# HG changeset patch # User Pat Downey # Date 1283340056 -3600 # Node ID 4a793f564d72831437a1df4f1d583458ec1ab753 # Parent 0aa8cc770c8a5f93876e40337f8a313599a7f0f7 Revert incorrect RCL_3 drop: Revision: 201032 Kit: 201035 diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backupengine/src/absession.cpp --- a/backupandrestore/backupengine/src/absession.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backupengine/src/absession.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -148,12 +148,7 @@ iCallbackWatchdog = NULL; // Remove this session from the server's session map - // Use dynamic_cast in case that ABServer is deconstructing - CABServer *pServer = dynamic_cast(const_cast(CSession2::Server())); - if(pServer) - { - pServer->RemoveElement(iClientSID); - } + Server().RemoveElement(iClientSID); // Clear up any outstanding message HandleIPCClosingDownCallback(); @@ -164,10 +159,7 @@ // If the client has detached properly, they should // have done this - but just in case. //DoCancelWaitForCallback(); - if(pServer) - { - pServer->DropSession(); - } + Server().DropSession(); } void CABSession::CreateL() diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/backup_public_files_registration.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/backupandrestore/backuptest/ABTester/data/backup_public_files_registration.xml Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/base_active_backup_registration.xml Binary file backupandrestore/backuptest/ABTester/data/base_active_backup_registration.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/base_active_backup_registration2.xml Binary file backupandrestore/backuptest/ABTester/data/base_active_backup_registration2.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/base_active_backup_registration3.xml Binary file backupandrestore/backuptest/ABTester/data/base_active_backup_registration3.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/incremental_active_backup_registration.xml Binary file backupandrestore/backuptest/ABTester/data/incremental_active_backup_registration.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/passive_backup_registration.xml --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/backupandrestore/backuptest/ABTester/data/passive_backup_registration.xml Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,94 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/data/proxy_active_backup_registration.xml Binary file backupandrestore/backuptest/ABTester/data/proxy_active_backup_registration.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/ABTester/group/abtester.iby --- a/backupandrestore/backuptest/ABTester/group/abtester.iby Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/ABTester/group/abtester.iby Wed Sep 01 12:20:56 2010 +0100 @@ -21,13 +21,13 @@ file=ABI_DIR\BUILD_DIR\abtestclient3.EXE System\programs\abtestclient3.EXE file=ABI_DIR\BUILD_DIR\abtestclient4.EXE System\programs\abtestclient4.EXE -data=DATAZ_\private\0ab7e57c\backup_registration.xml private\0ab7e57c\backup_registration.xml -data=DATAZ_\private\0ab7e57d\backup_registration.xml private\0ab7e57d\backup_registration.xml -data=DATAZ_\private\0ab7e57e\backup_registration.xml private\0ab7e57e\backup_registration.xml -data=DATAZ_\private\0ab7e58a\backup_registration.xml private\0ab7e58a\backup_registration.xml -data=DATAZ_\private\0ab7e58b\backup_registration.xml private\0ab7e58b\backup_registration.xml -data=DATAZ_\private\0ab7e58c\backup_registration.xml private\0ab7e58c\backup_registration.xml +data=DATAZ_\private\0AB7E57C\backup_registration.xml private\0AB7E57C\backup_registration.xml +data=DATAZ_\private\0AB7E57D\backup_registration.xml private\0AB7E57D\backup_registration.xml +data=DATAZ_\private\0AB7E57E\backup_registration.xml private\0AB7E57E\backup_registration.xml +data=DATAZ_\private\0AB7E58A\backup_registration.xml private\0AB7E58A\backup_registration.xml +data=DATAZ_\private\0AB7E58B\backup_registration.xml private\0AB7E58B\backup_registration.xml +data=DATAZ_\private\0AB7E58C\backup_registration.xml private\0AB7E58C\backup_registration.xml -data=DATAZ_\private\0fa00001\backup_registration.xml private\0fa00001\backup_registration.xml +data=DATAZ_\private\0FA00001\backup_registration.xml private\0FA00001\backup_registration.xml #endif diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/Group/bld.inf --- a/backupandrestore/backuptest/burtestserver/Group/bld.inf Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/Group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -40,8 +40,9 @@ ../testscripts/test_restorepackage.script z:/testdata/scripts/sbetestdata/test_restorepackage.script ../testscripts/test_increament.script z:/testdata/scripts/sbetestdata/test_increament.script -../../testdata/armv5/bigexeforbackup.sis /epoc32/data/z/testdata/scripts/sbetestdata/bigexeforbackup.sis -../../testdata/armv5/test_dll_nopublic.sis /epoc32/data/z/testdata/scripts/sbetestdata/test_dll_nopublic.sis +../testscripts/sbeconfig.xml /epoc32/release/winscw/udeb/z/private/10202d56/sbeconfig.xml +../testscripts/sbeconfig.xml /epoc32/release/winscw/urel/z/private/10202d56/sbeconfig.xml + PRJ_TESTMMPFILES burtestserver.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/Group/burtestserver.iby --- a/backupandrestore/backuptest/burtestserver/Group/burtestserver.iby Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/Group/burtestserver.iby Wed Sep 01 12:20:56 2010 +0100 @@ -35,10 +35,6 @@ data=EPOCROOT##Epoc32\data\z\testdata\scripts\sbetestdata\test_activebackuprestore.script testdata\scripts\sbetestdata\test_activebackuprestore.script data=EPOCROOT##Epoc32\data\z\testdata\scripts\sbetestdata\test_increament.script testdata\scripts\sbetestdata\test_increament.script -data=EPOCROOT##Epoc32\data\z\testdata\scripts\sbetestdata\bigexeforbackup.sis testdata\scripts\sbetestdata\bigexeforbackup.sis -data=EPOCROOT##Epoc32\data\z\testdata\scripts\sbetestdata\test_dll_nopublic.sis testdata\scripts\sbetestdata\test_dll_nopublic.sis - - #ifndef __SERIES60_ data=EPOCROOT##Epoc32\data\z\testdata\scripts\sbetestdata\sbeconfig.xml private\10202d56\sbeconfig.xml #endif diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/inc/t_burteststepbase.h --- a/backupandrestore/backuptest/burtestserver/TestSteps/inc/t_burteststepbase.h Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/inc/t_burteststepbase.h Wed Sep 01 12:20:56 2010 +0100 @@ -90,9 +90,6 @@ public: RSIDArray iSidArray; - // add support for exclude sid list - RSIDArray iExcludeSidArray; - private: HBufC* GetIndentation(TInt aLevel); diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_burteststepbase.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_burteststepbase.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_burteststepbase.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -63,9 +63,6 @@ iDataOwners.Close(); iSidArray.Close(); - - iExcludeSidArray.Close(); - iJidArray.Close(); iPublicFileNames.Close(); iPrivateFileNames.Close(); @@ -390,48 +387,6 @@ /** Read private file sizes into array */ _LIT(KExpectPrivateFileSizes, "ExpectPrivateFileSizes"); ReadListIntoIntArray(KExpectPrivateFileSizes, delimiter, iPrivateFileSizes); - - // Read Exclude IDs LIST // - TSecureId sid; - TChar ch; - TPtrC list; - - // clear the array - iExcludeSidArray.Reset(); - // read the string - _LIT(KExcludeSIDList, "ExcludeIDs"); - GetStringFromConfig(ConfigSection(), KExcludeSIDList, list); - TLex sidLex(list); - // parse the string - while (!sidLex.Eos()) - { - sidLex.Mark(); - ch=sidLex.Peek(); - - while(!sidLex.Eos() && ( ch=sidLex.Peek() ) != TChar(',')) - sidLex.Inc(); - - if(!sidLex.TokenLength()) - continue; - - TPtrC pToken = sidLex.MarkedToken(); - TLex token(pToken); - - if (pToken.Length() <= KMaxHexLength && token.Val(sid.iId, EHex) == KErrNone) - { - iExcludeSidArray.Append(sid); - _LIT(KFound, "Exclude ID Found in ini file: "); - LogWithSID(LOG_LEVEL4, KFound, sid); - } //if - - if(ch==TChar(',')) - sidLex.Inc(); - - sidLex.SkipSpace(); - - } //while - - } void CBURTestStepBase::ReadListIntoStringArray(const TDesC& aSectionName, const TChar& aDelimiter, RArray& aResultList) @@ -503,6 +458,7 @@ LogWithNum(LOG_LEVEL2,KTempText1, err); iFailures++; } + // Log if (iDataOwners.Count() == 0) { @@ -514,30 +470,6 @@ _LIT(KTempText4, "Number of data owners found on device: "); LogWithNum(LOG_LEVEL3, KTempText4, iDataOwners.Count()); } - - //filter the dataowners per the exclude SID list - for (TInt index = 0; index < iDataOwners.Count(); index++) - { - TSecureId sid = NULL; - sid = ExtractIDL(*iDataOwners[index]); - - if (sid != NULL) - { - TInt position = iExcludeSidArray.Find(sid); - if (position != KErrNotFound) - { - _LIT(KTempText2, "ExcludeID found in list of data owners: "); - LogWithSID(LOG_LEVEL3, KTempText2, sid); - - delete iDataOwners[index]; - iDataOwners[index] = NULL; - iDataOwners.Remove(index); - index--; - } - } - } - - } void CBURTestStepBase::PopulateListOfDataOwnersAsyncL() @@ -578,28 +510,6 @@ _LIT(KTempText4, "Number of data owners found on device: "); LogWithNum(LOG_LEVEL3, KTempText4, iDataOwners.Count()); } - - //filter the dataowners per the exclude SID list - for (TInt index = 0; index < iDataOwners.Count(); index++) - { - TSecureId sid = NULL; - sid = ExtractIDL(*iDataOwners[index]); - - if (sid != NULL) - { - TInt position = iExcludeSidArray.Find(sid); - if (position != KErrNotFound) - { - _LIT(KTempText2, "ExcludeID found in list of data owners: "); - LogWithSID(LOG_LEVEL3, KTempText2, sid); - - delete iDataOwners[index]; - iDataOwners[index] = NULL; - iDataOwners.Remove(index); - index--; - } - } - } } void CBURTestStepBase::SetBURModeL(TBURPartType aBURPartType, TBackupIncType aBackupIncType) @@ -647,8 +557,8 @@ for (TInt index = 0; index < iDataOwners.Count(); index++) { TBool notFound = ETrue; - sid = ExtractIDL(*iDataOwners[index]); - + sid = ExtractIDL(*iDataOwners[index]); + if (sid != NULL) { TInt position = iSidArray.Find(sid); @@ -666,22 +576,19 @@ else // possibly jid { HBufC* pSuiteHash = ExtractJavaIDL(*iDataOwners[index]); - if (pSuiteHash != NULL) - { - TPtrC suiteHash = pSuiteHash->Des(); - if (iJidArray.Find(suiteHash) != KErrNotFound) - { - _LIT(KTempText3, "Java ID found in list of data owners: "); - LogWithText(LOG_LEVEL3, KTempText3, suiteHash); - notFound = EFalse; - } - else // not found - { - notFound = ETrue; - } - delete pSuiteHash; - pSuiteHash = NULL; - } + TPtrC suiteHash = pSuiteHash->Des(); + if (iJidArray.Find(suiteHash) != KErrNotFound) + { + _LIT(KTempText3, "Java ID found in list of data owners: "); + LogWithText(LOG_LEVEL3, KTempText3, suiteHash); + notFound = EFalse; + } + else // not found + { + notFound = ETrue; + } + delete pSuiteHash; + pSuiteHash = NULL; } if (notFound) { @@ -1316,12 +1223,6 @@ j--; total--; } - else - { - // print the status - LogWithSID(LOG_LEVEL3, _L("---The unexpected dataowner status-SID: "),statusArray[j].iSID.iId); - LogWithNum(LOG_LEVEL3,_L("---The unexpected dataowner status-status: "),statusArray[j].iStatus) ; - } } //for statusArray.Reset(); CleanupStack::PopAndDestroy(&statusArray); @@ -1466,25 +1367,8 @@ for (TInt i=0; i < KRetries;) { - - - LogWithNum(LOG_LEVEL3,_L("retryies :"), i); - CheckSIDStatusL(iTransferTypes, readyArray); - - - LogWithNum(LOG_LEVEL3,_L("readyArray count :"), readyArray.Count()); - - // print all the ready array - for(TInt jj = 0 ; jj < readyArray.Count(); jj++) - { - CSBSIDTransferType* type = CSBSIDTransferType::NewL(readyArray[jj]); - CleanupStack::PushL(type); - - LogWithSID(LOG_LEVEL3, _L("readyArray SIDs : ") , type->SecureIdL()); - CleanupStack::PopAndDestroy(type); - } - + if (readyArray.Count()) // dataowners ready { // ========= Supply Data ================ @@ -1505,19 +1389,6 @@ iFailures++; _LIT(KLogNoTrans, "***Error: Some Data Owners were Not Ready or Failed to Connect"); Log(LOG_LEVEL3, KLogNoTrans); - - // print the remenan sids - for( TInt kk = 0 ; kk SecureIdL(); - CleanupStack::PopAndDestroy(sidType); - LogWithSID(LOG_LEVEL3, _L("--iTransferTypes, remanent SIDs : "),id.iId); - } - // } readyArray.ResetAndDestroy(); CleanupStack::PopAndDestroy(&readyArray); @@ -1611,6 +1482,7 @@ { User::Leave(KErrInUse); } + iStatus = KRequestPending; SetActive(); iActiveScheduler->Start(); } diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -17,7 +17,7 @@ @file @released */ -#include "W32STD.H" + #include "t_teststepbackup.h" namespace bur_ts @@ -145,8 +145,6 @@ Log(LOG_LEVEL2, KLog3); } - _LIT(KLog31, "Checking valid registration..."); - Log(LOG_LEVEL2, KLog31); CheckValidRegistrationL(); _LIT(KLog4, "Saving Data Owners..."); @@ -203,13 +201,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - // do active backup when in partial backup mode - if (iIsPartial) - { - //active - BackupActiveBaseDataL(); - BackupActiveSnapshotDataL(); - } + //active + BackupActiveBaseDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveBaseDataL(); @@ -244,13 +238,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - // do active backup when in partial backup mode - if (iIsPartial) - { - //active - BackupActiveIncDataL(); - BackupActiveSnapshotDataL(); - } + // active + BackupActiveIncDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveIncDataL(); @@ -540,10 +530,6 @@ TRAPD(error, for (TInt i=0; i < KRetries;) { - // - LogWithNum(LOG_LEVEL3,_L("doActiveBackup-retryies :"), i); - - CheckSIDStatusL(transferTypes, iTransferTypes); if (iTransferTypes.Count()) // dataowners ready { @@ -565,20 +551,7 @@ iFailures++; _LIT(KLogNoTrans, "***Error: Some Data Owners were Not Ready or Failed to Connect"); Log(LOG_LEVEL3, KLogNoTrans); - - - //print the remenant sids - for( TInt kk = 0 ; kk SecureIdL(); - CleanupStack::PopAndDestroy(sidType); - LogWithSID(LOG_LEVEL3, _L("doActiveBackup-transferTypes, remanent SIDs : "),id.iId); - } - } //if + } //if transferTypes.ResetAndDestroy(); User::LeaveIfError(error); diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup2.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup2.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackup2.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -204,13 +204,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - // do active backup when in partial backup mode - if (iIsPartial) - { - //active - BackupActiveBaseDataL(); - BackupActiveSnapshotDataL(); - } + //active + BackupActiveBaseDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveBaseDataL(); @@ -245,13 +241,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - // do active backup when in partial backup mode - if (iIsPartial) - { - //active - BackupActiveIncDataL(); - BackupActiveSnapshotDataL(); - } + // active + BackupActiveIncDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveIncDataL(); diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackupasync.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackupasync.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststepbackupasync.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -148,8 +148,6 @@ Log(LOG_LEVEL2, KLog3); } - _LIT(KLog31, "Checking valid registration..."); - Log(LOG_LEVEL2, KLog31); CheckValidRegistrationL(); _LIT(KLog4, "Saving Data Owners..."); @@ -206,12 +204,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - if (iIsPartial) - { - //active - BackupActiveBaseDataL(); - BackupActiveSnapshotDataL(); - } + //active + BackupActiveBaseDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveBaseDataL(); @@ -256,12 +251,9 @@ BackupSystemBaseDataL(); BackupSystemSnapshotDataL(); - if (iIsPartial) - { - // active - BackupActiveIncDataL(); - BackupActiveSnapshotDataL(); - } + // active + BackupActiveIncDataL(); + BackupActiveSnapshotDataL(); //passive BackupPassiveIncDataL(); diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestore.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestore.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestore.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -241,13 +241,9 @@ SupplyPassiveSnapshotDataL(); RestorePassiveBaseDataL(); - // do active restore when in partial restore mode - if (iIsPartial) - { - //active - SupplyActiveSnapshotDataL(); - RestoreActiveBaseDataL(); - } + //active + SupplyActiveSnapshotDataL(); + RestoreActiveBaseDataL(); } void CBURTestStepRestore::IncrementalRestoreL() @@ -263,14 +259,11 @@ RestorePassiveBaseDataL(); RestorePassiveIncDataL(); - // do active restore when in partial restore mode - if (iIsPartial) - { - //active - SupplyActiveSnapshotDataL(); - RestoreActiveBaseDataL(); - RestoreActiveIncDataL(); - } + + //active + SupplyActiveSnapshotDataL(); + RestoreActiveBaseDataL(); + RestoreActiveIncDataL(); } diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestoreasync.cpp --- a/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestoreasync.cpp Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/TestSteps/src/t_teststeprestoreasync.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -200,12 +200,9 @@ { RestoreJavaMidletDataL(); - if (iIsPartial) - { - // passive - SupplyPassiveSnapshotDataL(); - RestorePassiveBaseDataL(); - } + // passive + SupplyPassiveSnapshotDataL(); + RestorePassiveBaseDataL(); //active SupplyActiveSnapshotDataL(); @@ -219,19 +216,17 @@ */ { RestoreJavaMidletDataL(); - - // passive - SupplyPassiveSnapshotDataL(); - RestorePassiveBaseDataL(); - RestorePassiveIncDataL(); - - if (iIsPartial) - { - //active - SupplyActiveSnapshotDataL(); - RestoreActiveBaseDataL(); - RestoreActiveIncDataL(); - } + + // passive + SupplyPassiveSnapshotDataL(); + RestorePassiveBaseDataL(); + RestorePassiveIncDataL(); + + + //active + SupplyActiveSnapshotDataL(); + RestoreActiveBaseDataL(); + RestoreActiveIncDataL(); } diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/testscripts/test.ini --- a/backupandrestore/backuptest/burtestserver/testscripts/test.ini Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/testscripts/test.ini Wed Sep 01 12:20:56 2010 +0100 @@ -17,14 +17,12 @@ IsPartial=0 BaseOnly=1 DriveList=c -ExcludeIDs=10281d18,101fdf81,2000b4d8,1028246f,1028312B,200286d2,101F51F2,10202BE9,101F99FB,100069CC,20021367,10003A73,101F401D,2002BCC0,1020383E [BACKUP_RESTORE_0040] BackupDir=c:\BackupArchive\ IsPartial=0 BaseOnly=0 DriveList=c -ExcludeIDs=10281d18,101fdf81,2000b4d8,1028246f,1028312B,200286d2,101F51F2,10202BE9,101F99FB,100069CC,20021367,10003A73,101F401D,2002BCC0,1020383E [BACKUP_RESTORE_0050] BackupDir=c:\BackupArchive\ diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/testscripts/test_backuprestore.script --- a/backupandrestore/backuptest/burtestserver/testscripts/test_backuprestore.script Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/testscripts/test_backuprestore.script Wed Sep 01 12:20:56 2010 +0100 @@ -20,6 +20,8 @@ //////////////////////////////////////////////////////////////////////////////////// LOAD_SUITE BURTestServer +DELAY 120000 + PRINT ---------------------------------------------- PRINT Test Backup Restore PRINT ---------------------------------------------- diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/burtestserver/testscripts/test_backuprestoreasync.script --- a/backupandrestore/backuptest/burtestserver/testscripts/test_backuprestoreasync.script Tue Aug 31 16:03:15 2010 +0300 +++ b/backupandrestore/backuptest/burtestserver/testscripts/test_backuprestoreasync.script Wed Sep 01 12:20:56 2010 +0100 @@ -21,6 +21,8 @@ //////////////////////////////////////////////////////////////////////////////////// LOAD_SUITE BURTestServer +DELAY 120000 + PRINT ---------------------------------------------- PRINT Test Backup Restore Async PRINT ---------------------------------------------- diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/testdata/armv5/bigexeforbackup.sis Binary file backupandrestore/backuptest/testdata/armv5/bigexeforbackup.sis has changed diff -r 0aa8cc770c8a -r 4a793f564d72 backupandrestore/backuptest/testdata/armv5/test_dll_nopublic.sis Binary file backupandrestore/backuptest/testdata/armv5/test_dll_nopublic.sis has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Info.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Info.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,34 @@ + + + + + CFBundleDevelopmentRegion + English + CFBundleGetInfoString + Nokia S60-32 v1.0, © Nokia + CFBundleIdentifier + nokia.com.phoneplugin.com.nokia.S6032 + CFBundleInfoDictionaryVersion + 6.0 + CFBundleName + Nokia S60-32 + CFBundlePackageType + BNDL + CFBundleShortVersionString + 1.0 + CFBundleSignature + ???? + CFBundleVersion + 556 + IPHPhoneConduitVersion + 597.0 + IPHPhonePluginUID + 367C0F5C-1E53-44A3-AEA5-54D1EEE12F29 + IPHPluginProviderName + Nokia + IPHPluginSupportURL + http://www.nokia.com/support + IPHPublicPluginVersion + 2.0 + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/MetaClasses.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/MetaClasses.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,329 @@ + + + family.com.nokia.S6032 + + InheritsFrom + + family.com.apple.external.all-phones.usb-bt + + Services + + + ServiceName + com.apple.synchro + ServiceClass + IPHSyncMLSyncTransportServiceObexClient + ServiceProperties + + IPHEnginePlist + SyncEngine.plist + SyncProperties2 + PhoneConduit.plist + SyncMLVersion + SyncML11 + SyncMLLargeObjectSupport + + SyncMLNumberOfChangesSupport + + SyncMLRefreshFromServerSupport + + SyncMLRemoteNeedsRelativePaths + + SyncMLBusySignalingSupport + + SyncMLOnlyOneBusySignaling + + SyncMLBusySignalingInterval + 60 + SyncMLSimulateBusySignalingWithEmptySync + + SyncDataClasses + + + com.apple.pimsync.contacts + com.apple.pimsync.calendars + + + DontSyncEventsAfterDateValue.visible + + DontSyncEventsAfterDateValue.default-value + 1month + OnlySyncContactsWithPhoneNumber.visible + + OnlySyncContactsWithPhoneNumber.default-value + + SyncAllDayEventsKey.visible + + SyncAllDayEventsKey.default-value + + DontSyncEventsPriorToDateValue.visible + + DontSyncEventsPriorToDateValue.default-value + 1week + DontSyncEventsPriorToDateIsEnabled.visible + + DontSyncEventsPriorToDateIsEnabled.default-value + + DontSyncEventsAfterDateIsEnabled.visible + + DontSyncEventsAfterDateIsEnabled.default-value + + SyncMLLocalSource + iSync + SyncMLCodec + SyncMLCodecLibWBXML + SyncMLMsgTemporization + 500000 + SyncMLMaxObjSize + 786432 + SyncMLMaxMsgSize + 65535 + BTProtocolService + com.nokia.S6032.protocol.bt.obex.syncml + USBProtocolService + com.nokia.S6032.protocol.usb.obex.syncml + + + + ServiceName + com.nokia.S6032.protocol.usb.obex.syncml + ServiceClass + IPHObexService + ServiceProperties + + ObexTargetUUID + 53 59 4e 43 4d 4c 2d 53 59 4e 43 + ObexTimeOut + 60 + TransportService + com.nokia.S6032.transport.usb.syncml + + + + ServiceName + com.nokia.S6032.protocol.bt.obex.syncml + ServiceClass + IPHObexService + ServiceProperties + + ObexTargetUUID + 53 59 4e 43 4d 4c 2d 53 59 4e 43 + ObexTimeOut + 60 + TransportService + com.nokia.S6032.transport.rfcomm.syncml + + + + ServiceName + com.apple.protocol.usb.AT + ServiceClass + IPHSerialATService + ServiceProperties + + + + ServiceName + com.nokia.S6032.transport.rfcomm.syncml + ServiceClass + IPHRFCOMMChannelService + ServiceProperties + + RFCOMMChannelUUID + 000000020000100080000002ee000002 + + + + ServiceName + com.apple.transport.usb.modem + ServiceClass + IPHUSBCDCChannelService + ServiceProperties + + + + ServiceName + com.nokia.S6032.transport.usb.syncml + ServiceClass + IPHUSBObexChannelService + ServiceProperties + + + + ServiceName + com.apple.pimsync.parser.vCal + ServiceClass + IPHSyncParserService + ServiceProperties + + ParserType + vCal + Encoding + QUOTED-PRINTABLE + FoldingStyle + FoldingNG + Charset + UTF-8 + AllDayEventFormat + AllDayEventFromMidnightTo235900 + vCalRecDropIfUseless + + EscapeSemicolonInNotComponedValues + + EscapeBackslash + + IgnoreProperties + + X-IRMC-LUID + + UntilDateInLocal + + SetUntilTimeWithStartTime + + + + + ServiceName + com.apple.pimsync.parser.vCard + ServiceClass + IPHSyncParserService + ServiceProperties + + ParserType + vCard + Encoding + QUOTED-PRINTABLE + FoldingStyle + FoldingNG + Charset + UTF-8 + EscapeSemicolonInNotComponedValues + + EscapeBackslash + + IgnoreProperties + + X-IRMC-LUID + + PropertyNameMapping + + X-NICKNAME + X-EPOCSECONDNAME + + AddCRLFAfterBase64Folding + + IgnoreSubTypesForThisMainTypes + + CELL + + + + + ServiceName + com.apple.pimsync.contacts + ServiceClass + IPHSyncDataClassService + ServiceProperties + + MimeType + text/x-vcard + ParserService + com.apple.pimsync.parser.vCard + RemoteName + + needsCompanyNameInFirstName + + needsFullAddressInStreetField + + DataClassName + Contacts + needsDeleteAddOnModify + + MaxSyncCmd + 1 + + + + ServiceName + com.apple.pimsync.calendars + ServiceClass + IPHSyncDataClassService + ServiceProperties + + MimeType + text/x-vcalendar + ParserService + com.apple.pimsync.parser.vCal + hasEvent + + RemoteName + + hasAllDayEvents + + hasAllDayFromMidnightTo235900 + + hasVCalRecurrence + + needsToFormatCountToUntilDate + + needsToFormatUntilDateToCount + + hasOneAlarmType + + alarmTypeIsDisplay + + hasTimeZone + + hasTask + + handleAllDayRecurrent + + doNotSyncAlarmIfAfterStartDateTime + + DataClassName + Calendar + allDayInLocalDateTime + + untilDateIsDateOnly + + exDatesAreDateOnly + + doNotSyncAlarmIfCompleted + + dueDateIsDateOnly + + + + + + com.nokia.S6032 + + Identification + + com.apple.usb.vendorid-modelid + 0x0421/0x0500 + com.apple.gmi+gmm + Nokia+Nokia 6290 + + InheritsFrom + + family.com.nokia.S6032 + + Services + + + ServiceName + com.apple.model + ServiceProperties + + ModelName + S60-32 + CompanyName + Nokia + ModelIcon + com.nokia.S6032.tiff + + + + + \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/PhoneConduit.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/PhoneConduit.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,534 @@ + + + + + Formatting + + com.apple.calendars.Event + + classification + + mappings + + + mappedValue + PUBLIC + originalValue + public + + + mappedValue + PRIVATE + originalValue + private + + + mappedValue + PRIVATE + originalValue + confidential + + + + description + + charsToStrip + \r,\n + maxLength + 500 + + end date + + location + + charsToStrip + \r,\n + maxLength + 255 + + start date + + summary + + charsToStrip + \r,\n + maxLength + 500 + + + com.apple.calendars.Task + + classification + + mappings + + + mappedValue + PUBLIC + originalValue + public + + + mappedValue + PRIVATE + originalValue + private + + + mappedValue + PRIVATE + originalValue + confidential + + + + completion date + + description + + charsToStrip + \r,\n + maxLength + 255 + + due date + + priority + + mappings + + + mappedValue + + originalValue + 0 + + + mappedValue + 1 + originalValue + 1 + + + mappedValue + 2 + originalValue + 2 + + + mappedValue + 3 + originalValue + 3 + + + mappedValue + 4 + originalValue + 4 + + + mappedValue + 5 + originalValue + 5 + + + mappedValue + 6 + originalValue + 6 + + + mappedValue + 7 + originalValue + 7 + + + mappedValue + 8 + originalValue + 8 + + + mappedValue + 9 + originalValue + 9 + + + + status + + mappings + + + mappedValue + DECLINED + originalValue + cancelled + + + mappedValue + NEEDS ACTION + originalValue + needsaction + + + mappedValue + COMPLETED + originalValue + completed + + + mappedValue + ACCEPTED + originalValue + inprocess + + + mappedValue + + originalValue + none + + + + summary + + charsToStrip + \r,\n + maxLength + 255 + + + com.apple.contacts.Contact + + birthday + + company name + + charsToStrip + \r,\n + maxLength + 255 + + department + + charsToStrip + \r,\n + maxLength + 255 + + first name + + charsToStrip + \r,\n + maxLength + 255 + + image + + maxLength + 0 + + job title + + charsToStrip + \r,\n + maxLength + 255 + + last name + + charsToStrip + \r,\n + maxLength + 255 + + middle name + + charsToStrip + \r,\n + maxLength + 255 + + nickname + + charsToStrip + \r,\n + maxLength + 255 + + notes + + maxLength + 1000 + + suffix + + charsToStrip + \r,\n + maxLength + 255 + + title + + charsToStrip + \r,\n + maxLength + 255 + + + com.apple.contacts.Date + + type + + mappings + + + value + + + com.apple.contacts.Email Address + + type + + mappings + + + mappedValue + WORK + originalValue + work + + + mappedValue + HOME + originalValue + home + + + mappedValue + INTERNET + originalValue + other + + + + value + + charsToStrip + \r,\n + maxLength + 255 + + + com.apple.contacts.Phone Number + + type + + mappings + + + mappedValue + WORK + originalValue + work + + + mappedValue + HOME + originalValue + home + + + mappedValue + CELL + originalValue + mobile + + + mappedValue + FAX + originalValue + work fax + + + mappedValue + FAX + originalValue + home fax + + + mappedValue + + originalValue + other + + + mappedValue + + originalValue + main + + + mappedValue + PAGER + originalValue + pager + + + + value + + charsToKeep + 0123456789+#*pw + maxLength + 255 + + + com.apple.contacts.Related Name + + type + + mappings + + + mappedValue + X-CHILDREN + originalValue + child + + + mappedValue + X-SPOUSE + originalValue + spouse + + + mappedValue + X-ASSISTANT + originalValue + assistant + + + + value + + charsToStrip + \r,\n + maxLength + 255 + + + com.apple.contacts.Street Address + + city + + charsToStrip + \r,\n + maxLength + 255 + + country + + charsToStrip + \r,\n + maxLength + 255 + + postal code + + charsToStrip + \r,\n + maxLength + 255 + + state + + charsToStrip + \r,\n + maxLength + 255 + + street + + charsToStrip + \r,\n + maxLength + 255 + + type + + mappings + + + mappedValue + WORK + originalValue + work + + + mappedValue + HOME + originalValue + home + + + mappedValue + + originalValue + other + + + relationshipConstraint + perSubType + relationshipSize + 1 + + + com.apple.contacts.URL + + type + + mappings + + + mappedValue + WORK + originalValue + work + + + mappedValue + HOME + originalValue + home page + + + mappedValue + HOME + originalValue + home + + + mappedValue + + originalValue + other + + + + value + + charsToStrip + \r,\n + maxLength + 500 + + + + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/SyncEngine.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/SyncEngine.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,151 @@ + + + + + Entities + + com.apple.calendars.AudioAlarm + + com.apple.syncservices.RecordEntityName + triggerdate + triggerduration + owner + + com.apple.calendars.Calendar + + com.apple.syncservices.RecordEntityName + title + read only + com.apple.PhoneConduitExtension.uid + + com.apple.calendars.DisplayAlarm + + com.apple.syncservices.RecordEntityName + triggerdate + triggerduration + owner + + com.apple.calendars.Event + + com.apple.syncservices.RecordEntityName + original date + all day + exception dates + calendar + recurrences + main event + detached events + audio alarms + display alarms + start date + location + summary + end date + description + classification + + com.apple.calendars.Recurrence + + com.apple.syncservices.RecordEntityName + frequency + count + until + interval + bymonth + byweeknumber + byyearday + bymonthday + bydayfreq + bydaydays + bysetpos + weekstartday + owner + + com.apple.calendars.Task + + com.apple.syncservices.RecordEntityName + due date is date only + calendar + audio alarms + display alarms + status + summary + completion date + description + due date + classification + priority + + com.apple.contacts.Contact + + com.apple.syncservices.RecordEntityName + title + suffix + image + last name + company name + first name + middle name + job title + nickname + notes + department + birthday + email addresses + phone numbers + URLs + street addresses + related names + dates + + com.apple.contacts.Date + + com.apple.syncservices.RecordEntityName + contact + value + type + + com.apple.contacts.Email Address + + com.apple.syncservices.RecordEntityName + contact + value + type + + com.apple.contacts.Phone Number + + com.apple.syncservices.RecordEntityName + contact + value + type + + com.apple.contacts.Related Name + + com.apple.syncservices.RecordEntityName + contact + value + type + + com.apple.contacts.Street Address + + com.apple.syncservices.RecordEntityName + contact + city + state + street + country + type + postal code + + com.apple.contacts.URL + + com.apple.syncservices.RecordEntityName + contact + value + type + + + Type + device + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/com.nokia.S6032.tiff Binary file connectivitymodules/SeCon/apple/S60_RnD_32.phoneplugin/Contents/Resources/com.nokia.S6032.tiff has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Archive.bom Binary file connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Archive.bom has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Archive.pax.gz Binary file connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Archive.pax.gz has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Info.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Info.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,67 @@ + + + + + CFBundleGetInfoString + 0.0, Copyright 2006 Apple Computer, Inc. + CFBundleIdentifier + com.apple.isyncpluginmaker.phoneplugin + CFBundleShortVersionString + 0.0 + IFMajorVersion + 1 + IFMinorVersion + 0 + IFPkgFlagAllowBackRev + + IFPkgFlagAuthorizationAction + AdminAuthorization + IFPkgFlagBackgroundAlignment + topleft + IFPkgFlagBackgroundScaling + none + IFPkgFlagDefaultLocation + / + IFPkgFlagFollowLinks + + IFPkgFlagInstallFat + + IFPkgFlagInstalledSize + 156 + IFPkgFlagIsRequired + + IFPkgFlagOverwritePermissions + + IFPkgFlagRelocatable + + IFPkgFlagRestartAction + NoRestart + IFPkgFlagRootVolumeOnly + + IFPkgFlagUpdateInstalledLanguages + + IFPkgFormatVersion + 0.10000000149011612 + IFRequirementDicts + + + LabelKey + iSync24Label + MessageKey + iSync2XMessage + SpecArgument + /Applications/iSync.app/Contents/Info.plist + SpecProperty + CFBundleVersion + SpecType + plist + TestObject + 500.134 + TestOperator + ge + TitleKey + iSync24Title + + + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/PkgInfo --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/PkgInfo Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1 @@ +pkmkrpkg1 \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/Description.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/Description.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,10 @@ + + + + + IFPkgDescriptionDescription + Description of a Phone Plug-in + IFPkgDescriptionTitle + the phone plug-in + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/English.lproj/ReadMe.rtf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/English.lproj/ReadMe.rtf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,6 @@ +{\rtf1\mac\ansicpg10000\cocoartf824\cocoasubrtf410 +{\fonttbl\f0\fswiss\fcharset77 Helvetica;} +{\colortbl;\red255\green255\blue255;} +\pard\tx560\tx1120\tx1680\tx2240\tx2800\tx3360\tx3920\tx4480\tx5040\tx5600\tx6160\tx6720\ql\qnatural + +\f0\fs24 \cf0 This package has been built by Nokia Corporation. It will install a phone plugin to enable iSync support for your phone E60} \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/IFRequirement.strings Binary file connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/IFRequirement.strings has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/PhonePlugin.info --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/PhonePlugin.info Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,17 @@ +Title Phone Plug-in +Version +Description +DefaultLocation /Library/PhonePlugins +DeleteWarning + +### Package Flags + +NeedsAuthorization NO +Required YES +Relocatable YES +RequiresReboot NO +UseUserMask NO +OverwritePermissions NO +InstallFat NO +RootVolumeOnly YES +OnlyUpdateInstalledLanguages NO diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/TokenDefinitions.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/TokenDefinitions.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,17 @@ + + + + + iSyncToken + + + searchPlugin + CommonAppSearch + path + /Applications/iSync.app + identifier + com.apple.isync + + + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/Welcome.rtf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/Welcome.rtf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,17 @@ +{\rtf1\mac\ansicpg10000\cocoartf824\cocoasubrtf380 +{\fonttbl\f0\fnil\fcharset77 LucidaGrande-Bold;\f1\fswiss\fcharset77 Helvetica;\f2\fnil\fcharset77 LucidaGrande; +} +{\colortbl;\red255\green255\blue255;\red1\green1\blue1;} +\vieww9000\viewh8400\viewkind0 +\pard\tx560\tx1120\tx1680\tx2240\tx2800\tx3360\tx3920\tx4480\tx5040\tx5600\tx6160\tx6720\ql\qnatural + +\f0\b\fs24 \cf0 Welcome to the iSync Phone Plug-in for Mac OS X Installer +\f1\b0 \ +\ +\pard\tx560\tx1120\tx1680\tx2240\tx2800\tx3360\tx3920\tx4480\tx5040\tx5600\tx6160\tx6720\ql\qnatural + +\f2\fs22 \cf0 iSync for Mac OS X is synchronization software that keeps your Address Book contacts and iCal calendar and to-do information in sync between your Mac OS computers and iSync-compatible mobile phones.\ +\ +This installer guides you through the steps necessary to install an iSync Phone Plug-in for Mac OS X. To get started, click Continue. +\f1\fs24 \cf2 \ +} \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/en.lproj/Description.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/en.lproj/Description.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,10 @@ + + + + + IFPkgDescriptionDescription + + IFPkgDescriptionTitle + 367C0F5C-1E53-44A3-AEA5-54D1EEE12F29-installerRoot + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/package_version --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.pkg/Contents/Resources/package_version Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,2 @@ +major: 1 +minor: 0 \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/Icon.tiff Binary file connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/Icon.tiff has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/InstallerReadMe-en.rtf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/InstallerReadMe-en.rtf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,6 @@ +{\rtf1\mac\ansicpg10000\cocoartf824\cocoasubrtf410 +{\fonttbl\f0\fswiss\fcharset77 Helvetica;} +{\colortbl;\red255\green255\blue255;} +\pard\tx560\tx1120\tx1680\tx2240\tx2800\tx3360\tx3920\tx4480\tx5040\tx5600\tx6160\tx6720\ql\qnatural + +\f0\fs24 \cf0 This package has been built by Nokia Corporation. It will install a phone plugin to enable iSync support for your phone E60} \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/Properties.plist --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/apple/S60_RnD_32.ppdoc/Properties.plist Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1358 @@ + + + + + TramontaneVersion + 597.0 + UUID + 367C0F5C-1E53-44A3-AEA5-54D1EEE12F29 + properties + + BTOptionsDict + + OBEXTimeout + 60 + TransportType + 0 + synchroScriptConnect + + synchroScriptDisconnect + + + UISettingsOptionsDict + + DontSyncEventsAfterDateIsEnabled + + default + 0 + visible + + + DontSyncEventsAfterDateValue + + default + 1month + visible + + + DontSyncEventsPriorToDateIsEnabled + + default + 0 + visible + + + DontSyncEventsPriorToDateValue + + default + 1week + visible + + + OnlySyncContactsWithPhoneNumber + + default + 1 + visible + + + SyncAllDayEventsKey + + default + 0 + visible + + + + USBOptionsDict + + OBEXTimeout + 60 + identificationCDCChannel + 0 + identificationScriptConnect + + identificationScriptDisconnect + + synchroCDCChannel + 1 + synchroOBEXChannel + 0 + synchroScriptConnect + + synchroScriptDisconnect + + useOBEX + + useOtherCDC + + useSameCDC + + + advancedOptionsSettings + + com_apple_pimsync_contacts + + DataClassName + Contacts + MaxAddAndReplaceCmd + 0 + MaxDeleteCmd + 0 + MaxSyncCmd + 1 + needsDeleteAddOnModify + 1 + + com_apple_pimsync_events + + DataClassName + Calendar + MaxAddAndReplaceCmd + 0 + MaxDeleteCmd + 0 + MaxSyncCmd + 0 + allDayInLocalDateTime + 1 + allowedAlarmRelativeValues + + countValueWhenMissing + 0 + defaultUntilDateWhenMissing + + doNotSyncAlarmForADE + + doNotSyncAlarmIfAfterStartDateTime + 1 + dontSyncEventBeforeDate + + exDatesAreDateOnly + + handleMultiDayRecurrent + + hasAllDayMultiDay + + maxMinutesNbDeltaForAlarm + 0 + needsDeleteAddOnModify + 0 + noNewLines + 0 + onlyAsciiCharacters + + syncAlarmOnlyIfSameDayAsADEStartDate + + untilDateIsDateOnly + 1 + + com_apple_pimsync_parser_vCal + + AllDayCategories + REMINDER + EscapeBackslash + 1 + EscapeSemicolonInNotComponedValues + 1 + EscapeStrings + + ExDatesInLocal + + IgnoreProperties + X-IRMC-LUID + PropertyNameMapping + + SetExDateTimeWithEndTime + + SetExDateTimeWithStartTime + + SetUntilTimeWithEndTime + 0 + SetUntilTimeWithStartTime + 1 + TimedCategories + MEETING + UntilDateInLocal + 1 + + com_apple_pimsync_parser_vCard + + AddCRLFAfterBase64Folding + 1 + IgnoreSubTypesForThisMainTypes + CELL + PropertyNameMapping + + + key + X-NICKNAME + value + X-EPOCSECONDNAME + + + + com_apple_pimsync_tasks + + DataClassName + Tasks + MaxAddAndReplaceCmd + 0 + MaxDeleteCmd + 0 + MaxSyncCmd + 0 + completionDateIsDateOnly + + defaultDueDateValueWhenMissing + + defaultDueDateWhenMissing + + doNotSyncAlarmForTask + + doNotSyncAlarmIfCompleted + 1 + dueDateIsDateOnly + + needsDeleteAddOnModify + + setDueDateToCompletionDateIfCompleted + + + com_apple_synchro + + SyncMLCodec + 0 + SyncMLDoNotTryToDetectPhoneDBReset + + SyncMLLocalSource + iSync + SyncMLMaxMsgSize + 65535 + SyncMLMaxObjSize + 786432 + SyncMLMsgTemporization + 500000 + SyncMLNoPropertiesCapabilitiesInDevInf + + SyncMLSendDevInfIntoPutIfNoGetReceived + 0 + SyncMLUseBinaryWBXMLPublicID + + + + calendarsOptionsDict + + Charset + UTF-8 + FoldingStyle + FoldingNG + RemoteName + / + allDayFormat + 3 + eventRecurrenceEndType + 1 + hasAudioAlarm + + hasDisplayAlarm + + hasEvent + + hasTimeZone + 1 + hasVCalRecurrence + + + contactsOptionsDict + + RemoteName + / + firstAndLastNameInSameField + + needsCompanyNameInFirstName + 0 + needsFullAddressInStreetField + + + documentVersion + 556 + extraOptionsSettings + + familyOptionsDict + + BTAvailable + + BluetoothAvailable + + CGMI + Nokia + CGMM + Nokia 6290 + GMI + Nokia + GMM + Nokia 6290 + ModelID + com.nokia.S6032 + Name + S60-32 + PluginProviderName + Nokia + ProductID + 0x0500 + USBAvailable + + VendorID + 0x0421 + connection + 2 + constructorName + Nokia + domainName + nokia.com + fixedDatabasesNames + 0 + pluginVersion + 1.0 + supportURL + http://www.nokia.com/support + useCGMICGMM + + + javaScriptDict + + btObexConnection + + Value + function prepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + btObexDisconnection + + Value + function unprepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + usbCdcConnection + + Value + function prepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + usbCdcDisconnection + + Value + function unprepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + usbObexConnection + + Value + function prepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + usbObexDisconnection + + Value + function unprepareChannelForProtocol() +{ + // You can customize this function but do NOT change the signature +} + + + notes + + WW91IGNhbiBzYXZlIGFueSBraW5kIG9mIGluZm9ybWF0aW9uIG9uIHRoZSBw + bHVnaW4gaGVyZS4KVGhleSB3b24ndCBiZSBleHBvcnRlZCBpbiB0aGUgcGx1 + Z2luLg== + + syncFieldsSettings + + com_apple_calendars_Event + + classification + + Activated + + mappings + + + activated + + mappedValue + PUBLIC + originalValue + public + + + activated + + mappedValue + PRIVATE + originalValue + private + + + activated + + mappedValue + PRIVATE + originalValue + confidential + + + + description + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 500 + + end date + + Activated + + + location + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + start date + + Activated + + + summary + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 500 + + + com_apple_calendars_Task + + classification + + Activated + + mappings + + + activated + + mappedValue + PUBLIC + originalValue + public + + + activated + + mappedValue + PRIVATE + originalValue + private + + + activated + + mappedValue + PRIVATE + originalValue + confidential + + + + completion date + + Activated + + + description + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + due date + + Activated + + + priority + + Activated + + mappings + + + activated + + originalValue + 0 + + + activated + + mappedValue + 1 + originalValue + 1 + + + activated + + mappedValue + 2 + originalValue + 2 + + + activated + + mappedValue + 3 + originalValue + 3 + + + activated + + mappedValue + 4 + originalValue + 4 + + + activated + + mappedValue + 5 + originalValue + 5 + + + activated + + mappedValue + 6 + originalValue + 6 + + + activated + + mappedValue + 7 + originalValue + 7 + + + activated + + mappedValue + 8 + originalValue + 8 + + + activated + + mappedValue + 9 + originalValue + 9 + + + + status + + Activated + + mappings + + + activated + + mappedValue + DECLINED + originalValue + cancelled + + + activated + + mappedValue + NEEDS ACTION + originalValue + needsaction + + + activated + + mappedValue + COMPLETED + originalValue + completed + + + activated + + mappedValue + ACCEPTED + originalValue + inprocess + + + activated + + mappedValue + + originalValue + none + + + + summary + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + + com_apple_contacts_Contact + + birthday + + Activated + + + company name + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + department + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + first name + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + image + + Activated + + maxLength + 0 + + job title + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + last name + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + middle name + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + nickname + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + notes + + Activated + + maxLength + 1000 + + suffix + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + title + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + + com_apple_contacts_Date + + IPSGlobalEntity + + Activated + + + type + + Activated + + mappings + + + activated + + mappedValue + X-ANNIVERSARY + originalValue + anniversary + + + activated + + mappedValue + X-DATE + originalValue + other + + + + value + + Activated + + + + com_apple_contacts_Email Address + + IPSGlobalEntity + + Activated + + + type + + Activated + + mappings + + + activated + + mappedValue + WORK + originalValue + work + + + activated + + mappedValue + HOME + originalValue + home + + + activated + + mappedValue + INTERNET + originalValue + other + + + + value + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + + com_apple_contacts_Phone Number + + IPSGlobalEntity + + Activated + + + type + + Activated + + mappings + + + activated + + mappedValue + WORK + originalValue + work + + + activated + + mappedValue + HOME + originalValue + home + + + activated + + mappedValue + CELL + originalValue + mobile + + + activated + + mappedValue + FAX + originalValue + work fax + + + activated + + mappedValue + FAX + originalValue + home fax + + + activated + + mappedValue + + originalValue + other + + + activated + + mappedValue + + originalValue + main + + + activated + + mappedValue + PAGER + originalValue + pager + + + + value + + Activated + + DontNeedCheckBox + + charsFiltering + 2 + charsToKeep + 0123456789+#*pw + maxLength + 255 + + + com_apple_contacts_Related Name + + IPSGlobalEntity + + Activated + + + type + + Activated + + mappings + + + activated + + mappedValue + X-FATHER + originalValue + father + + + activated + + mappedValue + X-MOTHER + originalValue + mother + + + activated + + mappedValue + X-PARENT + originalValue + parent + + + activated + + mappedValue + X-CHILDREN + originalValue + child + + + activated + + mappedValue + X-BROTHER + originalValue + brother + + + activated + + mappedValue + X-SISTER + originalValue + sister + + + activated + + mappedValue + X-FRIEND + originalValue + friend + + + activated + + mappedValue + X-SPOUSE + originalValue + spouse + + + activated + + mappedValue + X-PARTNER + originalValue + partner + + + activated + + mappedValue + X-ASSISTANT + originalValue + assistant + + + activated + + mappedValue + X-MANAGER + originalValue + manager + + + activated + + mappedValue + X-NAME + originalValue + other + + + + value + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + + com_apple_contacts_Street Address + + IPSGlobalEntity + + Activated + + + city + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + country + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + postal code + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + state + + Activated + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + street + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 255 + + type + + Activated + + mappings + + + activated + + mappedValue + WORK + originalValue + work + + + activated + + mappedValue + HOME + originalValue + home + + + activated + + mappedValue + + originalValue + other + + + relationshipLimitKind + 2 + + + com_apple_contacts_URL + + IPSGlobalEntity + + Activated + + + type + + Activated + + mappings + + + activated + + mappedValue + WORK + originalValue + work + + + activated + + mappedValue + HOME + originalValue + home page + + + activated + + mappedValue + HOME + originalValue + home + + + activated + + mappedValue + + originalValue + other + + + + value + + Activated + + DontNeedCheckBox + + charsFiltering + 1 + charsToStrip + \r,\n + maxLength + 500 + + + + syncMLOptionsDict + + SyncMLBusySignalingInterval + 60 + SyncMLBusySignalingSupport + + SyncMLLargeObjectSupport + + SyncMLMaxSyncCmdNbInEncodedMsg + 30 + SyncMLNumberOfChangesSupport + + SyncMLOnlyOneBusySignaling + + SyncMLRefreshFromServerSupport + + SyncMLRemoteNeedsRelativePaths + + SyncMLSimulateBusySignalingWithEmptySync + + SyncMLVersion + SyncML11 + limitSyncCmd + + + tasksOptionsDict + + RemoteName + Tasks + hasDifferentDataclassesForTasksAndEvents + + hasTasks + + + vCalRecSettings + + com_apple_pimsync_events + + handleAllDayRecurrent + + + com_apple_pimsync_parser_vCal + + vCalExDatesSupport + + vCalRecDaily + + vCalRecDailyInterval + + vCalRecDropIfUseless + 1 + vCalRecMaxExDatesNb + 0 + vCalRecMonthlyByDay + + vCalRecMonthlyByDayOnlyOnStartDateMonthDay + + vCalRecMonthlyByDayOnlyOneMonthDay + + vCalRecMonthlyByDayWithMonthDay + + vCalRecMonthlyByPos + + vCalRecMonthlyByPosOnlyOnStartDateWeekDay + + vCalRecMonthlyByPosOnlyOneWeekDay + + vCalRecMonthlyInterval + + vCalRecOnlyForever + + vCalRecWeekly + + vCalRecWeeklyInterval + + vCalRecWeeklyOnlyOnStartDateWeekDay + + vCalRecWeeklyOnlyOneWeekDay + + vCalRecWeeklyWithWeekDay + + vCalRecYearlyByMonth + + vCalRecYearlyByMonthInterval + + vCalRecYearlyByMonthOnlyOnStartDateMonthNumber + + vCalRecYearlyByMonthOnlyOneMonthNumber + + vCalRecYearlyByMonthWithMonthNumber + + + + + version + 0 + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/bwins/catalogspcconnectivitypluginu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/bwins/catalogspcconnectivitypluginu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,10 @@ +EXPORTS + ??1CCatalogsPCConnectivityPlugin@@UAE@XZ @ 1 NONAME ; CCatalogsPCConnectivityPlugin::~CCatalogsPCConnectivityPlugin(void) + ?Close@CCatalogsPCConnectivityPlugin@@QAEXXZ @ 2 NONAME ; void CCatalogsPCConnectivityPlugin::Close(void) + ?Connect@CCatalogsPCConnectivityPlugin@@QAEHXZ @ 3 NONAME ; int CCatalogsPCConnectivityPlugin::Connect(void) + ?GetDataL@CCatalogsPCConnectivityPlugin@@QAEXAAVTDataType@@AAVCBufFlat@@@Z @ 4 NONAME ; void CCatalogsPCConnectivityPlugin::GetDataL(class TDataType &, class CBufFlat &) + ?NewL@CCatalogsPCConnectivityPlugin@@SAPAV1@XZ @ 5 NONAME ; class CCatalogsPCConnectivityPlugin * CCatalogsPCConnectivityPlugin::NewL(void) + ?NewLC@CCatalogsPCConnectivityPlugin@@SAPAV1@XZ @ 6 NONAME ; class CCatalogsPCConnectivityPlugin * CCatalogsPCConnectivityPlugin::NewLC(void) + ?PutDataL@CCatalogsPCConnectivityPlugin@@QAEXABVTDataType@@ABVCBufFlat@@@Z @ 7 NONAME ; void CCatalogsPCConnectivityPlugin::PutDataL(class TDataType const &, class CBufFlat const &) + ?SupportedMimeTypesL@CCatalogsPCConnectivityPlugin@@QAE?AV?$RPointerArray@VTDataType@@@@XZ @ 8 NONAME ; class RPointerArray CCatalogsPCConnectivityPlugin::SupportedMimeTypesL(void) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/eabi/catalogspcconnectivitypluginu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/eabi/catalogspcconnectivitypluginu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,14 @@ +EXPORTS + _ZN29CCatalogsPCConnectivityPlugin19SupportedMimeTypesLEv @ 1 NONAME + _ZN29CCatalogsPCConnectivityPlugin4NewLEv @ 2 NONAME + _ZN29CCatalogsPCConnectivityPlugin5CloseEv @ 3 NONAME + _ZN29CCatalogsPCConnectivityPlugin5NewLCEv @ 4 NONAME + _ZN29CCatalogsPCConnectivityPlugin7ConnectEv @ 5 NONAME + _ZN29CCatalogsPCConnectivityPlugin8GetDataLER9TDataTypeR8CBufFlat @ 6 NONAME + _ZN29CCatalogsPCConnectivityPlugin8PutDataLERK9TDataTypeRK8CBufFlat @ 7 NONAME + _ZN29CCatalogsPCConnectivityPluginD0Ev @ 8 NONAME + _ZN29CCatalogsPCConnectivityPluginD1Ev @ 9 NONAME + _ZN29CCatalogsPCConnectivityPluginD2Ev @ 10 NONAME + _ZTI29CCatalogsPCConnectivityPlugin @ 11 NONAME ; ## + _ZTV29CCatalogsPCConnectivityPlugin @ 12 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/group/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,23 @@ +/* +* Copyright (c) 2006-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Build info file for Catalogs PC Connectivity Plugin +* +*/ + + +PRJ_MMPFILES + +catalogspcconnectivityplugin.mmp + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/group/catalogspcconnectivityplugin.