdInfo& CGroupIdArray::At(TInt aIndex) const
+ {
+ return *(*iGroupIdInfoArray)[ aIndex ];
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetGroupId
+// ---------------------------------------------------------
+//
+TInt CGroupIdArray::GetGroupId(TUint32 aClientId,TUint32& aGroupId)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::GetGroupId aClientId = %x" ), aClientId ) );
+ TInt count = Count();
+ TBool found(EFalse);
+ TUint32 groupId =0;
+ for(TInt i=0;i<count;i++)
+ {
+ TInt ret = At(i).GetGroupName(aClientId,groupId);
+ if ( ret == KErrNone )
+ {
+ aGroupId = groupId;
+ found = ETrue;
+ CLOG( ( EClient, 0, _L( "<- CGroupIdArray::Group Id of aClientId= %x is %x" ), aClientId, aGroupId ) );
+ break;
+ }
+ }
+ if(found)
+ return KErrNone;
+ else
+ return KErrNotFound;
+ }
+// ---------------------------------------------------------
+// CCookieGroupDataArray::GetGroupId
+// ---------------------------------------------------------
+//
+
+TInt CGroupIdArray::GetGroupId(TUint32 aClientId,TUint32& aGroupId,TBool& aCookieSharableFlag)
+ {
+ CLOG( ( EClient, 0, _L( "-> CGroupIdArray::GetGroupId aClientId = %x,aAppUid =%x" ), aClientId, aAppUid ) );
+ TInt count = Count();
+ TBool found(EFalse);
+
+ for(TInt i=0;i<count;i++)
+ {
+ if( At(i).GetGroupId() == aClientId || At(i).IsThisPartOfSharedGroup(aClientId) )
+ {
+ aGroupId = At(i).GetGroupId();
+ aCookieSharableFlag = At(i).GetCookieSharableFlag();
+ found = ETrue;
+ break;
+ }
+ }
+ if(found)
+ return KErrNone;
+ else
+ return KErrNotFound;
+
+ }
+
+// ---------------------------------------------------------
+// CCookieGroupDataArray::Count
+// ---------------------------------------------------------
+//
+TInt CGroupIdArray::Count()
+ {
+ return iGroupIdInfoArray->Count();
+ }
--- a/httpfilters/cookie/Rom/CookieManager.iby Mon Mar 15 12:42:40 2010 +0200
+++ b/httpfilters/cookie/Rom/CookieManager.iby Wed Mar 31 22:32:15 2010 +0300
@@ -20,5 +20,6 @@
file=ABI_DIR\BUILD_DIR\CookieManager.dll SHARED_LIB_DIR\CookieManager.dll
file=ABI_DIR\BUILD_DIR\CookieServer.exe PROGRAMS_DIR\CookieServer.exe
+data=EPOCROOT##epoc32\data\z\private\101F8530\CookieGroup.xml private\101F8530\CookieGroup.xml
#endif
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/httpfilters/cookie/data/CookieGroup.xml Wed Mar 31 22:32:15 2010 +0300
@@ -0,0 +1,14 @@
+<?xml version="1.0" encoding="ISO-8859-1" ?>
+<CookieManagerSettings>
+ <ShareGroup name="Web Browser" id="0x10008d39" cookie_apps_share="on">
+ <SharedApp name="WebBrowser" uid3="0x10008d39" >
+ </SharedApp>
+ <SharedApp name="DownloadManager" uid3="0x10008D60">
+ </SharedApp>
+ </ShareGroup>
+
+ <ShareGroup name="WRT Widget" id="0x10282822" cookie_apps_share="off">
+ <SharedApp name="WRT Widget" uid3="0x10282822" >
+ </SharedApp>
+ </ShareGroup>
+</CookieManagerSettings>
--- a/netprotocols_plat/cookie_manager_api/inc/cookie.h Mon Mar 15 12:42:40 2010 +0200
+++ b/netprotocols_plat/cookie_manager_api/inc/cookie.h Wed Mar 31 22:32:15 2010 +0300
@@ -77,6 +77,7 @@
// cookie was generated. It is important to know it
// for correct age calculation.
//EAge, // The age of the cookie as estimated by the cache
+ ELastAttribute
};
public : // exported methods
@@ -266,7 +267,7 @@
* @return TBool indicating the cookies's Version attribute's notoriety.
*/
TBool IsUnknownVersion() const;
-
+ static CCookie* CloneL( const CCookie& aCopy );
private : // class for internal use
/**
@@ -278,7 +279,11 @@
* @return A TBool holding the result
*/
TBool ExpiredNetscapeL( THTTPHdrVal aAttrVal ) const;
-
+
+ /* For logging Cookie attributes
+ *
+ */
+ void Log( TInt aAssociatedId = 0 ) const;
/**
* Tokenize a string.
* @return actual number of tokens
--- a/netprotocols_plat/cookie_manager_api/inc/cookiemanagerclient.h Mon Mar 15 12:42:40 2010 +0200
+++ b/netprotocols_plat/cookie_manager_api/inc/cookiemanagerclient.h Wed Mar 31 22:32:15 2010 +0300
@@ -87,6 +87,14 @@
* @return Error code indicating the result of the call.
*/
IMPORT_C TInt SetAppUidL(const TUint32& aAppUid );
+ IMPORT_C void Close();
+ IMPORT_C TInt StoreCookie( const CCookie& aCookie,
+ const TUriC8& aUri,TUint32& aAppUid);
+ IMPORT_C void GetCookiesL( const TDesC8& aUri,
+ RPointerArray<CCookie>& aCookies,
+ TBool& aCookie2Reqd,TUint32& aAppUid );
+ IMPORT_C TInt ClearAllAppUidCookies(const TUint32& aAppUid);
+
private : // internal methods
/**
@@ -102,6 +110,9 @@
*/
TInt DoGetCookieSize( const TDesC8& aRequestUri,
TPckg<TInt>& aPkgSize ) const;
+
+ TInt DoGetCookieSize( const TDesC8& aRequestUri,
+ TPckg<TInt>& aPkgSize,TDesC& aAppUidPtr ) const;
/**
* Puts those cookies in the buffer that have been previously selected
@@ -115,12 +126,21 @@
*
*/
TInt DoStoreCookie( const TDesC8& aPackedCookie,
- const TDesC8& aUri ) const;
+ const TDesC8& aUri,TDesC& aAppUidPtr ) const;
/**
*
*/
TVersion Version() const;
+
+ TInt DestroyCookiesFromMemory( TInt& aDeleteStatus );
+
+ void StoreCookieAtClientSide( const CCookie* aCookie, const TDesC8& aUri,TUint32 aWidgetUid );
+
+ TInt GetClientSideCookies( const TDesC8& aRequestUri,RPointerArray<CCookie>& aCookies
+ ,TBool& aFound, TUint32 aWidgetUid );
+ TInt GetCookieSharableFlagFromServer(TBool& aCookieSharableFlag ) const;
+
private : // data members
RStringPool iStringPool;