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/group/catalogspcconnectivityplugin.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,40 @@ +/* +* Copyright (c) 2006-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Project definition file for project Catalogs PC Connectivity +* Plugin +* +*/ + +#include +#include + +TARGET catalogspcconnectivityplugin.dll +TARGETTYPE dll +UID 0x1000008D 0x10207E73 + +CAPABILITY CAP_ECOM_PLUGIN +VENDORID VID_DEFAULT + +SOURCEPATH ../src +SOURCE catalogspcconnectivityplugin.cpp +SOURCE catalogspcconnectivityclient.cpp + +USERINCLUDE ../inc + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY apmime.lib + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivityclient.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivityclient.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,145 @@ +/* +* Copyright (c) 2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: This is a client which communicate with the server +* CatalogsEnginePCClientFrontEnd +* +*/ + + +#ifndef R_CATALOGSPCCONNECTIVITYCLIENT_H +#define R_CATALOGSPCCONNECTIVITYCLIENT_H + +#include +#include + +/** + * This client communicate with the server CatalogsEnginePCClientFrontEnd + * + * This class get requests from CatalogsPCConnectivityPlugin. + * Class itself is client in client-server solution. When request + * is received it will start the server (CatalogsEnginePCClientFrontEnd). + * This client class is dummy, the server have all the functionality. + * + * @lib catalogspcconnectivityplugin + * @since S60 v3.1 + */ +class RCatalogsPCConnectivityClient : public RSessionBase + { +public: + + /** + * Constructor + * + * @since S60 v3.1 + */ + RCatalogsPCConnectivityClient(); + + /** + * Destructor + * + * @since S60 v3.1 + */ + ~RCatalogsPCConnectivityClient(); + + /** + * A connection is formed to the Catalogs engine pc client front-end. + * This will start up the front-end server and connect to it + * + * @since S60 v3.1 + * @return TInt Standard error code, KErrNone if connection is formed + * or the connection was formed already + */ + TInt Connect(); + + /** + * The connection to the Catalogs engine front-end is closed + * + * @since S60 v3.1 + */ + void Close(); + + /** + * All MIME types supported by this component can be asked using this method + * + * @since S60 v3.1 + * @return RPointerArray< TDataType > contain all supported MIME types + * RPointerArray TDataTypes have allocated using new, caller + * have to remember to delete them properly + * @exeption Leaves with standard error codes + */ + RPointerArray SupportedMimeTypesL(); + + /** + * A data packet of max length 65535 (0xFFFF) bytes is synchronously + * sent to the Catalogs engine front-end + * Usage: After PutDataL have been called, you have to call GetDataL + * before you can call PutDataL again + * + * @since S60 v3.1 + * @param aMimeType data packet MIME type + * @param aData data buffer to read from + * @exeption Leaves with standard error codes + */ + void PutDataL( const TDataType& aMimeType, + const CBufFlat& aData ); + + /** + * A data packet is synchronously transfered from the Catalogs front-end + * and returned to caller + * Usage: Everytime before calling GetDataL, you have to call PutDataL. + * So you can't call GetData in sequentially. + * + * @since S60 v3.1 + * @param aMimeType data packet MIME type + * @param aData data buffer to write to. Will call ExpandL function + * for aData, but never more than max length 65535 (OxFFFF) + * @return nothing, but parameter aData work as return buffer + * @exeption Leaves with standard error codes + */ + void GetDataL( TDataType& aMimeType, CBufFlat& aData ); + + +private: + +// private functions + + /** + * Returns the earliest version number of the server that we can talk to + * + * @since S60 v3.1 + * @return TVersion Earliest version number we can talk to + */ + TVersion Version() const; + + /** + * Start server if it isn't running already + * + * @since S60 v3.1 + * @return TInt Standard error code, KErrNone if server was running + * already or start was succesfull + */ + TInt StartServer(); + + /** + * Create server process + * + * @since S60 v3.1 + * @return TInt standard error code, KErrNone when creation was success + */ + TInt CreateServerProcess(); + + }; + +#endif // R_CATALOGSPCCONNECTIVITYCLIENT_H + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivitydefines.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivitydefines.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,49 @@ +/* +* Copyright (c) 2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Server information that the client needs +* +*/ + + +#include + +/** Server name */ +_LIT( KCatalogsPCConnectivityServerName, + "CatalogsPCConnectivityServer" ); + +/** Semaphore that is used when creating a new server */ +_LIT( KCatalogsPCConnectivityServerSemaphoreName, + "CATALOGSPCCONNECTIVITYSemaphore" ); + +/** File that is passed to the new server-process for execution */ +_LIT( KCatalogsPCConnectivityServerFilename, + "catalogsenginepcclientfrontend" ); + +// Default message slot amount in a session +const TUint KCatalogsPCConnectivityDefaultMessageSlots = 255; + +/** Version numbers */ +const TUint KCatalogsPCConnectivityMajorVersionNumber=1; +const TUint KCatalogsPCConnectivityMinorVersionNumber=0; +const TUint KCatalogsPCConnectivityBuildVersionNumber=0; + +/** Function opcodes used in message passing between client and server */ +enum TCatalogsPCConnectivityServRqst + { + ECatalogsPCConnectivitySupportedMimeTypes = 1, + ECatalogsPCConnectivityPutData, + ECatalogsPCConnectivityGetData, + ECatalogsPCConnectivityGetSize + }; + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivityplugin.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/inc/catalogspcconnectivityplugin.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,147 @@ +/* +* Copyright (c) 2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: This plugin enables the Catalogs PC client to communicate +* with the Catalogs engine +* +*/ + + +#ifndef C_CATALOGSPCCONNECTIVITYPLUGIN_H +#define C_CATALOGSPCCONNECTIVITYPLUGIN_H + +#include "catalogspcconnectivityclient.h" + +/** + * Plugin enables Catalogs PC client to communicate with the Catalogs engine + * + * This class get requests from Catalogs PC client. It passes the requests + * to client CatalogsPCConnectivityClient + * + * @lib catalogspcconnectivityplugin + * @since S60 v3.1 + */ +class CCatalogsPCConnectivityPlugin : public CBase + { +public: + + /** + * Standard symbian object construction first phase + * + * @since S60 v3.1 + * @return CCatalogsPCConnectivityPlugin pointer + */ + IMPORT_C static CCatalogsPCConnectivityPlugin* NewL(); + + /** + * Standard symbian object constructing first phase + * + * @since S60 v3.1 + * @return CCatalogsPCConnectivityPlugin pointer + */ + IMPORT_C static CCatalogsPCConnectivityPlugin* NewLC(); + + /** + * Destructor + * + * @since S60 v3.1 + */ + IMPORT_C virtual ~CCatalogsPCConnectivityPlugin(); + + /** + * A connection is formed to the Catalogs engine pc client front-end. + * This will start up the front-end server and connect to it + * + * @return TInt Standard error code, KErrNone if connection is formed + * @since S60 v3.1 + */ + IMPORT_C TInt Connect(); + + /** + * The connection to the Catalogs engine front-end is closed + * + * @since S60 v3.1 + */ + IMPORT_C void Close(); + + /** + * All MIME types supported by this component can be asked using this method + * + * @return RPointerArray contains all supported MIME types. + * The ownership is transferred to the caller. + * Use ResetAndDestroy method to free all allocated memory + * @exeption Leaves with standard error codes + * @since S60 v3.1 + */ + IMPORT_C RPointerArray SupportedMimeTypesL(); + + /** + * A Data packet of max length 65535 (0xFFFF) bytes is synchronously + * sent to the Catalogs engine front-end. + * Usage: After PutDataL has been called, you must call GetDataL + * before you can call PutDataL again + * + * @param aMimeType Data packet MIME type + * @param aData Data buffer to read from + * @exeption Leaves with standard error codes + * KErrNotSupported if not supported MIME type + * @since S60 v3.1 + */ + IMPORT_C void PutDataL( const TDataType& aMimeType, + const CBufFlat& aData ); + + /** + * A data packet is synchronously transfered from the Catalogs front-end + * and returned to caller + * Usage: Everytime before calling GetDataL, you have to call PutDataL. + * You may not call GetData in sequentially. + * + * @since S60 v3.1 + * @param aMimeType MIME type of the received data packet + * @param aData Data buffer to write to. ExpandL function will be called + * with the correct size for aData, but not more than max length + * 65535 (OxFFFF) + * @return The reference parameters contain the return data + * @exeption Leaves with standard error codes + */ + IMPORT_C void GetDataL( TDataType& aMimeType, CBufFlat& aData ); + + +private: + +// private functions + + + /** + * Constructor + * + * @since S60 v3.1 + */ + CCatalogsPCConnectivityPlugin(); + + /** + * Standard symbian object construction second phase + */ + void ConstructL(); + + +private: // data + + /** + * Client that communicate with the CatalogsEnginePCClientFrontEnd + */ + RCatalogsPCConnectivityClient iClient; + + }; + +#endif // C_CATALOGSPCCONNECTIVITYPLUGIN_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/src/catalogspcconnectivityclient.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/src/catalogspcconnectivityclient.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,229 @@ +/* +* Copyright (c) 2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Client that communicate with CatalogsEnginePCClientFrontEnd +* +*/ + + +#include "catalogspcconnectivityclient.h" +#include "catalogspcconnectivitydefines.h" + + +// ======== MEMBER FUNCTIONS ======== + +// --------------------------------------------------------------------------- +// Constructor +// --------------------------------------------------------------------------- +// +RCatalogsPCConnectivityClient::RCatalogsPCConnectivityClient() + { + } + +// --------------------------------------------------------------------------- +// Destructor +// --------------------------------------------------------------------------- +// +RCatalogsPCConnectivityClient::~RCatalogsPCConnectivityClient() + { + } + +// --------------------------------------------------------------------------- +// Start server and create session with server +// --------------------------------------------------------------------------- +// +TInt RCatalogsPCConnectivityClient::Connect() + { + TInt err = StartServer(); + + if ( err == KErrNone ) + { + err = CreateSession( + KCatalogsPCConnectivityServerName, + Version(), + KCatalogsPCConnectivityDefaultMessageSlots ); + } + return err; + } + +// --------------------------------------------------------------------------- +// Close session (After session is closed will server be closed too) +// --------------------------------------------------------------------------- +// +void RCatalogsPCConnectivityClient::Close() + { + RHandleBase::Close(); + } + +// --------------------------------------------------------------------------- +// Give MIME types supported by this Module +// --------------------------------------------------------------------------- +// +RPointerArray RCatalogsPCConnectivityClient:: +SupportedMimeTypesL() + { + RPointerArray supportedMIMEs; + TBool isThereMore = ETrue; + TPckgBuf pckgIsThereMore; + TDataType* tempMIME = 0; + TPckgBuf pckgMIME; + + while( isThereMore ) + { + User::LeaveIfError( SendReceive( + ECatalogsPCConnectivitySupportedMimeTypes, + TIpcArgs( &pckgMIME, &pckgIsThereMore ) ) ); + isThereMore = pckgIsThereMore(); + tempMIME = new( ELeave ) TDataType( pckgMIME() ); + User::LeaveIfError( supportedMIMEs.Append( tempMIME ) ); + } + + return supportedMIMEs; + } + +// --------------------------------------------------------------------------- +// Data package from CatalogsPCConnectivityPlugin +// --------------------------------------------------------------------------- +// +void RCatalogsPCConnectivityClient::PutDataL( + const TDataType& aMimeType, const CBufFlat& aData ) + { + TInt size = aData.Size(); + + RBuf8 desData; + desData.CreateL( size ); + desData.CleanupClosePushL(); + aData.Read( 0, desData, size ); + TPckgBuf pckgMIME( aMimeType ); + + User::LeaveIfError( SendReceive( + ECatalogsPCConnectivityPutData, + TIpcArgs( &pckgMIME, &desData, size ) ) ); + + CleanupStack::Pop(); //desData + desData.Close(); + } + +// --------------------------------------------------------------------------- +// Data request from CatalogsPCConnectivityPlugin +// First ask the size from server, then give correct size CBufFlat +// --------------------------------------------------------------------------- +// +void RCatalogsPCConnectivityClient::GetDataL( + TDataType& aMimeType, CBufFlat& aData ) + { + TPckgBuf pckgSize; + TPckgBuf pckgMIME; + + User::LeaveIfError( SendReceive( + ECatalogsPCConnectivityGetSize, + TIpcArgs( &pckgMIME, &pckgSize ) ) ); + + TInt size = pckgSize(); + aMimeType = pckgMIME(); + + RBuf8 desData; + desData.CreateL( size ); + desData.CleanupClosePushL(); + + User::LeaveIfError( SendReceive( + ECatalogsPCConnectivityGetData, + TIpcArgs( &desData ) ) ); + + aData.Reset(); + aData.ExpandL( 0, size ); + aData.Write( 0, desData, size ); + + CleanupStack::Pop(); //desData + desData.Close(); + } + +// --------------------------------------------------------------------------- +// Return version number +// --------------------------------------------------------------------------- +// +TVersion RCatalogsPCConnectivityClient::Version() const + { + return( TVersion( KCatalogsPCConnectivityMajorVersionNumber, + KCatalogsPCConnectivityMinorVersionNumber, + KCatalogsPCConnectivityBuildVersionNumber ) ); + } + +// --------------------------------------------------------------------------- +// Start server if it isn't running already +// --------------------------------------------------------------------------- +// +TInt RCatalogsPCConnectivityClient::StartServer() + { + // Check if the server is already running + TFindServer findServer( KCatalogsPCConnectivityServerName ); + TFullName name; + + TInt result = findServer.Next( name ); + if ( result == KErrNone ) + { + // Server is running + return KErrNone; + } + + // Create a semaphore so we can wait while the server starts + RSemaphore semaphore; + result = semaphore.CreateGlobal( + KCatalogsPCConnectivityServerSemaphoreName, 0 ); + if ( result != KErrNone ) + { + return result; + } + + // Create new Engine service process + result = CreateServerProcess(); + if ( result != KErrNone ) + { + semaphore.Close(); + return result; + } + + // Wait while the server starts + semaphore.Wait(); + + // Semaphore has been signaled, close and return + semaphore.Close(); + + return KErrNone; + } + +// --------------------------------------------------------------------------- +// Create server process +// --------------------------------------------------------------------------- +// +TInt RCatalogsPCConnectivityClient::CreateServerProcess() + { + + RProcess server; + + TInt result = server.Create( + KCatalogsPCConnectivityServerFilename, KNullDesC ); + if ( result != KErrNone ) + { + return result; + } + + // Resume server thread and close handle + server.Resume(); + server.Close(); + + return KErrNone; + } + + +//end diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/catalogspcconnectivityplugin/src/catalogspcconnectivityplugin.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/catalogspcconnectivityplugin/src/catalogspcconnectivityplugin.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,139 @@ +/* +* Copyright (c) 2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: This plugin enables the Catalogs PC client to communicate +* with the Catalogs engine +* +*/ + + + +#include "catalogspcconnectivityplugin.h" + + + +// ======== MEMBER FUNCTIONS ======== + +// --------------------------------------------------------------------------- +// Constructor +// --------------------------------------------------------------------------- +// +CCatalogsPCConnectivityPlugin::CCatalogsPCConnectivityPlugin() + { + } + +// --------------------------------------------------------------------------- +// Empty +// --------------------------------------------------------------------------- +// +void CCatalogsPCConnectivityPlugin::ConstructL() + { + } + + +// --------------------------------------------------------------------------- +// Standard symbian object constructing first phase +// --------------------------------------------------------------------------- +// +EXPORT_C CCatalogsPCConnectivityPlugin* CCatalogsPCConnectivityPlugin::NewL() + { + CCatalogsPCConnectivityPlugin* self = + CCatalogsPCConnectivityPlugin::NewLC(); + CleanupStack::Pop( self ); + return self; + } + + +// --------------------------------------------------------------------------- +// Standard symbian object constructing first phase +// --------------------------------------------------------------------------- +// +EXPORT_C CCatalogsPCConnectivityPlugin* CCatalogsPCConnectivityPlugin::NewLC() + { + CCatalogsPCConnectivityPlugin* self = + new( ELeave ) CCatalogsPCConnectivityPlugin; + CleanupStack::PushL( self ); + self->ConstructL(); + return self; + } + +// --------------------------------------------------------------------------- +// Destructor +// --------------------------------------------------------------------------- +// +EXPORT_C CCatalogsPCConnectivityPlugin::~CCatalogsPCConnectivityPlugin() + { + iClient.Close(); + } + + +// --------------------------------------------------------------------------- +// Connect to Catalogs engine pc client front-end +// --------------------------------------------------------------------------- +// +EXPORT_C TInt CCatalogsPCConnectivityPlugin::Connect() + { + return iClient.Connect(); + } + +// --------------------------------------------------------------------------- +// Close the connection to Catalogs engine pc client front-end +// --------------------------------------------------------------------------- +// +EXPORT_C void CCatalogsPCConnectivityPlugin::Close() + { + iClient.Close(); + } + +// --------------------------------------------------------------------------- +// Give all MIME types supported by this component +// --------------------------------------------------------------------------- +// +EXPORT_C RPointerArray CCatalogsPCConnectivityPlugin:: + SupportedMimeTypesL() + { + return iClient.SupportedMimeTypesL(); + } + +// --------------------------------------------------------------------------- +// Data package from PC Client +// --------------------------------------------------------------------------- +// +EXPORT_C void CCatalogsPCConnectivityPlugin::PutDataL( + const TDataType& aMimeType, const CBufFlat& aData ) + { + iClient.PutDataL( aMimeType, aData ); + } + +// --------------------------------------------------------------------------- +// Data request from PC Client +// --------------------------------------------------------------------------- +// +EXPORT_C void CCatalogsPCConnectivityPlugin::GetDataL( + TDataType& aMimeType, CBufFlat& aData ) + { + iClient.GetDataL( aMimeType, aData ); + } + + +// ======== GLOBAL FUNCTIONS ======== + +// --------------------------------------------------------------------------- +// Dll entry point +// --------------------------------------------------------------------------- +// +GLDEF_C TInt E32Dll() + { + return( KErrNone ); + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2005 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: +* This file provides the information required for building the +* whole of SConPCConnClient +* +*/ + + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +../bld/sconpcconnclient.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/bld/def/bwinscwu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/bld/def/bwinscwu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,9 @@ +EXPORTS + ??0RSConPCConnSession@@QAE@XZ @ 1 NONAME ; RSConPCConnSession::RSConPCConnSession(void) + ??1RSConPCConnSession@@QAE@XZ @ 2 NONAME ; RSConPCConnSession::~RSConPCConnSession(void) + ?Close@RSConPCConnSession@@QAEXXZ @ 3 NONAME ; void RSConPCConnSession::Close(void) + ?Connect@RSConPCConnSession@@QAEHXZ @ 4 NONAME ; int RSConPCConnSession::Connect(void) + ?GetPacketL@RSConPCConnSession@@QAEHABVTDesC16@@ABVTDesC8@@AAPAVCBufFlat@@@Z @ 5 NONAME ; int RSConPCConnSession::GetPacketL(class TDesC16 const &, class TDesC8 const &, class CBufFlat * &) + ?PutPacketL@RSConPCConnSession@@QAEHABVTDesC16@@ABVTDesC8@@AAPAVCBufFlat@@@Z @ 6 NONAME ; int RSConPCConnSession::PutPacketL(class TDesC16 const &, class TDesC8 const &, class CBufFlat * &) + ?ResetServer@RSConPCConnSession@@QAEHXZ @ 7 NONAME ; int RSConPCConnSession::ResetServer(void) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/bld/def/eabiuu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/bld/def/eabiuu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,11 @@ +EXPORTS + _ZN18RSConPCConnSession10GetPacketLERK7TDesC16RK6TDesC8RP8CBufFlat @ 1 NONAME + _ZN18RSConPCConnSession10PutPacketLERK7TDesC16RK6TDesC8RP8CBufFlat @ 2 NONAME + _ZN18RSConPCConnSession11ResetServerEv @ 3 NONAME + _ZN18RSConPCConnSession5CloseEv @ 4 NONAME + _ZN18RSConPCConnSession7ConnectEv @ 5 NONAME + _ZN18RSConPCConnSessionC1Ev @ 6 NONAME + _ZN18RSConPCConnSessionC2Ev @ 7 NONAME + _ZN18RSConPCConnSessionD1Ev @ 8 NONAME + _ZN18RSConPCConnSessionD2Ev @ 9 NONAME + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/bld/sconpcconnclient.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/bld/sconpcconnclient.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,62 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Client side of PC Connectivity Server-Client +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_CLIENT_DLL + +TARGET sconpcconnclient.dll +TARGETTYPE dll + +UID 0x10009D8D 0x101F99F7 + +TARGETPATH sys/bin + +#if defined(ARMCC) +DEFFILE ./def/eabiu +#elif defined(WINSCW) +DEFFILE ./def/bwinscw +#elif defined(WINS) +DEFFILE ./def/bwins +#elif defined(ARM) +DEFFILE ./def/bmarm +#endif + + +SOURCEPATH ../src + +SOURCE sconpcconnclient.cpp + +// Client +USERINCLUDE ../inc +USERINCLUDE ../../../inc + +// Server +USERINCLUDE ../../../servers/pcconn/inc + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY estor.lib // RMemWriteStream +LIBRARY efsrv.lib // Rfs, RFile +DEBUGLIBRARY flogger.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/inc/sconpcconnclient.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/inc/sconpcconnclient.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,79 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity client +* +*/ + + +#ifndef __SCONPCCONNCLIENT_H__ +#define __SCONPCCONNCLIENT_H__ + +// ----------------------------------------------------------------------------- +// class RSConPCConnSession - the client session +// ----------------------------------------------------------------------------- +class RSConPCConnSession : public RSessionBase + { +public: + IMPORT_C RSConPCConnSession(); + IMPORT_C ~RSConPCConnSession(); + + /** + * Starts the server and connects to it + * @param none + * @return KerrNone or an error code + */ + IMPORT_C TInt Connect(); + + /** + * Disconnects from the server and terminates the server + * @param none + * @return none + */ + IMPORT_C void Close(); + + /** + * Passes an OBEX Put -message to the server + * @param none + * @return none + */ + IMPORT_C TInt PutPacketL( const TDesC& aNameHeader, + const TDesC8& aTypeHeader, + CBufFlat*& aBuffer ); + + /** + * Passes an OBEX Get -message to the server + * @param none + * @return none + */ + IMPORT_C TInt GetPacketL( const TDesC& aNameHeader, + const TDesC8& aTypeHeader, + CBufFlat*& aBuffer ); + + /** + * Passes an reset -message to the server + * @param none + * @return none + */ + IMPORT_C TInt ResetServer(); + +private: + TVersion Version() const; + TInt LaunchServer(); + TInt CreateAndSendChunkHandle(); + +private: + RChunk iChunk; + }; + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/pcconn/src/sconpcconnclient.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/pcconn/src/sconpcconnclient.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,304 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity client +* +*/ + + + +// ----------------------------------------------------------------------------- +// Includes +// ----------------------------------------------------------------------------- +#include +#include + +// Client - server +#include "sconpcconnclient.h" +#include "sconpcconnclientserver.h" +#include "debug.h" + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::RSConPCConnSession() +// Default constructor +// ----------------------------------------------------------------------------- +// +EXPORT_C RSConPCConnSession::RSConPCConnSession() + { + TRACE_FUNC; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::~RSConPCConnSession() +// Default destructor +// ----------------------------------------------------------------------------- +// +EXPORT_C RSConPCConnSession::~RSConPCConnSession() + { + TRACE_FUNC; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Connect() +// Creates a chunk and server, starts the server connection +// ----------------------------------------------------------------------------- +// +EXPORT_C TInt RSConPCConnSession::Connect() + { + TRACE_FUNC_ENTRY; + + TInt ret ( KErrNone ); + + ret = CreateSession(KSConPCConnServerName,Version()); + + if ( ret == KErrNotFound || ret == KErrServerTerminated ) + { + ret = LaunchServer(); + + if ( ret == KErrNone || ret == KErrAlreadyExists ) + { + ret = CreateSession( KSConPCConnServerName, Version() ); + } + } + + if ( ret == KErrNone ) + { + ret = CreateAndSendChunkHandle(); + if ( ret != KErrNone ) + { + LOGGER_WRITE("CreateAndSendChunkHandle failed, close session"); + Close(); + } + } + + LOGGER_WRITE_1( "RSConPCConnSession::Connect() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Close() +// Closes the server connection +// ----------------------------------------------------------------------------- +// +EXPORT_C void RSConPCConnSession::Close() + { + TRACE_FUNC_ENTRY; + iChunk.Close(); + RSessionBase::Close(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Version() +// Returns the version of the client +// ----------------------------------------------------------------------------- +// +TVersion RSConPCConnSession::Version(void) const + { + return (TVersion(KSConPCConnServerVersionMajor, + KSConPCConnServerVersionMinor, + KSConPCConnServerVersionBuild)); + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Version() +// Forwards a PUT -message to the server +// ----------------------------------------------------------------------------- +// +EXPORT_C TInt RSConPCConnSession::PutPacketL( + const TDesC& aNameHeader, const TDesC8& aTypeHeader, CBufFlat*& aBuffer ) + { + TRACE_FUNC_ENTRY; + + if ( !aBuffer ) + { + return KErrArgument; + } + + if ((aBuffer->Size() + aTypeHeader.Size() + + aNameHeader.Size()) > KSConPCConnChunkMaxSize) + { + LOGGER_WRITE( "RSConPCConnSession::PutPacketL() :\ + WBXML document too big" ); + return KErrTooBig; + } + + TInt ret (KErrNone); + iChunk.Adjust( KSConPCConnChunkMaxSize ); + RMemWriteStream buf( iChunk.Base(), iChunk.Size() ); + + buf.WriteInt32L( aNameHeader.Size() ); + buf.WriteL( aNameHeader ); + + buf.WriteInt32L( aTypeHeader.Size() ); + buf.WriteL( aTypeHeader ); + + // WBXML document + buf.WriteInt32L( aBuffer->Size() ); + buf.WriteL( aBuffer->Ptr(0) ); + buf.CommitL(); + buf.Close(); + + TIpcArgs args; + ret = SendReceive ( EPutMessage, args ); + + LOGGER_WRITE_1( "RSConPCConnSession::PutPacketL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Version() +// Forwards a GET -message to the server +// ----------------------------------------------------------------------------- +// +EXPORT_C TInt RSConPCConnSession::GetPacketL( + const TDesC& aNameHeader, const TDesC8& aTypeHeader, CBufFlat*& aBuffer ) + { + TRACE_FUNC_ENTRY; + + if ( !aBuffer ) + { + return KErrArgument; + } + + TInt ret (KErrNone); + + iChunk.Adjust( KSConPCConnChunkMaxSize); + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + writeBuf.WriteInt32L( aNameHeader.Size() ); + writeBuf.WriteL( aNameHeader ); + + writeBuf.WriteInt32L( aTypeHeader.Size() ); + writeBuf.WriteL( aTypeHeader ); + + writeBuf.CommitL(); + writeBuf.Close(); + + TIpcArgs args; + ret = SendReceive ( EGetMessage, args ); + + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSConPCConnSession::GetPacketL() :\ + Send Receive failed with code %d", ret ); + return ret; + }; + + // copy data from the chunk + RMemReadStream readBuf( iChunk.Base(), iChunk.Size() ); + TInt32 length ( 0 ); + + aBuffer->Reset(); + length = readBuf.ReadInt32L(); + + HBufC8* data = HBufC8::NewLC( length ); + TPtr8 dataPtr = data->Des(); + + readBuf.ReadL( dataPtr, length ); + aBuffer->ExpandL( 0, length ); + aBuffer->Write ( 0, dataPtr ); + + readBuf.Close(); + + CleanupStack::PopAndDestroy(); // data; + + LOGGER_WRITE_1( "RSConPCConnSession::GetPacketL()\ + : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::Version() +// Forwards a Reset -message to the server +// ----------------------------------------------------------------------------- +// +EXPORT_C TInt RSConPCConnSession::ResetServer() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TIpcArgs args; + ret = SendReceive ( EResetMessage, args ); + LOGGER_WRITE_1( "RSConPCConnSession::ResetServerL(): ret %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::LaunchServer() +// Launches the server +// ----------------------------------------------------------------------------- +// +TInt RSConPCConnSession::LaunchServer() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + + // Create server + RProcess p; + ret = p.Create(KSConPCConnServerExe, KNullDesC); + + if ( ret != KErrNone ) + { + // Loading failed. + LOGGER_WRITE_1( "RProcess::Create failed, err: %d", ret ); + return ret; + } + + + TRequestStatus status; + p.Rendezvous( status ); + + if ( status != KRequestPending ) + { + p.Kill(0); // abort startup + p.Close(); + LOGGER_WRITE("Abort startup, return KErrGeneral"); + return KErrGeneral; + } + else + { + p.Resume(); // logon OK - start the server + } + + User::WaitForRequest(status); + + p.Close(); + + LOGGER_WRITE_1( "RSConPCConnSession::LaunchServerL(): returned %d", status.Int() ); + return status.Int(); + } + +// ----------------------------------------------------------------------------- +// RSConPCConnSession::CreateAndSendChunkHandle() +// Creates a chunk and sends a handle to server +// ----------------------------------------------------------------------------- +// +TInt RSConPCConnSession::CreateAndSendChunkHandle() + { + TRACE_FUNC_ENTRY; + TInt err = iChunk.CreateGlobal( KNullDesC, + KSConPCConnChunkSize, + KSConPCConnChunkMaxSize ); + if ( err != KErrNone ) + { + LOGGER_WRITE_1("iChunk.CreateGlobal failed, err: %d", err); + return err; + } + TIpcArgs args; + args.Set( 0, iChunk ); + err = SendReceive( EChunkMessage, args ); + + LOGGER_WRITE_1("RSConPCConnSession::CreateAndSendChunkHandle : returned: %d", err); + return err; + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/bwins/sconsyncclientu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/bwins/sconsyncclientu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,43 @@ +EXPORTS + ??0RSconSyncSession@@QAE@XZ @ 1 NONAME ; RSconSyncSession::RSconSyncSession(void) + ??1CSconDataproviderInfo@@UAE@XZ @ 2 NONAME ; CSconDataproviderInfo::~CSconDataproviderInfo(void) + ??1RSconSyncSession@@QAE@XZ @ 3 NONAME ; RSconSyncSession::~RSconSyncSession(void) + ?AddedItemsL@RSconSyncSession@@QBEXAAV?$RArray@H@@@Z @ 4 NONAME ; void RSconSyncSession::AddedItemsL(class RArray &) const + ?CancelRequest@RSconSyncSession@@QAEXXZ @ 5 NONAME ; void RSconSyncSession::CancelRequest(void) + ?Close@RSconSyncSession@@QAEXXZ @ 6 NONAME ; void RSconSyncSession::Close(void) + ?CloseDataStore@RSconSyncSession@@QBEXXZ @ 7 NONAME ; void RSconSyncSession::CloseDataStore(void) const + ?CommitChangeInfoL@RSconSyncSession@@QAEXABV?$RArray@H@@@Z @ 8 NONAME ; void RSconSyncSession::CommitChangeInfoL(class RArray const &) + ?Connect@RSconSyncSession@@QAEHXZ @ 9 NONAME ; int RSconSyncSession::Connect(void) + ?CreateItemL@RSconSyncSession@@QAEXAAHHABVTDesC8@@11@Z @ 10 NONAME ; void RSconSyncSession::CreateItemL(int &, int, class TDesC8 const &, class TDesC8 const &, class TDesC8 const &) + ?CreateItemL@RSconSyncSession@@QAEXAAV?$TPckg@H@@HABVTDesC8@@11AAVTRequestStatus@@@Z @ 11 NONAME ; void RSconSyncSession::CreateItemL(class TPckg &, int, class TDesC8 const &, class TDesC8 const &, class TDesC8 const &, class TRequestStatus &) + ?DefaultStoreL@CSconDataproviderInfo@@QAEAAVTDesC16@@XZ @ 12 NONAME ; class TDesC16 & CSconDataproviderInfo::DefaultStoreL(void) + ?DeleteAllItems@RSconSyncSession@@QAEXAAVTRequestStatus@@@Z @ 13 NONAME ; void RSconSyncSession::DeleteAllItems(class TRequestStatus &) + ?DeleteItemL@RSconSyncSession@@QAEXH@Z @ 14 NONAME ; void RSconSyncSession::DeleteItemL(int) + ?DeletedItemsL@RSconSyncSession@@QBEXAAV?$RArray@H@@@Z @ 15 NONAME ; void RSconSyncSession::DeletedItemsL(class RArray &) const + ?DisplayNameL@CSconDataproviderInfo@@QAEAAVTDesC16@@XZ @ 16 NONAME ; class TDesC16 & CSconDataproviderInfo::DisplayNameL(void) + ?ExternalizeL@CSconDataproviderInfo@@QBEXAAVRWriteStream@@@Z @ 17 NONAME ; void CSconDataproviderInfo::ExternalizeL(class RWriteStream &) const + ?GetParent@RSconSyncSession@@QAEHHAAH@Z @ 18 NONAME ; int RSconSyncSession::GetParent(int, int &) + ?GetSyncTimeStampL@RSconSyncSession@@QBEXHHAAVTDateTime@@@Z @ 19 NONAME ; void RSconSyncSession::GetSyncTimeStampL(int, int, class TDateTime &) const + ?HasSyncHistoryL@RSconSyncSession@@QBEHXZ @ 20 NONAME ; int RSconSyncSession::HasSyncHistoryL(void) const + ?ImplementationUid@CSconDataproviderInfo@@QBE?AVTUid@@XZ @ 21 NONAME ; class TUid CSconDataproviderInfo::ImplementationUid(void) const + ?InternalizeL@CSconDataproviderInfo@@QAEXAAVRReadStream@@@Z @ 22 NONAME ; void CSconDataproviderInfo::InternalizeL(class RReadStream &) + ?ListAllImplementationsL@RSconSyncSession@@QAEXAAV?$RPointerArray@VCSconDataproviderInfo@@@@@Z @ 23 NONAME ; void RSconSyncSession::ListAllImplementationsL(class RPointerArray &) + ?ListStoresL@CSconDataproviderInfo@@QBEPAVCDesC16Array@@XZ @ 24 NONAME ; class CDesC16Array * CSconDataproviderInfo::ListStoresL(void) const + ?ModifiedItemsL@RSconSyncSession@@QBEXAAV?$RArray@H@@@Z @ 25 NONAME ; void RSconSyncSession::ModifiedItemsL(class RArray &) const + ?MoveItemL@RSconSyncSession@@QAEXHH@Z @ 26 NONAME ; void RSconSyncSession::MoveItemL(int, int) + ?MovedItemsL@RSconSyncSession@@QBEXAAV?$RArray@H@@@Z @ 27 NONAME ; void RSconSyncSession::MovedItemsL(class RArray &) const + ?NewL@CSconDataproviderInfo@@SAPAV1@XZ @ 28 NONAME ; class CSconDataproviderInfo * CSconDataproviderInfo::NewL(void) + ?OpenDataStoreL@RSconSyncSession@@QAEXHABVTDesC16@@H@Z @ 29 NONAME ; void RSconSyncSession::OpenDataStoreL(int, class TDesC16 const &, int) + ?OpenItemL@RSconSyncSession@@QAEXHAAH0AAVTDes8@@1AAVCBufFlat@@@Z @ 30 NONAME ; void RSconSyncSession::OpenItemL(int, int &, int &, class TDes8 &, class TDes8 &, class CBufFlat &) + ?ReplaceItemL@RSconSyncSession@@QAEXHHHABVTDesC8@@@Z @ 31 NONAME ; void RSconSyncSession::ReplaceItemL(int, int, int, class TDesC8 const &) + ?ReplaceItemL@RSconSyncSession@@QAEXHHHABVTDesC8@@AAVTRequestStatus@@@Z @ 32 NONAME ; void RSconSyncSession::ReplaceItemL(int, int, int, class TDesC8 const &, class TRequestStatus &) + ?ResetChangeInfoL@RSconSyncSession@@QAEXXZ @ 33 NONAME ; void RSconSyncSession::ResetChangeInfoL(void) + ?SetDefaultStoreL@CSconDataproviderInfo@@QAEXABVTDesC16@@@Z @ 34 NONAME ; void CSconDataproviderInfo::SetDefaultStoreL(class TDesC16 const &) + ?SetDisplayNameL@CSconDataproviderInfo@@QAEXABVTDesC16@@@Z @ 35 NONAME ; void CSconDataproviderInfo::SetDisplayNameL(class TDesC16 const &) + ?SetImplementationUid@CSconDataproviderInfo@@QAEXVTUid@@@Z @ 36 NONAME ; void CSconDataproviderInfo::SetImplementationUid(class TUid) + ?SetRemoteStoreFormatL@RSconSyncSession@@QAEXABVCSmlDataStoreFormat@@@Z @ 37 NONAME ; void RSconSyncSession::SetRemoteStoreFormatL(class CSmlDataStoreFormat const &) + ?SetStoresL@CSconDataproviderInfo@@QAEXABVCDesC16Array@@@Z @ 38 NONAME ; void CSconDataproviderInfo::SetStoresL(class CDesC16Array const &) + ?SoftDeleteItemL@RSconSyncSession@@QAEXH@Z @ 39 NONAME ; void RSconSyncSession::SoftDeleteItemL(int) + ?SoftDeletedItemsL@RSconSyncSession@@QBEXAAV?$RArray@H@@@Z @ 40 NONAME ; void RSconSyncSession::SoftDeletedItemsL(class RArray &) const + ?StoreFormatL@RSconSyncSession@@QAEPAVCSmlDataStoreFormat@@ABVRStringPool@@@Z @ 41 NONAME ; class CSmlDataStoreFormat * RSconSyncSession::StoreFormatL(class RStringPool const &) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/eabi/sconsyncclientu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/eabi/sconsyncclientu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,49 @@ +EXPORTS + _ZN16RSconSyncSession11CreateItemLER5TPckgIiEiRK6TDesC8S5_S5_R14TRequestStatus @ 1 NONAME + _ZN16RSconSyncSession11CreateItemLERiiRK6TDesC8S3_S3_ @ 2 NONAME + _ZN16RSconSyncSession11DeleteItemLEi @ 3 NONAME + _ZN16RSconSyncSession12ReplaceItemLEiiiRK6TDesC8 @ 4 NONAME + _ZN16RSconSyncSession12ReplaceItemLEiiiRK6TDesC8R14TRequestStatus @ 5 NONAME + _ZN16RSconSyncSession12StoreFormatLERK11RStringPool @ 6 NONAME + _ZN16RSconSyncSession13CancelRequestEv @ 7 NONAME + _ZN16RSconSyncSession14DeleteAllItemsER14TRequestStatus @ 8 NONAME + _ZN16RSconSyncSession14OpenDataStoreLEiRK7TDesC16i @ 9 NONAME + _ZN16RSconSyncSession15SoftDeleteItemLEi @ 10 NONAME + _ZN16RSconSyncSession16ResetChangeInfoLEv @ 11 NONAME + _ZN16RSconSyncSession17CommitChangeInfoLERK6RArrayIiE @ 12 NONAME + _ZN16RSconSyncSession21SetRemoteStoreFormatLERK19CSmlDataStoreFormat @ 13 NONAME + _ZN16RSconSyncSession23ListAllImplementationsLER13RPointerArrayI21CSconDataproviderInfoE @ 14 NONAME + _ZN16RSconSyncSession5CloseEv @ 15 NONAME + _ZN16RSconSyncSession7ConnectEv @ 16 NONAME + _ZN16RSconSyncSession9GetParentEiRi @ 17 NONAME + _ZN16RSconSyncSession9MoveItemLEii @ 18 NONAME + _ZN16RSconSyncSession9OpenItemLEiRiS0_R5TDes8S2_R8CBufFlat @ 19 NONAME + _ZN16RSconSyncSessionC1Ev @ 20 NONAME + _ZN16RSconSyncSessionC2Ev @ 21 NONAME + _ZN16RSconSyncSessionD1Ev @ 22 NONAME + _ZN16RSconSyncSessionD2Ev @ 23 NONAME + _ZN21CSconDataproviderInfo10SetStoresLERK12CDesC16Array @ 24 NONAME + _ZN21CSconDataproviderInfo12DisplayNameLEv @ 25 NONAME + _ZN21CSconDataproviderInfo12InternalizeLER11RReadStream @ 26 NONAME + _ZN21CSconDataproviderInfo13DefaultStoreLEv @ 27 NONAME + _ZN21CSconDataproviderInfo15SetDisplayNameLERK7TDesC16 @ 28 NONAME + _ZN21CSconDataproviderInfo16SetDefaultStoreLERK7TDesC16 @ 29 NONAME + _ZN21CSconDataproviderInfo20SetImplementationUidE4TUid @ 30 NONAME + _ZN21CSconDataproviderInfo4NewLEv @ 31 NONAME + _ZN21CSconDataproviderInfoD0Ev @ 32 NONAME + _ZN21CSconDataproviderInfoD1Ev @ 33 NONAME + _ZN21CSconDataproviderInfoD2Ev @ 34 NONAME + _ZNK16RSconSyncSession11AddedItemsLER6RArrayIiE @ 35 NONAME + _ZNK16RSconSyncSession11MovedItemsLER6RArrayIiE @ 36 NONAME + _ZNK16RSconSyncSession13DeletedItemsLER6RArrayIiE @ 37 NONAME + _ZNK16RSconSyncSession14CloseDataStoreEv @ 38 NONAME + _ZNK16RSconSyncSession14ModifiedItemsLER6RArrayIiE @ 39 NONAME + _ZNK16RSconSyncSession15HasSyncHistoryLEv @ 40 NONAME + _ZNK16RSconSyncSession17GetSyncTimeStampLEiiR9TDateTime @ 41 NONAME + _ZNK16RSconSyncSession17SoftDeletedItemsLER6RArrayIiE @ 42 NONAME + _ZNK21CSconDataproviderInfo11ListStoresLEv @ 43 NONAME + _ZNK21CSconDataproviderInfo12ExternalizeLER12RWriteStream @ 44 NONAME + _ZNK21CSconDataproviderInfo17ImplementationUidEv @ 45 NONAME + _ZTI21CSconDataproviderInfo @ 46 NONAME ; ## + _ZTV21CSconDataproviderInfo @ 47 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/group/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,28 @@ +/* +* Copyright (c) 2009-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Build information file for project SyncClient +* +*/ + + +PRJ_EXPORTS +../rom/sconsyncclient.iby CORE_APP_LAYER_IBY_EXPORT_PATH(sconsyncclient.iby) + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +sconsyncclient.mmp + +PRJ_TESTMMPFILES diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/group/sconsyncclient.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/group/sconsyncclient.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,50 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Client side of sconsyncserver +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +TARGET sconsyncclient.dll +TARGETTYPE dll + +CAPABILITY CAP_CLIENT_DLL + +UID 0x1000008d 0x2001A963 +VENDORID VID_DEFAULT + +SOURCEPATH ../src +SOURCE sconsyncclient.cpp +SOURCE scondataproviderinfo.cpp + +USERINCLUDE ../inc +USERINCLUDE ../../../inc + +// Server +USERINCLUDE ../../../servers/syncserver/inc + + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY estor.lib +LIBRARY bafl.lib +LIBRARY charconv.lib +LIBRARY smlstoreformat.lib +DEBUGLIBRARY flogger.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/inc/scondataproviderinfo.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/inc/scondataproviderinfo.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,61 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconDataproviderInfo header +* +*/ + + +#ifndef SCONDATAPROVIDERINFO_H_ +#define SCONDATAPROVIDERINFO_H_ + +#include +#include + +class RWriteStream; +class RReadStream; + +/** + * Contains information about DataSync dataprovider. + */ +class CSconDataproviderInfo : public CBase +{ +public: + IMPORT_C static CSconDataproviderInfo* NewL(); + IMPORT_C ~CSconDataproviderInfo(); + + IMPORT_C void ExternalizeL( RWriteStream& aStream ) const; + IMPORT_C void InternalizeL( RReadStream& aStream ); + + IMPORT_C TUid ImplementationUid() const; + IMPORT_C void SetImplementationUid( const TUid aUid ); + IMPORT_C TDesC& DisplayNameL(); + IMPORT_C void SetDisplayNameL( const TDesC& aName ); + IMPORT_C TDesC& DefaultStoreL(); + IMPORT_C void SetDefaultStoreL( const TDesC& aStore ); + IMPORT_C CDesCArray* ListStoresL() const; + IMPORT_C void SetStoresL( const CDesCArray& aStores ); +private: + CSconDataproviderInfo(); + void ConstructL(); + +private: + TInt iUid; + HBufC* iName; + HBufC* iDefaultStore; + CDesCArrayFlat* iStores; +}; + +typedef RPointerArray RSconDataProviderInfoArray; + +#endif /*SCONDATAPROVIDERINFO_H_*/ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/inc/sconsyncclient.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/inc/sconsyncclient.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,99 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: RSconSyncSession header +* +*/ + + +#ifndef _SCONSYNCCLIENT_H_ +#define _SCONSYNCCLIENT_H_ + +#include +#include +#include +#include + +#include "scondataproviderinfo.h" + + + +class CNSmlDataItemUidSet; + +class RSconSyncSession : public RSessionBase +{ +public: + IMPORT_C RSconSyncSession(); + IMPORT_C ~RSconSyncSession(); + + IMPORT_C TInt Connect(); + IMPORT_C void Close(); + + IMPORT_C void ListAllImplementationsL( RSconDataProviderInfoArray& aInfoArray ); + + IMPORT_C void OpenDataStoreL( const TSmlDataProviderId aProviderId, const TDesC& aStoreName, const TInt aContextId ); + + IMPORT_C void OpenItemL(TSmlDbItemUid aUid, TBool& aFieldChange, + TSmlDbItemUid& aParent, TDes8& aMimeType, TDes8& aMimeVer, + CBufFlat& aItemData ); + + IMPORT_C void CreateItemL(TSmlDbItemUid& aUid, TSmlDbItemUid aParent, + const TDesC8& aMimeType, const TDesC8& aMimeVer, const TDesC8& aData); + IMPORT_C void CreateItemL(TPckg& aUidPckg, TSmlDbItemUid aParent, + const TDesC8& aMimeType, const TDesC8& aMimeVer, const TDesC8& aData, + TRequestStatus& aStatus ); + + IMPORT_C void ReplaceItemL(TSmlDbItemUid aUid, TSmlDbItemUid aParent, + TBool aFieldChange, const TDesC8& aData); + IMPORT_C void ReplaceItemL(TSmlDbItemUid aUid, TSmlDbItemUid aParent, + TBool aFieldChange, const TDesC8& aData, + TRequestStatus& aStatus ); + + IMPORT_C void MoveItemL(TSmlDbItemUid aUid, TSmlDbItemUid aNewParent); + IMPORT_C void DeleteItemL(TSmlDbItemUid aUid); + IMPORT_C void SoftDeleteItemL(TSmlDbItemUid aUid); + IMPORT_C void DeleteAllItems( TRequestStatus& aStatus ); + + IMPORT_C TBool HasSyncHistoryL() const; + IMPORT_C void AddedItemsL( RArray& aItems ) const; + IMPORT_C void DeletedItemsL( RArray& aItems ) const; + IMPORT_C void SoftDeletedItemsL( RArray& aItems ) const; + IMPORT_C void ModifiedItemsL( RArray& aItems ) const; + IMPORT_C void MovedItemsL( RArray& aItems ) const; + + IMPORT_C void CloseDataStore() const; + + IMPORT_C void ResetChangeInfoL(); + IMPORT_C void CommitChangeInfoL(const RArray& aItems ); + + IMPORT_C void GetSyncTimeStampL( const TSmlDataProviderId aProviderId, const TInt aContextId, TDateTime& aTimeStamp ) const; + + IMPORT_C CSmlDataStoreFormat* StoreFormatL( const RStringPool& aStringPool ); + IMPORT_C void SetRemoteStoreFormatL( const CSmlDataStoreFormat& aServerDataStoreFormat ); + + + IMPORT_C void CancelRequest(); + + IMPORT_C TInt GetParent( TSmlDbItemUid aUid, TSmlDbItemUid& aParent ); +private: + TInt StartServer(); + TInt CreateAndSendChunkHandle(); +private: + RChunk iChunk; + TIpcArgs iArgs; + +}; + +#endif // _SCONSYNCCLIENT_H_ + +// End of File diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/rom/sconsyncclient.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/rom/sconsyncclient.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: IBY file for SconSyncClient +* +*/ + +#ifndef _SCONSYNCCLIENT_IBY_ +#define _SCONSYNCCLIENT_IBY_ + +#include + +file=ABI_DIR\BUILD_DIR\sconsyncclient.dll SHARED_LIB_DIR\sconsyncclient.dll + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/src/scondataproviderinfo.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/src/scondataproviderinfo.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,220 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconDataproviderInfo implementation +* +*/ + + +#include "scondataproviderinfo.h" +#include +#include +#include // for CnvUtfConverter +#include "debug.h" + +CSconDataproviderInfo::CSconDataproviderInfo() + { + } + +EXPORT_C CSconDataproviderInfo::~CSconDataproviderInfo() + { + delete iName; + delete iDefaultStore; + delete iStores; + } + +EXPORT_C CSconDataproviderInfo* CSconDataproviderInfo::NewL() + { + return new (ELeave) CSconDataproviderInfo(); + } + +EXPORT_C void CSconDataproviderInfo::ExternalizeL( RWriteStream& aStream ) const + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("iUid: 0x%x", iUid); + aStream.WriteInt32L( iUid ); + if ( iName ) + { + HBufC8* temp = CnvUtfConverter::ConvertFromUnicodeToUtf8L( iName->Des() ); + CleanupStack::PushL( temp ); + TPtrC8 tempPtr = temp->Des(); + aStream.WriteUint16L( tempPtr.Length() ); + aStream.WriteL( tempPtr ); + CleanupStack::PopAndDestroy( temp ); + } + else + { + aStream.WriteUint16L( 0 ); + } + + if ( iDefaultStore ) + { + HBufC8* temp = CnvUtfConverter::ConvertFromUnicodeToUtf8L( iDefaultStore->Des() ); + CleanupStack::PushL( temp ); + TPtrC8 tempPtr = temp->Des(); + aStream.WriteUint16L( tempPtr.Length() ); + aStream.WriteL( tempPtr ); + CleanupStack::PopAndDestroy( temp ); + } + else + { + aStream.WriteUint16L( 0 ); + } + if ( iStores ) + { + aStream.WriteUint16L( iStores->Count() ); + for ( TInt i=0; iCount(); i++ ) + { + TPtrC storePtr = (*iStores)[i]; + HBufC8* temp = CnvUtfConverter::ConvertFromUnicodeToUtf8L( storePtr ); + CleanupStack::PushL( temp ); + TPtrC8 tempPtr = temp->Des(); + aStream.WriteUint16L( tempPtr.Length() ); + if ( tempPtr.Length() > 0 ) + { + aStream.WriteL( tempPtr ); + } + CleanupStack::PopAndDestroy( temp ); + } + } + else + { + aStream.WriteUint16L( 0 ); + } + aStream.CommitL(); + TRACE_FUNC_EXIT; + } + +EXPORT_C void CSconDataproviderInfo::InternalizeL( RReadStream& aStream ) + { + TRACE_FUNC_ENTRY; + delete iName; + iName = NULL; + delete iDefaultStore; + iDefaultStore = NULL; + delete iStores; + iStores = NULL; + iStores = new ( ELeave ) CDesCArrayFlat( 1 ); + iUid = aStream.ReadInt32L(); + TInt len = aStream.ReadUint16L(); + if ( len > 0 ) + { + HBufC8* tempBuf = HBufC8::NewLC( len ); + TPtr8 tempPtr = tempBuf->Des(); + aStream.ReadL( tempPtr, len ); + + iName = CnvUtfConverter::ConvertToUnicodeFromUtf8L( tempPtr ); + CleanupStack::PopAndDestroy( tempBuf ); + } + + len = aStream.ReadUint16L(); + if ( len > 0 ) + { + HBufC8* tempBuf = HBufC8::NewLC( len ); + TPtr8 tempPtr = tempBuf->Des(); + aStream.ReadL( tempPtr, len ); + + iDefaultStore = CnvUtfConverter::ConvertToUnicodeFromUtf8L( tempPtr ); + CleanupStack::PopAndDestroy( tempBuf ); + } + + TInt storeCount = aStream.ReadUint16L(); + for (TInt i=0; i 0 ) + { + HBufC8* tempBuf8 = HBufC8::NewLC( len ); + TPtr8 tempPtr8 = tempBuf8->Des(); + aStream.ReadL( tempPtr8, len ); + + HBufC* temp = CnvUtfConverter::ConvertToUnicodeFromUtf8L( tempPtr8 ); + CleanupStack::PushL( temp ); + TPtr tempPtr = temp->Des(); + iStores->AppendL( tempPtr ); + CleanupStack::PopAndDestroy( temp ); + CleanupStack::PopAndDestroy( tempBuf8 ); + } + } + TRACE_FUNC_EXIT; + } + +EXPORT_C TUid CSconDataproviderInfo::ImplementationUid() const + { + return TUid::Uid( iUid ); + } + +EXPORT_C void CSconDataproviderInfo::SetImplementationUid( const TUid aUid ) + { + iUid = aUid.iUid; + } + +EXPORT_C TDesC& CSconDataproviderInfo::DisplayNameL() + { + if ( iName ) + { + return *iName; + } + else + { + iName = KNullDesC().AllocL(); + return *iName; + } + } + +EXPORT_C void CSconDataproviderInfo::SetDisplayNameL( const TDesC& aName ) + { + delete iName; + iName = NULL; + iName = aName.AllocL(); + } + +EXPORT_C TDesC& CSconDataproviderInfo::DefaultStoreL() + { + if ( iDefaultStore ) + { + return *iDefaultStore; + } + else + { + iDefaultStore = KNullDesC().AllocL(); + return *iDefaultStore; + } + } + +EXPORT_C void CSconDataproviderInfo::SetDefaultStoreL( const TDesC& aStore ) + { + delete iDefaultStore; + iDefaultStore = NULL; + iDefaultStore = aStore.AllocL(); + } + +EXPORT_C CDesCArray* CSconDataproviderInfo::ListStoresL() const + { + if ( !iStores ) + { + User::Leave( KErrNotFound ); + } + return iStores; + } + +EXPORT_C void CSconDataproviderInfo::SetStoresL( const CDesCArray& aStores ) + { + delete iStores; + iStores = NULL; + iStores = new ( ELeave ) CDesCArrayFlat( 1 ); + for ( TInt i=0; iAppendL( aStores[i] ); + } + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/clients/syncclient/src/sconsyncclient.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/clients/syncclient/src/sconsyncclient.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,668 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: RSconSyncSession implementation +* +*/ + + +#include "sconsyncclient.h" + +#include +#include + +#include "sconsyncclientserver.h" +#include "debug.h" + +const TInt KSConSyncChunkSize = 0xFFFF; // 65535 bytes; +const TInt KSConSyncChunkMaxSize = 0x400000; // 4194304 bytes + +EXPORT_C RSconSyncSession::RSconSyncSession() + { + TRACE_FUNC; + } + +EXPORT_C RSconSyncSession::~RSconSyncSession() + { + TRACE_FUNC; + } + +EXPORT_C TInt RSconSyncSession::Connect() + { + TRACE_FUNC_ENTRY; + TInt retryCount = 2; + TInt error = KErrNone; + while(retryCount) + { + error = CreateSession(KSconSyncServerName, TVersion(1,0,0)); + if ( error != KErrNotFound && error != KErrServerTerminated ) + { + break; + } + error = StartServer(); + if( error != KErrNone && error != KErrAlreadyExists ) + { + break; + } + --retryCount; + } + + if ( error == KErrNone ) + { + error = CreateAndSendChunkHandle(); + if ( error != KErrNone ) + { + LOGGER_WRITE("CreateAndSendChunkHandle failed, close session"); + Close(); + } + } + TRACE_FUNC_EXIT; + return error; + } + +// ----------------------------------------------------------------------------- +// RSconSyncSession::Close() +// Closes the server connection +// ----------------------------------------------------------------------------- +// +EXPORT_C void RSconSyncSession::Close() + { + TRACE_FUNC_ENTRY; + iChunk.Close(); + RSessionBase::Close(); + TRACE_FUNC_EXIT + } + +EXPORT_C void RSconSyncSession::ListAllImplementationsL( RSconDataProviderInfoArray& aInfoArray ) + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EListImplementations, args ); + + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::ListAllImplementationsL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + + // copy data from the chunk + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + TInt count( readStream.ReadUint16L() ); + LOGGER_WRITE_1("count: %d", count); + for ( TInt i=0; iInternalizeL( readStream ); + aInfoArray.AppendL( dpInfo ); + CleanupStack::Pop( dpInfo ); + } + + CleanupStack::PopAndDestroy( &readStream ); + + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::OpenDataStoreL( const TSmlDataProviderId aProviderId, const TDesC& aStoreName, TInt aContextId ) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( iChunk.Adjust( + sizeof(TInt32) + + sizeof(TInt32) + + aStoreName.Size() + + sizeof(TInt) )); + + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + writeBuf.WriteInt32L( aProviderId ); + + writeBuf.WriteInt32L( aStoreName.Length() ); + writeBuf.WriteL( aStoreName ); + + writeBuf.WriteInt32L( aContextId ); + + writeBuf.CommitL(); + writeBuf.Close(); + + TIpcArgs args; + TInt ret = SendReceive ( EOpenStore, args ); + + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::OpenDataStoreL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::OpenItemL( TSmlDbItemUid aUid, TBool& aFieldChange, + TSmlDbItemUid& aParent, TDes8& aMimeType, TDes8& aMimeVer, CBufFlat& aItemData ) + { + TRACE_FUNC_ENTRY; + TIpcArgs args( aUid ); + TInt ret = SendReceive ( EOpenItem, args ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::OpenItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + + // copy data from the chunk + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + TInt32 length ( 0 ); + + aItemData.Reset(); + length = readStream.ReadInt32L(); + + HBufC8* data = HBufC8::NewLC( length ); + TPtr8 dataPtr = data->Des(); + + readStream.ReadL( dataPtr, length ); + aItemData.ExpandL( 0, length ); + aItemData.Write ( 0, dataPtr ); + + CleanupStack::PopAndDestroy( data ); + + aFieldChange = readStream.ReadInt8L(); + + aParent = readStream.ReadInt32L(); + length = readStream.ReadInt32L(); + readStream.ReadL( aMimeType, length ); + + length = readStream.ReadInt32L(); + readStream.ReadL( aMimeVer, length ); + + CleanupStack::PopAndDestroy( &readStream ); + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::CreateItemL(TSmlDbItemUid& aUid/*, TInt aSize*/, + TSmlDbItemUid aParent, const TDesC8& aMimeType, const TDesC8& aMimeVer, + const TDesC8& aData) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( iChunk.Adjust( + sizeof(TInt32) + + sizeof(TInt32) + + aMimeType.Length() + + sizeof(TInt32) + + aMimeVer.Length() + + sizeof(TInt32) + + aData.Length() )); + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( writeBuf ); + writeBuf.WriteInt32L( aParent ); + writeBuf.WriteInt32L( aMimeType.Length() ); + writeBuf.WriteL( aMimeType ); + writeBuf.WriteInt32L( aMimeVer.Length() ); + writeBuf.WriteL( aMimeVer ); + writeBuf.WriteInt32L( aData.Length() ); + writeBuf.WriteL( aData ); + + writeBuf.CommitL(); + CleanupStack::PopAndDestroy( &writeBuf ); + + + + TPckg pckg(aUid); + iArgs = TIpcArgs( &pckg ); + + TInt ret = SendReceive ( ECreateItem, iArgs ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::CreateItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + LOGGER_WRITE_1("aUid: %d", aUid); + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::CreateItemL(TPckg& aUidPckg, + TSmlDbItemUid aParent, const TDesC8& aMimeType, const TDesC8& aMimeVer, + const TDesC8& aData, TRequestStatus& aStatus) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( iChunk.Adjust( + sizeof(TInt32) + + sizeof(TInt32) + + aMimeType.Length() + + sizeof(TInt32) + + aMimeVer.Length() + + sizeof(TInt32) + + aData.Length() )); + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( writeBuf ); + writeBuf.WriteInt32L( aParent ); + writeBuf.WriteInt32L( aMimeType.Length() ); + writeBuf.WriteL( aMimeType ); + writeBuf.WriteInt32L( aMimeVer.Length() ); + writeBuf.WriteL( aMimeVer ); + writeBuf.WriteInt32L( aData.Length() ); + writeBuf.WriteL( aData ); + + writeBuf.CommitL(); + CleanupStack::PopAndDestroy( &writeBuf ); + + iArgs = TIpcArgs( &aUidPckg ); + SendReceive( ECreateItem, iArgs, aStatus ); + + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::ReplaceItemL(TSmlDbItemUid aUid, + TSmlDbItemUid aParent, TBool aFieldChange, const TDesC8& aData) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( iChunk.Adjust( + sizeof(TInt32) + + sizeof(TInt32) + + sizeof(TInt8) + + sizeof(TInt32) + + aData.Length() )); + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( writeBuf ); + writeBuf.WriteInt32L( aUid ); + writeBuf.WriteInt32L( aParent ); + writeBuf.WriteInt8L( aFieldChange ); + writeBuf.WriteInt32L( aData.Length() ); + writeBuf.WriteL( aData ); + writeBuf.CommitL(); + CleanupStack::PopAndDestroy( &writeBuf ); + + TIpcArgs args; + TInt ret = SendReceive( EReplaceItem, args ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::ReplaceItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::ReplaceItemL(TSmlDbItemUid aUid, + TSmlDbItemUid aParent, TBool aFieldChange, const TDesC8& aData, + TRequestStatus& aStatus) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( iChunk.Adjust( + sizeof(TInt32) + + sizeof(TInt32) + + sizeof(TInt8) + + sizeof(TInt32) + + aData.Length() )); + RMemWriteStream writeBuf( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( writeBuf ); + writeBuf.WriteInt32L( aUid ); + writeBuf.WriteInt32L( aParent ); + writeBuf.WriteInt8L( aFieldChange ); + writeBuf.WriteInt32L( aData.Length() ); + writeBuf.WriteL( aData ); + writeBuf.CommitL(); + CleanupStack::PopAndDestroy( &writeBuf ); + + TIpcArgs args; + SendReceive( EReplaceItem, args, aStatus ); + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::MoveItemL( TSmlDbItemUid aUid, TSmlDbItemUid aNewParent ) + { + TRACE_FUNC_ENTRY; + + TIpcArgs args(aUid, aNewParent); + TInt ret = SendReceive ( EMoveItem, args ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::MoveItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::DeleteItemL( TSmlDbItemUid aUid ) + { + TRACE_FUNC_ENTRY; + + TIpcArgs args( aUid ); + TInt ret = SendReceive ( EDeleteItem, args ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::DeleteItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + TRACE_FUNC_EXIT; + } + + +EXPORT_C void RSconSyncSession::SoftDeleteItemL( TSmlDbItemUid aUid ) + { + TRACE_FUNC_ENTRY; + + TIpcArgs args( aUid ); + TInt ret = SendReceive ( ESoftDeleteItem, args ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "RSconSyncSession::SoftDeleteItemL() :\ + Send Receive failed with code %d", ret ); + User::Leave( ret ); + }; + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::DeleteAllItems( TRequestStatus& aStatus ) + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + SendReceive( EDeleteAllItems, args, aStatus ); + TRACE_FUNC_EXIT; + } + + +EXPORT_C TBool RSconSyncSession::HasSyncHistoryL() const + { + TRACE_FUNC; + TBool history(EFalse); + TPckg pck(history); + TIpcArgs args(&pck); + TInt ret = SendReceive ( EHasHistory, args ); + User::LeaveIfError( ret ); + TRACE_FUNC_EXIT; + return history; + } + +EXPORT_C void RSconSyncSession::AddedItemsL( RArray& aItems) const + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EAddedItems, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + aItems.Reset(); + TInt itemCount = readStream.ReadInt32L(); + for (TInt i=0; i& aItems) const + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EDeletedItems, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + aItems.Reset(); + TInt itemCount = readStream.ReadInt32L(); + for (TInt i=0; i& aItems) const + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( ESoftDeletedItems, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + aItems.Reset(); + TInt itemCount = readStream.ReadInt32L(); + for (TInt i=0; i& aItems) const + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EModifiedItems, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + aItems.Reset(); + TInt itemCount = readStream.ReadInt32L(); + for (TInt i=0; i& aItems) const + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EMovedItems, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + aItems.Reset(); + TInt itemCount = readStream.ReadInt32L(); + for (TInt i=0; i& aItems ) + { + TRACE_FUNC_ENTRY; + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + LOGGER_WRITE_1("items count: %d", aItems.Count()); + stream.WriteInt32L( aItems.Count() ); + for (TInt i=0; i < aItems.Count(); i++ ) + { + LOGGER_WRITE("Write item"); + stream.WriteInt32L( aItems[i] ); + } + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + + TIpcArgs args; + TInt ret = SendReceive ( ECommitChangeInfo, args ); + User::LeaveIfError( ret ); + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::GetSyncTimeStampL( const TSmlDataProviderId aProviderId, const TInt aContextId, TDateTime& aTimeStamp ) const + { + TRACE_FUNC_ENTRY; + + TPckg timeBuf( aTimeStamp ); + TIpcArgs args( aProviderId, aContextId, &timeBuf ); + TInt ret = SendReceive ( EGetSyncTimeStamp, args ); + User::LeaveIfError( ret ); + + TRACE_FUNC_EXIT; + } + +EXPORT_C CSmlDataStoreFormat* RSconSyncSession::StoreFormatL( const RStringPool& aStringPool ) + { + TRACE_FUNC_ENTRY; + TIpcArgs args; + TInt ret = SendReceive ( EExportStoreFormat, args ); + User::LeaveIfError( ret ); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + TInt len = readStream.ReadInt32L(); + LOGGER_WRITE_1("data size from server: %d", len); + LOGGER_WRITE("CSmlDataStoreFormat::NewLC"); + CSmlDataStoreFormat* tempStoreFormat = CSmlDataStoreFormat::NewLC( aStringPool, readStream ); + LOGGER_WRITE("CSmlDataStoreFormat::NewLC -ok"); + CleanupStack::Pop( tempStoreFormat ); + + LOGGER_WRITE("PopAndDestroy( &readStream )"); + CleanupStack::PopAndDestroy( &readStream ); + LOGGER_WRITE("return"); + TRACE_FUNC_EXIT; + return tempStoreFormat; + } + +EXPORT_C void RSconSyncSession::SetRemoteStoreFormatL( const CSmlDataStoreFormat& aServerDataStoreFormat ) + { + TRACE_FUNC_ENTRY; + const TInt KMaximumDataStoreFormatSize = 100000; // 100kb should be enought + User::LeaveIfError( iChunk.Adjust( KMaximumDataStoreFormatSize )); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + + aServerDataStoreFormat.ExternalizeL( stream ); + + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + + TIpcArgs args; + TInt ret = SendReceive ( ESetRemoteStoreFormat, args ); + User::LeaveIfError( ret ); + TRACE_FUNC_EXIT; + } + +EXPORT_C void RSconSyncSession::CancelRequest() + { + TRACE_FUNC_ENTRY; + SendReceive( ECancelRequest, TIpcArgs() ); + TRACE_FUNC_EXIT; + } + +EXPORT_C TInt RSconSyncSession::GetParent( TSmlDbItemUid aUid, TSmlDbItemUid& aParent ) + { + TRACE_FUNC_ENTRY; + TPckg pckg(aParent); + TIpcArgs args( aUid, &pckg ); + TInt ret = SendReceive( EReadParent, args ); + TRACE_FUNC_EXIT; + return ret; + } + +TInt RSconSyncSession::StartServer() + { + TRACE_FUNC_ENTRY; + + RProcess server; + TInt error = server.Create(KSconSyncServerExe, KNullDesC); + if ( error != KErrNone ) + { + return error; + } + // start server and wait for signal before proceeding + TRequestStatus status; + server.Rendezvous(status); + if ( status.Int() != KRequestPending ) + { + server.Kill(0); + } + else + { + server.Resume(); + } + + User::WaitForRequest( status ); + error = server.ExitType() == EExitPanic ? KErrGeneral : status.Int(); + server.Close(); + TRACE_FUNC_EXIT; + return error; + } + +// ----------------------------------------------------------------------------- +// RSconSyncSession::CreateAndSendChunkHandle() +// Creates a chunk and sends a handle to server +// ----------------------------------------------------------------------------- +// +TInt RSconSyncSession::CreateAndSendChunkHandle() + { + TRACE_FUNC_ENTRY; + + TInt err = iChunk.CreateGlobal( KNullDesC, + KSConSyncChunkSize, + KSConSyncChunkMaxSize ); + if ( err != KErrNone ) + { + LOGGER_WRITE_1("iChunk.CreateGlobal failed, err: %d", err); + return err; + } + TIpcArgs args; + args.Set( 0, iChunk ); + err = SendReceive( ESendChunkHandle, args ); + + LOGGER_WRITE_1("RSconSyncSession::CreateAndSendChunkHandle : returned: %d", err); + return err; + } + +// End of File diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,28 @@ +/* +* Copyright (c) 2002-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser Client-Server build information file. +* +*/ + + + +PRJ_PLATFORMS +DEFAULT + + +PRJ_MMPFILES +cntparsersrv.mmp +cntparsersrvexe.mmp + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/bld/cntparsersrv.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/bld/cntparsersrv.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,60 @@ +/* +* Copyright (c) 2002-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser Client +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_CLIENT_DLL + +TARGET cntparserserver.dll +TARGETTYPE dll + +UID 0x10009d8d 0x101F99F8 + +#if defined(ARMCC) +DEFFILE ./def/eabiu +#elif defined(WINSCW) +DEFFILE ./def/bwinscw +#elif defined(WINS) +DEFFILE ./def/bwins +#elif defined(ARM) +DEFFILE ./def/bmarm +#endif + +SOURCEPATH ../src +SOURCE cntparserclient.cpp +SOURCE cntparserinfolog.cpp + +USERINCLUDE ../inc +USERINCLUDE ../../inc + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY cntmodel.lib +LIBRARY efsrv.lib +LIBRARY estor.lib +LIBRARY versit.lib +LIBRARY vcard.lib +LIBRARY bafl.lib +DEBUGLIBRARY flogger.lib + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/bld/cntparsersrvexe.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/bld/cntparsersrvexe.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,50 @@ +/* +* Copyright (c) 2002-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser Server +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_SERVER + +TARGET cntparserserverexe.exe +TARGETTYPE exe + +UID 0 0x101F99F9 + +SOURCEPATH ../src +SOURCE cntparserserverexe.cpp +SOURCE cntparserserversession.cpp +SOURCE cntparsercollector.cpp + +USERINCLUDE ../inc +USERINCLUDE ../../inc + +// Default system include paths +APP_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY cntmodel.lib +LIBRARY efsrv.lib +LIBRARY estor.lib +LIBRARY versit.lib +LIBRARY vcard.lib +LIBRARY bafl.lib +DEBUGLIBRARY flogger.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/bld/def/bwinscwu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/bld/def/bwinscwu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,18 @@ +EXPORTS + ??0RCntParserServer@@QAE@XZ @ 1 NONAME ; RCntParserServer::RCntParserServer(void) + ?Cancel@RCntParserServer@@QAEHXZ @ 2 NONAME ; int RCntParserServer::Cancel(void) + ?CancelAll@RCntParserServer@@QAEHXZ @ 3 NONAME ; int RCntParserServer::CancelAll(void) + ?Connect@RCntParserServer@@QAEHXZ @ 4 NONAME ; int RCntParserServer::Connect(void) + ?ContactsParsed@RCntParserServer@@QAEHXZ @ 5 NONAME ; int RCntParserServer::ContactsParsed(void) + ?ContactsSaved@RCntParserServer@@QAEHXZ @ 6 NONAME ; int RCntParserServer::ContactsSaved(void) + ?CreateIrMCL2PhoneBook@RCntParserServer@@QAEHHH@Z @ 7 NONAME ; int RCntParserServer::CreateIrMCL2PhoneBook(int, int) + ?Disconnect@RCntParserServer@@QAEHXZ @ 8 NONAME ; int RCntParserServer::Disconnect(void) + ?MaximumRecords@CCntParserInfoLog@@QBEHXZ @ 9 NONAME ; int CCntParserInfoLog::MaximumRecords(void) const + ?NewL@CCntParserInfoLog@@SAPAV1@XZ @ 10 NONAME ; class CCntParserInfoLog * CCntParserInfoLog::NewL(void) + ?SaveToFileL@CCntParserInfoLog@@QBEXABVTDesC16@@@Z @ 11 NONAME ; void CCntParserInfoLog::SaveToFileL(class TDesC16 const &) const + ?SetMaximumRecords@CCntParserInfoLog@@QAEXH@Z @ 12 NONAME ; void CCntParserInfoLog::SetMaximumRecords(int) + ?SetTotalRecords@CCntParserInfoLog@@QAEXH@Z @ 13 NONAME ; void CCntParserInfoLog::SetTotalRecords(int) + ?TotalNumberOfContacts@RCntParserServer@@QAEHXZ @ 14 NONAME ; int RCntParserServer::TotalNumberOfContacts(void) + ?TotalRecords@CCntParserInfoLog@@QBEHXZ @ 15 NONAME ; int CCntParserInfoLog::TotalRecords(void) const + ?Version@RCntParserServer@@QBE?AVTVersion@@XZ @ 16 NONAME ; class TVersion RCntParserServer::Version(void) const + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/bld/def/eabiuu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/bld/def/eabiuu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,21 @@ +EXPORTS + _ZN16RCntParserServer10DisconnectEv @ 1 NONAME + _ZN16RCntParserServer13ContactsSavedEv @ 2 NONAME + _ZN16RCntParserServer14ContactsParsedEv @ 3 NONAME + _ZN16RCntParserServer21CreateIrMCL2PhoneBookEii @ 4 NONAME + _ZN16RCntParserServer21TotalNumberOfContactsEv @ 5 NONAME + _ZN16RCntParserServer6CancelEv @ 6 NONAME + _ZN16RCntParserServer7ConnectEv @ 7 NONAME + _ZN16RCntParserServer9CancelAllEv @ 8 NONAME + _ZN16RCntParserServerC1Ev @ 9 NONAME + _ZN16RCntParserServerC2Ev @ 10 NONAME + _ZN17CCntParserInfoLog15SetTotalRecordsEi @ 11 NONAME + _ZN17CCntParserInfoLog17SetMaximumRecordsEi @ 12 NONAME + _ZN17CCntParserInfoLog4NewLEv @ 13 NONAME + _ZNK16RCntParserServer7VersionEv @ 14 NONAME + _ZNK17CCntParserInfoLog11SaveToFileLERK7TDesC16 @ 15 NONAME + _ZNK17CCntParserInfoLog12TotalRecordsEv @ 16 NONAME + _ZNK17CCntParserInfoLog14MaximumRecordsEv @ 17 NONAME + _ZTI17CCntParserInfoLog @ 18 NONAME ; ## + _ZTV17CCntParserInfoLog @ 19 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/clientserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/clientserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,45 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser Server definitions +* +*/ + + +#ifndef __CLIENTSERVER_H__ +#define __CLIENTSERVER_H__ +#include + +// server name +_LIT(KCntParserName,"Contacts Parser"); + +// A version must be specified when creating a session with the server + +const TUint KCntParserMajorVersionNumber=0; +const TUint KCntParserMinorVersionNumber=1; +const TUint KCntParserBuildVersionNumber=1; + +// opcodes used in message passing between client and server +enum TCntParserRqst + { + ECntParserServerCancel, + ECntParserServerClose, + ECntParserServerCreateIrMCL2, + ECntParserServerTotalNumOfContacts, + ECntParserServerDisconnect, + ECntParserServerCntParsed, + ECntParserServerCntSaved, + ECntParserServerCancelAll + }; + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/cntparserclient.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/cntparserclient.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,56 @@ +/* +* Copyright (c) 2002-2005 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser Client +* +*/ + + + +#if !defined(__CNTPARSERCLIENT_H__) +#define __CNTPARSERCLIENT_H__ + +#include +#include + +enum TCntParserConnection +{ + ECntParserNotConnected, + ECntParserConnected +}; + +//********************************** +//RCntParserServer +//********************************** + +class RCntParserServer : public RSessionBase +{ + public: + IMPORT_C RCntParserServer(); + IMPORT_C TInt Connect(); + IMPORT_C TInt Disconnect(); + IMPORT_C TVersion Version() const; + IMPORT_C TInt CreateIrMCL2PhoneBook(TInt aMaxNumberOfContacts, TBool aForced); + IMPORT_C TInt ContactsParsed(); + IMPORT_C TInt ContactsSaved(); + IMPORT_C TInt TotalNumberOfContacts(); + IMPORT_C TInt Cancel(); //cancels phonebook request + IMPORT_C TInt CancelAll(); //cancels all request + + private: + TCntParserConnection iConnected; +}; + + +#endif + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/cntparsercollector.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/cntparsercollector.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,76 @@ +/* +* Copyright (c) 2002-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserCollector header +* +*/ + + + +#ifndef __CNTPARSERCOLLECTOR_H__ +#define __CNTPARSERCOLLECTOR_H__ + +#include +#include + +class CCntParserServer; +class CContactDatabase; +class CContactIdArray; +class CCntFilter; +class CVersitTlsData; + +class CCntParserCollector : public CActive +{ + public: + + CCntParserCollector(); + static CCntParserCollector* NewL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase); + static CCntParserCollector* NewLC(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase); + virtual ~CCntParserCollector(); + void ConstructL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase); + TInt CreateIrMCL2FileL(const TDesC& aFileName,TInt aMaxNumberOfContacts,TBool aForced); + void PrepareParserL(); + void ParseCntDatabaseL(); + void DoCancel(); + + TInt CurrentItem(); + TInt Count(); + TInt ContactsSaved(); + + protected: + void RunL(); + TInt RunError(TInt aError); + void ExternalizeCurrentContactL(CContactDatabase* aContactsDb,TInt aCurrentItem,TBool ExternalizeEmpty); + void CloseResources(); + void SaveTotalCountL(); + TInt ReadTotalCountL() const; + TBool ContactCountChanged(); + + private: + CContactDatabase* iContactsDb; //Caller has the ownership + TInt iCurrentItem; + TInt iCount; //Contacts in CDB + TInt iMaxNumberOfContacts; //Max contacts to be parsed (MAXIMUM RECORDS in info.log) + RFileWriteStream iWriter; + CContactIdArray* iIds; //List of ID numbers of contacts + CCntParserServer* iServer; //Caller has the ownership + CCntFilter* iFilter; + CVersitTlsData* iVersitTLS; //For speed optimization + TBool iCancel; + TInt iContactsSaved; + TInt iTotalCount; + + RFs iFsSession; +}; + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/cntparserinfolog.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/cntparserinfolog.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,50 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserInfoLog header. +* This class is intended to create the INFO.LOG file for RANSI car phone when +* downloading contacts using IrMC L2. The implementation contains only mandatory +* needs and some extension possibilities. This class is RANSI specific and +* should _NOT_ be used by anyone else without a deeper knowledge. +* +*/ + + +#ifndef _CNTPARSERINFOLOG_H_ +#define _CNTPARSERINFOLOG_H_ + + +class CCntParserInfoLog : public CBase +{ + public: + CCntParserInfoLog(); + virtual ~CCntParserInfoLog(); + IMPORT_C static CCntParserInfoLog* NewL(); + void ConstructL(); + + IMPORT_C void SaveToFileL(const TDesC& aFileName) const; + + IMPORT_C void SetTotalRecords(TInt aTotalRecords); + IMPORT_C void SetMaximumRecords(TInt aMaximumRecords); + + IMPORT_C TInt TotalRecords() const; + IMPORT_C TInt MaximumRecords() const; + + private: + + TInt iTotalRecords; + TInt iLastUsedIndex; + TInt iMaximumRecords; +}; + +#endif // _CNTPARSERINFOLOG_H_ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/cntparserserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/cntparserserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,95 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserServer header +* +*/ + + +#ifndef __CNTPARSERSERVER_H__ +#define __CNTPARSERSERVER_H__ + +#include +#include + +class CCntParserCollector; +class CContactDatabase; + +_LIT(KTxtServer,"CntParserServerExe.exe"); + +// needed for creating server thread. +const TUint KDefaultHeapSize=0x10000; + +// reasons for server panic +enum TCntParserServerPanic +{ + EBadRequest, + EBadDescriptor, + EMainSchedulerError, + ESvrCreateServer, + ESvrStartServer, + ECreateTrapCleanup, + ENotImplementedYet, +}; + + +//********************************** +//CCntParserServer +//********************************** +class CCntParserServer : public CServer2 +{ + public: + IMPORT_C static CCntParserServer* NewL(); + IMPORT_C virtual ~CCntParserServer(); + static TInt RunServer(); + static void RunServerL(); + void IncreaseSessionCountL(); + void DecreaseSessionCount(); + void Stop(); + + TInt CreateIrMCL2PhoneBookL(const TDesC& path, TInt aMaxNumberOfContacts,TBool aForced); + void PrepareCollectorL(); + TInt ContactsParsed(); + void CancelPhoneBookRequest(); + void CancelAllPhoneBookRequests(); + TInt TotalNumOfContacts(); + TInt ContactsSaved(); + void Disconnect(); + void CompletePhoneBookRequests(TInt aErr); + void SetRequests(TInt aRequests); + + protected: + virtual CSession2* NewSessionL(const TVersion &aVersion, const RMessage2& aMsg) const; + + + protected: + CCntParserServer(); + + + private: + TInt iSessionCount; + TInt iRequests; //How many PB.VCF requests are ongoing, if 0 collector is canceled + + CCntParserCollector* iCollector; + CContactDatabase* iCurrentDatabase; +}; + +//********************************** +//global functions +//********************************** + +// function to panic the server +GLREF_C void PanicServer(TCntParserServerPanic aPanic); + + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/cntparserserversession.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/cntparserserversession.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,57 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserServerSession header +* +*/ + + +#ifndef __CNTPARSERSERVERSESSION_H__ +#define __CNTPARSERSERVERSESSION_H__ + +#include "clientserver.h" +#include "cntparserclient.h" +#include "cntparserserver.h" +#include "cntparsercollector.h" + +class CCntParserServer; + +//********************************** +//CCntParserServerSession +//********************************** +class CCntParserServerSession : public CSession2 +{ + public: + static CCntParserServerSession* NewL(CCntParserServer* aServer); + virtual ~CCntParserServerSession(); + void ConstructL(CCntParserServer* aServer); + + private: + CCntParserServerSession(); + + public: + virtual void ServiceL(const RMessage2& aMessage); + TInt DispatchMessageL(const RMessage2& aMessage); + void CompletePhoneBookRequest(TInt aErr); + + protected: + // panic the client + void PanicClient(TInt aPanic) const; + + private: + CCntParserServer* iContactsParserSrv; + TBool iPhoneBookRequest; + RMessage2 iPhoneBookRequestMessage; +}; + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/inc/irmcconsts.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/inc/irmcconsts.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,27 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Contact Parser constants +* +*/ + + +#ifndef _IRMCCONSTS_H_ +#define _IRMCCONSTS_H_ + +_LIT(KPhoneBookFilename,"c:\\IrMC\\pb.vcf"); +const TInt KMaximumNumberOfContacts=-1; //-1 == all contacts are transferred +const TInt KPBNotUpdated=1; //Must be grater than 0 +const TInt KPerformComplete=2; //Must be grater than 0 and different than KPBNotUpdated + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/src/cntparserclient.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/src/cntparserclient.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,252 @@ +/* +* Copyright (c) 2002-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: RCntParserServer implementation. +* +*/ + + +// needed for client interface +#include "clientserver.h" +#include "cntparserserver.h" +#include "cntparserclient.h" + +#include "debug.h" + +const TUint KDefaultMessageSlots=4; + + +//------------------------------------------------------------ +// RCntParserServer::RCntParserServer() +//------------------------------------------------------------ +EXPORT_C RCntParserServer::RCntParserServer():iConnected(ECntParserNotConnected) + { + } +//------------------------------------------------------------ +// RCntParserServer::Connect() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::Connect() + { + LOGGER_ENTERFN( "RCntParserServer::Connect()" ); + + TInt r = KErrNone; + + if( iConnected == ECntParserNotConnected ) + { + r = CreateSession( KCntParserName, Version(), KDefaultMessageSlots ); + if(r==KErrNone) + { + iConnected=ECntParserConnected; + } + else + { + RProcess p; + TInt err = p.Create(KTxtServer, KNullDesC); + if ( err != KErrNone ) + { + // Loading failed. + return err; + } + TRequestStatus status; + p.Rendezvous( status ); + if( status != KRequestPending ) + { + p.Kill(0); // abort startup + p.Close(); + return KErrGeneral; // status can be KErrNone: don't return status.Int() + } + else + { + p.Resume(); // logon OK - start the server + } + + User::WaitForRequest( status ); + + if( status != KErrNone ) + { + p.Close(); + return status.Int(); + } + + r = CreateSession( KCntParserName, Version() ); + if( r == KErrNone ) + { + iConnected = ECntParserConnected; + } + p.Close(); + } + } + else + { + r = KErrCouldNotConnect; + } + LOGGER_WRITE_1( "RCntParserServer::Connect() : return %d", r ); + return r; + } +//------------------------------------------------------------ +// RCntParserServer::Disconnect() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::Disconnect() + { + LOGGER_ENTERFN( "RCntParserServer::Disconnect()" ); + + TInt res = KErrNone; + if(iConnected==ECntParserConnected) + { + res = SendReceive( ECntParserServerDisconnect, TIpcArgs(NULL) ); + if( res == KErrNone ) + { + iConnected = ECntParserNotConnected; + RSessionBase::Close(); + } + } + else + { + res = KErrCouldNotDisconnect; + } + LOGGER_WRITE_1( "RCntParserServer::CreateIrMCL2PhoneBook() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::Version(void) const +//------------------------------------------------------------ +EXPORT_C TVersion RCntParserServer::Version(void) const + { + return(TVersion(KCntParserMajorVersionNumber,KCntParserMinorVersionNumber,KCntParserBuildVersionNumber)); + } +//------------------------------------------------------------ +// RCntParserServer::CreateIrMCL2PhoneBook(TInt aMaxNumberOfContacts, TBool aForced) +//------------------------------------------------------------ +EXPORT_C int RCntParserServer::CreateIrMCL2PhoneBook(TInt aMaxNumberOfContacts, TBool aForced) + { + LOGGER_ENTERFN( "RCntParserServer::CreateIrMCL2PhoneBook()" ); + TInt res(KErrNone); + if( iConnected == ECntParserConnected ) + { + res = SendReceive(ECntParserServerCreateIrMCL2,TIpcArgs(aMaxNumberOfContacts,aForced)); + } + else + { + res = KErrNotReady; + } + LOGGER_WRITE_1( "RCntParserServer::CreateIrMCL2PhoneBook() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::ContactsParsed() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::ContactsParsed() + { + LOGGER_ENTERFN( "RCntParserServer::ContactsParsed()" ); + + TInt res=KErrNone; + if( iConnected == ECntParserConnected ) + { + TPckgBuf pckg; + res = SendReceive(ECntParserServerCntParsed,TIpcArgs(&pckg)); + if( res == KErrNone ) + { + res = pckg(); + } + } + else + { + res = KErrNotReady; + } + LOGGER_WRITE_1( "RCntParserServer::ContactsParsed() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::TotalNumberOfContacts() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::TotalNumberOfContacts() + { + LOGGER_ENTERFN( "RCntParserServer::TotalNumberOfContacts()" ); + + TInt res = KErrNone; + if( iConnected == ECntParserConnected ) + { + TPckgBuf pckg; + res = SendReceive(ECntParserServerTotalNumOfContacts,TIpcArgs(&pckg)); + if( res == KErrNone) + { + res = pckg(); + } + } + else + { + res = KErrNotReady; + } + LOGGER_WRITE_1( "RCntParserServer::TotalNumberOfContacts() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::Cancel() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::Cancel() + { + LOGGER_ENTERFN( "RCntParserServer::Cancel()" ); + + TInt res = KErrNone; + if( iConnected == ECntParserConnected ) + { + res = SendReceive(ECntParserServerCancel,TIpcArgs(NULL)); + } + else + { + res = KErrCancel; + } + LOGGER_WRITE_1( "RCntParserServer::Cancel() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::CancelAll() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::CancelAll() + { + LOGGER_ENTERFN( "RCntParserServer::CancelAll()" ); + + TInt res = KErrNone; + if(iConnected==ECntParserConnected) + { + res = SendReceive(ECntParserServerCancelAll,TIpcArgs(NULL)); + } + else + { + res = KErrCancel; + } + LOGGER_WRITE_1( "RCntParserServer::CancelAll() : return %d", res ); + return res; + } +//------------------------------------------------------------ +// RCntParserServer::ContactsSaved() +//------------------------------------------------------------ +EXPORT_C TInt RCntParserServer::ContactsSaved() + { + LOGGER_ENTERFN( "RCntParserServer::ContactsSaved()" ); + + TInt res = KErrNone; + if( iConnected == ECntParserConnected ) + { + TPckgBuf pckg; + SendReceive(ECntParserServerCntSaved,TIpcArgs(&pckg)); + res = pckg(); + } + else + { + res = KErrNotReady; + } + LOGGER_WRITE_1( "RCntParserServer::ContactsSaved() : return %d", res ); + return res; + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/src/cntparsercollector.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/src/cntparsercollector.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,620 @@ +/* +* Copyright (c) 2002-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserCollector implementation. +* +*/ + + + +#include +#include +#include + +#include +#include +#include + +#include "cntparsercollector.h" +#include "cntparserserver.h" +#include "irmcconsts.h" +#include "debug.h" + +//Next values are defined in cntdef.h +const TUid typesToBeSearched[]={{KUidContactFieldPhoneNumberValue},{KUidContactFieldFaxValue}}; + +_LIT( KTotalCountFilePath, "count.txt" ); + +_LIT8( KNameProperty, "N" ); +_LIT8( KTelProperty, "TEL" ); + + +//------------------------------------------------------------ +// CCntParserCollector::CCntParserCollector():CActive( 0 ) +//------------------------------------------------------------ +CCntParserCollector::CCntParserCollector():CActive( 0 ) + { + } +//------------------------------------------------------------ +// CCntParserCollector::~CCntParserCollector() +//------------------------------------------------------------ +CCntParserCollector::~CCntParserCollector() + { + LOGGER_ENTERFN( "CntParserCollector::~CCntParserCollector()" ); + + if( iVersitTLS != NULL ) + { + iVersitTLS->VersitTlsDataClose(); //Close reference + } + LOGGER_WRITE( "CntParserCollector: Versit OK!" ); + + iFsSession.Close(); + LOGGER_WRITE( "CntParserCollector: FsSession OK!" ); + iWriter.Close(); + LOGGER_WRITE( "CntParserCollector: iWriter OK!" ); + delete iFilter; + LOGGER_LEAVEFN( "CntParserCollector::~CCntParserCollector()" ); + } +//------------------------------------------------------------ +// CCntParserCollector::NewL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) +//------------------------------------------------------------ +CCntParserCollector* CCntParserCollector::NewL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) + { + CCntParserCollector* self=NewLC(aServer, aCurrentDatabase); + CleanupStack::Pop(); + return self; + } +//------------------------------------------------------------ +// CCntParserCollector::NewLC(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) +//------------------------------------------------------------ +CCntParserCollector* CCntParserCollector::NewLC(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) + { + CCntParserCollector* self=new (ELeave) CCntParserCollector(); + CleanupStack::PushL( self ); + self->ConstructL( aServer, aCurrentDatabase ); + return self; + } +//------------------------------------------------------------ +// CCntParserCollector::ConstructL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) +//------------------------------------------------------------ +void CCntParserCollector::ConstructL(CCntParserServer* aServer,CContactDatabase* aCurrentDatabase) + { + LOGGER_WRITE( "CntParserCollector: ConstructL" ); + + CVersitTlsData& VersitTLS = CVersitTlsData::VersitTlsDataL(); //For speed optimization take a reference to TLS, SEE DESTRUCTOR!! + iVersitTLS = &VersitTLS; + + iServer = aServer; + iContactsDb = aCurrentDatabase; + PrepareParserL(); + + CActiveScheduler::Add(this); + } +//------------------------------------------------------------ +// CCntParserCollector::CreateIrMCL2FileL(const TDesC& aFileName, TInt aMaxNumberOfContacts,TBool aForced) +//------------------------------------------------------------ +TInt CCntParserCollector::CreateIrMCL2FileL(const TDesC& aFileName, TInt aMaxNumberOfContacts,TBool aForced) + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL" ); + LOGGER_WRITE_1( "CCntParserCollector::CreateIrMCL2FileL aFileName %S", &aFileName ); + + iMaxNumberOfContacts = aMaxNumberOfContacts; + + CContactIdArray* changedItems; + TTime tTime; + + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: Does the PB.VCF already exist" ); + + //Is there a previously created pb.vcf file? + RFile file; + TInt err = file.Open( iFsSession, aFileName, EFileShareExclusive ); //Open file + if( err == KErrNone ) + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: Yes, when created" ); + file.Modified(tTime); //When modified + } + file.Close(); + + err = iWriter.Open( iFsSession, aFileName, EFileShareExclusive ); //Open stream + CleanupClosePushL( iWriter ); //Yes, this is a member variable, but it's considered + + if( err == KErrPathNotFound ) + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: dir did not exist, creating..." ); + err = iFsSession.MkDir( aFileName ); + LOGGER_WRITE_1( "CCntParserCollector MkDir returned %d", err ); + if ( err == KErrNone ) + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: New file after MkDir" ); + //This is the situation that the file is created for the first time + User::LeaveIfError( iWriter.Create( iFsSession, aFileName, EFileShareExclusive ) ); + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: New file created after MkDir" ); + CleanupStack::Pop(); //iWriter + ParseCntDatabaseL(); //create IrMC L2 stuff + SaveTotalCountL(); + return KErrNone; //File created normally + } + } + if( err == KErrNotFound ) // file does not exist - create it + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: New file" ); + + //This is the situation that the file is created for the first time + User::LeaveIfError( iWriter.Create( iFsSession, aFileName, EFileShareExclusive ) ); + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: New file created" ); + CleanupStack::Pop(); //iWriter + ParseCntDatabaseL(); //create IrMC L2 stuff + SaveTotalCountL(); + return KErrNone; //File created normally + } + else + { + if( err != KErrNone ) + { + LOGGER_WRITE_1( "CreateIrMCL2FileL errror leaving %d", err ); + User::Leave(err); + } + iWriter.Close(); + + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: File exists, any changes in CDB?" ); + //The file exists, but are there any changes? + + changedItems = iContactsDb->ContactsChangedSinceL( tTime ); //Create a contactidarray, user takes the ownership + CleanupStack::PushL(changedItems); + + LOGGER_WRITE_1( "CreateIrMCL2FileL changedItems %d", changedItems->Count() ); + LOGGER_WRITE_1( "CreateIrMCL2FileL aForced %d", aForced ); + //Are there changes in any contact + if( changedItems->Count()!=0 || aForced || ContactCountChanged() ) + { + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: Changes in CDB, replace existing PB.VCF" ); + + CleanupStack::PopAndDestroy(changedItems); + + //Create pb.vcf + User::LeaveIfError( iWriter.Replace( iFsSession, aFileName, EFileShareExclusive) ); + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: file replaced" ); + CleanupStack::Pop(); //iWriter + ParseCntDatabaseL(); //create IrMC L2 stuff + SaveTotalCountL(); + return KErrNone; //File created normally + } + + //No changes + CleanupStack::PopAndDestroy(changedItems); + CleanupStack::PopAndDestroy(); + + LOGGER_WRITE( "CntParserCollector: CreateIrMCL2FileL: No Changes in CDB, keep old PB.VCF" ); + } + return KPBNotUpdated; //No error occured, KPBNotUpdated used as return value to tell that the file was not created.. + } +//------------------------------------------------------------ +// CCntParserCollector::ParseCntDatabaseL() +//------------------------------------------------------------ +void CCntParserCollector::ParseCntDatabaseL() + { + LOGGER_WRITE( "CntParserCollector: ParseCntDatabaseL" ); + + iCurrentItem = 0; + iCancel = EFalse; + iContactsSaved = 0; + + //Create owncard (it's always included, even if it's empty) + + TFileName defaultDb; + CContactDatabase::GetDefaultNameL( defaultDb ); + TFileName currentDb; + iContactsDb->GetCurrentDatabase( currentDb ); + + if( defaultDb.CompareF(currentDb) == 0 || currentDb == KNullDesC16 /*|| currentDb.CompareF(KSimDummyDatabase)==0*/) //Is current database also default? + { + LOGGER_WRITE( "CntParserCollector: ParseCntDatabaseL: Using default database" ); + TContactItemId ownCardId = iContactsDb->OwnCardId(); + ExternalizeCurrentContactL( iContactsDb, ownCardId, ETrue); + } + else + { + LOGGER_WRITE( "CntParserCollector: ParseCntDatabaseL: Not using default database" ); + CContactDatabase* db=CContactDatabase::OpenL(); //My contact card is only in default db, so open it + CleanupStack::PushL(db); + + TContactItemId ownCardId = db->OwnCardId(); + ExternalizeCurrentContactL( db, ownCardId, ETrue ); + + CleanupStack::PopAndDestroy( db ); + } + + //Start running RunL method and create everything else.. + TRequestStatus* s = &iStatus; + User::RequestComplete( s, KErrNone ); + SetActive(); + } +//------------------------------------------------------------ +// CCntParserCollector::CloseResources() +//------------------------------------------------------------ +void CCntParserCollector::CloseResources() + { + LOGGER_WRITE( "CntParserCollector: CloseResources: Closing resources (iWriter)" ); + iWriter.Close(); + } +//------------------------------------------------------------ +// CCntParserCollector::PrepareParserL() +//------------------------------------------------------------ +void CCntParserCollector::PrepareParserL() + { + LOGGER_WRITE( "CntParserCollector: PrepareParserL" ); + iFilter = CCntFilter::NewL(); //Filter all contact cards out of others + + iFilter->SetContactFilterTypeALL( EFalse ); + iFilter->SetContactFilterTypeCard( ETrue ); + iContactsDb->FilterDatabaseL( *iFilter ); + + iIds=iFilter->iIds; //Get IDs to filtered contacts + iCount=iIds->Count(); //Get number of contacts to be collected + + User::LeaveIfError( iFsSession.Connect() ); //Connect to the file server + + LOGGER_WRITE_1( "CntParserCollector: PrepareParserL: iCount == %d", iCount); + } +//------------------------------------------------------------ +// CCntParserCollector::RunL() +//------------------------------------------------------------ +void CCntParserCollector::RunL() + { + //MaxNumberOfContacts-1 for OwnCard + if( iCurrentItem < iCount && (iCurrentItem < ( iMaxNumberOfContacts - 1 ) || iMaxNumberOfContacts == -1 ) ) //If no more contacts left or maximum number of contacts already parsed + { + ExternalizeCurrentContactL( iContactsDb, (*iIds)[iCurrentItem], EFalse ); + iCurrentItem++; + TRequestStatus* s = &iStatus; //Let's rerun this RunL method as soon as possible + User::RequestComplete( s, KErrNone ); + SetActive(); + return; + } + iCurrentItem++; //for OwnCard that is created separately + LOGGER_WRITE( "CntParserCollector: RunL: No more items" ); + CloseResources(); + iServer->CompletePhoneBookRequests( KErrNone ); + } +//------------------------------------------------------------ +// CCntParserCollector::ExternalizeCurrentContactL(CContactDatabase* aContactsDb,TInt aCurrentItem,TBool ExternalizeEmpty) +//------------------------------------------------------------ +void CCntParserCollector::ExternalizeCurrentContactL(CContactDatabase* aContactsDb,TInt aCurrentItem,TBool ExternalizeEmpty) + { + CContactItem* ownCard; + + if( aCurrentItem < 0 ) + { + ownCard = CContactCard::NewLC(); + } + else + { + ownCard = aContactsDb->ReadContactLC( aCurrentItem ); //Take a new contact item + } + + CParserVCard* VCard=CParserVCard::NewL(); //Create new VCard + CleanupStack::PushL( VCard ); + + TInt nField = ownCard->CardFields().Find( KUidContactFieldGivenName ); + TInt fField = ownCard->CardFields().Find( KUidContactFieldFamilyName ); + TInt cField = ownCard->CardFields().Find( KUidContactFieldCompanyName ); + + //FOR NAMES + //N: -field always included even if it's empty + CDesC16Array* ValueArray=new (ELeave) CDesCArrayFlat(4); + CleanupStack::PushL( ValueArray ); + CParserPropertyValueCDesCArray* NameValues=new (ELeave) CParserPropertyValueCDesCArray( ValueArray ); + CleanupStack::PushL( NameValues ); + CArrayPtr* parameters=new (ELeave) CArrayPtrFlat(1); + CleanupStack::PushL( parameters ); + + TPtrC fName; + TPtrC nName; + TPtrC cName; + + if( fField != KErrNotFound ) + { + fName.Set( ownCard->CardFields()[fField].TextStorage()->Text() ); + } + if( nField != KErrNotFound ) + { + nName.Set( ownCard->CardFields()[nField].TextStorage()->Text() ); + } + if( cField != KErrNotFound ) + { + cName.Set( ownCard->CardFields()[cField].TextStorage()->Text() ); + } + + if( fName.Length() == 0) + { + fField = KErrNotFound; + } + if(nName.Length()==0) + { + nField = KErrNotFound; + if( fField==KErrNotFound ) + { + ValueArray->AppendL( cName ); + } + else + { + ValueArray->AppendL( fName ); + } + } + else + { + ValueArray->AppendL( fName ); + ValueArray->AppendL( nName ); + } + + VCard->AddPropertyL( CParserProperty::NewL((*NameValues),KNameProperty,parameters) ); //Add name property to VCard (VCard takes the ownership of the property) + CleanupStack::Pop(3); //parameters namevalues valuearray + + TBool isNumber = EFalse; + + TInt typeIndex = 0; + TInt index = -1; //NOTE: +1 added before used first time + + for(;;) //Go through all fields (Number of fields is unknown) + { + index = ownCard->CardFields().FindNext(typesToBeSearched[typeIndex],index+1);//Find next field (of current type) + if( index == KErrNotFound ) //No more phone numbers, move to the next group -> (See TypesToBeSearched) + { + typeIndex++; + if( typeIndex >= (signed) (sizeof(typesToBeSearched) / sizeof(TUid)) ) + { + break; //if no more types to search -> exit FOR-loop + } + + index=ownCard->CardFields().FindNext(typesToBeSearched[typeIndex],0); //Find next field + if( index==KErrNotFound ) + { + break; //No fields -> exit + } + } + + TPtrC number = ownCard->CardFields()[index].TextStorage()->Text(); + if( number.Length() != 0) + { + CDesC16Array* ValueArray2=new (ELeave) CDesCArrayFlat(4); + CleanupStack::PushL( ValueArray2 ); + CParserPropertyValueCDesCArray* NumberValues=new (ELeave) CParserPropertyValueCDesCArray(ValueArray2); + CleanupStack::PushL( NumberValues ); + CArrayPtr* parameters2=new (ELeave) CArrayPtrFlat(1); + CleanupStack::PushL( parameters2 ); + + //Take label name to parameter + + for( TInt i=0;iCardFields()[index].ContentType().FieldTypeCount();i++ ) + { + TFieldType fieldType=ownCard->CardFields()[index].ContentType().FieldType(i); + + if(fieldType==KUidContactFieldVCardMapWORK) parameters2->AppendL(CParserParam::NewL(KVersitParam8Work,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapHOME) parameters2->AppendL(CParserParam::NewL(KVersitParam8Home,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapMSG) parameters2->AppendL(CParserParam::NewL(KVersitParam8Msg,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapVOICE)parameters2->AppendL(CParserParam::NewL(KVersitParam8Voice,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapFAX) parameters2->AppendL(CParserParam::NewL(KVersitParam8Fax,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapPREF) parameters2->AppendL(CParserParam::NewL(KVersitParam8Pref,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapCELL) parameters2->AppendL(CParserParam::NewL(KVersitParam8Cell,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapPAGER)parameters2->AppendL(CParserParam::NewL(KVersitParam8Pager,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapBBS) parameters2->AppendL(CParserParam::NewL(KVersitParam8Bbs,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapMODEM)parameters2->AppendL(CParserParam::NewL(KVersitParam8Modem,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapCAR) parameters2->AppendL(CParserParam::NewL(KVersitParam8Car,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapISDN) parameters2->AppendL(CParserParam::NewL(KVersitParam8Isdn,KNullDesC8)); + if(fieldType==KUidContactFieldVCardMapVIDEO)parameters2->AppendL(CParserParam::NewL(KVersitParam8Video,KNullDesC8)); + } + + ValueArray2->AppendL( number ); + VCard->AddPropertyL(CParserProperty::NewL((*NumberValues),KTelProperty,parameters2)); //VCard takes the ownership of the property + isNumber=ETrue; + + CleanupStack::Pop(3); //parameters2 numbervalues valuearray2 + } + } + + if( (nField!=KErrNotFound) || (fField!=KErrNotFound) || (cField!=KErrNotFound) || isNumber || ExternalizeEmpty ) + { + if( !isNumber ) + { + //Create empty TEL field (required by the specs) + + CDesC16Array* ValueArray3=new (ELeave) CDesCArrayFlat(4); + CleanupStack::PushL(ValueArray3); + CParserPropertyValueCDesCArray* NumberValues2=new (ELeave) CParserPropertyValueCDesCArray(ValueArray3); + CleanupStack::PushL(NumberValues2); + CArrayPtr* parameters3=new (ELeave) CArrayPtrFlat(1); + CleanupStack::PushL(parameters3); + + VCard->AddPropertyL(CParserProperty::NewL((*NumberValues2),KTelProperty,parameters3)); //VCard takes the ownership of the property + + CleanupStack::Pop(3); //parameters3 numbervalues valuearray3 + } + + TRAPD( err, VCard->ExternalizeL( iWriter );) //If there are no name or numbers, then no externalizing.. + //if error then only current contact card is discarded, but others will be still collected.. + if( err == KErrNone ) + { + iContactsSaved++; + } + else + { + LOGGER_WRITE( "CntParserCollector: RunL: Error,VCARD _NOT_ saved" ); + } + } + + aContactsDb->CloseContactL( aCurrentItem ); //Close current contact item + + CleanupStack::PopAndDestroy( VCard ); // VCard and all arrays (parameters2, numvervalues, valuearray2) related to this VCard are deleted through the ownership relations + CleanupStack::PopAndDestroy( ownCard ); + } +//------------------------------------------------------------ +// CCntParserCollector::DoCancel() +//------------------------------------------------------------ +void CCntParserCollector::DoCancel() + { + LOGGER_WRITE( "CntParserCollector: DoCancel" ); + CloseResources(); + } +//------------------------------------------------------------ +// CCntParserCollector::RunError(TInt aError) +//------------------------------------------------------------ +TInt CCntParserCollector::RunError( TInt aError ) + { + LOGGER_WRITE( "CntParserCollector: RunError!" ); + CloseResources(); //JIC + + iServer->CompletePhoneBookRequests( aError ); //complete all requests with an error + return KErrNone; + } +//------------------------------------------------------------ +// CCntParserCollector::CurrentItem() +//------------------------------------------------------------ +TInt CCntParserCollector::CurrentItem() + { + return iCurrentItem; + } +//------------------------------------------------------------ +// CCntParserCollector::Count() +//------------------------------------------------------------ +TInt CCntParserCollector::Count() + { + return iCount; + } +//------------------------------------------------------------ +// CCntParserCollector::ContactsSaved() +//------------------------------------------------------------ +TInt CCntParserCollector::ContactsSaved() + { + return iContactsSaved; + } +//------------------------------------------------------------ +// CCntParserCollector::SaveTotalCountL() const +//------------------------------------------------------------ +void CCntParserCollector::SaveTotalCountL() + { + LOGGER_WRITE( "CntParserCollector: SaveTotalCount begin" ); + + if( iContactsDb ) + { + iTotalCount = iContactsDb->CountL(); + LOGGER_WRITE_1( "CntParserCollector: SaveTotalCount iTotalCount %d", iTotalCount ); + } + + RFs Fs; + RFile writer; + User::LeaveIfError(Fs.Connect()); //Connect to the file server + CleanupClosePushL(Fs); + + User::LeaveIfError(Fs.CreatePrivatePath( EDriveC )); + User::LeaveIfError(Fs.SetSessionToPrivate( EDriveC )); + + User::LeaveIfError(writer.Replace(Fs,KTotalCountFilePath,EFileWrite)); //Open file + CleanupClosePushL(writer); + LOGGER_WRITE( "CntParserCollector: SaveTotalCount file replaced" ); + + // Prepare externalized representation of iTotalCount + TBuf8< 256 > countData; + RDesWriteStream writeStream( countData ); + CleanupClosePushL( writeStream ); + writeStream.WriteInt32L( iTotalCount ); + writeStream.CommitL(); + CleanupStack::PopAndDestroy( &writeStream ); + + // Then write them to the file itself + User::LeaveIfError(writer.Write( countData )); + + CleanupStack::PopAndDestroy(); //writer + CleanupStack::PopAndDestroy(); //Fs + + LOGGER_WRITE( "CntParserCollector: SaveTotalCount end" ); + } +//------------------------------------------------------------ +// CCntParserCollector::ReadTotalCountL() const +//------------------------------------------------------------ +TInt CCntParserCollector::ReadTotalCountL() const + { + LOGGER_WRITE( "CntParserCollector: ReadTotalCount begin" ); + TInt total; + RFs Fs; + RFile reader; + User::LeaveIfError(Fs.Connect()); //Connect to the file server + CleanupClosePushL(Fs); + + User::LeaveIfError(Fs.CreatePrivatePath( EDriveC )); + User::LeaveIfError(Fs.SetSessionToPrivate( EDriveC )); + + User::LeaveIfError(reader.Open(Fs,KTotalCountFilePath,EFileRead)); //Open file + CleanupClosePushL(reader); + LOGGER_WRITE( "CntParserCollector: ReadTotalCount file opened" ); + + RFileReadStream readStream(reader); + readStream.PushL(); + + total = readStream.ReadInt32L(); + + LOGGER_WRITE_1( "CntParserCollector: ReadTotalCount total %d", total ); + + CleanupStack::PopAndDestroy(); //readStream + CleanupStack::PopAndDestroy(); //writer + CleanupStack::PopAndDestroy(); //Fs + LOGGER_WRITE( "CntParserCollector: ReadTotalCount end" ); + return total; + } +//------------------------------------------------------------ +// CCntParserCollector::ContactCountChanged() const +//------------------------------------------------------------ +TBool CCntParserCollector::ContactCountChanged() + { + LOGGER_WRITE( "CntParserCollector: ContactCountChanged begin" ); + TInt oldCount = 0; + TInt err( KErrNone ); + + if( iContactsDb ) + { + TRAP( err, iTotalCount = iContactsDb->CountL() ); + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "iContactsDb->CountL leaved: %d", err ); + LOGGER_WRITE( "CntParserCollector: ContactCountChanged ETrue" ); + return ETrue; + } + LOGGER_WRITE_1( "CntParserCollector: ContactCountChanged iTotalCount %d", iTotalCount ); + } + + TRAP( err, oldCount = ReadTotalCountL() ); + + LOGGER_WRITE_1( "CntParserCollector: ContactCountChanged err %d", err ); + LOGGER_WRITE_1( "CntParserCollector: ContactCountChanged oldCount %d", oldCount ); + LOGGER_WRITE_1( "CntParserCollector: ContactCountChanged iTotalCount %d", iTotalCount ); + + if( err == KErrNone ) + { + if( iTotalCount != oldCount ) + { + LOGGER_WRITE( "CntParserCollector: ContactCountChanged ETrue" ); + return ETrue; + } + else + { + LOGGER_WRITE( "CntParserCollector: ContactCountChanged EFalse" ); + return EFalse; + } + } + else + { + LOGGER_WRITE( "CntParserCollector: ContactCountChanged ETrue" ); + return ETrue; + } + } + +// end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/src/cntparserinfolog.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/src/cntparserinfolog.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,119 @@ +/* +* Copyright (c) 2002-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserInfoLog implementation. +* +*/ + + +#include +#include +#include + +#include "cntparserinfolog.h" + +_LIT8(KNewLine,"\r\n"); + +_LIT8(KMaxRecords,"Maximum-Records:"); +_LIT8(KTotalRecords,"Total-Records:"); + +//------------------------------------------------------------ +// CCntParserInfoLog::CCntParserInfoLog() +//------------------------------------------------------------ +CCntParserInfoLog::CCntParserInfoLog() + { + } + +//------------------------------------------------------------ +// CCntParserInfoLog::~CCntParserInfoLog() +//------------------------------------------------------------ +CCntParserInfoLog::~CCntParserInfoLog() + { + } + +//------------------------------------------------------------ +// CCntParserInfoLog::CCntParserInfoLog::NewL() +//------------------------------------------------------------ +EXPORT_C CCntParserInfoLog* CCntParserInfoLog::NewL() + { + CCntParserInfoLog* self=new (ELeave) CCntParserInfoLog(); + return self; + } + +//------------------------------------------------------------ +// CCntParserInfoLog::SaveToFileL(const TDesC& aFileName) const +//------------------------------------------------------------ +EXPORT_C void CCntParserInfoLog::SaveToFileL( const TDesC& aFileName ) const + { + TInt err = KErrNone; + RFs Fs; + RFile writer; + User::LeaveIfError( Fs.Connect() ); //Connect to the file server + CleanupClosePushL( Fs ); + err = writer.Replace( Fs, aFileName, EFileWrite ); //Open file + CleanupClosePushL( writer ); + + if( err == KErrNone ) + { + writer.Write( KMaxRecords ); + + TBuf8<16> numVal; + numVal.Num( iMaximumRecords ); + writer.Write( numVal ); + + writer.Write( KNewLine ); + + writer.Write( KTotalRecords ); + + TBuf8<16> numVal2; + numVal2.Num( iTotalRecords ); + writer.Write( numVal2 ); + } + + CleanupStack::PopAndDestroy(); //writer + CleanupStack::PopAndDestroy(); //Fs + } + +//------------------------------------------------------------ +// CCntParserInfoLog::SetTotalRecords(TInt aTotalRecords) +//------------------------------------------------------------ +EXPORT_C void CCntParserInfoLog::SetTotalRecords(TInt aTotalRecords) + { + iTotalRecords = aTotalRecords; + } + +//------------------------------------------------------------ +// CCntParserInfoLog::SetMaximumRecords(TInt aMaximumRecords) +//------------------------------------------------------------ +EXPORT_C void CCntParserInfoLog::SetMaximumRecords(TInt aMaximumRecords) + { + iMaximumRecords = aMaximumRecords; + } + +//------------------------------------------------------------ +// CCntParserInfoLog::TotalRecords() const +//------------------------------------------------------------ +EXPORT_C TInt CCntParserInfoLog::TotalRecords() const + { + return iTotalRecords; + } + +//------------------------------------------------------------ +// CCntParserInfoLog::MaximumRecords() const +//------------------------------------------------------------ +EXPORT_C TInt CCntParserInfoLog::MaximumRecords() const + { + return iMaximumRecords; + } + +// end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/src/cntparserserverexe.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/src/cntparserserverexe.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,322 @@ +/* +* Copyright (c) 2002-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserServer implementation. +* +*/ + + +#include "clientserver.h" +#include "cntparserserver.h" +#include "cntparserserversession.h" +#include "irmcconsts.h" + +#include "debug.h" + +#include + +//------------------------------------------------------------ +// RunServer +//------------------------------------------------------------ +TInt CCntParserServer::RunServer() + { + LOGGER_ENTERFN( "CCntParserServer::RunServer" ); + + CTrapCleanup* cleanup = CTrapCleanup::New(); + TInt ret( KErrNoMemory ); + if( cleanup ) + { + TRAP( ret, CCntParserServer::RunServerL() ); + delete cleanup; + } + if( ret != KErrNone ) + { + // Signal the client that server creation failed + RProcess::Rendezvous( ret ); + } + LOGGER_LEAVEFN( "CCntParserServer::RunServer" ); + return ret; + } +//------------------------------------------------------------ +// RunServerL +//------------------------------------------------------------ +void CCntParserServer::RunServerL() + { + // Create and install the active scheduler we need + LOGGER_ENTERFN( "CCntParserServer::RunServerL" ); + CActiveScheduler *as=new (ELeave)CActiveScheduler; + CleanupStack::PushL( as ); + CActiveScheduler::Install( as ); + + // Create server + CCntParserServer::NewL(); + + // Initialisation complete, now signal the client + User::LeaveIfError( RThread().RenameMe( KTxtServer ) ); + RProcess::Rendezvous( KErrNone ); + + // Ready to run + CActiveScheduler::Start(); + + // Cleanup the scheduler + CleanupStack::PopAndDestroy( as ); + LOGGER_LEAVEFN( "CCntParserServer::RunServerL" ); + } +//------------------------------------------------------------ +// E32Main() +//------------------------------------------------------------ +TInt E32Main() + { + return CCntParserServer::RunServer(); + } +//------------------------------------------------------------ +// PanicServer(TCntParserServerPanic aPanic) +//------------------------------------------------------------ +GLDEF_C void PanicServer(TCntParserServerPanic aPanic) + { + LOGGER_WRITE( "PANIC SERVER!" ); + _LIT(KTxtServerPanic,"Parser server panic"); + User::Panic( KTxtServerPanic, aPanic ); + } + + +//********************************** +//CCntParserServer +//********************************** + +//------------------------------------------------------------ +// CCntParserServer::CCntParserServer() +//------------------------------------------------------------ +CCntParserServer::CCntParserServer() : CServer2( EPriorityStandard ) + { + } +//------------------------------------------------------------ +// CCntParserServer::~CCntParserServer() +//------------------------------------------------------------ +EXPORT_C CCntParserServer::~CCntParserServer() + { + if( iCollector ) + { + iCollector->Cancel(); + } + delete iCollector; + delete iCurrentDatabase; + LOGGER_WRITE( "CntParserServer: DELETED!" ); + } +//------------------------------------------------------------ +// CCntParserServer* CCntParserServer::NewL() +//------------------------------------------------------------ +EXPORT_C CCntParserServer* CCntParserServer::NewL() + { + LOGGER_WRITE( "CntParserServer: NEW" ); + CCntParserServer* pS=new (ELeave) CCntParserServer(); + CleanupStack::PushL(pS); + pS->StartL( KCntParserName ); + CleanupStack::Pop( pS ); + LOGGER_WRITE( "CntParserServer: Created" ); + return pS; + } +//------------------------------------------------------------ +// CCntParserServer::NewSessionL(const TVersion &aVersion, const RMessage2& /*aMsg*/) const +//------------------------------------------------------------ +CSession2* CCntParserServer::NewSessionL(const TVersion &aVersion, const RMessage2& /*aMsg*/) const + { + LOGGER_WRITE( "CntParserServer: NEW SessionL" ); + // check we're the right version + TVersion v( KCntParserMajorVersionNumber,KCntParserMinorVersionNumber,KCntParserBuildVersionNumber ); + if ( !User::QueryVersionSupported( v,aVersion ) ) + User::Leave( KErrNotSupported ); + CCntParserServerSession* self=CCntParserServerSession::NewL( (CCntParserServer*)this ); + return self; + } +//------------------------------------------------------------ +// CCntParserServer::IncreaseSessionCountL() +//------------------------------------------------------------ +void CCntParserServer::IncreaseSessionCountL() + { + LOGGER_WRITE( "CntParserServer: Increase Session Count" ); + iSessionCount++; + if( iSessionCount == 1 ) //If first session, prepare collector + { + PrepareCollectorL(); + } + } +//------------------------------------------------------------ +// CCntParserServer::DecreaseSessionCount() +//------------------------------------------------------------ +void CCntParserServer::DecreaseSessionCount() + { + LOGGER_WRITE( "CntParserServer: Decrease Session Count" ); + iSessionCount--; + if( iSessionCount==0 ) //if last session is disconnected, delete server + { + Stop(); + } + } +//------------------------------------------------------------ +// CCntParserServer::ContactsParsed() +//------------------------------------------------------------ +TInt CCntParserServer::ContactsParsed() + { + return iCollector->CurrentItem(); + } +//------------------------------------------------------------ +// CCntParserServer::TotalNumOfContacts() +//------------------------------------------------------------ +TInt CCntParserServer::TotalNumOfContacts() + { + //After the PrepareCollector is called, the number of contacts can be returned + return iCollector->Count(); + } +//------------------------------------------------------------ +// CCntParserServer::ContactsSaved() +//------------------------------------------------------------ +TInt CCntParserServer::ContactsSaved() + { + return iCollector->ContactsSaved(); + } +//------------------------------------------------------------ +// CCntParserServer::PrepareCollectorL() +//------------------------------------------------------------ +void CCntParserServer::PrepareCollectorL() + { + LOGGER_WRITE( "CntParserServer: Prepare collectorL: Open Contact Database" ); + + TFileName dbFile; + TFileName defaultDb; + + CContactDatabase::GetDefaultNameL( defaultDb ); + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: GetDefault" ); + + iCurrentDatabase=CContactDatabase::OpenL(); + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: OpenDefault" ); + + iCurrentDatabase->GetCurrentDatabase( dbFile ); //Get selected database + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: CompareDefault" ); + + if( dbFile.CompareF(defaultDb)!=0 && dbFile!=KNullDesC16 /*&& dbFile.CompareF(KSimDummyDatabase)!=0*/) //If the selected database is not the default and something is selected + { + LOGGER_WRITE( "CntParserServer: Prepare collectorL: Close Default" ); + delete iCurrentDatabase; + iCurrentDatabase = NULL; + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: OpenSelected" ); + iCurrentDatabase=CContactDatabase::OpenL( dbFile ); //open the selected one + } + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: Is everything ok?" ); + if( !iCurrentDatabase ) + { + User::Leave( KErrNotFound ); + } + + LOGGER_WRITE( "CntParserServer: Prepare collectorL: Create Collector" ); + iCollector = CCntParserCollector::NewL( this,iCurrentDatabase ); + + iRequests = 0; + } +//------------------------------------------------------------ +// CCntParserServer::CreateIrMCL2PhoneBookL() +//------------------------------------------------------------ +TInt CCntParserServer::CreateIrMCL2PhoneBookL(const TDesC& path, TInt aMaxNumberOfContacts,TBool aForced) + { + LOGGER_WRITE( "CntParserServer: CreateIrMCL2PhoneBookL" ); + + TInt err( KErrNone ); + + iRequests++; + if( iRequests == 1 ) + { + LOGGER_WRITE( "CntParserServer: CreateIrMCL2PhoneBookL: Ready to call collector" ); + + err = iCollector->CreateIrMCL2FileL( path,aMaxNumberOfContacts,aForced ); + if( err==KPBNotUpdated ) + { + iRequests = 0; //If the file exists (no parsing), then more requests can be made + } + } + else + { + return KErrNotReady; + } + return err; + } +//------------------------------------------------------------ +// CCntParserServer::CompletePhoneBookRequests() +//------------------------------------------------------------ +void CCntParserServer::CompletePhoneBookRequests(TInt aErr) //Goes through all the sessions and completes the request + { + LOGGER_WRITE( "CntParserServer: Complete phonebook request" ); + iSessionIter.SetToFirst(); + while( iSessionIter!=NULL ) //Go through all sessions + { + ( (CCntParserServerSession*) (iSessionIter++) )->CompletePhoneBookRequest( aErr ); + } + iRequests = 0; //Collector is ready to start again.. + } +//------------------------------------------------------------ +// CCntParserServer::CancelPhoneBookRequest() +//------------------------------------------------------------ +void CCntParserServer::CancelPhoneBookRequest() + { + if( iRequests == 1 ) + { + iCollector->Cancel(); + } + iRequests--; + } +//------------------------------------------------------------ +// CCntParserServer::CancelAllPhoneBookRequests() +//------------------------------------------------------------ +void CCntParserServer::CancelAllPhoneBookRequests() + { + iCollector->Cancel(); + iRequests = 0; + } +//------------------------------------------------------------ +// CCntParserServer::Disconnect() +//------------------------------------------------------------ +void CCntParserServer::Disconnect() + { + LOGGER_WRITE( "CntParserServer: Disconnect" ); + } +//------------------------------------------------------------ +// CCntParserServer::Stop() +//------------------------------------------------------------ +void CCntParserServer::Stop() + { + LOGGER_ENTERFN( "CntParserServer::Stop()" ); + if( iCollector ) + { + iCollector->Cancel(); + } + delete iCollector; + iCollector = NULL; + delete iCurrentDatabase; + iCurrentDatabase = NULL; + CActiveScheduler::Stop(); + LOGGER_LEAVEFN( "CntParserServer::Stop()" ); + } +//------------------------------------------------------------ +// CCntParserServer::SetRequests() +//------------------------------------------------------------ +void CCntParserServer::SetRequests(TInt aRequests) + { + iRequests=aRequests; + } + + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/cntparser/src/cntparserserversession.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/cntparser/src/cntparserserversession.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,219 @@ +/* +* Copyright (c) 2002-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCntParserServerSession implementation. +* +*/ + + +#include "cntparserserversession.h" +#include +#include "cntparsercollector.h" +#include "cntparserinfolog.h" +#include "irmcconsts.h" + +#include "debug.h" + +//------------------------------------------------------------ +// CCntParserServerSession::CCntParserServerSession() +//------------------------------------------------------------ +CCntParserServerSession::CCntParserServerSession() + { + } +//------------------------------------------------------------ +// CCntParserServerSession::NewL(CCntParserServer* aServer) +//------------------------------------------------------------ +CCntParserServerSession* CCntParserServerSession::NewL( CCntParserServer* aServer ) + { + LOGGER_ENTERFN( "CntParserServerSession::NewL()" ); + + CCntParserServerSession* self = new( ELeave ) CCntParserServerSession(); + CleanupStack::PushL( self ); + self->ConstructL( aServer ); + CleanupStack::Pop( self ); + LOGGER_LEAVEFN( "CntParserServerSession::NewL()" ); + return self; + } +//------------------------------------------------------------ +// CCntParserServerSession::ConstructL( CCntParserServer* aServer ) +//------------------------------------------------------------ +void CCntParserServerSession::ConstructL( CCntParserServer* aServer ) + { + iContactsParserSrv = aServer; + iContactsParserSrv->IncreaseSessionCountL(); + } +//------------------------------------------------------------ +// CCntParserServerSession::~CCntParserServerSession() +//------------------------------------------------------------ +CCntParserServerSession::~CCntParserServerSession() + { + LOGGER_ENTERFN( "CntParserServerSession::~CCntParserServerSession()" ); + if ( iContactsParserSrv ) + { + iContactsParserSrv->DecreaseSessionCount(); + } + LOGGER_LEAVEFN( "CntParserServerSession::~CCntParserServerSession()" ); + } +//------------------------------------------------------------ +// CCntParserServerSession::ServiceL( const RMessage2& aMessage ) +//------------------------------------------------------------ +void CCntParserServerSession::ServiceL( const RMessage2& aMessage ) + { + LOGGER_WRITE( "CntParserServerSession: ServiceL" ); + + TInt err( KErrNone ); + TInt ret( KErrNone ); + + TRAP( err, ret = DispatchMessageL( aMessage ) ); + + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "CntParserServerSession: ServiceL: Error trapped, complete with ERR code %d", err ); + + iPhoneBookRequest = EFalse; //If requested, then clear request flag + iContactsParserSrv->SetRequests( 0 ); //Reset requests count in server to allow new requests to start.. + aMessage.Complete( err ); //If trap error, complete with it + return; + } + + if ( ret == KErrNone ) + { + LOGGER_WRITE( "CntParserServerSession: ServiceL: No complete" ); + return; + } + + if ( ret == KPerformComplete ) + { + LOGGER_WRITE( "CntParserServerSession: ServiceL: Normal complete" ); + + aMessage.Complete( KErrNone ); + return; + } + + if ( ret == KPBNotUpdated ) + { + LOGGER_WRITE( "CntParserServerSession: ServiceL: Complete (PB not updated)" ); + + iPhoneBookRequest = EFalse; + aMessage.Complete( KPBNotUpdated ); + return; + } + LOGGER_WRITE( "CntParserServerSession: ServiceL: Error, should never come here" ); + aMessage.Complete( KErrGeneral ); + } +//------------------------------------------------------------ +// CCntParserServerSession::CompletePhoneBookRequest( TInt aErr ) +//------------------------------------------------------------ +void CCntParserServerSession::CompletePhoneBookRequest( TInt aErr ) + { + LOGGER_WRITE( "CntParserServerSession: CompletePhoneBookRequest" ); + + if ( iPhoneBookRequest ) //If this session has requested phonebook, then the completion should be done here, as it was not done in ServiceL + { + LOGGER_WRITE( "CntParserServerSession: CompletePhoneBookRequest: collector or cancel" ); + iPhoneBookRequest = EFalse; + iPhoneBookRequestMessage.Complete( aErr ); + } + else + { + LOGGER_WRITE( "CntParserServerSession: CompletePhoneBookRequest: No complete for this session" ); + } + } +//------------------------------------------------------------ +// CCntParserServerSession::DispatchMessageL( const RMessage2 &aMessage ) +//------------------------------------------------------------ +TInt CCntParserServerSession::DispatchMessageL( const RMessage2 &aMessage ) + { + LOGGER_WRITE( "CntParserServerSession: DispatchMessageL" ); + + TInt res( KPerformComplete ); + + switch( aMessage.Function() ) + { + case ECntParserServerCreateIrMCL2: //Create pb.vcf file + { + res = ETrue; + + if ( iPhoneBookRequest == EFalse ) + { + iPhoneBookRequestMessage = aMessage; + iPhoneBookRequest = ETrue; + + TInt sid=aMessage.SecureId(); + TInt MaxNumOfContacts = aMessage.Int0(); + TBool Forced = aMessage.Int1(); + TBuf<8> sidLit; + sidLit.AppendNumFixedWidth( sid, EHex, 8); + TBuf<255> path; + path.Insert( 0, KPhoneBookFilename ); + + res = iContactsParserSrv->CreateIrMCL2PhoneBookL( path, (TInt) MaxNumOfContacts, Forced ); + } + break; + } + case ECntParserServerCntParsed: //How many contacts already parsed + { + TPckgBuf p((TInt) iContactsParserSrv->ContactsParsed()); + aMessage.WriteL( 0, p, 0 ); + break; + } + case ECntParserServerTotalNumOfContacts: //How many contacts total? + { + TPckgBuf p((TInt) iContactsParserSrv->TotalNumOfContacts()); + aMessage.WriteL( 0, p, 0 ); + break; + } + case ECntParserServerDisconnect: //Disconnect session from server + { + iContactsParserSrv->Disconnect(); + break; + } + case ECntParserServerCancel: //Cancel phone book request + { + if (iPhoneBookRequest) + { + iContactsParserSrv->CancelPhoneBookRequest(); + CompletePhoneBookRequest( KErrCancel ); + } + break; + } + case ECntParserServerCntSaved: //How many contacts total? + { + TPckgBuf p((TInt) iContactsParserSrv->ContactsSaved()); + aMessage.WriteL( 0, p, 0 ); + break; + } + case ECntParserServerCancelAll: //Cancel all requests, not just current? + { + iContactsParserSrv->CancelAllPhoneBookRequests(); + break; + } + // requests we don't understand + // so panic the client here, this function also completes the message + default: + { + PanicClient( EBadRequest ); + break; + } + } + return res; + } +//------------------------------------------------------------ +// CCntParserServerSession::PanicClient(TInt aPanic) const +//------------------------------------------------------------ +void CCntParserServerSession::PanicClient(TInt aPanic) const + { + User::Panic( KTxtServer,aPanic ); + } + +// end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/common/conmltask/inc/sconconmltask.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/common/conmltask/inc/sconconmltask.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,598 @@ +/* +* Copyright (c) 2005-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Header file for ConML tasks +* +*/ + + +#ifndef _SCONCONMLTASK_H_ +#define _SCONCONMLTASK_H_ + +#include +#include + +const TInt KSConTaskPartiallyCompleted( 206 ); +const TInt KMaxPackageNameLength = 128; + +enum TSConMethodName + { + ECancel = 0, + EGetDataOwnerStatus, + EGetDataSize, + EGetStatus, + EInstall, + EListDataOwners, + EListInstalledApps, + EListPublicFiles, + ERequestData, + ESetBURMode, + ESetInstParams, + ESupplyData, + EUninstall, + EUpdateDeviceInfo, + EReboot, + EGetMetadata + }; + +enum TSConInstallMode + { + ESilentInstall = 0, + EUnsilentInstall, + EUnknown + }; + +enum TSConUserPerm + { + EPermReadOnly = 0, + EPermNormal + }; + +enum TSConDOType + { + EActiveDataOwner = 1, + EPassiveDataOwner, + EHybridDataOwner + }; + +enum TSConHasFiles + { + ENoFiles = 0, + EPublicFiles, + ESystemFiles, + EPublicSystemFiles + }; + +enum TSConAppType + { + ESisApplication = 0, + ESisAugmentation, + EJavaApplication, + EWidgetApplication + }; + +enum TSConBurMode + { + ESConBurNormal = 1, // 1 BUR mode - normal + ESConBurBackupFull, // 2 BUR mode � backup full + ESConBurBackupPartial, // 3 BUR mode � backup partial + ESConBurRestoreFull, // 4 BUR mode � restore full + ESConBurRestorePartial // 5 BUR mode � restore partial + }; + +enum TSConIncType + { + ESConNoBackup = 0, // 0 No backup + ESConBackupBase = 100, // 100 Backup � base + ESConBackupIncrement = 200 // 200 Backup - increment + }; + +enum TSConTransferDataType + { + ESConRegistrationData = 1, // 1 RegistrationData + ESConPassiveSnapshotData, // 2 Passive snapshot data + ESConPassiveBaseData, // 3 Passive base data + ESConPassiveIncrementalData,// 4 Passive incremental data + ESConActiveSnapshotData, // 5 Active snapshot data + ESConActiveBaseData, // 6 Active base data + ESConActiveIncrementalData, // 7 Active incremental data + ESConSystemData, // 8 System data + ESConSystemSnapshotData // 9 System snapshot data + }; + +enum TSConDataOwnerStatus + { + ESConUnset = 0, // 0 Unset + ESConNotFound, // 1 Not found + ESConReady, // 2 Ready + ESConNotReady, // 3 Not ready + ESConFailed, // 4 Failed + ESConNotConnected, // 5 Not connected + ESConNotImplemented // 6 Not implemented + }; + + + + +//============================================================ +// class CSConReboot declaration +//============================================================ +NONSHARABLE_CLASS( CSConReboot ) : public CBase + { + public: + CSConReboot(); + ~CSConReboot(); + CSConReboot* CopyL(); + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConDataOwner declaration +//============================================================ +NONSHARABLE_CLASS( CSConDataOwner ) : public CBase + { + public: + CSConDataOwner(); + ~CSConDataOwner(); + CSConDataOwner* CopyL(); + + public: + //dataowner type + TSConDOType iType; + //unique identifier + TUid iUid; + //drive list + TDriveList iDriveList; + //package name + TBuf iPackageName; + //requires reboot + TBool iReqReboot; + //has files + TSConHasFiles iHasFiles; + //supports incremental backup + TBool iSupportsInc; + //supports selective backup + TBool iSupportsSel; + //delay to prepare data + TBool iDelayToPrep; + //size + TUint iSize; + //data owner status + TSConDataOwnerStatus iDataOwnStatus; + //transfer data type + TSConTransferDataType iTransDataType; + //Java hash + HBufC* iJavaHash; + }; + +//============================================================ +// class CSConUpdateDeviceInfo declaration +//============================================================ +NONSHARABLE_CLASS( CSConUpdateDeviceInfo ) : public CBase + { + public: + CSConUpdateDeviceInfo(); + ~CSConUpdateDeviceInfo(); + CSConUpdateDeviceInfo* CopyL(); + + TBuf8<3> iVersion; //version number + TBool iInstallSupp; + TBool iUninstallSupp; + TBool iInstParamsSupp; + TBool iInstAppsSupp; + TBool iDataOwnersSupp; + TBool iSetBURModeSupp; + TBool iGetSizeSupp; + TBool iReqDataSupp; + TBool iSupplyDataSupp; + TBool iRebootSupp; + TInt iMaxObjectSize; //kBytes + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; +//============================================================ +// class CSConInstApp declaration +//============================================================ +NONSHARABLE_CLASS( CSConInstApp ) : public CBase + { + public: + CSConInstApp() {}; + ~CSConInstApp(); + CSConInstApp* CopyL(); + + TFileName iName; + TFileName iParentName; + TFileName iVendor; + TFileName iVersion; + TInt64 iSize; + TSConAppType iType; + TUid iUid; + HBufC* iWidgetBundleId; // Widget bundle identifier like "com.nokia.widget.HelloWorld" + }; + +//============================================================ +// class CSConListInstApps declaration +//============================================================ +NONSHARABLE_CLASS( CSConListInstApps ) : public CBase + { + public: + CSConListInstApps(); + ~CSConListInstApps(); + CSConListInstApps* CopyL(); + + TBool iAllApps; //list all apps + TDriveList iDriveList; //drive list + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + + RPointerArray iApps; //installed apps + }; + +//============================================================ +// class CSConGetStatus declaration +//============================================================ +NONSHARABLE_CLASS( CSConGetStatus ) : public CBase + { + public: + TBool iAll; //list all statuses + TInt iTaskId; //task id + }; + +//============================================================ +// class CSConFile declaration +//============================================================ +NONSHARABLE_CLASS( CSConFile ) : public CBase + { + public: + CSConFile(); + ~CSConFile(); + CSConFile* CopyL(); + + TFileName iPath; //file path + name + TBuf iModified; //modified date + TUint iSize; //file size + TSConUserPerm iUserPerm; //user permission + }; + +//============================================================ +// class CSConInstall declaration +//============================================================ +NONSHARABLE_CLASS( CSConInstall ) : public CBase + { + public: + CSConInstall(); + ~CSConInstall(); + + CSConInstall* CopyL(); + + TFileName iPath; //path to file + TSConInstallMode iMode; //install mode + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConUninstall declaration +//============================================================ +NONSHARABLE_CLASS( CSConUninstall ) : public CBase + { + public: + CSConUninstall(); + ~CSConUninstall(); + + CSConUninstall* CopyL(); + + TFileName iName; // application name + TFileName iVendor; // application vendor + TUid iUid; // application uid + TSConAppType iType; // application type + TSConInstallMode iMode; // install mode + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConListDataOwners declaration +//============================================================ +NONSHARABLE_CLASS( CSConListDataOwners ) : public CBase + { + public: + CSConListDataOwners(); + ~CSConListDataOwners(); + CSConListDataOwners* CopyL(); + void DeleteDataOwners(); + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + + RPointerArray iDataOwners; //data owners + }; + +//============================================================ +// class CSConSetBURMode declaration +//============================================================ +NONSHARABLE_CLASS( CSConSetBURMode ) : public CBase + { + public: + TDriveList iDriveList; //drive list + TSConBurMode iPartialType; //partial backup type + TSConIncType iIncType; //incremental backup type + + CSConSetBURMode(); + ~CSConSetBURMode(); + CSConSetBURMode* CopyL(); + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConGetDataSize declaration +//============================================================ +NONSHARABLE_CLASS( CSConGetDataSize ) : public CBase + { + public: + CSConGetDataSize(); + ~CSConGetDataSize(); + + CSConGetDataSize* CopyL(); + void DeleteDataOwners(); + + public: + RPointerArray iDataOwners; //data owners + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConListPublicFiles declaration +//============================================================ +NONSHARABLE_CLASS( CSConListPublicFiles ) : public CBase + { + public: + CSConListPublicFiles(); + ~CSConListPublicFiles(); + CSConListPublicFiles* CopyL(); + + public: + RPointerArray iFiles; //data owners + RPointerArray iDataOwners; //data owners + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConRequestData declaration +//============================================================ +NONSHARABLE_CLASS( CSConRequestData ) : public CBase + { + public: + CSConRequestData(); + ~CSConRequestData(); + CSConRequestData* CopyL(); + void DeleteDataAndDataOwner(); + + CSConDataOwner* iDataOwner; //data owner + HBufC8* iBackupData; //backup data + TBool iMoreData; //more data + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConGetDataOwnerStatus declaration +//============================================================ +NONSHARABLE_CLASS( CSConGetDataOwnerStatus ) : public CBase + { + public: + CSConGetDataOwnerStatus(); + ~CSConGetDataOwnerStatus(); + CSConGetDataOwnerStatus* CopyL(); + void DeleteDataOwners(); + + public: + RPointerArray iDataOwners; //data owners + + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConSupplyData declaration +//============================================================ +NONSHARABLE_CLASS( CSConSupplyData ) : public CBase + { + public: + CSConSupplyData(); + ~CSConSupplyData(); + CSConSupplyData* CopyL(); + public: + CSConDataOwner* iDataOwner; + HBufC8* iRestoreData; //restore data + TBool iMoreData; //more data + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConGetMetadata declaration +//============================================================ +NONSHARABLE_CLASS( CSConGetMetadata ) : public CBase + { + public: + CSConGetMetadata(); + ~CSConGetMetadata(); + CSConGetMetadata* CopyL(); + public: + TFileName iFilename; + HBufC8* iData; //metadata + TBool iMoreData; //more data + //used only with reply + TBool iComplete; //task complete + TInt iProgress; //task progress + }; + +//============================================================ +// class CSConTask declaration +//============================================================ +NONSHARABLE_CLASS( CSConTask ): public CBase + { + public: + /** + * Two-phase constructor + * @return CSConTask instance + */ + static CSConTask* NewL( TSConMethodName aMethod ); + static CSConTask* NewLC( TSConMethodName aMethod ); + + CSConTask(); + ~CSConTask(); + TSConMethodName GetServiceId() const; + CSConTask* CopyL() const; + TBool GetComplete(); + void SetCompleteValue( TBool aValue ); + TBool GetCompleteValue(); + void SetProgressValue( TInt aValue ); + private: + + void ConstructL( TSConMethodName aMethod ); + public: + //Task + //service id + TSConMethodName iMethod; + //task number + TInt iTaskId; + + //DeviceInfo -params + CSConUpdateDeviceInfo* iDevInfoParams; + //ListInstalledTasks -params + CSConListInstApps* iListAppsParams; + //GetStatus -params + CSConGetStatus* iGetStatusParams; + //Install -params + CSConInstall* iInstallParams; + //Uninstall -params + CSConUninstall* iUninstallParams; + //SetBURMode -params + CSConSetBURMode* iBURModeParams; + //GetDataSize -params + CSConGetDataSize* iGetDataSizeParams; + //RequestData -params + CSConRequestData* iRequestDataParams; + //GetDataOwnerStatus -params + CSConGetDataOwnerStatus* iGetDataOwnerParams; + //SupplyData -params + CSConSupplyData* iSupplyDataParams; + //ListPublicFiles -params + CSConListPublicFiles* iPubFilesParams; + //ListDataOwners -params + CSConListDataOwners* iListDataOwnersParams; + //Reboot -params + CSConReboot* iRebootParams; + //GetMetadata -params + CSConGetMetadata* iGetMetadataParams; + + TInt iCancelTaskId; + TBool iCancelTaskAll; + }; + +//============================================================ +// class CSConTaskReply declaration +//============================================================ +NONSHARABLE_CLASS( CSConTaskReply ) : public CBase + { + public: + CSConTaskReply(); + CSConTaskReply( TSConMethodName aMethod ); + ~CSConTaskReply(); + void InitializeL( const CSConTask& aTask ); + void InitializeL( TSConMethodName aMethod, + TInt aProgress, TBool aComplete ); + CSConTaskReply* CopyAndFreeL(); + void CleanTaskData(); + + public: + //task id number + TInt iTaskId; + //method type + TSConMethodName iMethod; + + //DeviceInfo -params + CSConUpdateDeviceInfo* iDevInfoParams; + //ListInstalledTasks -params + CSConListInstApps* iListAppsParams; + //GetStatus -params + CSConGetStatus* iGetStatusParams; + //Install -params + CSConInstall* iInstallParams; + //Uninstall -params + CSConUninstall* iUninstallParams; + //SetBURMode -params + CSConSetBURMode* iBURModeParams; + //GetDataSize -params + CSConGetDataSize* iGetDataSizeParams; + //RequestData -params + CSConRequestData* iRequestDataParams; + //GetDataOwnerStatus -params + CSConGetDataOwnerStatus* iGetDataOwnerParams; + //SupplyData -params + CSConSupplyData* iSupplyDataParams; + //ListPublicFiles -params + CSConListPublicFiles* iPubFilesParams; + //ListDataOwners -params + CSConListDataOwners* iListDataOwnersParams; + //Reboot -params + CSConReboot* iRebootParams; + //GetMetadata -params + CSConGetMetadata* iGetMetadataParams; + }; + +//============================================================ +// class CSConStatusReply declaration +//============================================================ +NONSHARABLE_CLASS( CSConStatusReply ): public CBase + { + public: + CSConStatusReply(); + ~CSConStatusReply(); + + public: + TBool iNoTasks; //no active tasks + RPointerArray iTasks; + }; + +#endif + +// End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/common/conmltask/src/sconconmltask.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/common/conmltask/src/sconconmltask.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1696 @@ +/* +* Copyright (c) 2005-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: ConML Task implementations +* +*/ + + +// INCLUDE FILES + +#include "sconconmltask.h" + +// ----------------------------------------------------------------------------- +// CSConReboot::CSConReboot() +// +// ----------------------------------------------------------------------------- +// +CSConReboot::CSConReboot() : iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConReboot::~CSConReboot() +// +// ----------------------------------------------------------------------------- +// +CSConReboot::~CSConReboot() + { + } + +// ----------------------------------------------------------------------------- +// CSConReboot::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConReboot* CSConReboot::CopyL() + { + CSConReboot* copy = new (ELeave) CSConReboot(); + copy->iComplete = iComplete; + copy->iProgress = iProgress; + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConDataOwner::CSConDataOwner() +// +// ----------------------------------------------------------------------------- +// +CSConDataOwner::CSConDataOwner() + { + iHasFiles = ENoFiles; + iJavaHash = NULL; + iUid.iUid = 0; + + //Initialize iDriveList with zeros + iDriveList.Fill( '\x0' ); + } + +// ----------------------------------------------------------------------------- +// CSConDataOwner::~CSConDataOwner() +// +// ----------------------------------------------------------------------------- +// +CSConDataOwner::~CSConDataOwner() + { + delete iJavaHash; + iJavaHash = NULL; + } + +// ----------------------------------------------------------------------------- +// CSConDataOwner::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConDataOwner* CSConDataOwner::CopyL() + { + CSConDataOwner* copy = new (ELeave) CSConDataOwner(); + copy->iType = iType; + copy->iUid = iUid; + copy->iDriveList.Copy( iDriveList ); + copy->iPackageName = iPackageName; + copy->iReqReboot = iReqReboot; + copy->iHasFiles = iHasFiles; + copy->iSupportsInc = iSupportsInc; + copy->iSupportsSel = iSupportsSel; + copy->iDelayToPrep = iDelayToPrep; + copy->iSize = iSize; + copy->iDataOwnStatus = iDataOwnStatus; + copy->iTransDataType = iTransDataType; + + if ( iJavaHash ) + { + if ( copy->iJavaHash ) + { + delete copy->iJavaHash; + copy->iJavaHash = NULL; + } + copy->iJavaHash = iJavaHash->Alloc(); + } + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConUpdateDeviceInfo::CSConUpdateDeviceInfo() +// +// ----------------------------------------------------------------------------- +// +CSConUpdateDeviceInfo::CSConUpdateDeviceInfo() : + iInstallSupp(EFalse), iUninstallSupp(EFalse), + iInstParamsSupp(EFalse), iInstAppsSupp(EFalse), + iDataOwnersSupp(EFalse), iSetBURModeSupp(EFalse), + iGetSizeSupp(EFalse), iReqDataSupp(EFalse), + iSupplyDataSupp(EFalse), iRebootSupp(EFalse), + iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConUpdateDeviceInfo::~CSConUpdateDeviceInfo() +// +// ----------------------------------------------------------------------------- +// +CSConUpdateDeviceInfo::~CSConUpdateDeviceInfo() + { + } + +// ----------------------------------------------------------------------------- +// CSConUpdateDeviceInfo::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConUpdateDeviceInfo* CSConUpdateDeviceInfo::CopyL() + { + CSConUpdateDeviceInfo* copy = new (ELeave) CSConUpdateDeviceInfo(); + copy->iVersion.Copy( iVersion ); + copy->iInstallSupp = iInstallSupp; + copy->iUninstallSupp = iUninstallSupp; + copy->iInstParamsSupp = iInstParamsSupp; + copy->iInstAppsSupp = iInstAppsSupp; + copy->iDataOwnersSupp = iDataOwnersSupp; + copy->iSetBURModeSupp = iSetBURModeSupp; + copy->iGetSizeSupp = iGetSizeSupp; + copy->iReqDataSupp = iReqDataSupp; + copy->iSupplyDataSupp = iSupplyDataSupp; + copy->iMaxObjectSize = iMaxObjectSize; + copy->iRebootSupp = iRebootSupp; + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +CSConInstApp::~CSConInstApp() + { + delete iWidgetBundleId; + } +// ----------------------------------------------------------------------------- +// CSConInstApp::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConInstApp* CSConInstApp::CopyL() + { + CSConInstApp* copy = new (ELeave) CSConInstApp(); + + copy->iName.Copy( iName ); + copy->iParentName.Copy( iParentName ); + copy->iVendor.Copy( iVendor ); + copy->iVersion.Copy( iVersion ); + copy->iSize = iSize; + copy->iType = iType; + copy->iUid = iUid; + if ( iWidgetBundleId ) + { + copy->iWidgetBundleId = iWidgetBundleId->AllocL(); + } + else + { + copy->iWidgetBundleId = NULL; + } + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConListInstApps::CSConListInstApps() +// +// ----------------------------------------------------------------------------- +// +CSConListInstApps::CSConListInstApps() : iComplete( EFalse ), iProgress( 0 ) + { + //Initialize iDriveList with zeros + iDriveList.Fill( '\x0' ); + } + +// ----------------------------------------------------------------------------- +// CSConListInstApps::~CSConListInstApps() +// +// ----------------------------------------------------------------------------- +// +CSConListInstApps::~CSConListInstApps() + { + iApps.ResetAndDestroy(); + iApps.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConListInstApps::CopyL() +// +// ----------------------------------------------------------------------------- +// +CSConListInstApps* CSConListInstApps::CopyL() + { + CSConListInstApps* copy = new (ELeave) CSConListInstApps(); + copy->iAllApps = iAllApps; + copy->iDriveList = iDriveList; + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + for( TInt i = 0; i < iApps.Count(); i++ ) + { + copy->iApps.Append( iApps[i]->CopyL() ); + } + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConFile::CSConFile +// +// ----------------------------------------------------------------------------- +// +CSConFile::CSConFile() + { + } + +// ----------------------------------------------------------------------------- +// CSConFile::~CSConFile +// +// ----------------------------------------------------------------------------- +// +CSConFile::~CSConFile() + { + + } + +// ----------------------------------------------------------------------------- +// CSConFile::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConFile* CSConFile::CopyL() + { + CSConFile* copy = new (ELeave) CSConFile(); + + copy->iPath.Copy( iPath ); + copy->iModified.Copy( iModified ); + copy->iSize = iSize; + copy->iUserPerm = iUserPerm; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConInstall::CSConInstall() +// +// ----------------------------------------------------------------------------- +// +CSConInstall::CSConInstall() : iMode( EUnknown ), iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConInstall::~CSConInstall() +// +// ----------------------------------------------------------------------------- +// +CSConInstall::~CSConInstall() + { + } + +// ----------------------------------------------------------------------------- +// CSConInstall::CopyL() +// +// ----------------------------------------------------------------------------- +// +CSConInstall* CSConInstall::CopyL() + { + CSConInstall* copy = new (ELeave) CSConInstall(); + copy->iPath = iPath; + copy->iMode = iMode; + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConUninstall::CSConUninstall() +// +// ----------------------------------------------------------------------------- +// +CSConUninstall::CSConUninstall() : iMode( EUnknown ), iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConUninstall::~CSConUninstall() +// +// ----------------------------------------------------------------------------- +// +CSConUninstall::~CSConUninstall() + { + } + +// ----------------------------------------------------------------------------- +// CSConUninstall::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConUninstall* CSConUninstall::CopyL() + { + CSConUninstall* copy = new (ELeave) CSConUninstall(); + copy->iName = iName; + copy->iVendor = iVendor; + copy->iUid = iUid; + copy->iMode = iMode; + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConListDataOwners::CSConListDataOwners() +// +// ----------------------------------------------------------------------------- +// +CSConListDataOwners::CSConListDataOwners() : iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConListDataOwners::~CSConListDataOwners() +// +// ----------------------------------------------------------------------------- +// +CSConListDataOwners::~CSConListDataOwners() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConListDataOwners::CopyL() +// +// ----------------------------------------------------------------------------- +// +CSConListDataOwners* CSConListDataOwners::CopyL() + { + CSConListDataOwners* copy = new (ELeave) CSConListDataOwners(); + CleanupStack::PushL( copy ); + for( TInt i = 0; i < iDataOwners.Count(); i++ ) + { + copy->iDataOwners.Append( iDataOwners[i]->CopyL() ); + } + CleanupStack::Pop( copy ); + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConListDataOwners::DeleteDataOwners() +// +// ----------------------------------------------------------------------------- +// +void CSConListDataOwners::DeleteDataOwners() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CCSConSetBURMode::CSConSetBURMode() +// +// ----------------------------------------------------------------------------- +// +CSConSetBURMode::CSConSetBURMode() : iComplete( EFalse ), iProgress( 0 ) + { + //Initialize iDriveList with zeros + iDriveList.Fill( '\x0' ); + } + +// ----------------------------------------------------------------------------- +// CSConSetBURMode::~CSConSetBURMode() +// +// ----------------------------------------------------------------------------- +// +CSConSetBURMode::~CSConSetBURMode() + { + } + +// ----------------------------------------------------------------------------- +// CSConSetBURMode::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConSetBURMode* CSConSetBURMode::CopyL() + { + CSConSetBURMode* copy = new (ELeave) CSConSetBURMode(); + copy->iDriveList.Copy( iDriveList ); + copy->iPartialType = iPartialType; + copy->iIncType = iIncType; + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConGetDataSize::CSConGetDataSize() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataSize::CSConGetDataSize() : iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConGetDataSize::~CSConGetDataSize() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataSize::~CSConGetDataSize() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConGetDataSize::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataSize* CSConGetDataSize::CopyL() + { + CSConGetDataSize* copy = new (ELeave) CSConGetDataSize(); + CleanupStack::PushL( copy ); + for( TInt i = 0; i < iDataOwners.Count(); i++ ) + { + copy->iDataOwners.Append( iDataOwners[i]->CopyL() ); + } + CleanupStack::Pop( copy ); + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConGetDataSize::DeleteDataOwners() +// +// ----------------------------------------------------------------------------- +// +void CSConGetDataSize::DeleteDataOwners() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConListPublicFiles::CSConListPublicFiles() +// +// ----------------------------------------------------------------------------- +// +CSConListPublicFiles::CSConListPublicFiles() : iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConListPublicFiles::~CSConListPublicFiles() +// +// ----------------------------------------------------------------------------- +// +CSConListPublicFiles::~CSConListPublicFiles() + { + iFiles.ResetAndDestroy(); + iFiles.Close(); + + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConListPublicFiles::CopyL() +// +// ----------------------------------------------------------------------------- +// +CSConListPublicFiles* CSConListPublicFiles::CopyL() + { + CSConListPublicFiles* copy = new (ELeave) CSConListPublicFiles(); + CleanupStack::PushL( copy ); + for( TInt i = 0; i < iFiles.Count(); i++ ) + { + copy->iFiles.Append( iFiles[i]->CopyL() ); + } + + for( TInt j = 0; j < iDataOwners.Count(); j++ ) + { + copy->iDataOwners.Append( iDataOwners[j]->CopyL() ); + } + CleanupStack::Pop( copy ); + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConRequestData::CSConRequestData() +// +// ----------------------------------------------------------------------------- +// +CSConRequestData::CSConRequestData() : iDataOwner( NULL ), iBackupData( NULL ), + iMoreData( EFalse ), iComplete( EFalse ), iProgress( 0 ) + { + iDataOwner = new CSConDataOwner(); + } + +// ----------------------------------------------------------------------------- +// CSConRequestData::~CSConRequestData() +// +// ----------------------------------------------------------------------------- +// +CSConRequestData::~CSConRequestData() + { + if ( iDataOwner ) + { + delete iDataOwner; + iDataOwner = NULL; + } + + if ( iBackupData ) + { + delete iBackupData; + iBackupData = NULL; + } + } + +// ----------------------------------------------------------------------------- +// CSConRequestData::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConRequestData* CSConRequestData::CopyL() + { + CSConRequestData* copy = new (ELeave) CSConRequestData(); + + if ( iDataOwner ) + { + if ( copy->iDataOwner ) + { + delete copy->iDataOwner; + copy->iDataOwner = NULL; + } + copy->iDataOwner = iDataOwner->CopyL(); + } + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + if ( iBackupData ) + { + if ( copy->iBackupData ) + { + delete copy->iBackupData; + copy->iBackupData = NULL; + } + copy->iBackupData = iBackupData->Alloc(); + } + + copy->iMoreData = iMoreData; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConRequestData::DeleteDataAndDataOwner() +// +// ----------------------------------------------------------------------------- +// +void CSConRequestData::DeleteDataAndDataOwner() + { + if ( iDataOwner ) + { + delete iDataOwner; + iDataOwner = NULL; + } + + if ( iBackupData ) + { + delete iBackupData; + iBackupData = NULL; + } + } + +// ----------------------------------------------------------------------------- +// CSConGetDataOwnerStatus::CSConGetDataOwnerStatus() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataOwnerStatus::CSConGetDataOwnerStatus() : iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConGetDataOwnerStatus::~CSConGetDataOwnerStatus() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataOwnerStatus::~CSConGetDataOwnerStatus() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConGetDataOwnerStatus::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConGetDataOwnerStatus* CSConGetDataOwnerStatus::CopyL() + { + CSConGetDataOwnerStatus* copy = new (ELeave) CSConGetDataOwnerStatus(); + CleanupStack::PushL( copy ); + for( TInt i = 0; i < iDataOwners.Count(); i++ ) + { + copy->iDataOwners.Append( iDataOwners[i]->CopyL() ); + } + CleanupStack::Pop( copy ); + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConGetDataOwnerStatus::DeleteDataOwners() +// +// ----------------------------------------------------------------------------- +// +void CSConGetDataOwnerStatus::DeleteDataOwners() + { + iDataOwners.ResetAndDestroy(); + iDataOwners.Close(); + } + +// ----------------------------------------------------------------------------- +// CSConSupplyData::CSConSupplyData() +// +// ----------------------------------------------------------------------------- +// +CSConSupplyData::CSConSupplyData() : iDataOwner( NULL ), iRestoreData( NULL ), + iComplete( EFalse ), iProgress( 0 ) + { + iDataOwner = new CSConDataOwner(); + } + +// ----------------------------------------------------------------------------- +// CSConSupplyData::~CSConSupplyData() +// +// ----------------------------------------------------------------------------- +// +CSConSupplyData::~CSConSupplyData() + { + if ( iDataOwner ) + { + delete iDataOwner; + iDataOwner = NULL; + } + + if ( iRestoreData ) + { + delete iRestoreData; + iRestoreData = NULL; + } + } + +// ----------------------------------------------------------------------------- +// CSConSupplyData::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConSupplyData* CSConSupplyData::CopyL() + { + CSConSupplyData* copy = new (ELeave) CSConSupplyData(); + CleanupStack::PushL( copy ); + + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + if ( iDataOwner ) + { + if ( copy->iDataOwner ) + { + delete copy->iDataOwner; + copy->iDataOwner = NULL; + } + + copy->iDataOwner = iDataOwner->CopyL(); + } + CleanupStack::Pop( copy ); + + if ( iRestoreData ) + { + if ( copy->iRestoreData ) + { + delete copy->iRestoreData; + copy->iRestoreData = NULL; + } + + copy->iRestoreData = iRestoreData->Alloc(); + } + + copy->iMoreData = iMoreData; + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConGetMetadata::CSConGetMetadata() +// +// ----------------------------------------------------------------------------- +// +CSConGetMetadata::CSConGetMetadata() : iData( NULL ), + iMoreData( EFalse ), iComplete( EFalse ), iProgress( 0 ) + { + } + +// ----------------------------------------------------------------------------- +// CSConGetMetadata::~CSConGetMetadata() +// +// ----------------------------------------------------------------------------- +// +CSConGetMetadata::~CSConGetMetadata() + { + if ( iData ) + { + delete iData; + iData = NULL; + } + } + +// ----------------------------------------------------------------------------- +// CSConGetMetadata::Copy() +// +// ----------------------------------------------------------------------------- +// +CSConGetMetadata* CSConGetMetadata::CopyL() + { + CSConGetMetadata* copy = new (ELeave) CSConGetMetadata(); + + copy->iFilename = iFilename; + + if ( iData ) + { + if ( copy->iData ) + { + delete copy->iData; + copy->iData = NULL; + } + + copy->iData = iData->Alloc(); + } + + copy->iMoreData = iMoreData; + copy->iComplete = iComplete; + copy->iProgress = iProgress; + + return copy; + } + + +// ----------------------------------------------------------------------------- +// CSConTask::NewL( TSConMethodName aMethod ) +// +// ----------------------------------------------------------------------------- +// +CSConTask* CSConTask::NewL( TSConMethodName aMethod ) + { + CSConTask* self = NewLC( aMethod ); + CleanupStack::Pop( self ); + return self; + } + +// ----------------------------------------------------------------------------- +// CSConTask::NewLC( TSConMethodName aMethod ) +// +// ----------------------------------------------------------------------------- +// +CSConTask* CSConTask::NewLC( TSConMethodName aMethod ) + { + CSConTask* self = new (ELeave) CSConTask(); + CleanupStack::PushL( self ); + self->ConstructL( aMethod ); + return self; + } + +// ----------------------------------------------------------------------------- +// CSConTask::ConstructL( TSConMethodName aMethod ) +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CSConTask::ConstructL( TSConMethodName aMethod ) + { + iMethod = aMethod; + + switch( aMethod ) + { + case ECancel : + break; + case EGetDataOwnerStatus : + iGetDataOwnerParams = new (ELeave) CSConGetDataOwnerStatus(); + break; + case EGetDataSize : + iGetDataSizeParams = new (ELeave) CSConGetDataSize(); + break; + case EGetStatus : + iGetStatusParams = new (ELeave) CSConGetStatus(); + break; + case EInstall : + iInstallParams = new (ELeave) CSConInstall(); + break; + case EListDataOwners : + iListDataOwnersParams = new (ELeave) CSConListDataOwners(); + break; + case EListInstalledApps : + iListAppsParams = new (ELeave) CSConListInstApps(); + break; + case EListPublicFiles : + iPubFilesParams = new (ELeave) CSConListPublicFiles(); + break; + case ERequestData : + iRequestDataParams = new (ELeave) CSConRequestData(); + break; + case ESetBURMode : + iBURModeParams = new (ELeave) CSConSetBURMode(); + break; + case ESetInstParams : + break; + case ESupplyData : + iSupplyDataParams = new (ELeave) CSConSupplyData(); + break; + case EUninstall : + iUninstallParams = new (ELeave) CSConUninstall(); + break; + case EUpdateDeviceInfo : + iDevInfoParams = new (ELeave) CSConUpdateDeviceInfo(); + break; + case EReboot : + iRebootParams = new (ELeave) CSConReboot(); + break; + case EGetMetadata : + iGetMetadataParams = new (ELeave) CSConGetMetadata(); + break; + default : + break; + } + } +// ----------------------------------------------------------------------------- +// CSConTask::CSConTask() +// +// ----------------------------------------------------------------------------- +// +CSConTask::CSConTask() + { + } + +// ----------------------------------------------------------------------------- +// CSConTask::~CSConTask() +// +// ----------------------------------------------------------------------------- +// +CSConTask::~CSConTask() + { + delete iDevInfoParams; + delete iListAppsParams; + delete iGetStatusParams; + delete iInstallParams; + delete iUninstallParams; + delete iBURModeParams; + delete iGetDataSizeParams; + delete iRequestDataParams; + delete iGetDataOwnerParams; + delete iSupplyDataParams; + delete iPubFilesParams; + delete iListDataOwnersParams; + delete iRebootParams; + delete iGetMetadataParams; + } + +// ----------------------------------------------------------------------------- +// CSConTask::GetServiceId() const +// +// ----------------------------------------------------------------------------- +// +TSConMethodName CSConTask::GetServiceId() const + { + return iMethod; + } + +// ----------------------------------------------------------------------------- +// CSConTask::Copy() const +// +// ----------------------------------------------------------------------------- +// +CSConTask* CSConTask::CopyL() const + { + CSConTask* copy = new (ELeave) CSConTask(); + copy->iMethod = iMethod; + + if ( iDevInfoParams ) + { + copy->iDevInfoParams = iDevInfoParams->CopyL(); + } + if ( iListAppsParams ) + { + copy->iListAppsParams = iListAppsParams->CopyL(); + } + if ( iGetStatusParams ) + { + + } + if ( iInstallParams ) + { + copy->iInstallParams = iInstallParams->CopyL(); + } + if ( iUninstallParams ) + { + copy->iUninstallParams = iUninstallParams->CopyL(); + } + if ( iBURModeParams ) + { + copy->iBURModeParams = iBURModeParams->CopyL(); + } + if ( iGetDataSizeParams ) + { + copy->iGetDataSizeParams = iGetDataSizeParams->CopyL(); + } + if ( iRequestDataParams ) + { + copy->iRequestDataParams = iRequestDataParams->CopyL(); + } + if ( iGetDataOwnerParams ) + { + copy->iGetDataOwnerParams = iGetDataOwnerParams->CopyL(); + } + if ( iSupplyDataParams ) + { + copy->iSupplyDataParams = iSupplyDataParams->CopyL(); + } + if ( iPubFilesParams ) + { + copy->iPubFilesParams = iPubFilesParams->CopyL(); + } + if ( iListDataOwnersParams ) + { + copy->iListDataOwnersParams = iListDataOwnersParams->CopyL(); + } + if ( iRebootParams ) + { + copy->iRebootParams = iRebootParams->CopyL(); + } + if ( iGetMetadataParams ) + { + copy->iGetMetadataParams = iGetMetadataParams->CopyL(); + } + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConTask::GetComplete() +// +// ----------------------------------------------------------------------------- +// +TBool CSConTask::GetComplete() + { + TBool complete( EFalse ); + + switch( iMethod ) + { + case EInstall : + complete = this->iInstallParams->iComplete; + break; + case EUninstall : + complete = this->iUninstallParams->iComplete; + break; + case EListInstalledApps : + complete = this->iListAppsParams->iComplete; + break; + case ESetInstParams : + break; + case ESetBURMode : + complete = this->iBURModeParams->iComplete; + break; + case EListPublicFiles : + complete = this->iPubFilesParams->iComplete; + break; + case EListDataOwners : + complete = this->iListDataOwnersParams->iComplete; + break; + case EGetDataSize : + complete = this->iGetDataSizeParams->iComplete; + break; + case EReboot : + complete = this->iRebootParams->iComplete; + break; + case ERequestData : + //If task is partially completed, + //it can be removed from the queue + if ( this->iRequestDataParams->iProgress == KSConTaskPartiallyCompleted ) + { + complete = ETrue; + } + else + { + complete = this->iRequestDataParams->iComplete; + } + + break; + case EGetDataOwnerStatus : + complete = this->iGetDataOwnerParams->iComplete; + break; + case ESupplyData : + //If task is partially completed, + //it can be removed from the queue + if ( this->iSupplyDataParams->iProgress == KSConTaskPartiallyCompleted ) + { + complete = ETrue; + } + else + { + complete = this->iSupplyDataParams->iComplete; + } + + break; + case EGetMetadata : + complete = this->iGetMetadataParams->iComplete; + break; + default : + break; + } + + return complete; + } + +// ----------------------------------------------------------------------------- +// CSConTask::SetCompleteValue( TBool aValue ) +// +// ----------------------------------------------------------------------------- +// +void CSConTask::SetCompleteValue( TBool aValue ) + { + switch( iMethod ) + { + case EInstall : + this->iInstallParams->iComplete = aValue; + break; + case EUninstall : + this->iUninstallParams->iComplete = aValue; + break; + case EListInstalledApps : + this->iListAppsParams->iComplete = aValue; + break; + case ESetInstParams : + this->iInstallParams->iComplete = aValue; + break; + case ESetBURMode : + this->iBURModeParams->iComplete = aValue; + break; + case EListPublicFiles : + this->iPubFilesParams->iComplete = aValue; + break; + case EListDataOwners : + this->iListDataOwnersParams->iComplete = aValue; + break; + case EGetDataSize : + this->iGetDataSizeParams->iComplete = aValue; + break; + case EReboot : + this->iRebootParams->iComplete = aValue; + break; + case ERequestData : + this->iRequestDataParams->iComplete = aValue; + break; + case EGetDataOwnerStatus : + this->iGetDataOwnerParams->iComplete = aValue; + break; + case ESupplyData : + this->iSupplyDataParams->iComplete = aValue; + break; + case EGetMetadata : + this->iGetMetadataParams->iComplete = aValue; + break; + default: + break; + } + } + +// ----------------------------------------------------------------------------- +// CSConTask::GetCompleteValue() +// +// ----------------------------------------------------------------------------- +// +TBool CSConTask::GetCompleteValue() + { + TBool complete( EFalse ); + + switch( iMethod ) + { + case EInstall : + complete = this->iInstallParams->iComplete; + break; + case EUninstall : + complete = this->iUninstallParams->iComplete; + break; + case EListInstalledApps : + complete = this->iListAppsParams->iComplete; + break; + case ESetInstParams : + complete = this->iInstallParams->iComplete; + break; + case ESetBURMode : + complete = this->iBURModeParams->iComplete; + break; + case EListPublicFiles : + complete = this->iPubFilesParams->iComplete; + break; + case EListDataOwners : + complete = this->iListDataOwnersParams->iComplete; + break; + case EGetDataSize : + complete = this->iGetDataSizeParams->iComplete; + break; + case EReboot : + complete = this->iRebootParams->iComplete; + break; + case ERequestData : + if ( this->iRequestDataParams->iProgress != KSConTaskPartiallyCompleted ) + { + complete = this->iRequestDataParams->iComplete; + } + else + { + complete = ETrue; + } + + break; + case EGetDataOwnerStatus : + complete = this->iGetDataOwnerParams->iComplete; + break; + case ESupplyData : + if ( this->iSupplyDataParams->iProgress != KSConTaskPartiallyCompleted ) + { + complete = this->iSupplyDataParams->iComplete; + } + else + { + complete = ETrue; + } + break; + case EGetMetadata : + complete = this->iGetMetadataParams->iComplete; + break; + default: + break; + } + return complete; + } + +// ----------------------------------------------------------------------------- +// CSConTask::SetProgressValue( TInt aValue ) +// +// ----------------------------------------------------------------------------- +// +void CSConTask::SetProgressValue( TInt aValue ) + { + switch( iMethod ) + { + case EInstall : + this->iInstallParams->iProgress = aValue; + break; + case EUninstall : + this->iUninstallParams->iProgress = aValue; + break; + case EListInstalledApps : + this->iListAppsParams->iProgress = aValue; + break; + case ESetInstParams : + this->iInstallParams->iProgress = aValue; + break; + case ESetBURMode : + this->iBURModeParams->iProgress = aValue; + break; + case EListPublicFiles : + this->iPubFilesParams->iProgress = aValue; + break; + case EListDataOwners : + this->iListDataOwnersParams->iProgress = aValue; + break; + case EGetDataSize : + this->iGetDataSizeParams->iProgress = aValue; + break; + case EReboot : + this->iRebootParams->iProgress = aValue; + break; + case ERequestData : + this->iRequestDataParams->iProgress = aValue; + break; + case EGetDataOwnerStatus : + this->iGetDataOwnerParams->iProgress = aValue; + break; + case ESupplyData : + this->iSupplyDataParams->iProgress = aValue; + break; + case EGetMetadata : + this->iGetMetadataParams->iProgress = aValue; + break; + default: + break; + } + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::CSConTaskReply() +// +// ----------------------------------------------------------------------------- +// +CSConTaskReply::CSConTaskReply() + { + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::CSConTaskReply( TSConMethodName aMethod ) +// +// ----------------------------------------------------------------------------- +// +CSConTaskReply::CSConTaskReply( TSConMethodName aMethod ) + { + iMethod = aMethod; + switch( aMethod ) + { + case ECancel : + break; + case EGetDataOwnerStatus : + iGetDataOwnerParams = new CSConGetDataOwnerStatus(); + break; + case EGetDataSize : + iGetDataSizeParams = new CSConGetDataSize(); + break; + case EGetStatus : + iGetStatusParams = new CSConGetStatus(); + break; + case EInstall : + iInstallParams = new CSConInstall(); + break; + case EListDataOwners : + iListDataOwnersParams = new CSConListDataOwners(); + break; + case EListInstalledApps : + iListAppsParams = new CSConListInstApps(); + break; + case EListPublicFiles : + iPubFilesParams = new CSConListPublicFiles(); + break; + case ERequestData : + iRequestDataParams = new CSConRequestData(); + break; + case ESetBURMode : + iBURModeParams = new CSConSetBURMode(); + break; + case ESetInstParams : + break; + case ESupplyData : + iSupplyDataParams = new CSConSupplyData(); + break; + case EUninstall : + iUninstallParams = new CSConUninstall(); + break; + case EUpdateDeviceInfo : + iDevInfoParams = new CSConUpdateDeviceInfo(); + break; + case EReboot : + iRebootParams = new CSConReboot(); + break; + case EGetMetadata : + iGetMetadataParams = new CSConGetMetadata(); + break; + default : + break; + } + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::~CSConTaskReply() +// +// ----------------------------------------------------------------------------- +// +CSConTaskReply::~CSConTaskReply() + { + delete iDevInfoParams; + delete iListAppsParams; + delete iGetStatusParams; + delete iInstallParams; + delete iUninstallParams; + delete iBURModeParams; + delete iGetDataSizeParams; + delete iRequestDataParams; + delete iGetDataOwnerParams; + delete iSupplyDataParams; + delete iPubFilesParams; + delete iListDataOwnersParams; + delete iRebootParams; + delete iGetMetadataParams; + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::Initialize( const CSConTask& aTask ) +// +// ----------------------------------------------------------------------------- +// +void CSConTaskReply::InitializeL( const CSConTask& aTask ) + { + iTaskId = aTask.iTaskId; + iMethod = aTask.iMethod; + + if ( iMethod == EInstall ) + { + if ( iInstallParams ) + { + delete iInstallParams; + iInstallParams = NULL; + } + iInstallParams = aTask.iInstallParams->CopyL(); + } + else if ( iMethod == EListInstalledApps ) + { + if ( iListAppsParams ) + { + delete iListAppsParams; + iListAppsParams = NULL; + } + + iListAppsParams = aTask.iListAppsParams->CopyL(); + } + else if ( iMethod == EUninstall ) + { + if ( iUninstallParams ) + { + delete iUninstallParams; + iUninstallParams = NULL; + } + + iUninstallParams = aTask.iUninstallParams->CopyL(); + } + else if ( iMethod == ESetBURMode ) + { + if ( iBURModeParams ) + { + delete iBURModeParams; + iBURModeParams = NULL; + } + + iBURModeParams = aTask.iBURModeParams->CopyL(); + } + else if ( iMethod == EListPublicFiles ) + { + if ( iPubFilesParams ) + { + delete iPubFilesParams; + iPubFilesParams = NULL; + } + + iPubFilesParams = aTask.iPubFilesParams->CopyL(); + } + else if ( iMethod == EListDataOwners ) + { + if ( iListDataOwnersParams ) + { + delete iListDataOwnersParams; + iListDataOwnersParams = NULL; + } + + iListDataOwnersParams = aTask.iListDataOwnersParams->CopyL(); + } + else if ( iMethod == EGetDataSize ) + { + if ( iGetDataSizeParams ) + { + delete iGetDataSizeParams; + iGetDataSizeParams = NULL; + } + + iGetDataSizeParams = aTask.iGetDataSizeParams->CopyL(); + } + else if ( iMethod == EReboot ) + { + if ( iRebootParams ) + { + delete iRebootParams; + iRebootParams = NULL; + } + } + else if ( iMethod == ERequestData ) + { + if ( iRequestDataParams ) + { + delete iRequestDataParams; + iRequestDataParams = NULL; + } + + iRequestDataParams = aTask.iRequestDataParams->CopyL(); + } + else if ( iMethod == EGetDataOwnerStatus ) + { + if ( iGetDataOwnerParams ) + { + delete iGetDataOwnerParams; + iGetDataOwnerParams = NULL; + } + + iGetDataOwnerParams = aTask.iGetDataOwnerParams->CopyL(); + } + else if ( iMethod == ESupplyData ) + { + if ( iSupplyDataParams ) + { + delete iSupplyDataParams; + iSupplyDataParams = NULL; + } + + iSupplyDataParams = aTask.iSupplyDataParams->CopyL(); + } + else if ( iMethod == EGetMetadata ) + { + if ( iGetMetadataParams ) + { + delete iGetMetadataParams; + iGetMetadataParams = NULL; + } + + iGetMetadataParams = aTask.iGetMetadataParams->CopyL(); + } + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::Initialize( TSConMethodName aMethod, +// TInt aProgress, TBool aComplete ) +// +// ----------------------------------------------------------------------------- +// +void CSConTaskReply::InitializeL( TSConMethodName aMethod, + TInt aProgress, TBool aComplete ) + { + iMethod = aMethod; + if ( aMethod == EUpdateDeviceInfo ) + { + if ( !iDevInfoParams ) + { + iDevInfoParams = new (ELeave) CSConUpdateDeviceInfo(); + } + + iDevInfoParams->iComplete = aComplete; + iDevInfoParams->iProgress = aProgress; + } + else if ( aMethod == EReboot ) + { + if ( !iRebootParams ) + { + iRebootParams = new (ELeave) CSConReboot(); + } + + iRebootParams->iComplete = aComplete; + iRebootParams->iProgress = aProgress; + } + else if ( aMethod == EGetMetadata ) + { + if ( !iGetMetadataParams ) + { + iGetMetadataParams = new (ELeave) CSConGetMetadata(); + } + + iGetMetadataParams->iComplete = aComplete; + iGetMetadataParams->iProgress = aProgress; + } + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::CopyAndFree() +// +// ----------------------------------------------------------------------------- +// +CSConTaskReply* CSConTaskReply::CopyAndFreeL() + { + CSConTaskReply* copy = new (ELeave) CSConTaskReply(); + copy->iTaskId = iTaskId; + copy->iMethod = iMethod; + + if ( iDevInfoParams ) + { + copy->iDevInfoParams = iDevInfoParams->CopyL(); + + //free allocated memory + delete iDevInfoParams; + iDevInfoParams = NULL; + } + if ( iListAppsParams ) + { + copy->iListAppsParams = iListAppsParams->CopyL(); + + //free allocated memory + delete iListAppsParams; + iListAppsParams = NULL; + } + if ( iInstallParams ) + { + copy->iInstallParams = iInstallParams->CopyL(); + + //free allocated memory + delete iInstallParams; + iInstallParams = NULL; + } + if ( iUninstallParams ) + { + copy->iUninstallParams = iUninstallParams->CopyL(); + + //free allocated memory + delete iUninstallParams; + iUninstallParams = NULL; + } + if ( iBURModeParams ) + { + copy->iBURModeParams = iBURModeParams->CopyL(); + + //free allocated memory + delete iBURModeParams; + iBURModeParams = NULL; + } + if ( iGetDataSizeParams ) + { + copy->iGetDataSizeParams = iGetDataSizeParams->CopyL(); + + //free allocated memory + delete iGetDataSizeParams; + iGetDataSizeParams = NULL; + } + if ( iRequestDataParams ) + { + copy->iRequestDataParams = iRequestDataParams->CopyL(); + + //free allocated memory + delete iRequestDataParams; + iRequestDataParams = NULL; + } + if ( iGetDataOwnerParams ) + { + copy->iGetDataOwnerParams = iGetDataOwnerParams->CopyL(); + + //free allocated memory + delete iGetDataOwnerParams; + iGetDataOwnerParams = NULL; + } + if ( iSupplyDataParams ) + { + copy->iSupplyDataParams = iSupplyDataParams->CopyL(); + + //free allocated memory + delete iSupplyDataParams; + iSupplyDataParams = NULL; + } + if ( iPubFilesParams ) + { + copy->iPubFilesParams = iPubFilesParams->CopyL(); + + //free allocated memory + delete iPubFilesParams; + iPubFilesParams = NULL; + } + if ( iListDataOwnersParams ) + { + copy->iListDataOwnersParams = iListDataOwnersParams->CopyL(); + + //free allocated memory + delete iListDataOwnersParams; + iListDataOwnersParams = NULL; + } + if ( iRebootParams ) + { + copy->iRebootParams = iRebootParams->CopyL(); + + //free allocated memory + delete iRebootParams; + iRebootParams = NULL; + } + if ( iGetMetadataParams ) + { + copy->iGetMetadataParams = iGetMetadataParams->CopyL(); + + //free allocated memory + delete iGetMetadataParams; + iGetMetadataParams = NULL; + } + + return copy; + } + +// ----------------------------------------------------------------------------- +// CSConTaskReply::CleanTaskData() +// +// ----------------------------------------------------------------------------- +// +void CSConTaskReply::CleanTaskData() + { + switch( iMethod ) + { + case EGetDataSize : + if ( iGetDataSizeParams ) + { + this->iGetDataSizeParams->DeleteDataOwners(); + } + break; + case EGetDataOwnerStatus : + if ( iGetDataOwnerParams ) + { + this->iGetDataOwnerParams->DeleteDataOwners(); + } + break; + case EListDataOwners : + if ( iListDataOwnersParams ) + { + this->iListDataOwnersParams->DeleteDataOwners(); + } + break; + case ERequestData : + if ( iRequestDataParams ) + { + this->iRequestDataParams->DeleteDataAndDataOwner(); + } + break; + default : + break; + } + } + +// ----------------------------------------------------------------------------- +// CSConStatusReply::CSConStatusReply() +// +// ----------------------------------------------------------------------------- +// +CSConStatusReply::CSConStatusReply() : iNoTasks( EFalse ) + { + } + +// ----------------------------------------------------------------------------- +// CSConStatusReply::~CSConStatusReply() +// +// ----------------------------------------------------------------------------- +// +CSConStatusReply::~CSConStatusReply() + { + iTasks.ResetAndDestroy(); + iTasks.Close(); + }; + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,52 @@ +/* +* Copyright (c) 2002-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Build info file for SeCon +* +*/ + +#include + +#include "../catalogspcconnectivityplugin/group/bld.inf" +#include "../cntparser/bld/bld.inf" +#include "../services/csc/bld/bld.inf" +#include "../services/ftp/bld/bld.inf" +#include "../services/pcd/bld/bld.inf" + +#include "../wbxml/conmlhandler/bld/bld.inf" +#include "../servers/pcconn/bld/bld.inf" +#include "../servers/syncserver/group/bld.inf" + +#include "../clients/pcconn/bld/bld.inf" +#include "../clients/syncclient/group/bld.inf" + +#include "../plugins/pcconn/bld/bld.inf" +#include "../plugins/ftp/bld/bld.inf" +#include "../plugins/hapticsconnplugin/group/bld.inf" + +PRJ_EXPORTS + +// Export stub files +stubs/secon_stub.SIS /epoc32/data/z/system/install/secon_stub.SIS +stubs/sconpcconnplugin_stub.SIS /epoc32/data/z/system/install/sconpcconnplugin_stub.SIS +stubs/sconftpplugin_stub.SIS /epoc32/data/z/system/install/sconftpplugin_stub.SIS + +../rom/sconpcd.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconpcd.iby) +../rom/sconpcconnplugin.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconpcconnplugin.iby) +../rom/sconpcconnclientserver.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconpcconnclientserver.iby) +../rom/sconftpresources.iby LANGUAGE_MW_LAYER_IBY_EXPORT_PATH(sconftpresources.iby) +../rom/sconftpplugin.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconftpplugin.iby) +../rom/sconftp.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconftp.iby) +../rom/sconcsc.iby CORE_MW_LAYER_IBY_EXPORT_PATH(sconcsc.iby) +../rom/cntparser.iby CORE_MW_LAYER_IBY_EXPORT_PATH(cntparser.iby) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/createstubs.bat --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/group/stubs/createstubs.bat Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,19 @@ +rem +rem Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +rem All rights reserved. +rem This component and the accompanying materials are made available +rem under the terms of "Eclipse Public License v1.0" +rem which accompanies this distribution, and is available +rem at the URL "http://www.eclipse.org/legal/epl-v10.html". +rem +rem Initial Contributors: +rem Nokia Corporation - initial contribution. +rem +rem Contributors: +rem +rem Description: Batch file for creating needed stub files. +rem + +makesis -s sconftpplugin_stub.pkg +makesis -s sconpcconnplugin_stub.pkg +makesis -s secon_stub.pkg diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/sconftpplugin_stub.SIS Binary file connectivitymodules/SeCon/group/stubs/sconftpplugin_stub.SIS has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/sconftpplugin_stub.pkg --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/group/stubs/sconftpplugin_stub.pkg Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,30 @@ +; +; Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +; All rights reserved. +; This component and the accompanying materials are made available +; under the terms of "Eclipse Public License v1.0" +; which accompanies this distribution, and is available +; at the URL "http://www.eclipse.org/legal/epl-v10.html". +; +; Initial Contributors: +; Nokia Corporation - initial contribution. +; +; Contributors: +; +; Description: Sis-stub file for FTP Plugin +; +; Languages +&EN + +; Header +#{"FTP Plugin"},(0x101F9686),1,0,0, TYPE=SA + +; Localised Vendor name +%{"Nokia"} + +; Unique Vendor name +:"Nokia" + +; Files to install +""-"z:\resource\plugins\sconftpplugin.rsc" +""-"z:\sys\bin\sconftpplugin.dll" diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/sconpcconnplugin_stub.SIS Binary file connectivitymodules/SeCon/group/stubs/sconpcconnplugin_stub.SIS has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/sconpcconnplugin_stub.pkg --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/group/stubs/sconpcconnplugin_stub.pkg Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,30 @@ +; +; Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +; All rights reserved. +; This component and the accompanying materials are made available +; under the terms of "Eclipse Public License v1.0" +; which accompanies this distribution, and is available +; at the URL "http://www.eclipse.org/legal/epl-v10.html". +; +; Initial Contributors: +; Nokia Corporation - initial contribution. +; +; Contributors: +; +; Description: Sis-stub file for PCConn Plugin +; +; Languages +&EN + +; Header +#{"PCConn Plugin"},(0x101F9688),1,0,0, TYPE=SA + +; Localised Vendor name +%{"Nokia"} + +; Unique Vendor name +:"Nokia" + +; Files to install +""-"z:\resource\plugins\sconpcconnplugin.rsc" +""-"z:\sys\bin\sconpcconnplugin.dll" diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/secon_stub.SIS Binary file connectivitymodules/SeCon/group/stubs/secon_stub.SIS has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/group/stubs/secon_stub.pkg --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/group/stubs/secon_stub.pkg Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,38 @@ +; +; Copyright (c) 2010 Nokia Corporation and/or its subsidiary(-ies). +; All rights reserved. +; This component and the accompanying materials are made available +; under the terms of "Eclipse Public License v1.0" +; which accompanies this distribution, and is available +; at the URL "http://www.eclipse.org/legal/epl-v10.html". +; +; Initial Contributors: +; Nokia Corporation - initial contribution. +; +; Contributors: +; +; Description: Sis-stub file for Service Controllers +; +; Languages +&EN + +; Header +#{"Service Controllers"},(0x101F99F6),1,72,0, TYPE=SA + +; Localised Vendor name +%{"Nokia"} + +; Unique Vendor name +:"Nokia" + +; Files to install +""-"z:\sys\bin\sconpcconnserver.exe" +""-"z:\sys\bin\sconpcconnclient.dll" +""-"z:\sys\bin\sconpcd.dll" +""-"z:\resource\sconftp.r??" +""-"z:\sys\bin\sconftp.dll" +""-"z:\sys\bin\sconcsc.dll" +""-"z:\sys\bin\sconconmlhandler.dll" +""-"z:\sys\bin\catalogspcconnectivityplugin.dll" +""-"z:\sys\bin\cntparserserver.dll" +""-"z:\sys\bin\cntparserserverexe.exe" diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/inc/debug.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/inc/debug.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,128 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Debug utility for SeCon components. +* +*/ + + +#ifndef _SECON_DEBUG_H +#define _SECON_DEBUG_H + +#ifdef _DEBUG + + #ifdef __WINS__ + // Enable file logging + #define __FLOGGING__ + #endif //__WINS__ + + #include + #ifdef __FLOGGING__ + #include + #include + #endif + + NONSHARABLE_CLASS(TOverflowTruncate16) : public TDes16Overflow + { + public: + void Overflow(TDes16& /*aDes*/) {} + }; + + NONSHARABLE_CLASS(TOverflowTruncate8) : public TDes8Overflow + { + public: + void Overflow(TDes8& /*aDes*/) {} + }; + + _LIT( KLogDir, "SECON" ); + _LIT( KLogFile, "SeconDebug.txt" ); + + _LIT(KTracePrefix16, "[SeCon] "); + _LIT8(KTracePrefix8, "[SeCon] "); + _LIT8(KFuncEntryFormat8, "%S : Begin"); + _LIT8(KFuncExitFormat8, "%S : End"); + _LIT8(KFuncReturnFormat8, "%S : End, return: %d"); + _LIT8(KFuncFormat8, "><%S"); + + const TInt KMaxLogLineLength = 512; + + // old function loggin macros + #define LOGGER_ENTERFN( name ) {TRACE_FUNC_ENTRY;} + #define LOGGER_LEAVEFN( name ) {TRACE_FUNC_EXIT;} + + #define LOGGER_WRITE( text ) {_LIT( KTemp, text ); FPrint( KTemp );} + #define LOGGER_WRITE_1( text,par1 ) {_LIT( KTemp, text ); FPrint( KTemp, par1 );} + #define LOGGER_WRITE8_1( text,par1 ) {_LIT8( KTemp, text ); FPrint( KTemp, par1 );} + #define LOGGER_WRITE_2( text,par1,par2 ) {_LIT( KTemp, text ); FPrint( KTemp, par1, par2 );} + #define LOGGER_WRITE_3( text,par1,par2,par3 ) {_LIT( KTemp, text ); FPrint( KTemp, par1, par2, par3 );} + + // New function logging macros + #define TRACE_FUNC_ENTRY {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncEntryFormat8, &ptr8);} + #define TRACE_FUNC_EXIT {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncExitFormat8, &ptr8);} + #define TRACE_FUNC {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncFormat8, &ptr8);} + + #define TRACE_FUNC_RET( number ) {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncReturnFormat8, &ptr8, number);} + // Declare the FPrint function + inline void FPrint( TRefByValue aFmt, ...) + { + VA_LIST list; + VA_START(list,aFmt); + #ifdef __FLOGGING__ + RFileLogger::WriteFormat( KLogDir, KLogFile, EFileLoggingModeAppend, aFmt, list ); + #endif + TBuf16 theFinalString; + theFinalString.Append(KTracePrefix16); + TOverflowTruncate16 overflow; + theFinalString.AppendFormatList(aFmt,list,&overflow); + RDebug::Print(theFinalString); + } + + // Declare the FPrint function + inline void FPrint(TRefByValue aFmt, ...) + { + VA_LIST list; + VA_START(list, aFmt); + #ifdef __FLOGGING__ + RFileLogger::WriteFormat(KLogDir, KLogFile, EFileLoggingModeAppend, aFmt, list); + #endif + TOverflowTruncate8 overflow; + TBuf8 buf8; + buf8.Append(KTracePrefix8); + buf8.AppendFormatList(aFmt, list, &overflow); + TBuf16 buf16(buf8.Length()); + buf16.Copy(buf8); + TRefByValue tmpFmt(_L("%S")); + RDebug::Print(tmpFmt, &buf16); + } +#else + + // No loggings --> reduced code size + + #define LOGGER_ENTERFN( name ) + #define LOGGER_LEAVEFN( name ) + #define LOGGER_WRITE( text ) + #define LOGGER_WRITE_1( text, par1 ) + #define LOGGER_WRITE8_1( text, par1 ) + #define LOGGER_WRITE_2( text, par1, par2 ) + #define LOGGER_WRITE_3( text, par1, par2, par3 ) + #define TRACE_FUNC_ENTRY + #define TRACE_FUNC_EXIT + #define TRACE_FUNC + #define TRACE_FUNC_RET( number ) + +#endif //_DEBUG + +#endif // SECON_DEBUG_H + +// End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,23 @@ +/* +* Copyright (c) 2002 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in build information file. +* +*/ + + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +sconftpplugin.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/bld/def/bwinscwU.DEF --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/bld/def/bwinscwU.DEF Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,3 @@ +EXPORTS + ?ImplementationGroupProxy@@YAPBUTImplementationProxy@@AAH@Z @ 1 NONAME ; struct TImplementationProxy const * ImplementationGroupProxy(int &) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/bld/def/eabiU.DEF --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/bld/def/eabiU.DEF Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,5 @@ +EXPORTS + _Z24ImplementationGroupProxyRi @ 1 NONAME + _ZTI14CSConFTPplugin @ 2 NONAME ; ## + _ZTV14CSConFTPplugin @ 3 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/bld/sconftpplugin.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/bld/sconftpplugin.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,57 @@ +/* +* Copyright (c) 2002-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_ECOM_PLUGIN + +TARGET sconftpplugin.dll +TARGETTYPE PLUGIN + +UID 0x10009D8D 0x101F9686 + +SOURCEPATH ../src + +SOURCE sconftpplugin.cpp +SOURCE proxy.cpp +SOURCE sconftppluginutils.cpp +SOURCE sconservicetimer.cpp +SOURCE sconshutdownwatcher.cpp + +START RESOURCE 101f9686.rss + TARGET sconftpplugin.rsc +END + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +USERINCLUDE ../inc +USERINCLUDE ../../../inc +USERINCLUDE ../../../services/ftp/inc + +DEBUGLIBRARY flogger.lib +LIBRARY euser.lib +LIBRARY irobex.lib +LIBRARY ecom.lib +LIBRARY efsrv.lib +LIBRARY bluetooth.lib +LIBRARY esock.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/inc/sconftpplugin.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/inc/sconftpplugin.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,194 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in header file +* +*/ + + +#ifndef _SCONFTPPLUGIN_H +#define _SCONFTPPLUGIN_H + +#include +#include + +#include "sconshutdownwatcher.h" + +// forward declaration +class CSConFTP; +class CSConServiceTimer; +// CLASS DECLARATION + +/* +* File Transfer Profile Plugin class +* +*/ + +class CSConFTPplugin : public CSrcsInterface, public MObexServerNotify, + public MShutdownObserver + { + public: + static CSConFTPplugin* NewL(); + ~CSConFTPplugin(); + + /** + * Returns active status of OBEX session + * @return ETrue if session is active, else EFalse + */ + TBool IsOBEXActive(); + + /** + * Device is shutting down, abort connection. + */ + void NotifyShutdown(); + + private: + /** + * Loads sconftp.dll module + * @return none + */ + void LoadFTPDllL(); + /** + * Closes initialized services + * @return none + */ + void Disconnect(); + /** + * Removes spaces and nulls from the end of the string + * @param aDes String to be formatted + * @return none + */ + void TrimRightSpaceAndNull( TDes8& aDes ) const; + /** + * Current used transfer media (IR,USB,BT) + * @param aMediaType Enumeration indicating the media type + * @return none + */ + void SetMediaType( TSrcsMediaType aMediaType ); + /** + * MObexServerNotify implementation + * @param aError Error code + * @return none + */ + void ErrorIndication( TInt aError ); + /** + * MObexServerNotify implementation + * @return none + */ + void TransportUpIndication(); + /** + * MObexServerNotify implementation + * @return none + */ + void TransportDownIndication(); + /** + * MObexServerNotify implementation + * @param aRemoteInfo Structure containing information used during OBEX + * connection + * @param aInfo Further information about the requested connection + * @return System wide error code that indicates the success of the connection + */ + TInt ObexConnectIndication( const TObexConnectInfo& aRemoteInfo, + const TDesC8& aInfo ); + /** + * MObexServerNotify implementation + * @param aInfo Contains information about the disconnection + * @return none + */ + void ObexDisconnectIndication( const TDesC8& aInfo ); + /** + * MObexServerNotify implementation + * @return CObexBaseObject-derived object, which the object being put + * will be parsed into. + */ + CObexBufObject* PutRequestIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * PUT packet operation. + */ + TInt PutPacketIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * PUT packet operation. + */ + TInt PutCompleteIndication(); + /** + * MObexServerNotify implementation + * @param aRequiredObject Details about the object the remote client + * has requested + * @returnObject to return to the client + */ + CObexBufObject* GetRequestIndication( CObexBaseObject + *aRequiredObject ); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * GET packet operation. + */ + TInt GetPacketIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * GET packet operation. + */ + TInt GetCompleteIndication(); + /** + * MObexServerNotify implementation + * @param aPathInfo SETPATH command parameters + * @param aInfo Not currently used + * @return System wide error code indicating the success of the + * setpath command. + */ + TInt SetPathIndication( const CObex::TSetPathInfo& aPathInfo, + const TDesC8& aInfo ); + /** + * SetObexServer + * @param aObexServer pass obex server pointer to sevice controller + * @return System wide error code. + */ + TInt SetObexServer( CObexServer* aObexServer ); + /** + * MObexServerNotify implementation + * @return none + */ + void AbortIndication(); + + void ConstructL(); + CSConFTPplugin(); + + private: + RLibrary iFTPlib; + CObexBufObject* iObject; + CBufFlat* iBuffer; + CSConFTP* iFTPHandler; + TInt iPutError; + TBool iSessionActive; + CSConServiceTimer* iServiceTimer; + TBool iStartTimer; + TSrcsMediaType iMediaType; + CObexFileObject* iFileObject; + TBool iPutPacketIndicationCalled; + CShutdownWatcher* iShutdownWatcher; + TBool iShutdownInProgress; + CObexServer* iObexServer; + RSocketServ iSocketServer; + RBTPhysicalLinkAdapter iLinkAdapter; + private: + // Friend class is used,because existing impelentation has been working + // properly. Avoiding re-design. + friend class CSConServiceTimer; + }; + +#endif // SCONPCCONNPLUGIN_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/inc/sconftppluginutils.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/inc/sconftppluginutils.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,37 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in Utils header +* +*/ + + +#ifndef _SCONFTPPLUGINUTILS_H +#define _SCONFTPPLUGINUTILS_H + +#include +//============================================================ +// Class TFTPpluginUtils declaration +//============================================================ +class TFTPpluginUtils + { + public: + /** + * Converts Symbian error code to OBEX error code + * @param aError The error code + * @return The converted error code + */ + static TInt ConvertFTPResponseCode( TInt aError ); + }; + +#endif // _SCONFTPPLUGINUTILS_H \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/inc/sconservicetimer.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/inc/sconservicetimer.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,61 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in Service Timer Header file +* +*/ + + +#ifndef _SCONSERVICETIMER_H +#define _SCONSERVICETIMER_H + +#include + +class CSConFTPplugin; + + +//============================================================ +// Class CSConServiceTimer declaration +//============================================================ + +NONSHARABLE_CLASS ( CSConServiceTimer ) : public CActive + { + public: + CSConServiceTimer( CSConFTPplugin* aEngine, TInt aValue ); + void ConstructL(); + ~CSConServiceTimer(); + + /** + * Starts the timer + * @return none + */ + void StartTimer(); + /** + * Stops the timer + * @return none + */ + void StopTimer(); + + private: + void DoCancel(); + void RunL(); + + private: + RTimer iTimer; + CSConFTPplugin* iEngine; + TInt iValue; + }; + +#endif //_SCONSERVICETIMER_H + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/inc/sconshutdownwatcher.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/inc/sconshutdownwatcher.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,66 @@ +/* +* Copyright (c) 2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Power shutdown -watcher header file +* +*/ + + +#ifndef _SCONSHUTDOWNWATCHER_H +#define _SCONSHUTDOWNWATCHER_H + + +#include +#include + +//============================================================ +// Class MShutdownObserver declaration +//============================================================ +class MShutdownObserver + { +public: + virtual void NotifyShutdown()=0; + }; + +//============================================================ +// Class CShutdownWatcher declaration +//============================================================ +NONSHARABLE_CLASS ( CShutdownWatcher ) : public CActive + { + public: + static CShutdownWatcher* NewL( MShutdownObserver* aObserver ); + ~CShutdownWatcher(); + + /** + * Starts to watch shutdown status + * @return none + */ + void StartShutdownWatcher(); + + private: + //construct/destruct + CShutdownWatcher( MShutdownObserver* aObserver ); + void ConstructL(); + + // from CActive + void DoCancel(); + void RunL(); + + private: + MShutdownObserver* iObserver; + RProperty iProperty; + }; + +#endif //_SCONSHUTDOWNWATCHER_H + +// End of file \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/101f9686.rss --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/101f9686.rss Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,68 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in resource file +* +*/ + + +#include "ecom/registryinfo.rh" + +// Declares info for two implementations +RESOURCE REGISTRY_INFO theInfo + { + // UID for the DLL + dll_uid = 0x101F9686; + // Declare array of interface info + interfaces = + { + INTERFACE_INFO + { + // UID of interface that is implemented + interface_uid = 0x101F7C8C; + implementations = + { + // Info for CSConFTPplugin + IMPLEMENTATION_INFO + { + implementation_uid = 0x101F9687; + version_no = 1; + display_name = "OBEX File Transfer"; + default_data = "OBEX/BT"; + + // + // opaque_data contains parameters used by following API calls in SRCS: + // 1. Setup USB interface string descriptor in Unicode; + // 2. TInt CObex::SetLocalWho(const TDesC8& aInfo); + // 3. TInt CBTConnection::RegisterSecuritySettingsL( TUint aService, + // TInt aProtocol, + // TInt aChannel, + // TBool aAuthenticate, + // TBool aAuthorise, + // TBool aEncrypt ); + // opaque_data = "@0||@1||@2||@3||@4||@5||@6" + // @0 aStrDesc e.g. "OBEX File Transfer" + // @1 aInfo e.g. KFolderBrowsingID, "\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09" + // @2 aService e.g. KBTSecurityUidFileTransfer, 0x1106 + // @3 aProtocol e.g. KSolBtRFCOMM, 0x1013 + // @4 aAuthenticate e.g. EFalse, 0 + // @5 aAuthorise e.g. EFalse, 0 + // @6 aEncrypt e.g. EFalse, 0 + // + opaque_data = "OBEX File Transfer||\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09||0x1106||0x1013||1||1||1"; + } + }; + } + }; + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/proxy.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/proxy.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,42 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in proxy implementation +* +*/ + + +// INCLUDE FILES + +#include +#include + +#include "sconftpplugin.h" + +const TImplementationProxy ImplementationTable[] = + { + IMPLEMENTATION_PROXY_ENTRY(0x101F9687, CSConFTPplugin::NewL) + }; + +// ----------------------------------------------------------------------------- +// TImplementationProxy* ImplementationGroupProxy(TInt& aTableCount) +// Exported proxy for instantiation method resolution +// ----------------------------------------------------------------------------- +// +EXPORT_C const TImplementationProxy* ImplementationGroupProxy( + TInt& aTableCount) + { + aTableCount = sizeof(ImplementationTable) / sizeof(TImplementationProxy); + + return ImplementationTable; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/sconftpplugin.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/sconftpplugin.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,880 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in implementation +* +*/ + + +// INCLUDE FILES + +#ifdef SYMBIAN_ENABLE_SPLIT_HEADERS +#include +#endif +#include "sconftpplugin.h" +#include "sconftp.h" +#include "sconftppluginutils.h" +#include "sconservicetimer.h" +#include "debug.h" + + +// CONSTANTS +_LIT(KSConFTPLibName, "sconftp.dll"); +const TInt KSConFTPUidValue = 0x10009D8D; +const TUid KSConFTPUid = {KSConFTPUidValue}; + +// Folder listing type from IrObex specification +_LIT8( KSConFolderListType, "x-obex/folder-listing" ); + +_LIT( K_C_ROOT, "C:\\" ); +const TInt KSConBufSize = 262144; // 256KB +// Time (in milliseconds) for the timer +const TInt KSConTimeOutValue = 60000000; +// Flags used to indicate SetPath commands +const TInt KSConNULLSetPath = 0x00; + +const TInt KSConHeaderMaxLength = 256; + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::NewL() +// Two-phase constructor +// ----------------------------------------------------------------------------- +// +CSConFTPplugin* CSConFTPplugin::NewL() + { + TRACE_FUNC_ENTRY; + CSConFTPplugin* self = new ( ELeave ) CSConFTPplugin(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + TRACE_FUNC_EXIT; + return( self ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::~CSConFTPplugin() +// Destructor +// ----------------------------------------------------------------------------- +// +CSConFTPplugin::~CSConFTPplugin() + { + TRACE_FUNC_ENTRY; + + // Disconnect from services. + Disconnect(); + + if ( iFTPHandler ) + { + delete iFTPHandler; + iFTPHandler = NULL; + iFTPlib.Close(); + } + + delete iBuffer; + iBuffer = NULL; + delete iObject; + iObject = NULL; + + if ( iServiceTimer ) + { + iServiceTimer->Cancel(); + } + + delete iServiceTimer; + iServiceTimer = NULL; + + if ( iFileObject ) + { + delete iFileObject; + iFileObject = NULL; + } + + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::IsOBEXActive() +// Returns active status of OBEX session +// ----------------------------------------------------------------------------- +// +TBool CSConFTPplugin::IsOBEXActive() + { + TRACE_FUNC; + return iSessionActive; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::NotifyShutdown() +// System is shutting down +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::NotifyShutdown() + { + TRACE_FUNC; + iShutdownInProgress = ETrue; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::LoadFTPDllL() +// Loads sconftp.dll module +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::LoadFTPDllL() + { + TRACE_FUNC_ENTRY; + // Dynamically load DLL + User::LeaveIfError( iFTPlib.Load( KSConFTPLibName ) ); + if ( iFTPlib.Type()[1] != KSConFTPUid ) + { + LOGGER_WRITE( "KSConFTPUidValue incorrect" ); + iFTPlib.Close(); + User::Leave( KErrNotFound ); + } + TSConCreateCSConFTPFunc CreateCSConFTPL = + (TSConCreateCSConFTPFunc)iFTPlib.Lookup(1); + iFTPHandler = (CSConFTP*)CreateCSConFTPL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::Disconnect() +// Closes initialized services +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::Disconnect() + { + TRACE_FUNC_ENTRY; + + iLinkAdapter.Close(); + iSocketServer.Close(); + + if ( iStartTimer != EFalse ) + { + iServiceTimer->Cancel(); + iServiceTimer->StartTimer(); + } + + delete iObject; + iObject = NULL; + + if ( iFileObject ) + { + delete iFileObject; + iFileObject = NULL; + } + if ( iFTPHandler ) + { + delete iFTPHandler; + iFTPHandler = NULL; + iFTPlib.Close(); + } + + TRACE_FUNC_EXIT + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::ErrorIndication( TInt aError ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::ErrorIndication( TInt aError ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1( "aError : %d", aError ); + + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + // Keep compiler happy + (void)aError; + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err2 = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err2 ); + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::AbortIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::AbortIndication() + { + TRACE_FUNC_ENTRY; + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::TransportUpIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::TransportUpIndication() + { + TRACE_FUNC; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::ObexConnectIndication( const TObexConnectInfo& aRemoteInfo, +// const TDesC8& aInfo ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::ObexConnectIndication( + const TObexConnectInfo& /*aRemoteInfo*/, + const TDesC8& /*aInfo*/ ) + { + TRACE_FUNC_ENTRY; + TInt err( KErrNone ); + iStartTimer = ETrue; + + if ( iMediaType == ESrcsMediaBT && iObexServer ) + { + TSockAddr remoteAddr; + iObexServer->RemoteAddr( remoteAddr ); + + TBTSockAddr btSockAddr( remoteAddr ); + TBTDevAddr devAddr = btSockAddr.BTAddr(); + + err = iSocketServer.Connect(); + LOGGER_WRITE_1("iSocketServer.Connect err: %d", err ); + if ( !err ) + { + err = iLinkAdapter.Open( iSocketServer, devAddr ); + LOGGER_WRITE_1("iLinkAdapter.Open err: %d", err ); + } + // Ignore all BT link errors + err = KErrNone; + } + + if ( err == KErrNone && !iFTPHandler ) + { + TRAP( err, LoadFTPDllL() ); + LOGGER_WRITE_1( "LoadFTPDllL returned : %d", err ); + } + + if ( err == KErrNone ) + { + iFTPHandler->SetProfile( EStandard ); + LOGGER_WRITE( "CSConFTPplugin::ObexConnectIndication() : iServiceTimer->StopTimer()" ); + iServiceTimer->Cancel(); + iServiceTimer->StopTimer(); + } + + TRACE_FUNC_EXIT; + LOGGER_WRITE_1( "CSConFTPplugin::ObexConnectIndication returned %d", err ); + return TFTPpluginUtils::ConvertFTPResponseCode( err ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::ObexDisconnectIndication( const TDesC8& ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::ObexDisconnectIndication( const TDesC8& ) + { + TRACE_FUNC_ENTRY; + Disconnect(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::TransportDownIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::TransportDownIndication() + { + TRACE_FUNC_ENTRY; + Disconnect(); + if ( iBuffer ) + { + iBuffer->Reset(); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::PutRequestIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +CObexBufObject* CSConFTPplugin::PutRequestIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + iPutError = KErrNone; + + if ( iBuffer ) + { + iBuffer->Reset(); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + TRAP( err, iObject = CObexBufObject::NewL ( iBuffer ) ); + + if ( err != KErrNone ) + { + return NULL; + } + + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return NULL; + } + + TRAP( err, ret = iFTPHandler->PutFileObjectInitL( iObject, iBuffer ) ); + + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "iFTPHandler->PutFileObjectInitL() leaves: %d", err ); + return NULL; + } + if ( ret != KErrNone ) + { + LOGGER_WRITE_1( "PutFileObjectInitL failed - returning error in next PutPacketIndication : %d", ret ); + iPutError = ret; + } + iPutPacketIndicationCalled = EFalse; + + if ( !iShutdownWatcher ) + { + TRAP( err, iShutdownWatcher = CShutdownWatcher::NewL( this ) ); + if ( err == KErrNone ) + { + iShutdownWatcher->StartShutdownWatcher(); + } + else + { + LOGGER_WRITE_1( "CShutdownWatcher::NewL leaves: %d", err ); + } + } + + if ( iLinkAdapter.IsOpen() ) + { + // request active BT mode (high power mode) + err = iLinkAdapter.ActivateActiveRequester(); + LOGGER_WRITE_1( "iLinkAdapter.ActivateActiveRequester() err: %d", err ); + } + + TRACE_FUNC_EXIT; + return( iObject ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::PutPacketIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::PutPacketIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + + // always normal file transfer + if ( (TInt)iObject->Length() > 0 ) + { + if ( !iPutPacketIndicationCalled ) + { + // This is first check, need to check only once + TFileName path; + iFTPHandler->GetPath( path ); + if ( path.CompareF( K_C_ROOT ) == 0 ) + { + // path forbidden + ret = KErrAccessDenied; + } + else + { + if ( iPutError != KErrNone ) + { + ret = iPutError; + LOGGER_WRITE_1( "CSConFTPplugin::PutPacketIndication() : PutError : %d", iPutError ); + } + else + { + // check required free space + // if filesize is small ( <65k ) it fits into one package and its already saved to filesystem. + // if file is larger, need to check is there enought free space in device. + + const TUint32 filesize = iObject->Length(); + LOGGER_WRITE_1( "CSConFTPplugin::PutPacketIndication() filesize %d", filesize ); + LOGGER_WRITE_1( "CSConFTPplugin::PutPacketIndication() iObject->BytesReceived() %d", iObject->BytesReceived() ); + if ( filesize > iObject->BytesReceived() ) + { + LOGGER_WRITE( "CSConFTPplugin::PutPacketIndication() : check freespace" ); + // file does not fit into one obex packet, check is there enought free space in current drive + if ( iFTPHandler->IsCurrentDiskSpaceBelowCritical( filesize ) ) + { + LOGGER_WRITE( "CSConFTPplugin::PutPacketIndication() : returning KErrNoMemory" ); + ret = KErrNoMemory; + } + } + } + } + } + + if ( iShutdownInProgress ) + { + LOGGER_WRITE( "ShutdownInProgress, abort" ); + ret = KErrDisconnected; + } + } + + if ( !iPutPacketIndicationCalled ) + { + // Need to check only once + iPutPacketIndicationCalled = ETrue; + + //Check if filename is too long. + TFileName path; + iFTPHandler->GetPath( path ); + if ( ret == KErrNone && path.Length() + iObject->Name().Length() > KMaxFileName ) + { + LOGGER_WRITE_1( "Name length overflow! : %d", path.Length() + iObject->Name().Length() ); + ret = KErrBadName; + } + } + + if ( ret != KErrNone ) + { + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + delete iObject; + iObject = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + } + + LOGGER_WRITE_1( "CSConFTPplugin::PutPacketIndication returned: %d", ret ); + return TFTPpluginUtils::ConvertFTPResponseCode( ret ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::PutCompleteIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::PutCompleteIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err2 = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err2 ); + } + + TObexHeaderMask validHdrs = iObject->ValidHeaders(); + TTime time = iObject->Time(); + + // shutdownWatcher is not needed anymore + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + TInt size = iObject->BytesReceived(); + + if (!(validHdrs & KObexHdrTime)) + { + LOGGER_WRITE( "CSConFTPplugin::PutCompleteIndication() no valid time header received - using hometime" ); + time.HomeTime(); + TRAP( ret, iObject->SetTimeL(time) ); + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication SetTimeL %d", ret ); + } + + if ( ( validHdrs & KObexHdrBody ) || ( validHdrs & KObexHdrEndOfBody ) ) + { + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication : number of received bytes %d", size ); + TSConUsedMedia media( ESConNoMedia ); + + switch ( iMediaType ) + { + case ESrcsMediaBT: + media = ESConBTMedia; + break; + case ESrcsMediaIrDA: + media = ESConIRMedia; + break; + case ESrcsMediaUSB: + media = ESConUSBMedia; + break; + default: + media = ESConNoMedia; + break; + } + iFTPHandler->SetUsedMedia( media ); + + TRAP( ret, err = + this->iFTPHandler->PutFileObjectFinalizeL( iObject ) ); + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication :PutFileObjectL %d", ret ); + } + else + { + LOGGER_WRITE( "CSConFTPplugin::PutCompleteIndication() : Delete starts" ); + TRAP( ret, err = this->iFTPHandler->DeleteObjectL( iObject->Name() ) ); + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication : DeleteObjectL %d", ret ); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + iFTPHandler->DeleteTempFile(); + + if ( ret != KErrNone ) + { + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication : returned %d", ret ); + return TFTPpluginUtils::ConvertFTPResponseCode( ret ); + } + + LOGGER_WRITE_1( "CSConFTPplugin::PutCompleteIndication : returned %d", err ); + return TFTPpluginUtils::ConvertFTPResponseCode( err ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::GetRequestIndication( CObexBaseObject* aRequiredObject ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +CObexBufObject* CSConFTPplugin::GetRequestIndication( + CObexBaseObject* aRequiredObject ) + { + TRACE_FUNC_ENTRY; + CObexBufObject* bufObject(NULL); + if ( aRequiredObject->Type().Length() > KSConHeaderMaxLength ) + { + LOGGER_WRITE("TypeHeader too big"); + return NULL; + } + if ( aRequiredObject->Name().Length() > KMaxFileName ) + { + LOGGER_WRITE("NameHeader is too long"); + return NULL; + } + TInt ret( KErrNone ); + TInt err( KErrNone ); + TBuf8 typeHeader( aRequiredObject->Type() ); + TrimRightSpaceAndNull( typeHeader ); + LOGGER_WRITE8_1("type: %S", &typeHeader); + LOGGER_WRITE_1("name: %S", &aRequiredObject->Name()); + + iBuffer->Reset(); + + delete iObject; + iObject = NULL; + + TRAP( err, iObject = CObexBufObject::NewL ( iBuffer ) ); + if ( err != KErrNone ) + { + return NULL; + } + + // Client requests folder listing + if ( typeHeader == KSConFolderListType ) + { + LOGGER_WRITE( "Client requests folder listning" ); + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return NULL; + } + + TRAP( err, ret = iFTPHandler->GetFolderObjectL( iObject ) ); + LOGGER_WRITE_1( "iFTPHandler->GetFolderObjectL() returned: %d", ret ); + if ( err == KErrNone && ret == KErrNone ) + { + bufObject = iObject; + } + else + { + LOGGER_WRITE_1( "CSConFTPplugin::GetRequestIndication : Leavecode returned %d", err ); + return NULL; + } + } + + // Client requests a file + else + { + if ( iFileObject ) + { + delete iFileObject; + iFileObject = NULL; + } + + TRAP( err, iFileObject = CObexFileObject::NewL() ); + if ( err != KErrNone ) + { + LOGGER_WRITE( "Creating iFileObject has failed" ); + return NULL; + } + iFileObject->Reset(); + TRAP( err, iFileObject->SetNameL( aRequiredObject->Name() ) ); + + if ( err == KErrNone ) + { + if ( !iFTPHandler ) + { + LOGGER_WRITE( "CSConFTPplugin::GetRequestIndication() Creating iFTPHandler has failed" ); + return NULL; + } + + TRAP( err, ret = + this->iFTPHandler->GetFileObjectL( iFileObject ) ); + LOGGER_WRITE_1( "CSConFTPplugin::GetRequestIndication : GetFileObjectL returned %d", ret ); + } + if ( err == KErrNone && ret == KErrNone ) + { + bufObject = (CObexBufObject*)iFileObject; + } + else + { + LOGGER_WRITE_1( "CSConFTPplugin::GetRequestIndication : Leavecode %d", err ); + return NULL; + } + } + if ( bufObject && iLinkAdapter.IsOpen() ) + { + // request active BT mode (high power mode) + err = iLinkAdapter.ActivateActiveRequester(); + LOGGER_WRITE_1( "iLinkAdapter.ActivateActiveRequester() err: %d", err ); + } + return bufObject; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::GetPacketIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::GetPacketIndication() + { + TRACE_FUNC; + return KErrNone; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::GetCompleteIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::GetCompleteIndication() + { + TRACE_FUNC_ENTRY; + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + + TInt ret( KErrNone ); + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + LOGGER_WRITE_1( "CSConFTPplugin::GetCompleteIndication() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::SetPathIndication( const CObex::TSetPathInfo& aPathInfo, +// const TDesC8& aInfo ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::SetPathIndication( const CObex::TSetPathInfo& aPathInfo, + const TDesC8& /*aInfo*/ ) + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return TFTPpluginUtils::ConvertFTPResponseCode( KErrNoMemory ); + } + + if ( aPathInfo.iFlags == KSConNULLSetPath ) + { + TRAP( err, ret = this->iFTPHandler->CreateFolderL( aPathInfo.iName ) ); + } + else + { + TRAP( err, ret = this->iFTPHandler->SetPathL( aPathInfo.iName, + aPathInfo.iFlags ) ); + } + + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "CSConFTPplugin::SetPathIndication : returned %d", err ); + return TFTPpluginUtils::ConvertFTPResponseCode( err ); + } + LOGGER_WRITE_1( "CSConFTPplugin::SetPathIndication : returned %d", ret ); + return TFTPpluginUtils::ConvertFTPResponseCode( ret ); + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::TrimRightSpaceAndNull( TDes8& aDes ) const +// Removes spaces and nulls from the end of the string +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::TrimRightSpaceAndNull( TDes8& aDes ) const + { + TRACE_FUNC; + aDes.TrimRight(); + if ( aDes.Length() > 0 ) + { + if ( !aDes[aDes.Length() - 1] ) + { + aDes.SetLength( aDes.Length() - 1 ); + } + } + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::SetMediaType ( TSrcsMediaType aMediaType ) +// Current used transfer media (IR,USB,BT) +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::SetMediaType ( TSrcsMediaType aMediaType ) + { + TRACE_FUNC; + iMediaType = aMediaType; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::CSConFTPplugin() +// Constructor +// ----------------------------------------------------------------------------- +// +CSConFTPplugin::CSConFTPplugin() + { + TRACE_FUNC; + iBuffer = NULL; + iObject = NULL; + iFileObject = NULL; + iSessionActive = EFalse; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CSConFTPplugin::ConstructL() + { + TRACE_FUNC_ENTRY; + iBuffer = CBufFlat::NewL( KSConBufSize ); + iObject = CObexBufObject::NewL ( iBuffer ); + iServiceTimer = new (ELeave) CSConServiceTimer( this, KSConTimeOutValue ); + iServiceTimer->ConstructL(); + CActiveScheduler::Add( iServiceTimer ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConFTPplugin::SetObexServer( CObexServer* aObexServer ) +// SetObexServer +// ----------------------------------------------------------------------------- +// +TInt CSConFTPplugin::SetObexServer( CObexServer* aObexServer ) + { + iObexServer = aObexServer; + TInt ret = iObexServer->Start(this); + LOGGER_WRITE_1( "CSConFTPplugin::SetObexServer() ret: %d", ret ); + return ret; + } + +// End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/sconftppluginutils.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/sconftppluginutils.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,129 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in utilities +* +*/ + + +// INCLUDE FILES +#include +#include "sconftppluginutils.h" +#include "debug.h" + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// TFTPpluginUtils::ConvertFTPResponseCode( TInt aError ) +// Converts Symbian error code to OBEX error code +// ----------------------------------------------------------------------------- +// +TInt TFTPpluginUtils::ConvertFTPResponseCode( TInt aError ) + { + LOGGER_WRITE_1( "TFTPpluginUtils::ConvertFTPResponseCode : begin Code %d", aError ); + TInt obexErr ( KErrIrObexRespBadRequest ); + switch( aError ) + { + case KErrNone: + obexErr = KErrNone; + break; + case KErrNotFound: + obexErr = KErrIrObexRespNotFound; + break; + case KErrGeneral: + case KErrCancel: + obexErr = KErrIrObexRespBadRequest; + break; + case KErrNoMemory: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrNotSupported: + obexErr = KErrIrObexRespNotImplemented; + break; + case KErrArgument: + case KErrTotalLossOfPrecision: + case KErrBadHandle: + case KErrOverflow: + case KErrUnderflow: + case KErrAlreadyExists: + obexErr = KErrIrObexRespConflict; + break; + case KErrPathNotFound: + case KErrDied: + obexErr = KErrIrObexRespNotFound; + break; + case KErrInUse: + obexErr = KErrIrObexRespTimedOut; + break; + case KErrServerTerminated: + obexErr = KErrIrObexRespNotFound; + break; + case KErrServerBusy: + case KErrCompletion: + case KErrNotReady: + case KErrUnknown: + case KErrCorrupt: + obexErr = KErrIrObexRespForbidden; + break; + case KErrAccessDenied: + case KErrLocked: + obexErr = KErrIrObexRespUnauthorized; + break; + case KErrWrite: + case KErrDisMounted: + case KErrEof: + obexErr = KErrIrObexRespForbidden; + break; + case KErrDiskFull: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrBadDriver: + case KErrBadName: + obexErr = KErrIrObexRespPreCondFailed; + break; + case KErrCommsLineFail: + case KErrCommsFrame: + case KErrCommsOverrun: + case KErrCommsParity: + case KErrTimedOut: + case KErrCouldNotConnect: + case KErrCouldNotDisconnect: + case KErrBadLibraryEntryPoint: + case KErrBadDescriptor: + case KErrAbort: + obexErr = KErrIrObexRespForbidden; + break; + case KErrTooBig: + obexErr = KErrIrObexRespReqEntityTooLarge; + break; + case KErrDivideByZero: + case KErrBadPower: + case KErrDirFull: + case KErrHardwareNotAvailable: + obexErr = KErrIrObexRespForbidden; + break; + case KErrDisconnected: // System is shutting down + obexErr = KErrIrObexRespMethodNotAllowed; + break; + default: + obexErr = KErrIrObexRespBadRequest; + break; + }; + LOGGER_WRITE_1( "TFTPpluginUtils::ConvertFTPResponseCode : returned %d", obexErr ); + return obexErr; +}; + +//End of file + + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/sconservicetimer.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/sconservicetimer.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,119 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: File Transfer Profile Plug-in Service Timer implementation +* +*/ + + +// INCLUDE FILES + +#include "sconservicetimer.h" +#include "sconftpplugin.h" +#include "debug.h" + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::CSConServiceTimer( CSConFTPplugin* aEngine, TInt aValue ) +// Constuctor +// ----------------------------------------------------------------------------- +// +CSConServiceTimer::CSConServiceTimer( CSConFTPplugin* aEngine, TInt aValue ) + : CActive( EPriorityStandard ), iEngine( aEngine ), iValue( aValue ) {} + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::ConstructL() + { + LOGGER_ENTERFN( "CSConServiceTimer::ConstructL()" ); + // create a thread-relative timer + User::LeaveIfError( iTimer.CreateLocal() ); + LOGGER_LEAVEFN( "CSConServiceTimer::ConstructL()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::~CSConServiceTimer() +// Destructor +// ----------------------------------------------------------------------------- +// +CSConServiceTimer::~CSConServiceTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::~CSConServiceTimer()" ); + iTimer.Close(); + LOGGER_LEAVEFN( "CSConServiceTimer::~CSConServiceTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::~CSConServiceTimer() +// Starts the timer +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::StartTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::StartTimer()" ); + if( !IsActive() ) + { + LOGGER_WRITE( "CSConServiceTimer::StartTimer() : !IsActive()" ); + iTimer.After( iStatus, TTimeIntervalMicroSeconds32( iValue ) ); + iEngine->iSessionActive = ETrue; + SetActive(); + LOGGER_WRITE( "CSConServiceTimer::StartTimer() : SetActive()" ); + } + LOGGER_LEAVEFN( "CSConServiceTimer::StartTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::StopTimer() +// StopTimer() +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::StopTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::StopTimer()" ); + iEngine->iSessionActive = ETrue; + LOGGER_WRITE( "CSConServiceTimer::StopTimer() : iSessionActive = ETrue" ); + LOGGER_LEAVEFN( "CSConServiceTimer::StopTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::DoCancel() +// Cancels the timer +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::DoCancel() + { + LOGGER_ENTERFN( "CSConServiceTimer::DoCancel()" ); + iTimer.Cancel(); + LOGGER_LEAVEFN( "CSConServiceTimer::DoCancel()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::RunL() +// Executed when timer is triggered +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::RunL() + { + LOGGER_ENTERFN( "CSConServiceTimer::RunL()" ); + iEngine->iSessionActive = EFalse; + LOGGER_WRITE( "CSConServiceTimer::RunL() : iSessionActive = EFalse" ); + iEngine->iStartTimer = EFalse; + LOGGER_WRITE( "CSConServiceTimer::RunL() : iStartTimer = EFalse " ); + LOGGER_LEAVEFN( "CSConServiceTimer::RunL()" ); + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/ftp/src/sconshutdownwatcher.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/ftp/src/sconshutdownwatcher.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,153 @@ +/* +* Copyright (c) 2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Power shutdown -watcher implementation +* +*/ + + +// INCLUDE FILES + +#include "sconshutdownwatcher.h" +#include "debug.h" + +#include + + + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::NewL( MShutdownObserver* aObserver ) +// Two-phase constructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher* CShutdownWatcher::NewL( MShutdownObserver* aObserver ) + { + LOGGER_ENTERFN( "CShutdownWatcher::NewL()" ); + CShutdownWatcher* self = new (ELeave) CShutdownWatcher( aObserver ); + CleanupStack::PushL(self); + self->ConstructL(); + CleanupStack::Pop(self); + LOGGER_LEAVEFN( "CShutdownWatcher::NewL()" ); + return self; + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::~CShutdownWatcher() +// Destructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher::~CShutdownWatcher() + { + LOGGER_ENTERFN( "CShutdownWatcher::~CShutdownWatcher()" ); + Cancel(); + iProperty.Close(); + LOGGER_LEAVEFN( "CShutdownWatcher::~CShutdownWatcher()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::StartShutdownWatcher() +// Starts to watch shutdown status +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::StartShutdownWatcher() + { + LOGGER_ENTERFN( "CShutdownWatcher::StartShutdownWatcher()" ); + TInt status; + TInt err = iProperty.Get( KPSUidStartup, KPSGlobalSystemState, status ); + LOGGER_WRITE_2( "CShutdownWatcher::StartShutdownWatcher() :\ + err %d, KPSGlobalSystemState status %d", err, status); + if ( err == KErrNone ) + { + if ( status == ESwStateShuttingDown ) + { + LOGGER_WRITE( "Call NotifyShutdown" ); + iObserver->NotifyShutdown(); + return; + } + } + + err = iProperty.Attach( KPSUidStartup, KPSGlobalSystemState ); + LOGGER_WRITE_1( "CShutdownWatcher::StartShutdownWatcher() :\ + iProperty.Attach( KPSUidStartup, KPSGlobalSystemState ) : err %d", err ); + iProperty.Subscribe( iStatus ); + LOGGER_WRITE( "CShutdownWatcher::StartShutdownWatcher() :\ + iProperty.Subscribe( iStatus ) : ok" ); + SetActive(); + + LOGGER_LEAVEFN( "CShutdownWatcher::StartShutdownWatcher()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::DoCancel() +// Executed when CActive is canceled. +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::DoCancel() + { + LOGGER_ENTERFN( "CShutdownWatcher::DoCancel()" ); + iProperty.Cancel(); + LOGGER_LEAVEFN( "CShutdownWatcher::DoCancel()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::RunL() +// Executed when disk watcher is triggered +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::RunL() + { + LOGGER_ENTERFN( "CShutdownWatcher::RunL()" ); + TInt status; + iProperty.Get( status ); + LOGGER_WRITE_1( "CShutdownWatcher::RunL() : status %d", status ); + + if ( status == ESwStateShuttingDown ) + { + LOGGER_WRITE( "Call NotifyShutdown" ); + iObserver->NotifyShutdown(); + return; + } + + iProperty.Cancel(); + iProperty.Close(); + + LOGGER_LEAVEFN( "CShutdownWatcher::RunL()" ); + } + + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::CShutdownWatcher( MShutdownObserver* aObserver ) +// Default constructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher::CShutdownWatcher( MShutdownObserver* aObserver ) +: CActive(EPriorityStandard), + iObserver(aObserver) + { + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::ConstructL() + { + LOGGER_ENTERFN( "CShutdownWatcher::ConstructL()" ); + CActiveScheduler::Add(this); + LOGGER_LEAVEFN( "CShutdownWatcher::ConstructL()" ); + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/data/2001FE54.rss --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/data/2001FE54.rss Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,74 @@ +/* +* Copyright (c) 2001 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Plugin info file. +* +*/ + + +#include "ecom/registryinfo.rh" + +// Declares info for two implementations +RESOURCE REGISTRY_INFO theInfo + { + // UID for the DLL + dll_uid = 0x2001FE54; + // Declare array of interface info + interfaces = + { + INTERFACE_INFO + { + // UID of interface that is implemented + interface_uid = 0x101F7C8C; + implementations = + { + IMPLEMENTATION_INFO + { + implementation_uid = 0x2001FE53; + version_no = 1; + display_name = "Haptics Bridge"; + default_data = "OBEX/USB||OBEX/BT"; + // + // opaque_data contains parameters used by following API calls in SRCS: + // 1. Setup USB interface string descriptor in Unicode; + // 2. TInt CObex::SetLocalWho(const TDesC8& aInfo); + // 3. TInt CBTConnection::RegisterSecuritySettingsL( TUint aService, + // TInt aProtocol, + // TInt aChannel, + // TBool aAuthenticate, + // TBool aAuthorise, + // TBool aEncrypt ); + // opaque_data = "@0||@1||@2||@3||@4||@5||@6" + // @0 aStrDesc e.g. "PC Connectivity" + // @1 aInfo e.g. KFolderBrowsingID, "\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09" + // @2 aService e.g. KBTSecurityUidFileTransfer, 0x1106 + // @3 aProtocol e.g. KSolBtRFCOMM, 0x1013 + // @4 aAuthenticate e.g. EFalse, 0 + // @5 aAuthorise e.g. EFalse, 0 + // @6 aEncrypt e.g. EFalse, 0 + // + opaque_data = "Haptics Bridge|"\ + "|\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09|"\ + "|0x2001E2B5|"\ + "|0x1013|"\ + "|0|"\ + "|1|"\ + "|0|"\ + "|0xffff|"\ + "|0xffff"; + } + }; + } + }; + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/group/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,28 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Haptics connection plugin build file. +* +*/ + +#include + +PRJ_PLATFORMS +DEFAULT + +PRJ_EXPORTS +../rom/hapticsconnplugin.iby CORE_IBY_EXPORT_PATH(mw, hapticsconnplugin.iby) + +PRJ_MMPFILES +hapticsconnplugin.mmp + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/group/hapticsconnplugin.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/group/hapticsconnplugin.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,58 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Haptics connection plugin project definition file. +* +*/ + + +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_ECOM_PLUGIN + +TARGET hapticsconnplugin.dll +TARGETTYPE PLUGIN + +UID 0x10009D8D 0x2001FE54 + +SOURCEPATH ../src + +SOURCE hapticsconnplugin.cpp +SOURCE hapticsconntimer.cpp +SOURCE hapticsmsghandler.cpp +SOURCE hapticsbridgeclient.cpp +SOURCE proxy.cpp + +SOURCEPATH ../data + +START RESOURCE 2001FE54.rss + TARGET hapticsconnplugin.rsc +END + +MW_LAYER_SYSTEMINCLUDE +SYSTEMINCLUDE /epoc32/include/stdapis + +USERINCLUDE ../inc + +LIBRARY flogger.lib +LIBRARY euser.lib +LIBRARY ecom.lib +LIBRARY efsrv.lib +LIBRARY avkon.lib +LIBRARY bafl.lib +LIBRARY platformenv.lib +LIBRARY irobex.lib +LIBRARY hwrmhapticspacketizer.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsbridgeclient.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsbridgeclient.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,101 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Client interface to haptics server for haptics bridge +* commands. +* +*/ + + +#ifndef C_HAPTICSBRIDGECLIENT_H +#define C_HAPTICSBRIDGECLIENT_H + +#include + +class CHWRMHapticsPacketizer; + +class RHapticsBridgeClient : public RSessionBase +{ +public: + /** + * Constructor + */ + RHapticsBridgeClient(); + + /** + * Destructor + */ + virtual ~RHapticsBridgeClient(); + +public: + /** + * Create a connection to haptics server. + */ + TInt Connect(); + + /** + * Close the connection to haptics server. + */ + void Close(); + + /** + * Send message to haptics server. + * @param aReqData Data request to be sent to haptics server. + * @param aRetDataPckg Returned data from haptics server. + * @return KErrNone if sent succesfully, otherwise system wide error code. + */ + TInt SendBridgeBuffer( const TDesC8& aReqData, TDes8& aRetDataPckg ); + + /** + * Sends a message clean-up commend to haptics server. + */ + void CleanUp(); + + +private: + + /** + * Returns the version of the haptics server. + * @return Version. + */ + TVersion ServerVersion() const; + + /** + * Starts the server process if it is not already running. + * @return KErrNone on success, otherwise a system error code. + */ + TInt StartServer() const; + + /** + * Handles the device opening request. + * @param aResponse Reference to a descriptor containing the response + * received from haptics server. + */ + void HandleOpenDeviceResponseL( const TDesC8& aResponse ); + + /** + * Opens the haptic effect ("vibra") device. + * @return KErrNone on success, otherwise a system error code. + */ + TInt OpenHapticsDevice(); + +private: + + /** + * Haptic packetizer. + * Owned. + */ + CHWRMHapticsPacketizer* iPacketizer; +}; + +#endif // C_HAPTICSBRIDGECLIENT_H \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconnplugin.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconnplugin.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,66 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Haptics OBEX connection plugin. +* +*/ + + +#ifndef C_HAPTICSCONNPLUGIN_H +#define C_HAPTICSCONNPLUGIN_H + +#include +#include + +class CHapticsMsgHandler; + +class CHapticsConnPlugin : public CSrcsInterface + { + public: + /** + * 2-phased constructor. + */ + static CHapticsConnPlugin* NewL(); + + /** + * Destructor. + */ + virtual ~CHapticsConnPlugin(); + + /** + * From CSrcsInterface. + * @see CSrcsInterface. + */ + TBool IsOBEXActive(); + + private: + /** + * 2nd phase constructor. + */ + void ConstructL(); + + /** + * Constructor. + */ + CHapticsConnPlugin(); + + private: + /** + * Component to handle messages between file systen and + * haptics server. + * Own. + */ + CHapticsMsgHandler* iMsgHandler; + }; + +#endif // C_HAPTICSCONNPLUGIN_H \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconntimer.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconntimer.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,71 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Connection shutdown timer for haptics server connection. +* +*/ + + +#ifndef C_HAPTICSCONNTIMER_H +#define C_HAPTICSCONNTIMER_H + +#include + +#include "hapticsmsghandler.h" + +NONSHARABLE_CLASS ( CHapticsConnTimer ) : public CTimer + { + public: + /** + * 2-phased constructor. + */ + static CHapticsConnTimer* NewL( MHapticsConnectionShutdown* aCallback ); + + /** + * Destructor. + */ + virtual ~CHapticsConnTimer(); + + /** + * Starts the timer + */ + void Start(); + + private: // From CActive. + /** + * Notifies client on timeout. + */ + void RunL(); + + private: + /** + * Constructor. + */ + CHapticsConnTimer( MHapticsConnectionShutdown* aCallback ); + + /** + * 2nd phase constructor. + */ + void ConstructL(); + + private: + /** + * Callback interface to notify about timeout. + * Not own. + */ + MHapticsConnectionShutdown* iCallback; + }; + +#endif // C_HAPTICSCONNTIMER_H + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconntrace.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsconntrace.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,113 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Haptics conn plugin debug trace macro definition header file. +* +*/ +#ifndef HAPTICSCONNTRACE_H +#define HAPTICSCONNTRACE_H + +#include +#include +#include +#include +#include + +/** + * Writes formatted string data to a file using RFileLogger. + * + * @param aFmt Value-referenced descriptor containing the formatted string. + */ +inline void HwrmWriteFormat( TRefByValue aFmt, ... ) + { + _LIT( KDir, "Hwrm" ); + _LIT( KName, "Hwres.log" ); + + // take the ellipsis parameters + VA_LIST args; + VA_START( args, aFmt ); + RFileLogger::WriteFormat( KDir, KName, EFileLoggingModeAppend, aFmt, args ); + VA_END( args ); + } + +/** + * Writes data dump in hex format in "[ 00 01 FF ]" style. + * + * @param aPrefix Descriptor containing the string to be appended in + * front of the actual data dump. + * @param aData An 8-bit descriptor containing the data buffer for which + * the data dump is written. + */ +inline void DataDumpTrace( const TDesC& aPrefix, const TDesC8& aData ) + { + _LIT( KSATraceDataDumpStart, " [ " ); + _LIT( KSATraceDataDumpLineAlign, " " ); + _LIT( KSATraceDataDumpStop, " ] " ); + _LIT( KSATraceDataDumpValue, "%02x " ); + const TInt KSASDataDumpTraceBytesPerLine = 10; + + HBufC* buffer = HBufC::New( 255 ); + + if ( buffer != NULL ) + { + buffer->Des().Copy( aPrefix ); + buffer->Des().Append( KSATraceDataDumpStart ); + for ( TInt i = 0; i < aData.Length(); i++) + { + buffer->Des().AppendFormat( KSATraceDataDumpValue, aData[i] ); + + if( ( i % KSASDataDumpTraceBytesPerLine == ( KSASDataDumpTraceBytesPerLine - 1 ) ) && + ( i + 1 < aData.Length() ) ) + { + RDebug::Print( buffer->Des() ); + + buffer->Des().Copy( aPrefix); + buffer->Des().Append( KSATraceDataDumpLineAlign ); + } + } + buffer->Des().Append( KSATraceDataDumpStop ); + + RDebug::Print( buffer->Des() ); + + } + + delete buffer; + } + +#ifdef _DEBUG + + #ifdef USE_FILE_LOGGING + + #define COMPONENT_TRACE( a ) HwrmWriteFormat a + #define API_TRACE( a ) HwrmWriteFormat a + #define DATADUMP_TRACE( a, b ) + + #else + + #define COMPONENT_TRACE( a ) RDebug::Print a + #define API_TRACE( a ) RDebug::Print a + #define DATADUMP_TRACE( a, b ) DataDumpTrace( a, b ) + + #endif // #ifdef USE_FILE_LOGGING + +#else // #ifdef _DEBUG + + #define COMPONENT_TRACE( a ) + #define API_TRACE( a ) + #define DATADUMP_TRACE( a, b ) + +#endif //#ifdef _DEBUG +#endif //#ifndef HAPTICSCONNTRACE_H + + +// End of File diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsmsghandler.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/inc/hapticsmsghandler.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,136 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Handles messaging between file system and haptics +* client interface. +* +*/ + + +#ifndef C_HAPTICSMSGHANDLER_H +#define C_HAPTICSMSGHANDLER_H + +#include +#include +#include + +#include "hapticsbridgeclient.h" + +class CHapticsConnTimer; + +/** + * Interface to notify about connection timeout. + */ +class MHapticsConnectionShutdown + { + public: + /** + * Called to notify about connection timeout. + */ + virtual void NotifyShutdown() = 0; + + }; + +/** + * Helper class for Bridge functionality for handling RFs (File Session) + * change notifications for VibeTonz request file. + * + * @since S60 5.1 + */ +class CHapticsMsgHandler : public CActive, + public MHapticsConnectionShutdown + { +public: + /** + * 2-phased constructor. + */ + static CHapticsMsgHandler* NewL(); + + /** + * Destructor + */ + virtual ~CHapticsMsgHandler(); + + /** + * Method for starting the listening for change notifications + */ + void StartNotifier(); + + /** + * From MHapticsConnectionShutdown. + * Called to notify about connection timeout. + */ + void NotifyShutdown(); + +protected: // From CActive. + /** + * @see CActive + */ + void RunL(); + /** + * @see CActive + */ + TInt RunError(TInt aError); + /** + * @see CActive + */ + void DoCancel(); + +private: + + /** + * Constructor + */ + CHapticsMsgHandler(); + + /** + * Two-phase construction ConstructL + */ + void ConstructL(); + + /** + * Method for connecting to file system. Also sets the paths and + * creates directories (if not already exists). + */ + void ConnectToFilesystemL(); + + /** + * Helper for clearing the possible left-over request file from + * previous runs. + */ + void ClearRequestFile(); + +private: // data + + /** + * File server session through which all file server related + * services are requested. + */ + RFs iFs; + + /** + * Buffer for the request file data + */ + HBufC8* iReqBuf; + + /** + * The RHapticsBridgeClient object that is responsible for further + * handling of received Bridge commands + */ + RHapticsBridgeClient iClient; + + CHapticsConnTimer* iConnectionTimeout; + + }; + +#endif // C_HAPTICSMSGHANDLER_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/rom/hapticsconnplugin.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/rom/hapticsconnplugin.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,26 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: IBY file for Haptics conn plugin. +* +*/ + + +#ifndef HAPTICSCONNPLUGIN_IBY +#define HAPTICSCONNPLUGIN_IBY + +#include + +ECOM_PLUGIN(hapticsconnplugin.dll,hapticsconnplugin.rsc) + +#endif // HAPTICSCONNPLUGIN_IBY diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsbridgeclient.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsbridgeclient.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,317 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Client interface to haptics server for haptics bridge +* commands. +* +*/ + + +#include +#include +#include // KDC_PROGRAMS_DIR +#include +#include +#include + +#include "hapticsbridgeclient.h" +#include "hapticsconntrace.h" + +const TInt KServerVersionMajor = 1; +const TInt KServerVersionMinor = 1; +const TInt KServerVersionBuild = 1; +_LIT( KServerProcessName, "!hwrmhapticsserver" ); +_LIT( KServerExeName, "hwrmhapticsserver.exe" ); +const TInt KAsyncMsgSlots = 10; + +const TInt KHWRMHapticsServiceCommand = 2001; +const TInt KHWRMHapticsOpenActuatorCommand = 2004; +const TInt KHWRMHapticsCleanupCommand = 2008; +const TInt KHWRMHapticsBridgeCommand = 2011; + +// -------------------------------------------------------------------------- +// Simple constructor +// +// -------------------------------------------------------------------------- +// +RHapticsBridgeClient::RHapticsBridgeClient() + { + TRAP_IGNORE( iPacketizer = + CHWRMHapticsPacketizer::NewL( EHWRMLogicalActuatorAny ) ); + } + +// -------------------------------------------------------------------------- +// Simple destructor +// +// -------------------------------------------------------------------------- +// +RHapticsBridgeClient::~RHapticsBridgeClient() + { + delete iPacketizer; + } + +// -------------------------------------------------------------------------- +// Method for connecting (creating a new session) with Haptics Server +// +// -------------------------------------------------------------------------- +// +TInt RHapticsBridgeClient::Connect() + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::Connect()" ) ) ); + TInt ret = CreateSession( KServerProcessName, + ServerVersion(), + KAsyncMsgSlots ); + if ( ret != KErrNone ) + { + ret = StartServer(); + if ( ret == KErrNone ) + { + ret = CreateSession( KServerProcessName, + ServerVersion(), + KAsyncMsgSlots ); + COMPONENT_TRACE(_L("RHapticsBridgeClient::Connect(), Session created")); + } + } + + // Initialize server components. + if ( ret == KErrNone ) + { + ret = SendReceive( KHWRMHapticsServiceCommand ); + } + + // Open the haptic effect ("vibra") device. + if ( ret == KErrNone ) + { + ret = OpenHapticsDevice(); + } + + + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::Connect - return(%d)" ), ret ) ); + return ret; + } + +// -------------------------------------------------------------------------- +// Method for starting Haptics Server (if not already running) +// +// -------------------------------------------------------------------------- +// +TInt RHapticsBridgeClient::StartServer() const + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::StartServer()" ) ) ); + + TParse parser; + parser.Set( KServerExeName, &KDC_PROGRAMS_DIR, NULL ); + + RProcess server; + TInt ret = server.Create( parser.FullName(), KNullDesC ); + + if ( ret != KErrNone ) // Loading failed. + { + return ret; + } + + TRequestStatus status; + server.Rendezvous( status ); + + if ( status != KRequestPending ) + { + server.Kill( 0 ); // Abort startup. + server.Close(); + return KErrGeneral; + } + else + { + server.Resume(); // Logon OK - start the server. + } + + User::WaitForRequest( status ); + server.Close(); + + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::StartServer() - return %d" ), status.Int() ) ); + return status.Int(); + } + +// -------------------------------------------------------------------------- +// Method for closing session to haptics server. +// +// -------------------------------------------------------------------------- +// +void RHapticsBridgeClient::Close() + { + RSessionBase::Close(); + } + +// -------------------------------------------------------------------------- +// Getter method for server version. +// +// -------------------------------------------------------------------------- +// +TVersion RHapticsBridgeClient::ServerVersion() const + { + return TVersion( KServerVersionMajor, + KServerVersionMinor, + KServerVersionBuild ); + } + +// -------------------------------------------------------------------------- +// Method for sending commands to Haptics Server. +// +// -------------------------------------------------------------------------- +// +TInt RHapticsBridgeClient::SendBridgeBuffer( const TDesC8& aReqData, TDes8& aRetDataPckg ) + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::SendBridgeBufferL() - Begin" ) ) ); + + TInt retVal( KErrDisconnected ); + if ( iHandle ) + { + TInt vibeStatus(0); + TPckg vibeStatusPckg( vibeStatus ); + retVal = SendReceive( KHWRMHapticsBridgeCommand, + TIpcArgs( &aReqData, + &vibeStatusPckg, + &aRetDataPckg ) ); + + if ( retVal == KErrNone ) + { + TRAP( retVal, HandleOpenDeviceResponseL( aRetDataPckg ) ); + } + } + + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::SendBridgeBufferL() - End (%d)" ), retVal ) ); + return retVal; + } + +// -------------------------------------------------------------------------- +// Method for cleaning up session to Haptics Server. +// +// -------------------------------------------------------------------------- +// +void RHapticsBridgeClient::CleanUp() + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::CleanUp() - Begin" ) ) ); + if ( iHandle ) + { + SendReceive ( KHWRMHapticsCleanupCommand ); + } + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::CleanUp() - End" ) ) ); + } + +// -------------------------------------------------------------------------- +// Method for handling Open Device responses (basically for requesting the +// setting of the license key). +// +// -------------------------------------------------------------------------- +// +void RHapticsBridgeClient::HandleOpenDeviceResponseL( const TDesC8& aResponse ) + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::HandleOpenDeviceResponse() - Begin" ) ) ); + TInt err( KErrNone ); + if ( !iPacketizer ) + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::HandleOpenDeviceResponse() - No Packetizer!" ) ) ); + User::Leave( KErrGeneral ); + } + else + { + const TUint8* pRsp ( aResponse.Ptr() ); + if ( 0x12 == pRsp[0] && 0x00 == pRsp[1] && 0x00 == pRsp[2] ) + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::HandleOpenDeviceResponse() - OPEN DEVICE RESPONSE handling" ) ) ); + iPacketizer->DecodeMessageL( aResponse, err ); + if ( !err ) + { + RBuf8 reqBuf; + err = iPacketizer->EncSetPlatformLicenseKeyReq( + iPacketizer->DeviceHandle(), reqBuf ); + if ( !err ) + { + TBuf8<50> dummyRetBuf; + TInt dummyStatus; + TPckg dummyStatusPckg( dummyStatus ); + err = SendReceive( KHWRMHapticsBridgeCommand, + TIpcArgs ( &reqBuf, + &dummyStatusPckg, + &dummyRetBuf ) ); + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::HandleOpenDeviceResponse() - Sent set license command (%d)"), err ) ); + } + reqBuf.Close(); + } + User::LeaveIfError( err ); + } + } + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::HandleOpenDeviceResponse() - End" ) ) ); + } + + +// -------------------------------------------------------------------------- +// Method for opening haptics device. This is needed since there's possibility +// that no other haptics client has opened the device prior to this bridge +// connectivity. This method also call set license key, i.e., completes the +// device opening. +// +// -------------------------------------------------------------------------- +// +TInt RHapticsBridgeClient::OpenHapticsDevice() + { + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - Begin" ) ) ); + TInt err( KErrGeneral ); + if ( iPacketizer ) + { + RBuf8 openDevReqBuf; + RBuf8 setLicenseReqBuf; + TBuf8<50> setLicenseRspBuf; + TInt dummyStatus; + TPckg dummyStatusPckg( dummyStatus ); + + err = iPacketizer->EncOpenDeviceReq( EHWRMLogicalActuatorAny, + openDevReqBuf ); + + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - EncOpenDevice (%d)" ), err ) ); + if ( !err ) + { + TInt deviceHandle; + TPckg deviceHandlePckg( deviceHandle ); + err = SendReceive( KHWRMHapticsOpenActuatorCommand, + TIpcArgs ( &openDevReqBuf, + &deviceHandlePckg, + EHWRMLogicalActuatorAny ) ); + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - Send OpenDevice (%d)" ), err ) ); + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - Device handle = %d" ), deviceHandle ) ); + if ( !err ) + { + err = iPacketizer->EncSetPlatformLicenseKeyReq( + deviceHandle, setLicenseReqBuf ); + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - EncSetEmptyLicenseKey (%d)" ), err ) ); + if ( !err ) + { + TBuf8<50> dummyRspBuf; + TInt dummyStatus; + TPckg dummyStatusPckg( dummyStatus ); + err = SendReceive( KHWRMHapticsBridgeCommand, + TIpcArgs ( &setLicenseReqBuf, + &dummyStatusPckg, + &dummyRspBuf ) ); + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - Send SetLicense (%d)" ), err ) ); + } + } + } + + openDevReqBuf.Close(); + setLicenseReqBuf.Close(); + } + COMPONENT_TRACE( ( _L( "RHapticsBridgeClient::OpenHapticsDevice - End (err=%d)" ),err ) ); + return err; + } + +// eof diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsconnplugin.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsconnplugin.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,84 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Haptics OBEX connection plugin. +* +*/ + + +#include "hapticsconnplugin.h" +#include "hapticsmsghandler.h" +#include "hapticsconntrace.h" + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::NewL() +// Two-phase constructing +// ----------------------------------------------------------------------------- +// +CHapticsConnPlugin* CHapticsConnPlugin::NewL() + { + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::NewL - Begin" ) ) ); + CHapticsConnPlugin* self = new ( ELeave ) CHapticsConnPlugin(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::NewL - End" ) ) ); + return( self ); + } + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::ConstructL() +// +// ----------------------------------------------------------------------------- +// +void CHapticsConnPlugin::ConstructL() + { + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::ConstructL() - Begin" ) ) ); + iMsgHandler = CHapticsMsgHandler::NewL(); + iMsgHandler->StartNotifier(); + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::ConstructL() - End" ))); + } + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::~CHapticsConnPlugin() +// Destructor +// ----------------------------------------------------------------------------- +// +CHapticsConnPlugin::~CHapticsConnPlugin() + { + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::~CHapticsConnPlugin() - Begin" ) ) ); + delete iMsgHandler; + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::~CHapticsConnPlugin() - End" ) ) ); + } + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::CHapticsConnPlugin() +// Constructor +// ----------------------------------------------------------------------------- +// +CHapticsConnPlugin::CHapticsConnPlugin() + { + } + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::IsOBEXActive() +// +// ----------------------------------------------------------------------------- +// +TBool CHapticsConnPlugin::IsOBEXActive() + { + COMPONENT_TRACE( ( _L( "CHapticsConnPlugin::IsOBEXActive" ) )); + return ETrue; + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsconntimer.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsconntimer.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,81 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Connection shutdown timer for haptics server connection. +* +*/ + + +#include "hapticsconntimer.h" + +const TInt KHapticsConnectionTimeout = 30000000; // 30 sec. + +// --------------------------------------------------------------------------- +// Two phased constructor. +// --------------------------------------------------------------------------- +// +CHapticsConnTimer* CHapticsConnTimer::NewL( MHapticsConnectionShutdown* aCallback ) + { + CHapticsConnTimer* self = new ( ELeave ) CHapticsConnTimer(aCallback); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +// --------------------------------------------------------------------------- +// Destructor. +// --------------------------------------------------------------------------- +// +CHapticsConnTimer::~CHapticsConnTimer() + { + } + +// --------------------------------------------------------------------------- +// Activates this timer. +// --------------------------------------------------------------------------- +// +void CHapticsConnTimer::Start() + { + After( KHapticsConnectionTimeout ); + } + +// --------------------------------------------------------------------------- +// Constructor of the shutdown timer. +// --------------------------------------------------------------------------- +// +CHapticsConnTimer::CHapticsConnTimer( MHapticsConnectionShutdown* aCallback ) + : CTimer( EPriorityStandard ), iCallback(aCallback) + { + CActiveScheduler::Add( this ); + } + +// --------------------------------------------------------------------------- +// Second phase construction. +// --------------------------------------------------------------------------- +// +void CHapticsConnTimer::ConstructL() + { + CTimer::ConstructL(); + } + +// --------------------------------------------------------------------------- +// +// --------------------------------------------------------------------------- +// +void CHapticsConnTimer::RunL() + { + iCallback->NotifyShutdown(); + } + +// End of File diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsmsghandler.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/src/hapticsmsghandler.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,255 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Handles messaging between file system and haptics +* client interface. +* +*/ + + +#include +#include +#include +#include + +#include "hapticsmsghandler.h" +#include "hapticsconntimer.h" +#include "hapticsconntrace.h" + +_LIT( KVibeTonzFolder,"VibeTonz\\" ); +_LIT( KSourceFileName,"VibeTonzDataReq" ); +_LIT( KTargetFileName,"VibeTonzDataRsp" ); + +// --------------------------------------------------------------------------- +// CHapticsMsgHandler* CHapticsMsgHandler::NewL() +// --------------------------------------------------------------------------- +// +CHapticsMsgHandler* CHapticsMsgHandler::NewL() + { + CHapticsMsgHandler* self = new (ELeave) CHapticsMsgHandler(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +// --------------------------------------------------------------------------- +// Default C++ constructor +// --------------------------------------------------------------------------- +// +CHapticsMsgHandler::CHapticsMsgHandler () : CActive( EPriorityStandard ) + { + } + +// --------------------------------------------------------------------------- +// void CHapticsMsgHandler::ConstructL() +// --------------------------------------------------------------------------- +// +void CHapticsMsgHandler::ConstructL() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ConstructL - Begin") ) ); + CActiveScheduler::Add( this ); + ConnectToFilesystemL(); + iConnectionTimeout = CHapticsConnTimer::NewL(this); + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ConstructL - End") ) ); + } + +// --------------------------------------------------------------------------- +// CHapticsMsgHandler::~CHapticsMsgHandler() +// --------------------------------------------------------------------------- +// +CHapticsMsgHandler::~CHapticsMsgHandler() + { + Cancel(); + + if ( iConnectionTimeout ) + { + iConnectionTimeout->Cancel(); + delete iConnectionTimeout; + } + + delete iReqBuf; + + iClient.Close(); + iFs.Close(); + } + +// --------------------------------------------------------------------------- +// void ClearRequestFile() +// --------------------------------------------------------------------------- +// +void CHapticsMsgHandler::ClearRequestFile() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ClearRequestFile - Begin") ) ); + + TFindFile findDataFile( iFs ); + + TFileName sourcefile = PathInfo::PhoneMemoryRootPath(); + sourcefile.Append( PathInfo::OthersPath() ); + sourcefile.Append( KVibeTonzFolder ); + sourcefile.Append( KSourceFileName ); + + if( findDataFile.FindByDir( sourcefile, KNullDesC ) == KErrNone ) + { + COMPONENT_TRACE( _L("CHapticsMsgHandler::ClearRequestFile - Deleting REQ file") ); + iFs.Delete( KSourceFileName ); + } + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ClearRequestFile - End") ) ); + } +// --------------------------------------------------------------------------- +// void ConnectToFilesystem() +// --------------------------------------------------------------------------- +// +void CHapticsMsgHandler::ConnectToFilesystemL() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ConnectToFilesystemL - Begin") ) ); + User::LeaveIfError( iFs.Connect() ); + + TFileName sessionPath = PathInfo::PhoneMemoryRootPath(); + sessionPath.Append( PathInfo::OthersPath() ); + sessionPath.Append( KVibeTonzFolder ); + TBool folderExists = BaflUtils::FolderExists( iFs, sessionPath ); + + if( folderExists ) + { + User::LeaveIfError( iFs.SetSessionPath( sessionPath ) ); + ClearRequestFile(); + } + else + { + User::LeaveIfError( iFs.MkDir( sessionPath ) ); + User::LeaveIfError( iFs.SetSessionPath( sessionPath ) ); + } + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::ConnectToFilesystemL - End") ) ); + } + +// --------------------------------------------------------------------------- +// CHapticsMsgHandler::StartNotifier() +// --------------------------------------------------------------------------- +// +void CHapticsMsgHandler::StartNotifier() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::StartNotifier - Begin" ) ) ); + if ( !IsActive() ) + { + TFileName sessionPath = PathInfo::PhoneMemoryRootPath(); + sessionPath.Append( PathInfo::OthersPath() ); + sessionPath.Append( KVibeTonzFolder ); + iFs.NotifyChange( ENotifyAll, iStatus, sessionPath ); + SetActive(); + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::StartNotifier - Started" ) ) ); + } + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::StartNotifier - End" ) ) ); + } + +// --------------------------------------------------------------------------- +// CHapticsMsgHandler::RunL() +// --------------------------------------------------------------------------- +// +void CHapticsMsgHandler::RunL() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::RunL - Begin" ) ) ); + + StartNotifier(); // re-subscribe for change notifications. + + TFindFile findDataFile(iFs); + TFileName sourcefileName = PathInfo::PhoneMemoryRootPath(); + sourcefileName.Append( PathInfo::OthersPath() ); + sourcefileName.Append( KVibeTonzFolder ); + sourcefileName.Append( KSourceFileName ); + + if( findDataFile.FindByDir( sourcefileName, KNullDesC ) == KErrNone ) + { + COMPONENT_TRACE( ( _L("CHapticsMsgHandler::RunL - found request file") ) ); + + RFile sourceFile; + TInt sourceFileSize; + + User::LeaveIfError( sourceFile.Open( iFs, sourcefileName, EFileShareAny ) ); + CleanupClosePushL( sourceFile ); + sourceFile.Size( sourceFileSize ); + + iReqBuf = HBufC8::NewL( sourceFileSize ); + TPtr8 reqBufPtr = iReqBuf->Des(); + sourceFile.Read( reqBufPtr ); + CleanupStack::PopAndDestroy( &sourceFile ); + + ClearRequestFile(); + + DATADUMP_TRACE( _L("CHapticsMsgHandler::RunL - request data dump:"), reqBufPtr ); + + if ( !iClient.Handle() ) + { + User::LeaveIfError( iClient.Connect() ); + } + + TBuf8<256> retData; + TInt bridgeErr = iClient.SendBridgeBuffer( reqBufPtr, retData ); + + delete iReqBuf; + iReqBuf = NULL; + + if ( bridgeErr == KErrNone ) + { + iConnectionTimeout->Cancel(); + iConnectionTimeout->Start(); + + DATADUMP_TRACE( _L("CHapticsMsgHandler::RunL - response data dump:"), retData ); + RFile targetFile; + targetFile.Replace( iFs, KTargetFileName, EFileWrite ); + targetFile.Write( retData ); + targetFile.Close(); + } + } + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::RunL - End" ) ) ); + } + +// ----------------------------------------------------------------------------- +// +// +// ----------------------------------------------------------------------------- +// +TInt CHapticsMsgHandler::RunError( TInt aError ) + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::RunError: %d" ), aError ) ); + return aError; + } + +// ----------------------------------------------------------------------------- +// +// +// ----------------------------------------------------------------------------- +// +void CHapticsMsgHandler::DoCancel() + { + COMPONENT_TRACE( ( _L( "Inside CHapticsMsgHandler::DoCancel" ) ) ); + if ( IsActive() ) + { + iFs.NotifyChangeCancel( iStatus ); + } + } + +// ----------------------------------------------------------------------------- +// CHapticsConnPlugin::CHapticsConnPlugin() +// Constructor +// ----------------------------------------------------------------------------- +// +void CHapticsMsgHandler::NotifyShutdown() + { + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::NotifyShutdown - Begin" ) ) ); + iClient.CleanUp(); + iClient.Close(); + COMPONENT_TRACE( ( _L( "CHapticsMsgHandler::NotifyShutdown - End" ) ) ); + } + +// end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/hapticsconnplugin/src/proxy.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/hapticsconnplugin/src/proxy.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,40 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Implementation proxy for haptics connection plugin. +* +*/ + + +#include +#include + +#include "hapticsconnplugin.h" + +// Map the interface UIDs to implementation factory functions +const TImplementationProxy ImplementationTable[] = + { + IMPLEMENTATION_PROXY_ENTRY( 0x2001FE53, CHapticsConnPlugin::NewL ) + }; + +// Exported proxy for instantiation method resolution +EXPORT_C const TImplementationProxy* ImplementationGroupProxy(TInt& aTableCount) + { + aTableCount = sizeof(ImplementationTable) / sizeof(TImplementationProxy); + + return ImplementationTable; + } + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,23 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in build information file. +* +*/ + + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +sconpcconnplugin.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/bld/def/bwinscwu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/bld/def/bwinscwu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,3 @@ +EXPORTS + ?ImplementationGroupProxy@@YAPBUTImplementationProxy@@AAH@Z @ 1 NONAME ; struct TImplementationProxy const * ImplementationGroupProxy(int &) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/bld/def/eabiu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/bld/def/eabiu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,5 @@ +EXPORTS + _Z24ImplementationGroupProxyRi @ 1 NONAME + _ZTI17CSConPCConnplugin @ 2 NONAME ; ## + _ZTV17CSConPCConnplugin @ 3 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/bld/sconpcconnplugin.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/bld/sconpcconnplugin.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,64 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in MMP file +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_ECOM_PLUGIN + +TARGET sconpcconnplugin.dll +TARGETTYPE PLUGIN + +UID 0x10009D8D 0x101F9688 + +SOURCEPATH ../src + +SOURCE sconpcconnplugin.cpp +SOURCE proxy.cpp +SOURCE sconpcconnpluginutils.cpp +SOURCE sconservicetimer.cpp +SOURCE sconshutdownwatcher.cpp + +START RESOURCE 101f9688.rss + TARGET sconpcconnplugin.rsc +END + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +USERINCLUDE ../inc +USERINCLUDE ../../../inc +USERINCLUDE ../../../clients/pcconn/inc +USERINCLUDE ../../../servers/pcconn/inc +USERINCLUDE ../../../services/ftp/inc +USERINCLUDE ../../../catalogspcconnectivityplugin/inc + +DEBUGLIBRARY flogger.lib +LIBRARY sconpcconnclient.lib +LIBRARY euser.lib +LIBRARY irobex.lib +LIBRARY ecom.lib +LIBRARY efsrv.lib +LIBRARY bafl.lib +LIBRARY catalogspcconnectivityplugin.lib +LIBRARY apmime.lib +LIBRARY bluetooth.lib +LIBRARY esock.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/inc/sconpcconnplugin.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/inc/sconpcconnplugin.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,234 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity plugin header file +* +*/ + +#ifndef _SCONPCCONNPLUGIN_H +#define _SCONPCCONNPLUGIN_H + +#include +#include +#include + +#include "sconpcconnclient.h" +#include "sconshutdownwatcher.h" + +// forward declaration +class CSConFTP; +class CSConServiceTimer; +class CCatalogsPCConnectivityPlugin; + + + +class CSConPCConnplugin : public CSrcsInterface, public MObexServerNotify, + public MShutdownObserver + { + public: + static CSConPCConnplugin* NewL(); + virtual ~CSConPCConnplugin(); + + /** + * Returns active status of OBEX session + * @return ETrue if session is active, else EFalse + */ + TBool IsOBEXActive(); + + /** + * Device is shutting down, abort connection. + */ + void NotifyShutdown(); + + private: + /** + * Loads sconftp.dll module + * @return none + */ + void LoadFTPDllL(); + /** + * Closes initialized services + * @return none + */ + void Disconnect(); + /** + * Removes spaces and nulls from the end of the string + * @param aDes String to be formatted + * @return none + */ + void TrimRightSpaceAndNull( TDes8& aDes ) const; + /** + * Current used transfer media (IR,USB,BT) + * @param aMediaType Enumeration indicating the media type + * @return none + */ + void SetMediaType( TSrcsMediaType aMediaType ); + /** + * MObexServerNotify implementation + * @param aError Error code + * @return none + */ + void ErrorIndication( TInt aError ); + /** + * MObexServerNotify implementation + * @return none + */ + void TransportUpIndication(); + /** + * MObexServerNotify implementation + * @return none + */ + void TransportDownIndication(); + /** + * MObexServerNotify implementation + * @param aRemoteInfo Structure containing information used during OBEX + * connection + * @param aInfo Further information about the requested connection + * @return System wide error code that indicates the success of the connection + */ + TInt ObexConnectIndication( const TObexConnectInfo& aRemoteInfo, + const TDesC8& aInfo ); + /** + * MObexServerNotify implementation + * @param aInfo Contains information about the disconnection + * @return none + */ + void ObexDisconnectIndication( const TDesC8& aInfo ); + /** + * MObexServerNotify implementation + * @return CObexBaseObject-derived object, which the object being put + * will be parsed into. + */ + CObexBufObject* PutRequestIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * PUT packet operation. + */ + TInt PutPacketIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * PUT packet operation. + */ + TInt PutCompleteIndication(); + /** + * MObexServerNotify implementation + * @param aRequiredObject Details about the object the remote client + * has requested + * @returnObject to return to the client + */ + CObexBufObject* GetRequestIndication( CObexBaseObject + *aRequiredObject ); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * GET packet operation. + */ + TInt GetPacketIndication(); + /** + * MObexServerNotify implementation + * @return System wide error code that indicates the success of the + * GET packet operation. + */ + TInt GetCompleteIndication(); + /** + * MObexServerNotify implementation + * @param aPathInfo SETPATH command parameters + * @param aInfo Not currently used + * @return System wide error code indicating the success of the + * setpath command. + */ + TInt SetPathIndication( const CObex::TSetPathInfo& aPathInfo, + const TDesC8& aInfo ); + /** + * SetObexServer + * @param aObexServer pass obex server pointer to sevice controller + * @return System wide error code. + */ + TInt SetObexServer( CObexServer* aObexServer ); + /** + * MObexServerNotify implementation + * @return none + */ + void AbortIndication(); + /** + * Checks if mime type belongs to Catalogs + * @return TBool + */ + TBool IsCatalogsMimeType( TDataType aMime ); + + void ConstructL(); + CSConPCConnplugin(); + + /** + * Handles PCD object. Used for advanced file handling. + * @param aDescriptionHeader Contains command code and destination filename + * @param aNameHeader Source filename + * @return System wide error code. + */ + TInt HandlePCDObjectPut( const TDesC& aDescriptionHeader, const TDesC& aNameHeader ); + + /** + * Get Capbility object or ConML message from PCConnServer + * @param aNameHeader Name information. + * @param aTypeHeader Object type header. ConML or Capability object type + * @return none + */ + void HandleGetPCConnObjectL( const TDesC& aNameHeader, const TDesC8& aTypeHeader ); + + /** + * Get Catalogs object + * @param aTypeHeader Object type header. + * @return none + */ + void HandleGetCatalogsObjectL( const TDesC8& aTypeHeader ); + + /** + * Get file object + * @param aNameHeader requested filename. + * @return none + */ + void HandleGetFileObjectL( const TDesC& aNameHeader ); + + private: + RLibrary iFTPlib; + CObexBufObject* iObject; + CBufFlat* iBuffer; + CSConFTP* iFTPHandler; + TInt iPutError; + TBool iSessionActive; + CSConServiceTimer* iServiceTimer; + TBool iStartTimer; + TSrcsMediaType iMediaType; + CObexFileObject* iFileObject; + RSConPCConnSession iPCConnSession; + TBool iPCConnSessionConnected; + CCatalogsPCConnectivityPlugin* iCatalogs; + TBool iCatalogsConnected; + HBufC8* iCatalogsMimeType; + RPointerArray iMimeArray; + TBool iCatalogsMimeTypesExist; + TBool iPutPacketIndicationCalled; + CShutdownWatcher* iShutdownWatcher; + TBool iShutdownInProgress; + CObexServer* iObexServer; + RSocketServ iSocketServer; + RBTPhysicalLinkAdapter iLinkAdapter; + private: + // Friend class is used,because existing impelentation has been working + // properly. Avoiding re-design. + friend class CSConServiceTimer; + }; + +#endif // SCONPCCONNPLUGIN_H \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/inc/sconpcconnpluginutils.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/inc/sconpcconnpluginutils.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,53 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in Utils header +* +*/ + + +#ifndef _SCONPCCONNPLUGINUTILS_H +#define _SCONPCCONNPLUGINUTILS_H + +#include +//============================================================ +// Class TPCConnpluginUtils declaration +//============================================================ +class TPCConnpluginUtils + { + public: + /** + * Converts Symbian error code to OBEX error code + * @param aError The error code + * @return The converted error code + */ + static TInt ConvertPCDResponseCode( TInt aError ); + /** + * Converts Symbian error code to OBEX error code + * @param aError The error code + * @return The converted error code + */ + static TInt ConvertFTPResponseCode( TInt aError ); + + /** + * Converts Symbian error code to OBEX error code + * @param aError The error code + * @return The converted error code + */ + static TInt ConvertObexMoveResponseCode( TInt aError ); + }; + +#endif //_SCONPCCONNPLUGINUTILS_H + +// End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/inc/sconservicetimer.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/inc/sconservicetimer.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,61 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in Service Timer Header file +* +*/ + + +#ifndef _SCONSERVICETIMER_H +#define _SCONSERVICETIMER_H + +#include + +class CSConPCConnplugin; + + +//============================================================ +// Class CSConServiceTimer declaration +//============================================================ + +NONSHARABLE_CLASS ( CSConServiceTimer ) : public CActive + { + public: + CSConServiceTimer( CSConPCConnplugin* aEngine, TInt aValue ); + void ConstructL(); + ~CSConServiceTimer(); + + /** + * Starts the timer + * @return none + */ + void StartTimer(); + /** + * Stops the timer + * @return none + */ + void StopTimer(); + + private: + void DoCancel(); + void RunL(); + + private: + RTimer iTimer; + CSConPCConnplugin* iEngine; + TInt iValue; + }; + +#endif //_SCONSERVICETIMER_H + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/inc/sconshutdownwatcher.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/inc/sconshutdownwatcher.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,66 @@ +/* +* Copyright (c) 2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Power shutdown -watcher header file +* +*/ + + +#ifndef _SCONSHUTDOWNWATCHER_H +#define _SCONSHUTDOWNWATCHER_H + + +#include +#include + +//============================================================ +// Class MShutdownObserver declaration +//============================================================ +class MShutdownObserver + { +public: + virtual void NotifyShutdown()=0; + }; + +//============================================================ +// Class CShutdownWatcher declaration +//============================================================ +NONSHARABLE_CLASS ( CShutdownWatcher ) : public CActive + { + public: + static CShutdownWatcher* NewL( MShutdownObserver* aObserver ); + ~CShutdownWatcher(); + + /** + * Starts to watch shutdown status + * @return none + */ + void StartShutdownWatcher(); + + private: + //construct/destruct + CShutdownWatcher( MShutdownObserver* aObserver ); + void ConstructL(); + + // from CActive + void DoCancel(); + void RunL(); + + private: + MShutdownObserver* iObserver; + RProperty iProperty; + }; + +#endif //_SCONSHUTDOWNWATCHER_H + +// End of file \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/101f9688.rss --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/101f9688.rss Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,68 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in resource file +* +*/ + + +#include "ecom/registryinfo.rh" + +// Declares info for two implementations +RESOURCE REGISTRY_INFO theInfo + { + // UID for the DLL + dll_uid = 0x101F9688; + // Declare array of interface info + interfaces = + { + INTERFACE_INFO + { + // UID of interface that is implemented + interface_uid = 0x101F7C8C; + implementations = + { + // Info for CSConPCConnplugin + IMPLEMENTATION_INFO + { + implementation_uid = 0x101F9689; + version_no = 1; + display_name = "PC Suite Services"; + default_data = "OBEX/USB||OBEX/BT||OBEX/IrDA"; + + // + // opaque_data contains parameters used by following API calls in SRCS: + // 1. Setup USB interface string descriptor in Unicode; + // 2. TInt CObex::SetLocalWho(const TDesC8& aInfo); + // 3. TInt CBTConnection::RegisterSecuritySettingsL( TUint aService, + // TInt aProtocol, + // TInt aChannel, + // TBool aAuthenticate, + // TBool aAuthorise, + // TBool aEncrypt ); + // opaque_data = "@0||@1||@2||@3||@4||@5||@6" + // @0 aStrDesc e.g. "PC Connectivity" + // @1 aInfo e.g. KFolderBrowsingID, "\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09" + // @2 aService e.g. KBTSecurityUidFileTransfer, 0x1106 + // @3 aProtocol e.g. KSolBtRFCOMM, 0x1013 + // @4 aAuthenticate e.g. EFalse, 0 + // @5 aAuthorise e.g. EFalse, 0 + // @6 aEncrypt e.g. EFalse, 0 + // + opaque_data = "PC Suite Services||\xF9\xEC\x7B\xC4\x95\x3C\x11\xd2\x98\x4E\x52\x54\x00\xDC\x9E\x09||0x000050050000100080000002EE000001||0x1013||1||1||1||0xffff||0xffff"; + } + }; + } + }; + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/proxy.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/proxy.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,41 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in proxy implementation +* +*/ + + + +#include +#include + +#include "sconpcconnplugin.h" + +// Map the interface UIDs to implementation factory functions +const TImplementationProxy ImplementationTable[] = + { + IMPLEMENTATION_PROXY_ENTRY(0x101F9689, CSConPCConnplugin::NewL) + }; + +// Exported proxy for instantiation method resolution +EXPORT_C const TImplementationProxy* ImplementationGroupProxy(TInt& aTableCount) + { + aTableCount = sizeof(ImplementationTable) / sizeof(TImplementationProxy); + + return ImplementationTable; + } + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/sconpcconnplugin.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/sconpcconnplugin.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1254 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in implementation +* +*/ + + +// INCLUDE FILES + +#ifdef SYMBIAN_ENABLE_SPLIT_HEADERS +#include +#endif +#include "sconpcconnplugin.h" +#include "sconftp.h" +#include "sconpcconnpluginutils.h" +#include "sconservicetimer.h" +#include "catalogspcconnectivityplugin.h" +#include "debug.h" + + +// CONSTANTS +_LIT(KSConFTPLibName, "sconftp.dll"); +const TInt KSConFTPUidValue = 0x10009D8D; +const TUid KSConFTPUid = {KSConFTPUidValue}; + +// Folder listing type from IrObex specification +_LIT8( KSConFolderListType, "x-obex/folder-listing" ); +// Folder listing type from IrObex specification +_LIT8( KSConCapabilityObjectType, "x-obex/capability" ); +// PCD types +_LIT8( KSConPCDObjectType, "application/vnd.nokia.pcd" ); +_LIT8( KSConPCDXMLObjectType, "application/vnd.nokia.conml+xml" ); +_LIT8( KSConPCDWBXMLObjectType, "application/vnd.nokia.conml+wbxml" ); +_LIT8( KSConPCDXMLObjectType2, "application/vnd.nokia.pcd+xml" ); +_LIT8( KSConPCDWBXMLObjectType2, "application/vnd.nokia.pcd+wbxml" ); +_LIT( K_C_ROOT, "C:\\" ); + +// PCD header commands +const TInt KSCon_PCD_TAG = 0x003A; +const TInt KSCon_PCD_CMD_COPY = 0x0037; +const TInt KSCon_PCD_CMD_MOVE_OR_RENAME = 0x0038; +const TInt KSCon_PCD_CMD_SET_PERMISSION = 0x0039; +// PCD header parameters +const TInt KSCon_PCD_PAR_FULL_PERMISSION = 0x0040; +const TInt KSCon_PCD_PAR_READ_ONLY_PERMISSION = 0x0041; + + +const TInt KSConBufSize = 262144; // 256KB +// Time (in milliseconds) for the timer +const TInt KSConTimeOutValue = 180000000; +// Flags used to indicate SetPath commands +const TInt KSConNULLSetPath = 0x00; + +const TInt KSConHeaderMaxLength = 256; + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::NewL() +// Two-phase constructing +// ----------------------------------------------------------------------------- +// +CSConPCConnplugin* CSConPCConnplugin::NewL() + { + TRACE_FUNC_ENTRY; + CSConPCConnplugin* self = new ( ELeave ) CSConPCConnplugin(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + TRACE_FUNC_EXIT; + return( self ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::~CSConPCConnplugin() +// Destructor +// ----------------------------------------------------------------------------- +// +CSConPCConnplugin::~CSConPCConnplugin() + { + TRACE_FUNC_ENTRY; + + // Disconnect from services. + Disconnect(); + + delete iBuffer; + iBuffer = NULL; + + if ( iServiceTimer ) + { + iServiceTimer->Cancel(); + } + + delete iServiceTimer; + iServiceTimer = NULL; + + delete iCatalogs; + iCatalogs = NULL; + delete iCatalogsMimeType; + iCatalogsMimeType = NULL; + + iMimeArray.Reset(); + iMimeArray.Close(); + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::IsOBEXActive() +// Returns active status of OBEX session +// ----------------------------------------------------------------------------- +// +TBool CSConPCConnplugin::IsOBEXActive() + { + TRACE_FUNC; + return iSessionActive; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::NotifyShutdown() +// System is shutting down +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::NotifyShutdown() + { + TRACE_FUNC; + iShutdownInProgress = ETrue; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::LoadFTPDllL() +// Loads sconftp.dll module +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::LoadFTPDllL() + { + TRACE_FUNC_ENTRY; + // Dynamically load DLL + User::LeaveIfError( iFTPlib.Load( KSConFTPLibName ) ); + if ( iFTPlib.Type()[1] != KSConFTPUid ) + { + LOGGER_WRITE( "KSConFTPUidValue incorrect" ); + iFTPlib.Close(); + User::Leave( KErrNotFound ); + } + TSConCreateCSConFTPFunc CreateCSConFTPL = + (TSConCreateCSConFTPFunc)iFTPlib.Lookup(1); + iFTPHandler = (CSConFTP*)CreateCSConFTPL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::Disconnect() +// Closes initialized services +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::Disconnect() + { + TRACE_FUNC_ENTRY; + + iLinkAdapter.Close(); + iSocketServer.Close(); + + //Disconnect from server + iPCConnSession.Close(); + iPCConnSessionConnected = EFalse; + + if ( iStartTimer != EFalse ) + { + iServiceTimer->Cancel(); + iServiceTimer->StartTimer(); + } + + delete iObject; + iObject = NULL; + + if ( iFTPHandler ) + { + delete iFTPHandler; + iFTPHandler = NULL; + iFTPlib.Close(); + } + if ( iFileObject ) + { + delete iFileObject; + iFileObject = NULL; + } + if ( iCatalogsConnected ) + { + iCatalogs->Close(); + iCatalogsConnected = EFalse; + iCatalogsMimeTypesExist = EFalse; + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::ErrorIndication( TInt aError ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::ErrorIndication( TInt aError ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1( "aError : %d", aError ); + + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + if ( iPCConnSessionConnected ) + { + iPCConnSession.ResetServer(); + } + + // Keep compiler happy + (void)aError; + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::AbortIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::AbortIndication() + { + TRACE_FUNC_ENTRY; + + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + if ( iPCConnSessionConnected ) + { + iPCConnSession.ResetServer(); + } + + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::TransportUpIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::TransportUpIndication() + { + TRACE_FUNC; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::ObexConnectIndication( const TObexConnectInfo& +// aRemoteInfo, const TDesC8& aInfo ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::ObexConnectIndication( const TObexConnectInfo& + /*aRemoteInfo*/, const TDesC8& /*aInfo*/ ) + { + TRACE_FUNC_ENTRY; + TInt err( KErrNone ); + TInt catalogsErr( KErrNone ); + iStartTimer = ETrue; + + if ( iMediaType == ESrcsMediaBT && iObexServer ) + { + TSockAddr remoteAddr; + iObexServer->RemoteAddr( remoteAddr ); + + TBTSockAddr btSockAddr( remoteAddr ); + TBTDevAddr devAddr = btSockAddr.BTAddr(); + + err = iSocketServer.Connect(); + LOGGER_WRITE_1("iSocketServer.Connect err: %d", err ); + if ( !err ) + { + err = iLinkAdapter.Open( iSocketServer, devAddr ); + LOGGER_WRITE_1("iLinkAdapter.Open err: %d", err ); + } + // Ignore all BT link errors + err = KErrNone; + } + + //Connect to server + if ( !iPCConnSessionConnected ) + { + LOGGER_WRITE("Try to connect to iPCConnSession"); + err = iPCConnSession.Connect(); + LOGGER_WRITE_1( "iPCConnSession.Connect returned : %d", err ); + if ( err == KErrNone ) + { + iPCConnSessionConnected = ETrue; + } + } + + if ( err == KErrNone && !iFTPHandler ) + { + TRAP( err, LoadFTPDllL() ); + LOGGER_WRITE_1( "LoadFTPDllL returned : %d", err ); + } + + if ( err == KErrNone ) + { + iFTPHandler->SetProfile( EProprietary ); + LOGGER_WRITE( "iServiceTimer->StopTimer()" ); + iServiceTimer->Cancel(); + iServiceTimer->StopTimer(); + } + + if ( !iCatalogsConnected ) + { + LOGGER_WRITE( "CSConPCConnplugin::ObexConnectIndication() before iCatalogs->Connect()" ); + catalogsErr = iCatalogs->Connect(); + LOGGER_WRITE_1( "CSConPCConnplugin::ObexConnectIndication() iCatalogs->Connect() err: %d", catalogsErr ); + if ( catalogsErr == KErrNone ) + { + LOGGER_WRITE( "CSConPCConnplugin::ObexConnectIndication() iCatalogs->Connect() success" ); + iCatalogsConnected = ETrue; + TRAPD( ret, iMimeArray = iCatalogs->SupportedMimeTypesL() ); + if ( ret == KErrNone ) + { + LOGGER_WRITE_1( "iCatalogs->SupportedMimeTypesL count: %d", iMimeArray.Count() ); + iCatalogsMimeTypesExist = ETrue; + } + } + } + TRACE_FUNC_EXIT; + return TPCConnpluginUtils::ConvertFTPResponseCode( err ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::ObexDisconnectIndication( const TDesC8& ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::ObexDisconnectIndication( const TDesC8& ) + { + TRACE_FUNC_ENTRY; + Disconnect(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::TransportDownIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::TransportDownIndication() + { + TRACE_FUNC_ENTRY; + Disconnect(); + if ( iBuffer ) + { + iBuffer->Reset(); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::PutRequestIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +CObexBufObject* CSConPCConnplugin::PutRequestIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + iPutError = KErrNone; + + if ( iBuffer ) + { + iBuffer->Reset(); + } + + if ( iObject ) + { + delete iObject; + iObject = NULL; + } + + TRAP( err, iObject = CObexBufObject::NewL ( iBuffer ) ); + + if ( err != KErrNone ) + { + return NULL; + } + + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return NULL; + } + + TRAP( err, ret = iFTPHandler->PutFileObjectInitL( iObject, iBuffer ) ); + + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "iFTPHandler->PutFileObjectInitL() leaves: %d", err ); + return NULL; + } + if ( ret != KErrNone ) + { + LOGGER_WRITE_1( "PutFileObjectInitL failed - returning error in next PutPacketIndication : %d", ret ); + iPutError = ret; + } + iPutPacketIndicationCalled = EFalse; + + if ( !iShutdownWatcher ) + { + TRAP( err, iShutdownWatcher = CShutdownWatcher::NewL( this ) ); + if ( err == KErrNone ) + { + iShutdownWatcher->StartShutdownWatcher(); + } + else + { + LOGGER_WRITE_1( "CShutdownWatcher::NewL leaves: %d", err ); + } + } + + if ( iLinkAdapter.IsOpen() ) + { + // request active BT mode (high power mode) + err = iLinkAdapter.ActivateActiveRequester(); + LOGGER_WRITE_1( "iLinkAdapter.ActivateActiveRequester() err: %d", err ); + } + + TRACE_FUNC_EXIT; + return( iObject ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::PutPacketIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::PutPacketIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + + TBool catalogsMime( EFalse ); + if ( iObject->Type().Length() > KSConHeaderMaxLength ) + { + LOGGER_WRITE("TypeHeader too big, return KErrNotSupported"); + return TPCConnpluginUtils::ConvertFTPResponseCode( KErrNotSupported ); + } + TBuf8 typeHeader( iObject->Type() ); + TrimRightSpaceAndNull( typeHeader ); + + if ( iCatalogsConnected && IsCatalogsMimeType( TDataType( typeHeader ) ) ) + { + catalogsMime = ETrue; + } + + if ( (TInt)iObject->Length() > 0 + && typeHeader != KSConPCDWBXMLObjectType + && typeHeader != KSConPCDWBXMLObjectType2 + && !catalogsMime + && typeHeader != KSConPCDObjectType ) + { + // normal file transfer + if ( !iPutPacketIndicationCalled ) + { + // This is first check, need to check only once + + TFileName path; + iFTPHandler->GetPath( path ); + if ( path.CompareF( K_C_ROOT ) == 0 ) + { + // path forbidden + ret = KErrAccessDenied; + } + else + { + if ( iPutError != KErrNone ) + { + ret = iPutError; + LOGGER_WRITE_1( "CSConPCConnplugin::PutPacketIndication() : PutError : %d", iPutError ); + } + else + { + // check required free space + // if filesize is small ( <65k ) it fits into one package and its already saved to filesystem. + // if file is larger, need to check is there enought free space in device. + + const TUint32 filesize = iObject->Length(); + LOGGER_WRITE_1( "CSConPCConnplugin::PutPacketIndication() filesize %d", filesize ); + LOGGER_WRITE_1( "CSConPCConnplugin::PutPacketIndication() iObject->BytesReceived() %d", iObject->BytesReceived() ); + if ( filesize > iObject->BytesReceived() ) + { + LOGGER_WRITE( "CSConPCConnplugin::PutPacketIndication() : check freespace" ); + // file does not fit into one obex packet, check is there enought free space in current drive + if ( iFTPHandler->IsCurrentDiskSpaceBelowCritical( filesize ) ) + { + LOGGER_WRITE( "CSConPCConnplugin::PutPacketIndication() : returning KErrNoMemory" ); + ret = KErrNoMemory; + } + } + } + } + } + + if ( iShutdownInProgress ) + { + LOGGER_WRITE( "ShutdownInProgress, abort" ); + ret = KErrDisconnected; + } + } + + if ( !iPutPacketIndicationCalled ) + { + // Need to check only once + iPutPacketIndicationCalled = ETrue; + + //Check if filename is too long. + TFileName path; + iFTPHandler->GetPath( path ); + if ( ret == KErrNone && path.Length() + iObject->Name().Length() > KMaxFileName ) + { + LOGGER_WRITE_1( "Name length overflow! : %d", path.Length() + iObject->Name().Length() ); + ret = KErrBadName; + } + } + + if ( ret != KErrNone ) + { + if ( iFTPHandler ) + { + iFTPHandler->AbortFileTransfer( iObject ); + } + + delete iObject; + iObject = NULL; + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + } + + LOGGER_WRITE_1( "CSConPCConnplugin::PutPacketIndication(): ret %d", ret ); + return TPCConnpluginUtils::ConvertFTPResponseCode( ret ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::PutCompleteIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::PutCompleteIndication() + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err2 = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err2 ); + } + + if ( iObject->Type().Length() > KSConHeaderMaxLength ) + { + LOGGER_WRITE("TypeHeader too big, return KErrNotSupported"); + delete iObject; + iObject = NULL; + + iFTPHandler->DeleteTempFile(); + return TPCConnpluginUtils::ConvertPCDResponseCode( KErrNotSupported ); + } + if ( iObject->Name().Length() > KSConHeaderMaxLength ) + { + LOGGER_WRITE("NameHeader too big, return KErrNotSupported"); + delete iObject; + iObject = NULL; + + iFTPHandler->DeleteTempFile(); + return TPCConnpluginUtils::ConvertPCDResponseCode( KErrNotSupported ); + } + + // check if ConML signal is received + TBuf8 typeHeader( iObject->Type() ); + TBuf nameHeader( iObject->Name() ); + TrimRightSpaceAndNull( typeHeader ); + LOGGER_WRITE8_1("type: %S", &typeHeader); + LOGGER_WRITE_1("name: %S", &nameHeader); + LOGGER_WRITE_1("description: %S", &iObject->Description()); + TInt size = iObject->BytesReceived(); + TTime time = iObject->Time(); + + // shutdownWatcher is not needed anymore + delete iShutdownWatcher; + iShutdownWatcher = NULL; + + if ( IsCatalogsMimeType( TDataType( typeHeader ) ) ) + { + if ( iCatalogsConnected ) + { + LOGGER_WRITE( "iCatalogs->PutDataL" ); + TRAP( err, iCatalogs->PutDataL( typeHeader, *iBuffer ) ); + LOGGER_WRITE_1( "iCatalogs->PutDataL : %d", err ); + if ( err == KErrServerTerminated ) + { + err = iCatalogs->Connect(); + LOGGER_WRITE_1( "CSConPCConnplugin::PutCompleteIndication() iCatalogs->Connect() err: %d", err ); + if ( err == KErrNone ) + { + LOGGER_WRITE( "iCatalogs->PutDataL" ); + TRAP( err, iCatalogs->PutDataL( typeHeader, *iBuffer ) ); + LOGGER_WRITE_1( "iCatalogs->PutDataL : %d", err ); + } + } + } + else + { + LOGGER_WRITE( "Catalogs mime type recognised - failing due no connection" ); + err = KErrNotSupported; + } + + delete iObject; + iObject = NULL; + + iFTPHandler->DeleteTempFile(); + return TPCConnpluginUtils::ConvertPCDResponseCode( err ); + } + + if ( typeHeader == KSConPCDObjectType ) + { + LOGGER_WRITE( "CSConPCConnplugin::PutCompleteIndication KSConPCDObjectType" ); + err = HandlePCDObjectPut( iObject->Description(), iObject->Name() ); + delete iObject; + iObject = NULL; + + iFTPHandler->DeleteTempFile(); + LOGGER_WRITE_1( "CSConPCConnplugin::PutCompleteIndication() end, err: %d", err ); + return TPCConnpluginUtils::ConvertObexMoveResponseCode( err ); + } + + if ( typeHeader != KSConPCDWBXMLObjectType && + typeHeader != KSConPCDWBXMLObjectType2 ) + { + TObexHeaderMask validHdrs = iObject->ValidHeaders(); + if ( ( validHdrs & KObexHdrBody ) || ( validHdrs & KObexHdrEndOfBody ) ) + { + LOGGER_WRITE( "CSConPCConnplugin::PutCompleteIndication() normal filetransfer" ); + LOGGER_WRITE_1( "Number of received bytes : %d", size ); + TSConUsedMedia media( ESConNoMedia ); + + switch( iMediaType ) + { + case ESrcsMediaBT : + media = ESConBTMedia; + break; + case ESrcsMediaIrDA : + media = ESConIRMedia; + break; + case ESrcsMediaUSB : + media = ESConUSBMedia; + break; + default : + media = ESConNoMedia; + break; + } + + iFTPHandler->SetUsedMedia( media ); + + TRAP( ret, err = iFTPHandler->PutFileObjectFinalizeL( iObject ) ); + LOGGER_WRITE_1( "PutFileObjectL() returned : %d", ret ); + } + else + { + LOGGER_WRITE( "Delete starts" ); + TRAP( ret, err = iFTPHandler->DeleteObjectL( iObject->Name() ) ); + LOGGER_WRITE_1( "DeleteObjectL() returned : %d", ret ); + } + } + + delete iObject; + iObject = NULL; + + if ( typeHeader == KSConPCDWBXMLObjectType || + typeHeader == KSConPCDWBXMLObjectType2 ) + { + LOGGER_WRITE( "CSConPCConnplugin::PutCompleteIndication() ReadWBXMLDataL" ); + TRAP( ret, err = iFTPHandler->ReadWBXMLDataL( iBuffer ) ); + + if ( err == KErrNone && ret == KErrNone ) + { + TRAP( ret, err = iPCConnSession.PutPacketL( nameHeader, + typeHeader, iBuffer ) ); + LOGGER_WRITE_1( "iPCConnSession.PutPacketL() leaveCode : %d", ret ); + LOGGER_WRITE_1( "iPCConnSession.PutPacketL() returned : %d", err ); + } + + iFTPHandler->DeleteTempFile(); + + return TPCConnpluginUtils::ConvertPCDResponseCode( err ); + } + + iFTPHandler->DeleteTempFile(); + + TRACE_FUNC_EXIT; + if ( ret != KErrNone ) + { + return TPCConnpluginUtils::ConvertFTPResponseCode( ret ); + } + return TPCConnpluginUtils::ConvertFTPResponseCode( err ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::GetRequestIndication( CObexBaseObject* aRequiredObject ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +CObexBufObject* CSConPCConnplugin::GetRequestIndication( CObexBaseObject* + aRequiredObject ) + { + TRACE_FUNC_ENTRY; + CObexBufObject* bufObject(NULL); + if ( aRequiredObject->Type().Length() > KSConHeaderMaxLength ) + { + LOGGER_WRITE("TypeHeader too big"); + return NULL; + } + if ( aRequiredObject->Name().Length() > KMaxFileName ) + { + LOGGER_WRITE("NameHeader is too long"); + return NULL; + } + TInt ret( KErrNone ); + TInt err( KErrNone ); + TBuf8 typeHeader( aRequiredObject->Type() ); + TrimRightSpaceAndNull( typeHeader ); + LOGGER_WRITE8_1("type: %S", &typeHeader); + LOGGER_WRITE_1("name: %S", &aRequiredObject->Name()); + + iBuffer->Reset(); + + delete iObject; + iObject = NULL; + + TRAP( err, iObject = CObexBufObject::NewL ( iBuffer ) ); + if ( err != KErrNone ) + { + return NULL; + } + + // Client requests folder listing + if ( typeHeader == KSConFolderListType ) + { + LOGGER_WRITE( "Client requests folder listning" ); + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return NULL; + } + + TRAP( err, ret = iFTPHandler->GetFolderObjectL( iObject ) ); + LOGGER_WRITE_1( "iFTPHandler->GetFolderObjectL() returned: %d", ret ); + if ( err == KErrNone && ret == KErrNone ) + { + bufObject = iObject; + } + else + { + return NULL; + } + } + // Client requests capability object or ConML packet + else if ( typeHeader == KSConCapabilityObjectType + || typeHeader == KSConPCDWBXMLObjectType + || typeHeader == KSConPCDWBXMLObjectType2) + { + LOGGER_WRITE( "Client requests capability object or ConML packet" ); + // HandleGetPCConnObjectL will set some data to iObject, or leaves if error occurs + TRAP( err, HandleGetPCConnObjectL( aRequiredObject->Name(), typeHeader ) ); + + if ( err == KErrNone ) + { + bufObject = iObject; + } + else + { + LOGGER_WRITE_1("Get PCConn object failed, err: %d", err); + return NULL; + } + } + // Client requests file conversion + else if ( typeHeader == KSConPCDObjectType ) + { + LOGGER_WRITE("request of KSConPCDObjectType is not supported.") + return NULL; + } + // catalogs + else if ( IsCatalogsMimeType( TDataType( typeHeader ) ) ) + { + TRAP( err, HandleGetCatalogsObjectL( typeHeader ) ); + if ( err == KErrNone ) + { + bufObject = iObject; + } + else + { + LOGGER_WRITE_1("Get catalogs object failed, err: %d", err); + return NULL; + } + } + // Client requests file + else + { + LOGGER_WRITE( "Client requests file" ); + TRAP( err, HandleGetFileObjectL( aRequiredObject->Name() ) ); + if ( err == KErrNone ) + { + bufObject = (CObexBufObject*)iFileObject; + } + else + { + LOGGER_WRITE_1("Get file object failed, err: %d", err); + return NULL; + } + } + if ( bufObject && iLinkAdapter.IsOpen() ) + { + // request active BT mode (high power mode) + err = iLinkAdapter.ActivateActiveRequester(); + LOGGER_WRITE_1( "iLinkAdapter.ActivateActiveRequester() err: %d", err ); + } + return bufObject; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::GetPacketIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::GetPacketIndication() + { + TRACE_FUNC; + return KErrNone; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::GetCompleteIndication() +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::GetCompleteIndication() + { + TRACE_FUNC_ENTRY; + if ( iLinkAdapter.IsOpen() ) + { + // Cancel ActivateActiveRequester & allow going to low power mode + TInt err = iLinkAdapter.CancelLowPowerModeRequester(); + LOGGER_WRITE_1( "iLinkAdapter.CancelLowPowerModeRequester() err: %d", err ); + } + + TInt ret( KErrNone ); + if ( iFileObject ) + { + iFileObject->Reset(); + delete iFileObject; + iFileObject = NULL; + } + + LOGGER_WRITE_1( "CSConPCConnplugin::GetCompleteIndication() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::SetPathIndication( const CObex::TSetPathInfo& aPathInfo, +// const TDesC8& aInfo ) +// MObexServerNotify implementation +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::SetPathIndication( const CObex::TSetPathInfo& aPathInfo, + const TDesC8& /*aInfo*/ ) + { + TRACE_FUNC_ENTRY; + TInt ret( KErrNone ); + TInt err( KErrNone ); + + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + return TPCConnpluginUtils::ConvertFTPResponseCode( KErrNoMemory ); + } + + if ( aPathInfo.iFlags == KSConNULLSetPath ) + { + TRAP( err, ret = this->iFTPHandler->CreateFolderL( aPathInfo.iName ) ); + } + else + { + TRAP( err, ret = this->iFTPHandler->SetPathL( aPathInfo.iName, + aPathInfo.iFlags ) ); + } + + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "CSConPCConnplugin::SetPathIndication : returned %d", err ); + return TPCConnpluginUtils::ConvertFTPResponseCode( err ); + } + LOGGER_WRITE_1( "CSConPCConnplugin::SetPathIndication : returned %d", ret ); + return TPCConnpluginUtils::ConvertFTPResponseCode( ret ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::TrimRightSpaceAndNull( TDes8& aDes ) const +// Removes spaces and nulls from the end of the string +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::TrimRightSpaceAndNull( TDes8& aDes ) const + { + TRACE_FUNC; + aDes.TrimRight(); + if ( aDes.Length() > 0 ) + { + if ( !aDes[aDes.Length() - 1] ) + { + aDes.SetLength( aDes.Length() - 1 ); + } + } + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::SetMediaType( TSrcsMediaType aMediaType ) +// Current used transfer media (IR,USB,BT) +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::SetMediaType( TSrcsMediaType aMediaType ) + { + TRACE_FUNC; + iMediaType = aMediaType; + } +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::TBool IsCatalogsMimeType( TDataType aMime ) +// Checks if mime type belogs to Catalogs +// ----------------------------------------------------------------------------- +// +TBool CSConPCConnplugin::IsCatalogsMimeType( TDataType aMime ) + { + TRACE_FUNC_ENTRY; + TBool result = EFalse; + + if ( !iCatalogsConnected + && aMime.Des8() != KSConPCDObjectType + && aMime.Des8() != KSConPCDXMLObjectType + && aMime.Des8() != KSConPCDWBXMLObjectType + && aMime.Des8() != KSConPCDXMLObjectType2 + && aMime.Des8() != KSConPCDWBXMLObjectType2 + ) + { + // Catalogs never connected and not secon mime type + // Try to connect to catalogs to get catalogstypes + TInt catalogsErr = iCatalogs->Connect(); + LOGGER_WRITE_1( "CSConPCConnplugin::IsCatalogsMimeType() iCatalogs->Connect() err: %d", catalogsErr ); + if ( catalogsErr == KErrNone ) + { + LOGGER_WRITE( "CSConPCConnplugin::IsCatalogsMimeType() iCatalogs->Connect() success" ); + iCatalogsConnected = ETrue; + TRAPD( ret, iMimeArray = iCatalogs->SupportedMimeTypesL() ); + if ( ret == KErrNone ) + { + LOGGER_WRITE_1( "iCatalogs->SupportedMimeTypesL count: %d", iMimeArray.Count() ); + iCatalogsMimeTypesExist = ETrue; + } + } + } + + if ( iCatalogsMimeTypesExist ) + { + // Compare to supported values + for ( TInt j = 0; j < iMimeArray.Count(); j++ ) + { + if ( (*iMimeArray[j]) == aMime ) + { + LOGGER_WRITE( "CSConPCConnplugin::IsCatalogsMimeTypeL returns TRUE" ); + result = ETrue; + break; + } + } + } + TRACE_FUNC_EXIT; + return result; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::CSConPCConnplugin() +// Default constructor +// ----------------------------------------------------------------------------- +// +CSConPCConnplugin::CSConPCConnplugin() + { + TRACE_FUNC; + iBuffer = NULL; + iObject = NULL; + iFileObject = NULL; + iSessionActive = EFalse; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::ConstructL() + { + TRACE_FUNC_ENTRY; + iBuffer = CBufFlat::NewL( KSConBufSize ); + iObject = CObexBufObject::NewL ( iBuffer ); + iServiceTimer = new (ELeave) CSConServiceTimer( this, KSConTimeOutValue ); + iServiceTimer->ConstructL(); + CActiveScheduler::Add( iServiceTimer ); + + // catalogs + iCatalogs = CCatalogsPCConnectivityPlugin::NewL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::SetObexServer( CObexServer* aObexServer ) +// SetObexServer +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::SetObexServer( CObexServer* aObexServer ) + { + iObexServer = aObexServer; + TInt ret = iObexServer->Start(this); + LOGGER_WRITE_1( "CSConPCConnplugin::SetObexServer() ret: %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::HandlePCDObjectPut +// Handles PCD object. Used for advanced file handling. +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnplugin::HandlePCDObjectPut( const TDesC& aDescriptionHeader, + const TDesC& aNameHeader ) + { + TRACE_FUNC_ENTRY; + TInt err( KErrNotSupported); + if ( aDescriptionHeader.Length() >= 3 ) + { + TInt commandTag = aDescriptionHeader[0]; + TInt commandID = aDescriptionHeader[1]; + TInt commandParam1 = aDescriptionHeader[2]; + + TPtrC destination; + if ( aDescriptionHeader.Length() >= 3 ) + { + destination.Set( aDescriptionHeader.Mid(3) ); + } + TPtrC source; + if ( aNameHeader.Length() >= 1 ) + { + // remove ":" character from beginning + source.Set( aNameHeader.Mid(1) ); + } + + if ( commandTag == KSCon_PCD_TAG ) + { + LOGGER_WRITE( "CSConPCConnplugin::HandlePCDObjectPut KSCon_PCD_TAG found" ); + switch (commandID) + { + case KSCon_PCD_CMD_COPY: + err = iFTPHandler->CopyFile( source, destination ); + break; + + case KSCon_PCD_CMD_MOVE_OR_RENAME: + err = iFTPHandler->MoveFile( source, destination ); + break; + + case KSCon_PCD_CMD_SET_PERMISSION: + if ( commandParam1 == KSCon_PCD_PAR_FULL_PERMISSION ) + { + err = iFTPHandler->SetReadOnly( source, EFalse ); + } + else if ( commandParam1 == KSCon_PCD_PAR_READ_ONLY_PERMISSION ) + { + err = iFTPHandler->SetReadOnly( source, ETrue ); + } + else + { + err = KErrNotSupported; + } + break; + + default: + LOGGER_WRITE( "CSConPCConnplugin::HandlePCDObjectPut unknown commandID" ); + err = KErrNotSupported; + break; + } + + } + + } + TRACE_FUNC_EXIT; + return err; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::HandleGetPCConnObjectL +// Get Capbility object or ConML message from PCConnServer +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::HandleGetPCConnObjectL( const TDesC& aNameHeader, + const TDesC8& aTypeHeader ) + { + TRACE_FUNC_ENTRY; + if ( !iPCConnSessionConnected ) + { + LOGGER_WRITE( "ERROR, iPCConnSession was not connected" ); + User::Leave( KErrNotReady ); + } + TInt err = iPCConnSession.GetPacketL( aNameHeader, aTypeHeader, iBuffer ); + LOGGER_WRITE_1( "iPCConnSession.GetPacketL() returned: %d", err ); + User::LeaveIfError( err ); + iObject->SetDataBufL( iBuffer ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::HandleGetCatalogsObjectL +// Get Catalogs object +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::HandleGetCatalogsObjectL( const TDesC8& aTypeHeader ) + { + TRACE_FUNC_ENTRY; + TInt err(KErrNone); + if ( !iCatalogsConnected ) + { + LOGGER_WRITE( "catalogs mime type recognised - failing due to no connection" ); + User::Leave( KErrNotReady ); + } + else + { + LOGGER_WRITE( "iCatalogs->GetDataL" ); + TDataType mime( aTypeHeader ); + TRAP( err, iCatalogs->GetDataL( mime, *iBuffer ) ); + LOGGER_WRITE_1( "iCatalogs->GetDataL : %d", err ); + if ( err == KErrServerTerminated ) + { + // server was terminated, try to reconnect + err = iCatalogs->Connect(); + LOGGER_WRITE_1( "iCatalogs->Connect() err: %d", err ); + User::LeaveIfError( err ); + LOGGER_WRITE( "iCatalogs->GetDataL" ); + iCatalogs->GetDataL( mime, *iBuffer ); + } + } + User::LeaveIfError( err ); + iObject->SetDataBufL( iBuffer ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnplugin::HandleGetFileObjectL +// Get file object +// ----------------------------------------------------------------------------- +// +void CSConPCConnplugin::HandleGetFileObjectL( const TDesC& aNameHeader ) + { + TRACE_FUNC_ENTRY; + delete iFileObject; + iFileObject = NULL; + iFileObject = CObexFileObject::NewL(); + + iFileObject->Reset(); + iFileObject->SetNameL( aNameHeader ); + + if ( !iFTPHandler ) + { + LOGGER_WRITE( "Creating iFTPHandler has failed" ); + User::Leave( KErrNotReady ); + } + + TInt err = iFTPHandler->GetFileObjectL( iFileObject ); + User::LeaveIfError( err ); + TRACE_FUNC_EXIT; + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/sconpcconnpluginutils.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/sconpcconnpluginutils.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,274 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in Utils implementation +* +*/ + + +// INCLUDE FILES +#include +#include "sconpcconnpluginutils.h" +#include "debug.h" + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// TPCConnpluginUtils::ConvertFTPResponseCode( TInt aError ) +// Converts Symbian error code to OBEX error code +// ----------------------------------------------------------------------------- +// +TInt TPCConnpluginUtils::ConvertFTPResponseCode( TInt aError ) + { + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertFTPResponseCode( TInt aError )\ + : begin, aError: %d", aError ); + TInt obexErr ( KErrIrObexRespBadRequest ); + switch( aError ) + { + case KErrNone: + obexErr = KErrNone; + break; + case KErrNotFound: + obexErr = KErrIrObexRespNotFound; + break; + case KErrGeneral: + case KErrCancel: + obexErr = KErrIrObexRespBadRequest; + break; + case KErrNoMemory: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrNotSupported: + obexErr = KErrIrObexRespNotImplemented; + break; + case KErrArgument: + case KErrTotalLossOfPrecision: + case KErrBadHandle: + case KErrOverflow: + case KErrUnderflow: + case KErrAlreadyExists: + obexErr = KErrIrObexRespConflict; + break; + case KErrPathNotFound: + case KErrDied: + obexErr = KErrIrObexRespNotFound; + break; + case KErrInUse: + obexErr = KErrIrObexRespTimedOut; + break; + case KErrServerTerminated: + obexErr = KErrIrObexRespNotFound; + break; + case KErrServerBusy: + case KErrCompletion: + case KErrNotReady: + case KErrUnknown: + case KErrCorrupt: + obexErr = KErrIrObexRespForbidden; + break; + case KErrAccessDenied: + case KErrLocked: + obexErr = KErrIrObexRespUnauthorized; + break; + case KErrWrite: + case KErrDisMounted: + case KErrEof: + obexErr = KErrIrObexRespForbidden; + break; + case KErrDiskFull: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrBadDriver: + case KErrBadName: + obexErr = KErrIrObexRespPreCondFailed; + break; + case KErrCommsLineFail: + case KErrCommsFrame: + case KErrCommsOverrun: + case KErrCommsParity: + case KErrTimedOut: + case KErrCouldNotConnect: + case KErrCouldNotDisconnect: + case KErrBadLibraryEntryPoint: + case KErrBadDescriptor: + case KErrAbort: + obexErr = KErrIrObexRespForbidden; + break; + case KErrTooBig: + obexErr = KErrIrObexRespReqEntityTooLarge; + break; + case KErrDivideByZero: + case KErrBadPower: + case KErrDirFull: + case KErrHardwareNotAvailable: + obexErr = KErrIrObexRespForbidden; + break; + case KErrDisconnected: // System is shutting down + obexErr = KErrIrObexRespMethodNotAllowed; + break; + default: + obexErr = KErrIrObexRespBadRequest; + break; + }; + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertFTPResponseCode( \ + TInt aError ) returned : %d", obexErr ); + return obexErr; +}; + +// ----------------------------------------------------------------------------- +// TPCConnpluginUtils::ConvertPCDResponseCode( TInt aError ) +// Converts Symbian error code to OBEX error code +// ----------------------------------------------------------------------------- +// +TInt TPCConnpluginUtils::ConvertPCDResponseCode( TInt aError ) + { + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertPCDResponseCode( TInt \ + aError ) : begin, aError: %d", aError ); + + TInt obexErr ( KErrIrObexRespInternalError ); + switch( aError ) + { + case KErrNone: + obexErr = KErrNone; + break; + case KErrNotFound: + obexErr = KErrIrObexRespNotFound; + break; + case KErrGeneral: + case KErrCancel: + obexErr = KErrIrObexRespInternalError; + break; + case KErrNoMemory: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrNotSupported: + obexErr = KErrIrObexRespUnsupMediaType; + break; + case KErrArgument: + case KErrTotalLossOfPrecision: + case KErrBadHandle: + case KErrOverflow: + case KErrUnderflow: + obexErr = KErrIrObexRespPreCondFailed; + break; + case KErrAlreadyExists: + obexErr = KErrIrObexRespConflict; + break; + case KErrPathNotFound: + case KErrDied: + case KErrInUse: + obexErr = KErrIrObexRespTimedOut; + break; + case KErrServerTerminated: + obexErr = KErrIrObexRespPreCondFailed; + break; + case KErrServerBusy: + obexErr = KErrIrObexRespConflict; + break; + case KErrCompletion: + case KErrNotReady: + case KErrUnknown: + case KErrCorrupt: + obexErr = KErrIrObexRespInternalError; + break; + case KErrAccessDenied: + case KErrLocked: + obexErr = KErrIrObexRespUnauthorized; + break; + case KErrWrite: + case KErrDisMounted: + case KErrEof: + obexErr = KErrIrObexRespInternalError; + break; + case KErrDiskFull: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrBadDriver: + case KErrBadName: + obexErr = KErrIrObexRespNotFound; + break; + case KErrCommsLineFail: + case KErrCommsFrame: + case KErrCommsOverrun: + case KErrCommsParity: + case KErrTimedOut: + case KErrCouldNotConnect: + case KErrCouldNotDisconnect: + case KErrBadLibraryEntryPoint: + case KErrBadDescriptor: + case KErrAbort: + case KErrTooBig: + case KErrDivideByZero: + case KErrBadPower: + case KErrDirFull: + case KErrHardwareNotAvailable: + obexErr = KErrIrObexRespInternalError; + break; + default: + obexErr = KErrIrObexRespInternalError; + break; + }; + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertPCDResponseCode(\ + TInt aError ) returned : %d", obexErr ); + return obexErr; +}; + +// ----------------------------------------------------------------------------- +// TPCConnpluginUtils::ConvertObexMoveResponseCode( TInt aError ) +// Converts Symbian error code to OBEX error code +// ----------------------------------------------------------------------------- +// +TInt TPCConnpluginUtils::ConvertObexMoveResponseCode( TInt aError ) + { + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertObexMoveResponseCode( TInt \ + aError ) : begin, aError: %d", aError ); + + TInt obexErr ( KErrIrObexRespInternalError ); + switch( aError ) + { + case KErrNone: + obexErr = KErrIrObexRespSuccess; + break; + case KErrNotFound: + case KErrPathNotFound: + obexErr = KErrIrObexRespNotFound; + break; + case KErrAccessDenied: + obexErr = KErrIrObexRespForbidden; + break; + case KErrNoMemory: + case KErrDiskFull: + obexErr = KErrIrObexRespDatabaseFull; + break; + case KErrInUse: + case KErrLocked: + obexErr = KErrIrObexRespConflict; + break; + case KErrNotSupported: + obexErr = KErrIrObexRespNotImplemented; + break; + case KErrAlreadyExists: + obexErr = KErrIrObexRespNotModified; + break; + + default: + obexErr = KErrIrObexRespInternalError; + break; + }; + LOGGER_WRITE_1( "TPCConnpluginUtils::ConvertObexMoveResponseCode(\ + TInt aError ) returned : %d", obexErr ); + return obexErr; +}; + +//End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/sconservicetimer.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/sconservicetimer.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,119 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Plug-in Service Timer implementation +* +*/ + + +// INCLUDE FILES + +#include "sconservicetimer.h" +#include "sconpcconnplugin.h" +#include "debug.h" + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::CSConServiceTimer( CSConPCConnplugin* aEngine, TInt aValue ) +// Constuctor +// ----------------------------------------------------------------------------- +// +CSConServiceTimer::CSConServiceTimer( CSConPCConnplugin* aEngine, TInt aValue ) + : CActive( EPriorityStandard ), iEngine( aEngine ), iValue( aValue ) {} + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::ConstructL() + { + LOGGER_ENTERFN( "CSConServiceTimer::ConstructL()" ); + // create a thread-relative timer + User::LeaveIfError( iTimer.CreateLocal() ); + LOGGER_LEAVEFN( "CSConServiceTimer::ConstructL()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::~CSConServiceTimer() +// Destructor +// ----------------------------------------------------------------------------- +// +CSConServiceTimer::~CSConServiceTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::~CSConServiceTimer()" ); + iTimer.Close(); + LOGGER_LEAVEFN( "CSConServiceTimer::~CSConServiceTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::~CSConServiceTimer() +// Starts the timer +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::StartTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::StartTimer()" ); + if( !IsActive() ) + { + LOGGER_WRITE( "CSConServiceTimer::StartTimer() : !IsActive()" ); + iTimer.After( iStatus, TTimeIntervalMicroSeconds32( iValue ) ); + iEngine->iSessionActive = ETrue; + SetActive(); + LOGGER_WRITE( "CSConServiceTimer::StartTimer() : SetActive()" ); + } + LOGGER_LEAVEFN( "CSConServiceTimer::StartTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::StopTimer() +// StopTimer() +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::StopTimer() + { + LOGGER_ENTERFN( "CSConServiceTimer::StopTimer()" ); + iEngine->iSessionActive = ETrue; + LOGGER_WRITE( "CSConServiceTimer::StopTimer() : iSessionActive = ETrue" ); + LOGGER_LEAVEFN( "CSConServiceTimer::StopTimer()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::DoCancel() +// Cancels the timer +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::DoCancel() + { + LOGGER_ENTERFN( "CSConServiceTimer::DoCancel()" ); + iTimer.Cancel(); + LOGGER_LEAVEFN( "CSConServiceTimer::DoCancel()" ); + } + +// ----------------------------------------------------------------------------- +// CSConServiceTimer::RunL() +// Executed when timer is triggered +// ----------------------------------------------------------------------------- +// +void CSConServiceTimer::RunL() + { + LOGGER_ENTERFN( "CSConServiceTimer::RunL()" ); + iEngine->iSessionActive = EFalse; + LOGGER_WRITE( "CSConServiceTimer::RunL() : iSessionActive = EFalse" ); + iEngine->iStartTimer = EFalse; + LOGGER_WRITE( "CSConServiceTimer::RunL() : iStartTimer = EFalse " ); + LOGGER_LEAVEFN( "CSConServiceTimer::RunL()" ); + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/plugins/pcconn/src/sconshutdownwatcher.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/plugins/pcconn/src/sconshutdownwatcher.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,153 @@ +/* +* Copyright (c) 2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Power shutdown -watcher implementation +* +*/ + + +// INCLUDE FILES + +#include "sconshutdownwatcher.h" +#include "debug.h" + +#include + + + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::NewL( MShutdownObserver* aObserver ) +// Two-phase constructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher* CShutdownWatcher::NewL( MShutdownObserver* aObserver ) + { + LOGGER_ENTERFN( "CShutdownWatcher::NewL()" ); + CShutdownWatcher* self = new (ELeave) CShutdownWatcher( aObserver ); + CleanupStack::PushL(self); + self->ConstructL(); + CleanupStack::Pop(self); + LOGGER_LEAVEFN( "CShutdownWatcher::NewL()" ); + return self; + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::~CShutdownWatcher() +// Destructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher::~CShutdownWatcher() + { + LOGGER_ENTERFN( "CShutdownWatcher::~CShutdownWatcher()" ); + Cancel(); + iProperty.Close(); + LOGGER_LEAVEFN( "CShutdownWatcher::~CShutdownWatcher()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::StartShutdownWatcher() +// Starts to watch shutdown status +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::StartShutdownWatcher() + { + LOGGER_ENTERFN( "CShutdownWatcher::StartShutdownWatcher()" ); + TInt status; + TInt err = iProperty.Get( KPSUidStartup, KPSGlobalSystemState, status ); + LOGGER_WRITE_2( "CShutdownWatcher::StartShutdownWatcher() :\ + err %d, KPSGlobalSystemState status %d",err, status); + if ( err == KErrNone ) + { + if ( status == ESwStateShuttingDown ) + { + LOGGER_WRITE( "Call NotifyShutdown" ); + iObserver->NotifyShutdown(); + return; + } + } + + err = iProperty.Attach( KPSUidStartup, KPSGlobalSystemState ); + LOGGER_WRITE_1( "CShutdownWatcher::StartShutdownWatcher() :\ + iProperty.Attach( KPSUidStartup, KPSGlobalSystemState ) : err %d", err ); + iProperty.Subscribe( iStatus ); + LOGGER_WRITE( "CShutdownWatcher::StartShutdownWatcher() :\ + iProperty.Subscribe( iStatus ) : ok" ); + SetActive(); + + LOGGER_LEAVEFN( "CShutdownWatcher::StartShutdownWatcher()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::DoCancel() +// Executed when CActive is canceled. +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::DoCancel() + { + LOGGER_ENTERFN( "CShutdownWatcher::DoCancel()" ); + iProperty.Cancel(); + LOGGER_LEAVEFN( "CShutdownWatcher::DoCancel()" ); + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::RunL() +// Executed when disk watcher is triggered +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::RunL() + { + LOGGER_ENTERFN( "CShutdownWatcher::RunL()" ); + TInt status; + iProperty.Get( status ); + LOGGER_WRITE_1( "CShutdownWatcher::RunL() : status %d", status ); + + if ( status == ESwStateShuttingDown ) + { + LOGGER_WRITE( "Call NotifyShutdown" ); + iObserver->NotifyShutdown(); + return; + } + + iProperty.Cancel(); + iProperty.Close(); + + LOGGER_LEAVEFN( "CShutdownWatcher::RunL()" ); + } + + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::CShutdownWatcher( MShutdownObserver* aObserver ) +// Default constructor +// ----------------------------------------------------------------------------- +// +CShutdownWatcher::CShutdownWatcher( MShutdownObserver* aObserver ) +: CActive(EPriorityStandard), + iObserver(aObserver) + { + } + +// ----------------------------------------------------------------------------- +// CShutdownWatcher::ConstructL() +// Initializes member data +// ----------------------------------------------------------------------------- +// +void CShutdownWatcher::ConstructL() + { + LOGGER_ENTERFN( "CShutdownWatcher::ConstructL()" ); + CActiveScheduler::Add(this); + LOGGER_LEAVEFN( "CShutdownWatcher::ConstructL()" ); + } + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/cntparser.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/cntparser.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,21 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for Contact Parser Client and Server. +* +*/ + + +file=ABI_DIR\BUILD_DIR\cntparserserverexe.exe PROGRAMS_DIR\cntparserserverexe.exe +file=ABI_DIR\BUILD_DIR\cntparserserver.dll SHARED_LIB_DIR\cntparserserver.dll + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconcsc.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconcsc.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,27 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for project SConCSC +* +*/ + + +#ifndef __SCONCSC_IBY__ +#define __SCONCSC_IBY__ +//file content + +file=ABI_DIR\BUILD_DIR\sconcsc.dll SHARED_LIB_DIR\sconcsc.dll +data=ZPRIVATE\101F99F6\capability\101F9698.xml PRIVATE\101F99F6\capability\101F9698.xml +data=ZPRIVATE\101F99F6\capability\fwdcomp.xml PRIVATE\101F99F6\capability\fwdcomp.xml +data=ZPRIVATE\101F99F6\capability\101F99F6.xml PRIVATE\101F99F6\capability\101F99F6.xml +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconftp.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconftp.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for CSConFTP +* +*/ + + +#ifndef __SCONFTP_IBY__ +#define __SCONFTP_IBY__ +//file content + +file=ABI_DIR\BUILD_DIR\sconftp.dll SHARED_LIB_DIR\sconftp.dll + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconftpplugin.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconftpplugin.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for FTPplugin +* +*/ + + +#ifndef __SCONFTP_PLUGIN_IBY__ +#define __SCONFTP_PLUGIN_IBY__ +//file content + +ECOM_PLUGIN(sconftpplugin.dll,101F9686.RSC) + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconftpresources.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconftpresources.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,23 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for SConFTP resources. +* +*/ + +#ifndef __SCONFTP_RESOURCE_IBY__ +#define __SCONFTP_RESOURCE_IBY__ + +data=DATAZ_\RESOURCE_FILES_DIR\sconftp.rsc RESOURCE_FILES_DIR\sconftp.rsc + +#endif \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconpcconnclientserver.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconpcconnclientserver.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,33 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for project PCCONNClientServer +* +*/ + + +#ifndef __SCONPCCONNCLIENTSERVER_IBY__ +#define __SCONPCCONNCLIENTSERVER_IBY__ +//file content + +file=ABI_DIR\BUILD_DIR\sconconmlhandler.dll SHARED_LIB_DIR\sconconmlhandler.dll + +file=ABI_DIR\BUILD_DIR\sconpcconnserver.exe PROGRAMS_DIR\sconpcconnserver.exe +file=ABI_DIR\BUILD_DIR\sconpcconnclient.dll SHARED_LIB_DIR\sconpcconnclient.dll + +// stub files +data=ZSYSTEM\install\secon_stub.sis system\install\secon_stub.sis +data=ZSYSTEM\install\sconpcconnplugin_stub.sis system\install\sconpcconnplugin_stub.sis +data=ZSYSTEM\install\sconftpplugin_stub.sis system\install\sconftpplugin_stub.sis + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconpcconnplugin.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconpcconnplugin.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for PC Connectivity Plug-in. +* +*/ +#ifndef __SCONPCCONN_PLUGIN_IBY__ +#define __SCONPCCONN_PLUGIN_IBY__ +//file content + +ECOM_PLUGIN(sconpcconnplugin.dll,101F9688.RSC) + +file=ABI_DIR\BUILD_DIR\catalogspcconnectivityplugin.dll SHARED_LIB_DIR\catalogspcconnectivityplugin.dll + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/rom/sconpcd.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/rom/sconpcd.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,25 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Image description file for SConPCD. +* +*/ +#ifndef __SCONPCD_IBY__ +#define __SCONPCD_IBY__ +//file content + +file=ABI_DIR\BUILD_DIR\sconpcd.dll system\libs\sconpcd.dll + +data=ZPRIVATE\10202D56\sbeconfig.xml PRIVATE\10202D56\sbeconfig.xml + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,26 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Build information file for project PCConnServer +* +*/ + + +PRJ_EXPORTS + + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +sconpcconnserver.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/bld/sconpcconnserver.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/bld/sconpcconnserver.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,77 @@ +/* +* Copyright (c) 2005-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity Server +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_SERVER TrustedUI + +TARGET sconpcconnserver.exe +TARGETTYPE exe + +EPOCSTACKSIZE 0x10000 +EPOCHEAPSIZE 0x10000 0x1000000 // heap memory 16MB + +UID 0 0x101F99F6 + +// Server +SOURCEPATH ../src +SOURCE sconpcconnserver.cpp +SOURCE sconimsireader.cpp +SOURCE sconfolderlister.cpp +SOURCE sconbtengine.cpp + +// ConML +SOURCEPATH ../../../wbxml/conmlhandler/src +SOURCE sconconmldtd.cpp +SOURCE sconxmlelement.cpp + +SOURCEPATH ../../../common/conmltask/src +SOURCE sconconmltask.cpp + +USERINCLUDE ../inc +USERINCLUDE ../../../inc +USERINCLUDE ../../../common/conmltask/inc +USERINCLUDE ../../../services/pcd/inc +USERINCLUDE ../../../services/csc/inc +USERINCLUDE ../../../services/oviaccounthandler/inc +USERINCLUDE ../../../wbxml/conmlhandler/inc + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +LIBRARY euser.lib +LIBRARY estor.lib // RMemWriteStream, RMemReadStream +LIBRARY efsrv.lib // Rfs, RFile +LIBRARY charconv.lib // For Unicode conversion +LIBRARY etel3rdparty.lib +LIBRARY platformenv.lib // For pathinfo +LIBRARY directorylocalizer.lib // For localizing directories +LIBRARY centralrepository.lib +LIBRARY commonengine.lib // For resource reader +LIBRARY bafl.lib // Basic Application Framework Library +LIBRARY btengdevman.lib +LIBRARY btmanclient.lib +LIBRARY btdevice.lib +LIBRARY bluetooth.lib +LIBRARY btengsettings.lib +DEBUGLIBRARY flogger.lib + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/inc/sconbtengine.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/inc/sconbtengine.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,82 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconBtEngine declaration +* +*/ + + + +#ifndef SCONBTENGINE_H_ +#define SCONBTENGINE_H_ + +#include +#include +#include +#include +#include + +const TInt KCenRepAddrBufSize = 2 * KBTDevAddrSize; + +class CSconBtEngine : public CBase, + public MBTEngDevManObserver, + public MBTEngSettingsObserver + { +public: + static CSconBtEngine* NewL(); + ~CSconBtEngine(); + + void ReadBTInfoL( RBufWriteStream& aStream ); + + void SetBtAuthorizedL( const TDesC& aBtDevAddress, TBool aAuthorized ); + + TInt SetBtPowerState( TBool aPower ); + + TInt SetBtName( const TDesC& aBtName ); + +protected: + // From MBTEngDevManObserver + void HandleDevManComplete( TInt aErr ); + void HandleGetDevicesComplete( TInt aErr, + CBTDeviceArray* aDeviceArray ); + + // From MBTEngSettingsObserver + void PowerStateChanged( TBTPowerStateValue aState ); + void VisibilityModeChanged( TBTVisibilityMode aState ); + +private: + CSconBtEngine(); + void ConstructL(); + + void PrintDevicesL(); + +private: + enum TState + { + EIdle, + ERequestBtInfo, + EChangeBtState, + EChangeAuthorized + }; + TState iState; + TInt iOperationError; + CActiveSchedulerWait iWait; + RBufWriteStream* iStream; + CBTEngDevMan* iBtEng; + CBTDeviceArray* iBtDevArray; + CBTEngSettings* iBtSettings; + TBool iAuthorizedValue; + TBuf iBtAddress; + }; + +#endif /* SCONBTENGINE_H_ */ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/inc/sconfolderlister.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/inc/sconfolderlister.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,136 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconFolderLister declaration +* +*/ + + +#ifndef CSCONFOLDERLISTER_H +#define CSCONFOLDERLISTER_H + +// INCLUDES +#include +#include +#include // For RMemReadStream +#include +// CLASS DECLARATION + +class TSconDriveInfoEntry + { +public: + TUint8 iDriveType; + TUint8 iDriveTypeCount; + TInt64 iSize; + TInt64 iFree; + }; + +class TSconDriveInfo : public TSconDriveInfoEntry + { +public: + TUint iDriveStatus; + TBuf16<2> iDriveLetter; + TUint iDriveAttr; + TBufC iVolumeName; + }; + + +class CSconFolderEntry : public CBase + { +public: + static CSconFolderEntry* NewLC(); + static CSconFolderEntry* NewLC( const TEntry& aEntry ); + ~CSconFolderEntry(); +private: + CSconFolderEntry(); + void ConstructL( const TEntry& aEntry ); + +public: + TUint iAtt; + TTime iModified; + HBufC *iName; + HBufC *iLabel; + TBool iDriveInfoEntryExists; + TSconDriveInfoEntry iDriveInfoEntry; + }; + + +class CDirectoryLocalizer; + +/** + * CSconFolderLister + * + */ +class CSconFolderLister : public CBase + { +public: + // Constructors and destructor + + /** + * Destructor. + */ + ~CSconFolderLister(); + + /** + * Two-phased constructor. + */ + static CSconFolderLister* NewL( RFs& aFs ); + + /** + * + * @param aStream + * @param aStartPath + * @param aLevelsToSearch -1 = Search all levels, 0 = Search only current level, 1..N Search N levels + */ + void GenerateFolderListL( RBufWriteStream& aStream, const TDesC& aStartPath, const TInt aLevelsToSearch ); + +private: + + void ListAllDrivesL( RBufWriteStream& aStream, const TInt aLevelsToSearch ); + void ListDriveAndPathL( RBufWriteStream& aStream, TInt aDrive, const TDesC& aStartPath, const TInt aLevelsToSearch ); + + void ExportDriveL( RBufWriteStream& aStream, const TSconDriveInfo& aDriveInfo, + const TDesC& aPathName, const TInt aLevelsToSearch ); + + /** + * + * @param aStream + * @param aPathName + */ + void ExportPathL( RBufWriteStream& aStream, const TDesC& aPathName, + const CSconFolderEntry& aEntry, const TBool aLocalize, const TInt aLevelsToSearch ); + + void GetDriveTypeNumberL( TInt aDrive , TUint driveStatus, TInt& aTypeNumber); + + /** + * Constructor for performing 1st stage construction + */ + CSconFolderLister( RFs& aFs ); + + /** + * EPOC default constructor for performing 2nd stage construction + */ + void ConstructL(); + + TBool IsDirectoryPrintable( const TDesC& aParentPath, const TEntry& aFolderEntry ); + + void GetLocalizedVolumeNameL( CSconFolderEntry& aDriveEntry ); +private: + RFs& iFs; + TInt iFolders; + TInt iFiles; + TInt iCriticalLevel; + CDirectoryLocalizer* iLocalizer; + }; + +#endif // CSCONFOLDERLISTER_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/inc/sconimsireader.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/inc/sconimsireader.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,65 @@ +/* +* Copyright (c) 2009-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Imsi reader +* +*/ + + +#ifndef __SCONIMSIREADER_H__ +#define __SCONIMSIREADER_H__ + +#include +#include + +enum TImsiReaderStatus + { + EIdle, + ERequestingImsi, + ERequestingNetworkStatus + }; + +class CSconImsiReader : public CActive + { + public: + + static TInt GetImsiL( TDes& aImsi ); + + static TInt GetNetworkStatusL( CTelephony::TRegistrationStatus& aRegistrationStatus ); + + private: + CSconImsiReader( TDes& aImsi, CTelephony::TRegistrationStatus& aRegistrationStatus ); + void ConstructL(); + ~CSconImsiReader(); + + void RequestImsi(); + void RequestNetworkStatus(); + + private: // From CActive + + void RunL(); + void DoCancel(); + + private: // data + TDes& iImsi; + CTelephony::TRegistrationStatus& iNetworkStatus; + CTelephony* iTelephony; + CTelephony::TSubscriberIdV1 iSubscriberIdV1; + CTelephony::TSubscriberIdV1Pckg iSubscriberIdV1Pckg; + + CTelephony::TNetworkRegistrationV1 iNetworkRegistrationV1; + CTelephony::TNetworkRegistrationV1Pckg iNetworkRegistrationV1Pckg; + TImsiReaderStatus iImsiReaderStatus; + }; + +#endif // __SCONIMSIREADER_H__ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/inc/sconpcconnclientserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/inc/sconpcconnclientserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,70 @@ +/* +* Copyright (c) 2005-2006 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity server client +* +*/ + + + + +#ifndef __SCONPCCONNCLIENTSERVER_H__ +#define __SCONPCCONNCLIENTSERVER_H__ + +#include + +// for debugging ConML messages and capability objects +//#define DEBUG_XML + + +// reasons for server panic +enum TPCConnServPanic + { + E_BadRequest = 1, + E_DispatchRequest, + E_InvalidClient, + E_CleanupCreate, + E_MainSchedulerError + }; + + +// server related constants +_LIT( KSConPCConnServerName,"SConPCConnServer" ); +_LIT( KSConPCConnServerExe, "SConPCConnServer.exe" ); + +// client +_LIT( KSConPCConnClientDll, "SConPCConnClient.dll" ); + + +// Chunk +const TUint KSConPCConnChunkSize = 128; +const TUint KSConPCConnChunkMaxSize = 65536; +const TUint KSConPCConnBufferMaxSize = 65000; + +// Version number +const TUint KSConPCConnServerVersionMajor = 1; +const TUint KSConPCConnServerVersionMinor = 0; +const TUint KSConPCConnServerVersionBuild = 1; + + +// Function codes + +enum TRequest +{ + EPutMessage, + EGetMessage, + EResetMessage, + EChunkMessage +}; + +#endif // __SCONPCCONNCLIENTSERVER_H__ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/inc/sconpcconnserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/inc/sconpcconnserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,247 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity server +* +*/ + + +#ifndef __SCONPCCONNSERVER_H__ +#define __SCONPCCONNSERVER_H__ + +#include "sconconmlhandler.h" +#include "sconconmltask.h" + + +class CSConPCD; +class CSConCSC; +class CSConConMLParser; + +const TUint KSConDefaultHeapSize=0x10000; +const TInt KSConFirstDrive = 65; + +_LIT8 ( KParamNameSilent, "Silent" ); + + +// PCD Handler Dll +_LIT(KSConPCDLibName, "sconpcd.dll"); +const TInt KSConPCDUidValue = 0x10009D8D; +const TUid KSConPCDUid = {KSConPCDUidValue}; + +// CSC Handler Dll +_LIT(KSConCSCLibName, "sconcsc.dll"); +const TInt KSConCSCUidValue = 0x10009D8D; +const TUid KSConCSCUid = {KSConCSCUidValue}; + +// ConML Handler Dll +_LIT (KSConConMLHandlerLibName, "sconconmlhandler.dll"); +const TInt KSConConMLHandlerUidValue = 0x10009D8D; +const TUid KSConConMLHandlerUid = {KSConConMLHandlerUidValue}; + +// debug file for put and get messages +_LIT ( KSConConMLDebugFile, "c:\\data\\handler_result.txt"); + +// Secure ids +_LIT_SECURE_ID(KSConPCConnClientSecureId,0x101F7C87); + +// PCD types +_LIT8( KSConPCDXMLObjectType, "application/vnd.nokia.conml+xml" ); +_LIT8( KSConPCDXMLObjectType2, "application/vnd.nokia.pcd+xml" ); +_LIT8( KSConPCDWBXMLObjectType, "application/vnd.nokia.conml+wbxml" ); +_LIT8( KSConPCDWBXMLObjectType2, "application/vnd.nokia.pcd+wbxml" ); + +// CSC types +_LIT8( KSConCapabilityObjectType, "x-obex/capability" ); + +// Drives +_LIT( KSConNoDrive, "\x0" ); +_LIT( KSConDriveExists, "\x1" ); + +// user permissions +_LIT8( KSConPermReadOnly, "R" ); +_LIT8( KSConPermNormal, "RW" ); +// Java hash id for ConML +_LIT8( KSConJavaHashId, "JAVA_"); + +_LIT8( KSConAppInfoSeparator, "#" ); + +//********************************** +//CSConPCConnServer - PC Connectivity Server +//********************************** + +class CSConPCConnServer : public CServer2 + { +public: + // From CServer2 + IMPORT_C static CSConPCConnServer* NewLC(); + IMPORT_C ~CSConPCConnServer(); + + /** + * Function to start the server + * @param none + * @return Error code + */ + static TInt RunServer(); + + /** + * Function to start the server + * @param none + * @return none + */ + static void RunServerL(); + + /** + * Increments session count. + * @param none + * @return none + */ + void IncSessionCount(); + + /** + * Decrements session count. + * When count reaches zero, stops active scheduler + * @param none + * @return none + */ + void DecSessionCount(); + + +protected: + virtual CSession2* NewSessionL( const TVersion &aVersion, + const RMessage2& aMessage) const; + +private: + CSConPCConnServer(); + + TInt iSessionCount; + + }; + + +class CSconFolderLister; +class CSconBtEngine; + +//********************************** +//CSConPCConnSession - Server session class, handles the requested operations +//********************************** +class CSConPCConnSession : public CSession2, public MWBXMLConMLCallback + { + +public: + static CSConPCConnSession* NewL(CSConPCConnServer& aServer); + + /** + * From CSession2 + */ + void ServiceL( const RMessage2 &aMessage); + +private: + void DispatchRequestL( const RMessage2 &aMessage); + void LoadPCDDllL(); + void LoadCSCDllL(); + void LoadConMLHandlerDllL(); + +protected: + // Callback funktion for WBXML parsing + void ConMLL ( ConML_ConMLPtr_t aContent ); + +private: + void ConstructL(); + CSConPCConnSession ( CSConPCConnServer& aServer); + ~CSConPCConnSession(); + + TInt HandlePutMessageL(); + TInt HandleGetMessageL(); + TInt HandleWBXMLGetRequestL( const TDesC& aFileName ); + TInt HandleResetMessage(); + TInt HandleChunkMessage( const RMessage2& aMessage ); + TInt OptionsFromExecuteL ( ConML_ExecutePtr_t aContent ); + TInt TaskCancelL(ConML_CancelPtr_t aContent); + TInt TaskGetStatusL(ConML_GetStatusPtr_t aContent ); + TInt TaskInstallL( ConML_InstallPtr_t aContent ); + TInt TaskUnInstallL( ConML_UnInstallPtr_t aContent ); + void SplitL( const TDesC8& aText, const TChar aSeparator, RArray& aArray ); + TInt TaskListInstalledAppsL( ConML_ListInstalledAppsPtr_t aContent ); + TInt TaskListDataOwnersL(); + TInt TaskSetBURModeL( ConML_SetBURModePtr_t aContent ); + TInt TaskGetDataSizeL( ConML_GetDataSizePtr_t aContent ); + TInt TaskRequestDataL( ConML_RequestDataPtr_t aContent ); + TInt TaskUpdateDeviceInfoL( ConML_UpdateDeviceInfoPtr_t aContent ); + TInt TaskListPublicFilesL( ConML_ListPublicFilesPtr_t aContent ); + TInt TaskGetDataOwnerStatusL( ConML_GetDataOwnerStatusPtr_t aContent ); + TInt TaskSupplyDataL ( ConML_SupplyDataPtr_t aContent ); + TInt TaskRebootL(); + TInt TaskGetMetadataL( ConML_GetMetadataPtr_t aContent ); + void AppendStatusL( ConML_ConMLPtr_t aContent, CSConStatusReply* reply ); + void AppendUpdateDeviceInfoResultsL( ConML_ResultsPtr_t aContent, + CSConUpdateDeviceInfo* aResult ); + void AppendSetBURModeResultsL ( ConML_ResultsPtr_t aContent, + CSConSetBURMode* aResult ); + void AppendListInstalledAppsResultsL ( ConML_ResultsPtr_t aContent, + CSConListInstApps* aResult ); + void AppendListPublicFilesResultsL ( ConML_ResultsPtr_t aContent, + CSConListPublicFiles* aResult ); + void AppendRequestDataResultsL( ConML_ResultsPtr_t aContent, + CSConRequestData* aResult ); + void AppendSupplyDataResultsL( ConML_ResultsPtr_t aContent, + CSConSupplyData* aResult ); + void AppendInstallResultsL( ConML_ResultsPtr_t aContent, + CSConInstall* aResult ); + void AppendUninstallResultsL( ConML_ResultsPtr_t aContent, + CSConUninstall* aResult ); + void AppendListDataOwnersResultsL ( ConML_ResultsPtr_t aContent, + CSConListDataOwners* aResult ); + void AppendGetDataOwnerStatusResultsL ( ConML_ResultsPtr_t aContent, + CSConGetDataOwnerStatus* aResult ); + void AppendGetDataSizeResultsL ( ConML_ResultsPtr_t aContent, + CSConGetDataSize* aResult ); + void AppendGetMetadataResultsL ( ConML_ResultsPtr_t aContent, + CSConGetMetadata* aResult ); + void AppendProgressL ( ConML_ResultsPtr_t aContent, TInt progress ); + void AppendDrivesL( ConML_DrivesPtr_t aContent, TDriveList aDrives ); + TDriveList DriveList( ConML_DriveListPtr_t aContent ); + TDesC8& IntToDesLC( const TInt& anInt); + TDesC8& DriveNumToDesLC( const TInt& anInt ); + TDesC8& BufToDesLC( const TDesC& aBuf ); + TDesC8& UidToDesLC( const TUid& aUid ); + TUid DesToUid ( const TDesC8& aDes ); + TInt DesToInt( const TDesC8& aDes); + TBool HasDrives( TDriveList& aDrive ); + TDesC8& HashToDesLC( const TDesC& aBuf ); + TPtr DesToHashLC( const TDesC8& aDes ); + TBool IsJavaHash( const TDesC8& aDes ); + + TInt ReadOviAccountInfoL( RWriteStream& aAccountInfoStream ); + +// data +private: + CSConPCConnServer& iServer; + + RLibrary iPCDlib; + RLibrary iCSClib; + RLibrary iConMLHandlerLib; + + CSConPCD* iPCDHandler; + CSConCSC* iCSCHandler; + CSConConMLHandler* iConMLHandler; + + RChunk iChunk; + CBufFlat* iBuffer; + TInt iResult; + + CSconFolderLister* iFolderLister; + RFs iFs; + CSconBtEngine* iBtEngine; + }; + +#endif // __SCONPCCONNSERVER_H__ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/src/sconbtengine.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/src/sconbtengine.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,415 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconBtEngine implementation +* +*/ + + + +#include +#include + +#include +#include +#include + +#include "sconbtengine.h" +#include "debug.h" + +CSconBtEngine* CSconBtEngine::NewL() + { + TRACE_FUNC; + CSconBtEngine* self = new (ELeave) CSconBtEngine(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +CSconBtEngine::~CSconBtEngine() + { + TRACE_FUNC; + if ( iBtEng ) + { + iBtEng->Cancel(); + delete iBtEng; + } + + delete iBtSettings; + } + +CSconBtEngine::CSconBtEngine() + { + } + +void CSconBtEngine::ConstructL() + { + iBtEng = CBTEngDevMan::NewL( this ); + iBtSettings = CBTEngSettings::NewL( this ); + iState = EIdle; + } + +void CSconBtEngine::ReadBTInfoL( RBufWriteStream& aStream ) + { + TRACE_FUNC_ENTRY; + if ( iState != EIdle ) + { + User::Leave( KErrInUse ); + } + iStream = &aStream; + iOperationError = KErrNone; + + // Write local name (8 bit name length + unicode name) + TBuf<100> localName; + TInt err = iBtSettings->GetLocalName( localName ); + User::LeaveIfError( err ); + LOGGER_WRITE_1("localName: %S", &localName); + iStream->WriteUint8L( localName.Length() ); + iStream->WriteL( localName, localName.Length() ); + + if ( iBtAddress.Length() == 0 ) + { + LOGGER_WRITE("Try to read bt address"); + + CRepository* cenRep = NULL; + // Use TRAP to catch a leave if the CenRep key does not exist. + TRAP( err, cenRep = CRepository::NewL( KCRUidBluetoothLocalDeviceAddress ) ); + CleanupStack::PushL( cenRep ); + if( !err ) + { + err = cenRep->Get( KBTLocalDeviceAddress, iBtAddress ); + LOGGER_WRITE_1("cenRep->Get err: %d", err); + } + CleanupStack::PopAndDestroy( cenRep ); + + if ( err ) + { + iBtAddress.Zero(); + } + } + + // Write bt address (8 bit addr length + unicode address) + if ( iBtAddress.Length() > 0 ) + { + LOGGER_WRITE_1("btAddr: %S", &iBtAddress); + iStream->WriteUint8L( iBtAddress.Length() ); + iStream->WriteL( iBtAddress, iBtAddress.Length() ); + } + else + { + iStream->WriteUint8L( 0 ); + } + + // Write BT Power State (8-bit, 0=Off, 1=On) + TBTPowerStateValue state; + err = iBtSettings->GetPowerState( state ); + User::LeaveIfError( err ); + LOGGER_WRITE_1("PowerState: %d", state); + iStream->WriteUint8L( state ); + + // Get device info + TBTRegistrySearch crit; + crit.FindAll(); + if ( !iBtDevArray ) + { + LOGGER_WRITE("create arr"); + iBtDevArray = new (ELeave) CBTDeviceArray(5); + LOGGER_WRITE("create arr -ok"); + } + else + { + iBtDevArray->ResetAndDestroy(); + } + err = iBtEng->GetDevices( crit, iBtDevArray ); + LOGGER_WRITE_1("GetDevices err: %d", err); + User::LeaveIfError( err ); + iState = ERequestBtInfo; + + // Wait until completed + iWait.Start(); + iState = EIdle; + if ( iOperationError ) + { + LOGGER_WRITE_1("Operation failed, leave %d", iOperationError); + User::Leave( iOperationError ); + } + TRACE_FUNC_EXIT; + } + +void CSconBtEngine::SetBtAuthorizedL( const TDesC& aBtDevAddress, TBool aAuthorized ) + { + TRACE_FUNC_ENTRY; + if ( iState != EIdle ) + { + User::Leave( KErrInUse ); + } + + TBTRegistrySearch crit; + TBTDevAddr addr; + addr.SetReadable( aBtDevAddress ); + crit.FindAddress( addr ); + + if ( !iBtDevArray ) + { + LOGGER_WRITE("create arr"); + iBtDevArray = new (ELeave) CBTDeviceArray(5); + LOGGER_WRITE("create arr -ok"); + } + else + { + iBtDevArray->ResetAndDestroy(); + } + TInt err = iBtEng->GetDevices( crit, iBtDevArray ); + LOGGER_WRITE_1("GetDevices err: %d", err); + User::LeaveIfError( err ); + iState = EChangeAuthorized; + iOperationError = KErrNone; + iAuthorizedValue = aAuthorized; + + // Wait until completed + iWait.Start(); + iState = EIdle; + if ( iOperationError ) + { + LOGGER_WRITE_1("Operation failed, leave %d", iOperationError); + User::Leave( iOperationError ); + + } + + TRACE_FUNC_EXIT; + } + +TInt CSconBtEngine::SetBtPowerState( TBool aPower ) + { + TRACE_FUNC_ENTRY; + if ( iState != EIdle ) + { + return KErrInUse; + } + + TBTPowerStateValue state; + iOperationError = iBtSettings->GetPowerState( state ); + if ( iOperationError ) + { + return iOperationError; + } + else if ( ( aPower && state == EBTPowerOn ) + || ( !aPower && state == EBTPowerOff ) ) + { + // No need to change state + return KErrNone; + } + + state = EBTPowerOff; + if ( aPower ) + { + state = EBTPowerOn; + } + iOperationError = iBtSettings->SetPowerState( state ); + if ( iOperationError ) + { + return iOperationError; + } + iState = EChangeBtState; + + // Wait until completed + iWait.Start(); + + iState = EIdle; + TRACE_FUNC_RET( iOperationError ); + return iOperationError; + } + +TInt CSconBtEngine::SetBtName( const TDesC& aBtName ) + { + LOGGER_WRITE_1("SetBtName aBtName: %S", &aBtName); + TInt err = iBtSettings->SetLocalName( static_cast( aBtName ) ); + TRACE_FUNC_RET( err ); + return err; + } + +// From MBTEngDevManObserver +void CSconBtEngine::HandleDevManComplete( TInt aErr ) + { + TRACE_FUNC; + LOGGER_WRITE_1("aErr: %d", aErr ); + if ( iState == EChangeAuthorized ) + { + if ( iWait.IsStarted() ) + { + iOperationError = aErr; + iWait.AsyncStop(); + } + } + + } + +void CSconBtEngine::HandleGetDevicesComplete( TInt aErr, + CBTDeviceArray* aDeviceArray ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aErr: %d", aErr); + //iBtReqOngoing = EFalse; + if ( iState == ERequestBtInfo ) + { + // Continue to write devices info + TRAP( iOperationError, PrintDevicesL() ); + LOGGER_WRITE_1("PrintDevicesL err: %d", iOperationError); + + if ( iWait.IsStarted() ) + { + iWait.AsyncStop(); + } + } + else if ( iState == EChangeAuthorized ) + { + iOperationError = aErr; + if ( !aErr && aDeviceArray->Count() == 1 ) + { + CBTDevice* btRef = aDeviceArray->At(0); + TBTDeviceSecurity devSec = btRef->GlobalSecurity(); + if ( btRef->IsPaired() && !devSec.Banned() ) + { + LOGGER_WRITE8_1("btAdrr: %S", &btRef->BDAddr().Des() ); + CBTDevice* btDevice = CBTDevice::NewLC( btRef->BDAddr() ); + + btDevice->SetPaired( ETrue ); + + btDevice->SetDeviceNameL( btRef->DeviceName() ); + btDevice->SetFriendlyNameL( btRef->FriendlyName() ); + LOGGER_WRITE8_1("name: %S", &btRef->DeviceName()); + LOGGER_WRITE8_1("FriendlyName: %S", &btRef->FriendlyName()); + + LOGGER_WRITE_1("iAuthorizedValue: %d", iAuthorizedValue); + // Set as authorized and store the device + TBTDeviceSecurity security; + security.SetNoAuthenticate( EFalse ); + security.SetNoAuthorise( iAuthorizedValue ); + security.SetBanned( EFalse ); + + btDevice->SetGlobalSecurity (security ); + + //iOperationError = iBtEng->ModifyDevice(*aDeviceArray->At(0)); + iOperationError = iBtEng->ModifyDevice( *btDevice ); + LOGGER_WRITE_1( "ModifyDevice err: %d", iOperationError ); + CleanupStack::PopAndDestroy( btDevice ); + } + else + { + LOGGER_WRITE("Device was not paired or it's banned") + iOperationError = KErrAccessDenied; + } + } + + // If error occured stop waiting, otherwise continue waiting until + // HandleDevManComplete has been called + if ( iOperationError && iWait.IsStarted() ) + { + iWait.AsyncStop(); + } + } + TRACE_FUNC_EXIT; + } + +void CSconBtEngine::PrintDevicesL() + { + TRACE_FUNC_ENTRY; + // calculate devices count + TInt devCount(0); + + for ( TInt i=0 ; iCount(); i++ ) + { + CBTDevice* device = iBtDevArray->At(i); + // show only paired and banned devices + if ( device->IsPaired() || device->GlobalSecurity().Banned() ) + { + devCount++; + } + } + + // Print info + iStream->WriteUint8L( devCount ); + + for ( TInt i=0 ; iCount(); i++ ) + { + CBTDevice* device = iBtDevArray->At(i); + + const TBTDeviceSecurity btSec = device->GlobalSecurity(); + + // show only paired and banned devices + if ( device->IsPaired() || btSec.Banned() ) + { + LOGGER_WRITE_1("IsValidDeviceName: %d", device->IsValidDeviceName()); + const TDesC8& deviceName = device->DeviceName(); + LOGGER_WRITE8_1("DeviceName: %S", &deviceName ); + iStream->WriteUint8L( deviceName.Length() ); + iStream->WriteL( deviceName, deviceName.Length() ); + + LOGGER_WRITE_1("IsValidFriendlyName: %d", device->IsValidFriendlyName()); + LOGGER_WRITE_1("FriendlyName: %S", &device->FriendlyName() ); + + const TBTDevAddr& addr = device->BDAddr(); + + TBuf<100> readable; + addr.GetReadable( readable ); + LOGGER_WRITE_1("readable addr: %S", &readable); + iStream->WriteUint8L( readable.Length() ); + iStream->WriteL( readable, readable.Length() ); + + LOGGER_WRITE_1("paired: %d", device->IsPaired() ); + LOGGER_WRITE_1("IsValidPaired: %d", device->IsValidPaired() ); + TUint8 paired(0); + if ( device->IsPaired() && device->IsValidPaired() ) + { + paired = 1; + } + iStream->WriteUint8L( paired ); + + TUint8 noAuthorise(0); + if ( btSec.NoAuthorise() ) + { + noAuthorise = 1; + } + iStream->WriteUint8L( noAuthorise ); + + TUint8 banned(0); + if ( btSec.Banned() ) + { + banned = 1; + } + iStream->WriteUint8L( banned ); + + LOGGER_WRITE(""); + } + } + iStream->CommitL(); + iStream = NULL; //delete reference only + TRACE_FUNC_EXIT; + } + +// From MBTEngSettingsObserver +void CSconBtEngine::PowerStateChanged( TBTPowerStateValue /*aState*/ ) + { + TRACE_FUNC; + if ( iState == EChangeBtState && iWait.IsStarted() ) + { + iWait.AsyncStop(); + } + + } + +void CSconBtEngine::VisibilityModeChanged( TBTVisibilityMode /*aState*/ ) + { + TRACE_FUNC; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/src/sconfolderlister.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/src/sconfolderlister.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,717 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconFolderLister implementation +* +*/ + + +#include "sconfolderlister.h" + +#include +#include +#include +#include +#include +#include +#include + +#include "debug.h" + +const TUint16 KFormatVersion( 1 ); + +// Obex package size +const TInt KPackageSize = 65536; + +const TInt KMaxLevelsToSearch = 80; + +_LIT( KSConResourceName, "z:\\Resource\\sconftp.rsc" ); + +CSconFolderEntry* CSconFolderEntry::NewLC() + { + CSconFolderEntry* self = new (ELeave) CSconFolderEntry(); + CleanupStack::PushL( self ); + return self; + } +CSconFolderEntry* CSconFolderEntry::NewLC( const TEntry& aEntry ) + { + CSconFolderEntry* self = new (ELeave) CSconFolderEntry(); + CleanupStack::PushL( self ); + self->ConstructL( aEntry ); + return self; + } +CSconFolderEntry::CSconFolderEntry() + { + } +CSconFolderEntry::~CSconFolderEntry() + { + delete iName; + delete iLabel; + } + + +void CSconFolderEntry::ConstructL( const TEntry& aEntry ) + { + iAtt = aEntry.iAtt; + iModified = aEntry.iModified.Int64(); + iName = aEntry.iName.AllocL(); + } + +CSconFolderLister::CSconFolderLister( RFs& aFs ) : iFs(aFs) + { + // No implementation required + } + +CSconFolderLister::~CSconFolderLister() + { + TRACE_FUNC; + delete iLocalizer; + } + +CSconFolderLister* CSconFolderLister::NewL( RFs& aFs ) + { + TRACE_FUNC_ENTRY; + CSconFolderLister* self = new (ELeave) CSconFolderLister( aFs ); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + TRACE_FUNC_EXIT; + return self; + } + +void CSconFolderLister::ConstructL() + { + TRACE_FUNC_ENTRY; + + iLocalizer = CDirectoryLocalizer::NewL(); + + // set free memory up to critical level for all drives + CRepository* repository = CRepository::NewLC( KCRUidDiskLevel ); + TInt iCriticalLevel(0); + User::LeaveIfError( repository->Get( KDiskCriticalThreshold, iCriticalLevel ) ); + CleanupStack::PopAndDestroy( repository ); + iCriticalLevel += KPackageSize; // add obex package size to critical level + TRACE_FUNC_EXIT; + } + + +void CSconFolderLister::GenerateFolderListL( RBufWriteStream& aStream, const TDesC& aStartPath, + const TInt aLevelsToSearch ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aStartPath: %S", &aStartPath ); + LOGGER_WRITE_1("aLevelsToSearch: %d", aLevelsToSearch ); + TInt levelsToSearch = aLevelsToSearch; + if ( levelsToSearch > KMaxLevelsToSearch || levelsToSearch == KErrNotFound ) + levelsToSearch = KMaxLevelsToSearch; + iFolders = 0; + iFiles = 0; + const TInt KDriveNameLength( 3 ); + + if ( aStartPath.CompareF( _L("\\") ) == 0 ) + { + LOGGER_WRITE("List all drives"); + aStream.WriteUint16L( KFormatVersion ); + ListAllDrivesL( aStream, levelsToSearch ); + } + else if ( aStartPath.Length() >= KDriveNameLength ) + { + if ( aStartPath.Length() > KDriveNameLength ) + { + // check root path permissions, is listing allowed + TPtrC path = aStartPath.Mid(KDriveNameLength); + LOGGER_WRITE_1("pathFromRoot: %S", &path); + TInt pathEndMark = path.Locate(TChar('\\')); + if ( pathEndMark == KErrNotFound ) + { + User::Leave( KErrArgument ); + } + //"private\" locate = 7" + TPtrC pathName = aStartPath.Left( KDriveNameLength+pathEndMark ); + LOGGER_WRITE_1("pathName: %S", &path); + TEntry pathEntry; + User::LeaveIfError( iFs.Entry(pathName, pathEntry) ); + + TBool printable = IsDirectoryPrintable( aStartPath.Left(3), pathEntry ); + if ( !printable ) + { + // access denied + LOGGER_WRITE("Access denied!"); + User::Leave( KErrAccessDenied ); + } + User::LeaveIfError( iFs.Entry(aStartPath, pathEntry) ); + if ( pathEntry.IsSystem() ) + { + // access denied + LOGGER_WRITE("System folder, Access denied!"); + User::Leave( KErrAccessDenied ); + } + } + + + aStream.WriteUint16L( KFormatVersion ); + + TInt drive; + User::LeaveIfError( iFs.CharToDrive( aStartPath[0], drive) ); + ListDriveAndPathL( aStream, drive, aStartPath, levelsToSearch); + + } + else + { + LOGGER_WRITE("aStartPath KErrArgument"); + User::Leave( KErrArgument ); + } + + + LOGGER_WRITE_1("iFolders: %d", iFolders); + LOGGER_WRITE_1("iFiles: %d", iFiles); + TRACE_FUNC_EXIT; + } + +void CSconFolderLister::ListAllDrivesL( RBufWriteStream& aStream, const TInt aLevelsToSearch ) + { + TRACE_FUNC_ENTRY; + TInt devDriveCount = 0; + TInt mmcDriveCount = 0; + TChar driveLetter; + TBuf8<1> driveBuf; + RArray sconDriveInfo(5); + + // Write all drives to folderlisting object + TDriveList driveList; + // Get all drives that are visible to the user. + TInt driveCount; + User::LeaveIfError( DriveInfo::GetUserVisibleDrives( iFs, driveList, driveCount ) ); + + for( TInt i = EDriveA; i < KMaxDrives; i++ ) + { + if( driveList[i] ) + { + TUint driveStatus; + User::LeaveIfError( DriveInfo::GetDriveStatus( iFs, i, driveStatus ) ); + //LOGGER_WRITE_1( "DriveInfo for drive: %d", i); + + if( !(driveStatus & DriveInfo::EDrivePresent ) + || driveStatus & DriveInfo::EDriveCorrupt + || (driveStatus & DriveInfo::EDriveRemote) ) + { + //LOGGER_WRITE_1( "skip drive %d", i); + continue; + } + + User::LeaveIfError( iFs.DriveToChar( i, driveLetter ) ); + //Letter to uppercase form. + driveLetter.UpperCase(); + + TSconDriveInfo info; + info.iDriveStatus = driveStatus; + info.iDriveLetter.Zero(); + info.iDriveLetter.Append( driveLetter ); + info.iDriveLetter.Append( _L(":") ); + + + info.iDriveAttr = KEntryAttNormal; // ReadWrite + + if( driveStatus & DriveInfo::EDriveInternal && devDriveCount==0 ) + { + //permission always R for first internal drive + info.iDriveAttr = KEntryAttReadOnly; + } + + //memory type + if( driveStatus & DriveInfo::EDriveInternal ) + { + LOGGER_WRITE( "DriveInfo::EDriveInternal" ); + devDriveCount++; + info.iDriveType = DriveInfo::EDriveInternal; // =1 + info.iDriveTypeCount = devDriveCount; + + } + else if( driveStatus & DriveInfo::EDriveRemovable ) + { + LOGGER_WRITE( "DriveInfo::EDriveRemovable" ); + mmcDriveCount++; + info.iDriveType = DriveInfo::EDriveRemovable;; // =2 + info.iDriveTypeCount = mmcDriveCount; + } + + TVolumeInfo volumeInfo; + User::LeaveIfError( iFs.Volume( volumeInfo, i) ); + + info.iVolumeName = volumeInfo.iName; + if ( volumeInfo.iFree > iCriticalLevel ) + { + volumeInfo.iFree = volumeInfo.iFree - iCriticalLevel; + } + else + { + volumeInfo.iFree = 0; + } + + info.iFree = volumeInfo.iFree; + info.iSize = volumeInfo.iSize; + + + sconDriveInfo.AppendL( info ); + + } + } + + LOGGER_WRITE_1("Drives: %d", sconDriveInfo.Count()); + aStream.WriteUint8L( sconDriveInfo.Count() ); + for ( TInt i=0; i < sconDriveInfo.Count(); i++ ) + { + + TBuf<3> path(KNullDesC); + path.Copy(sconDriveInfo[i].iDriveLetter); + path.Append(_L("\\")); + + ExportDriveL( aStream, sconDriveInfo[i], path, aLevelsToSearch); + } + sconDriveInfo.Close(); + TRACE_FUNC_EXIT; + } + +void CSconFolderLister::ListDriveAndPathL( RBufWriteStream& aStream, TInt aDrive, const TDesC& aStartPath, const TInt aLevelsToSearch ) + { + TRACE_FUNC_ENTRY; + TVolumeInfo volumeInfo; + User::LeaveIfError( iFs.Volume(volumeInfo, aDrive) ); + TInt driveCount(0); + TUint driveStatus; + User::LeaveIfError( DriveInfo::GetDriveStatus( iFs, aDrive, driveStatus ) ); + GetDriveTypeNumberL( aDrive, driveStatus, driveCount ); + + + TSconDriveInfo info; + info.iDriveLetter.Copy( aStartPath.Left(2) ); + info.iVolumeName = volumeInfo.iName; + + info.iDriveAttr = KEntryAttNormal; // ReadWrite + if( driveStatus & DriveInfo::EDriveInternal && driveCount==0 ) + { + //permission always R for first internal drive + info.iDriveAttr = KEntryAttReadOnly; + } + info.iDriveType = 0; + if( driveStatus & DriveInfo::EDriveInternal ) + { + info.iDriveType = DriveInfo::EDriveInternal; // =1 + } + else if( driveStatus & DriveInfo::EDriveRemovable ) + { + info.iDriveType = DriveInfo::EDriveRemovable;; // =2 + } + + if ( volumeInfo.iFree > iCriticalLevel ) + { + volumeInfo.iFree = volumeInfo.iFree - iCriticalLevel; + } + else + { + volumeInfo.iFree = 0; + } + + info.iFree = volumeInfo.iFree; + info.iSize = volumeInfo.iSize; + + aStream.WriteUint8L( 1 ); + ExportDriveL( aStream, info, aStartPath, aLevelsToSearch); + + TRACE_FUNC_EXIT; + } + +void CSconFolderLister::ExportDriveL( RBufWriteStream& aStream, const TSconDriveInfo& aDriveInfo, + const TDesC& aPathName, const TInt aLevelsToSearch ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("Drive: %S", &aDriveInfo.iDriveLetter); + LOGGER_WRITE_1("aLevelsToSearch: %d", aLevelsToSearch ); + + CSconFolderEntry* driveEntry = CSconFolderEntry::NewLC(); + driveEntry->iName = aDriveInfo.iDriveLetter.AllocL(); + + if ( driveEntry->iLabel ) + { + LOGGER_WRITE_1("Label: %S", &driveEntry->iLabel->Des()); + } + driveEntry->iAtt = aDriveInfo.iDriveAttr; + + driveEntry->iDriveInfoEntryExists = ETrue; + driveEntry->iDriveInfoEntry.iDriveType = aDriveInfo.iDriveType; + driveEntry->iDriveInfoEntry.iDriveTypeCount = aDriveInfo.iDriveTypeCount; + + driveEntry->iDriveInfoEntry.iFree = aDriveInfo.iFree; + driveEntry->iDriveInfoEntry.iSize = aDriveInfo.iSize; + + driveEntry->iLabel = aDriveInfo.iVolumeName.AllocL(); + GetLocalizedVolumeNameL( *driveEntry ); + + ExportPathL( aStream, aPathName, *driveEntry, ETrue, aLevelsToSearch ); + CleanupStack::PopAndDestroy( driveEntry ); + TRACE_FUNC_EXIT; + } + +void CSconFolderLister::GetLocalizedVolumeNameL( CSconFolderEntry& aDriveEntry ) + { + TRACE_FUNC_ENTRY; + // Get localized names + if ( aDriveEntry.iDriveInfoEntry.iDriveType == DriveInfo::EDriveInternal + && aDriveEntry.iDriveInfoEntry.iDriveTypeCount > 1 ) + { + LOGGER_WRITE("Internal mass memory"); + // internal second memory (Mass memory) + TFileName file( KSConResourceName ); + BaflUtils::NearestLanguageFile( iFs, file ); + + CStringResourceReader* reader = CStringResourceReader::NewL( file ); + if ( aDriveEntry.iLabel ) + { + delete aDriveEntry.iLabel; + aDriveEntry.iLabel = NULL; + } + aDriveEntry.iLabel = reader->ReadResourceString( R_SECON_VALUE_MASS_STORAGE ).AllocL(); + delete reader; + } + else if ( aDriveEntry.iLabel && aDriveEntry.iLabel->Length()>0 ) + { + LOGGER_WRITE("Use normal volume label"); + + } + else + { + TFileName file( KSConResourceName ); + BaflUtils::NearestLanguageFile( iFs, file ); + CStringResourceReader* reader = CStringResourceReader::NewL( file ); + if (aDriveEntry.iLabel) + { + delete aDriveEntry.iLabel; + aDriveEntry.iLabel = NULL; + } + if ( aDriveEntry.iDriveInfoEntry.iDriveType == DriveInfo::EDriveRemovable ) + { + LOGGER_WRITE("EDriveRemovable"); + // read default MMC name + aDriveEntry.iLabel = reader->ReadResourceString( R_SECON_VALUE_MMC ).AllocL(); + } + else + { + LOGGER_WRITE("EDriveInternal"); + // read default DEV name + aDriveEntry.iLabel = reader->ReadResourceString( R_SECON_VALUE_DEVICE ).AllocL(); + } + delete reader; + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSconFolderLister::GetDriveTypeNumberL() +// +// ----------------------------------------------------------------------------- +// +void CSconFolderLister::GetDriveTypeNumberL( TInt aDrive, TUint aDriveStatus , TInt& aTypeNumber) + { + TRACE_FUNC_ENTRY; + aTypeNumber = 0; + + //TUint driveStatus; + // + // if true, search internal drives, else search removable drives + TBool searchInternalDrives = (aDriveStatus & DriveInfo::EDriveInternal); + + TInt driveCount; + TDriveList driveList; + + User::LeaveIfError( DriveInfo::GetUserVisibleDrives( iFs, driveList, driveCount ) ); + + for( TInt i = EDriveA; i <= aDrive; i++ ) + { + if( driveList[i] ) + { + TUint driveStatus; + User::LeaveIfError( DriveInfo::GetDriveStatus( iFs, i, driveStatus ) ); + + if( !(driveStatus & DriveInfo::EDrivePresent ) + || driveStatus & DriveInfo::EDriveCorrupt ) + { + LOGGER_WRITE( "not present or corrupted" ); + continue; + } + + if( driveStatus & DriveInfo::EDriveInternal ) + { + if( searchInternalDrives ) + { + aTypeNumber++; + } + } + else if( driveStatus & DriveInfo::EDriveRemovable ) + { + if( !searchInternalDrives ) + { + aTypeNumber++; + } + } + } + } + TRACE_FUNC_EXIT; + } + + +void CSconFolderLister::ExportPathL( RBufWriteStream& aStream, const TDesC& aPathName, + const CSconFolderEntry& aEntry, const TBool aLocalize, const TInt aLevelsToSearch ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aPathName: %S", &aPathName ); + LOGGER_WRITE_1("aLevelsToSearch: %d", aLevelsToSearch ); + + LOGGER_WRITE_1("aEntry.iName: %S", &aEntry.iName->Des() ); + + TBool localized(EFalse); + + // foldername length + name + aStream.WriteUint8L( aEntry.iName->Length() ); + aStream.WriteL( aEntry.iName->Des() ); + + TUint att = aEntry.iAtt; + + if ( aEntry.iLabel && aEntry.iLabel->Length() > 0 ) + { + aStream.WriteUint8L( aEntry.iLabel->Length() ); + aStream.WriteL( aEntry.iLabel->Des() ); + } + else + { + if ( aLocalize ) + { + // initialize Localizer + iLocalizer->SetFullPath( aPathName ); + localized = iLocalizer->IsLocalized(); + } + + if( localized ) + { + const TDesC& localizedName = iLocalizer->LocalizedName(); + aStream.WriteUint8L( localizedName.Length() ); + aStream.WriteL( localizedName ); + LOGGER_WRITE_1("LocalizedName: %S", &localizedName ); + } + else if ( aPathName.CompareF(_L("C:\\Data\\")) == 0 ) + { + TFileName file( KSConResourceName ); + + BaflUtils::NearestLanguageFile( iFs, file ); + + CStringResourceReader* reader = CStringResourceReader::NewL( file ); + CleanupStack::PushL( reader ); + + const TDesC& localizedName = reader->ReadResourceString( R_SECON_DATA_FOLDER ); + aStream.WriteUint8L( localizedName.Length() ); + aStream.WriteL( localizedName ); + LOGGER_WRITE_1("LocalizedName: %S", &localizedName ); + + CleanupStack::PopAndDestroy( reader ); + localized = ETrue; + } + else + { + aStream.WriteUint8L( 0 ); + } + // attributes + if ( localized ) + { + // localized folder, set readonly flag + att = att | KEntryAttReadOnly; + } + } + + if ( aPathName.Length() == 3 && aLocalize ) + { + // enable subfolder localization, even when root cannot be localized + localized = ETrue; + } + + // DriveInfoEntry + if ( aEntry.iDriveInfoEntryExists ) + { + aStream.WriteUint8L( 1 ); + aStream.WriteUint8L( aEntry.iDriveInfoEntry.iDriveType ); + aStream.WriteUint8L( aEntry.iDriveInfoEntry.iDriveTypeCount ); + aStream << aEntry.iDriveInfoEntry.iFree; + aStream << aEntry.iDriveInfoEntry.iSize; + } + else + { + aStream.WriteUint8L( 0 ); + } + + + // modified time + TDateTime time = aEntry.iModified.DateTime(); + aStream.WriteInt16L( time.Year() ); + aStream.WriteInt8L( time.Month()+1 ); // range 1...12 + aStream.WriteInt8L( time.Day()+1 ); + aStream.WriteInt8L( time.Hour() ); + aStream.WriteInt8L( time.Minute() ); + aStream.WriteInt8L( time.Second() ); + + // write attribute + aStream.WriteUint32L( att ); + + + if ( aLevelsToSearch == 0 ) + { + // don't list directory content + LOGGER_WRITE("Not listing directory content"); + aStream.WriteInt16L( 0 ); // files count + aStream.WriteInt16L( 0 ); // directory count + return; + } + + CDir *fileList = 0; + CDir *dirList = 0; + + // show normal and hidden files and folders + TUint entryAttMask = KEntryAttNormal | KEntryAttHidden; + + // get folders and files + TInt err = iFs.GetDir( aPathName, entryAttMask, ESortByName, + fileList, dirList ); + + if ( err ) + { + LOGGER_WRITE_1( "ParseFolderListL GetDir returned: %d", err ); + User::Leave( err ); + } + + CleanupStack::PushL( dirList ); + CleanupStack::PushL( fileList ); + + + LOGGER_WRITE_1("files: %d", fileList->Count()); + aStream.WriteUint16L( fileList->Count() ); + + // Print files to folder listing object + for( TInt i = 0; i < fileList->Count(); i++ ) + { + const TEntry& fileEntry = ( *fileList )[i]; + iFiles++; + LOGGER_WRITE_1("fileEntry.iName: %S", &fileEntry.iName); + // filename length + name + aStream.WriteUint8L( fileEntry.iName.Length() ); + aStream.WriteL( fileEntry.iName ); + + // modified time + TDateTime time = fileEntry.iModified.DateTime(); + aStream.WriteInt16L( time.Year() ); + aStream.WriteInt8L( time.Month()+1 ); // range 1...12 + aStream.WriteInt8L( time.Day()+1 ); + aStream.WriteInt8L( time.Hour() ); + aStream.WriteInt8L( time.Minute() ); + aStream.WriteInt8L( time.Second() ); + + // attributes + aStream.WriteUint32L( fileEntry.iAtt ); + + // file size + aStream.WriteUint32L( fileEntry.iSize ); + } + CleanupStack::PopAndDestroy( fileList ); + + + // calculate ow many directories we are going to list + TInt directoryCount(0); + for( TInt i = 0; i < dirList->Count(); i++ ) + { + if ( IsDirectoryPrintable(aPathName, ( *dirList )[i] ) ) + { + directoryCount++; + } + } + LOGGER_WRITE_1("directories: %d", directoryCount); + aStream.WriteUint16L( directoryCount ); + + HBufC* fullpath = HBufC::NewL( KMaxPath ); + TPtr fullpathPtr = fullpath->Des(); + CleanupStack::PushL( fullpath ); + + // Print folders to folder listing object + for( TInt i = 0; i < dirList->Count(); i++ ) + { + const TEntry& folderEntry = ( *dirList )[i]; + if ( !IsDirectoryPrintable(aPathName, folderEntry) ) + { + continue; + } + iFolders++; + + fullpathPtr.Copy( aPathName ); + fullpathPtr.Append( folderEntry.iName ); + fullpathPtr.Append( _L("\\") ); + CSconFolderEntry* subFolderEntry = CSconFolderEntry::NewLC( folderEntry ); + if ( aLevelsToSearch == KErrNotFound ) + { + ExportPathL( aStream, fullpathPtr, *subFolderEntry, localized, aLevelsToSearch); + } + else + { + ExportPathL( aStream, fullpathPtr, *subFolderEntry, localized, aLevelsToSearch-1); + } + CleanupStack::PopAndDestroy( subFolderEntry ); + } + CleanupStack::PopAndDestroy( fullpath ); + CleanupStack::PopAndDestroy( dirList ); + + TRACE_FUNC_EXIT; + } +TBool CSconFolderLister::IsDirectoryPrintable( const TDesC& aParentPath, const TEntry& aFolderEntry ) + { + if ( aFolderEntry.IsSystem() ) + { + LOGGER_WRITE_1("folder '%S' was system folder", &aFolderEntry.iName); + return EFalse; + } + if ( aParentPath.Length() == 3 ) + { + if ( aParentPath.FindF(_L("C:\\")) == 0 && aFolderEntry.iName.CompareF(_L("data")) != 0 ) + { + // C root not visible, exept Data folder + LOGGER_WRITE_1("folder '%S' not visible to user in c-root", &aFolderEntry.iName); + return EFalse; + } + + if ( aFolderEntry.iName.CompareF(_L("private")) == 0 ) + { + LOGGER_WRITE_1("folder '%S' not visible to user", &aFolderEntry.iName); + return EFalse; + } + else if ( aFolderEntry.iName.CompareF(_L("sys")) == 0 ) + { + LOGGER_WRITE_1("folder '%S' not visible to user", &aFolderEntry.iName); + return EFalse; + } + else if ( aFolderEntry.iName.CompareF(_L("system")) == 0 ) + { + LOGGER_WRITE_1("folder '%S' not visible to user", &aFolderEntry.iName); + return EFalse; + } + else if ( aFolderEntry.iName.CompareF(_L("resource")) == 0 ) + { + LOGGER_WRITE_1("folder '%S' not visible to user", &aFolderEntry.iName); + return EFalse; + } + } + return ETrue; + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/src/sconimsireader.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/src/sconimsireader.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,123 @@ +/* +* Copyright (c) 2009-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconImsiReader implementation +* +*/ + + +#include "sconimsireader.h" +#include "debug.h" + +TInt CSconImsiReader::GetImsiL( TDes& aImsi ) + { + TRACE_FUNC_ENTRY; + CTelephony::TRegistrationStatus temp; + CSconImsiReader* self = new (ELeave) CSconImsiReader(aImsi, temp); + CleanupStack::PushL(self); + self->ConstructL(); + + self->RequestImsi(); + + TInt err = self->iStatus.Int(); + CleanupStack::PopAndDestroy(self); + TRACE_FUNC_RET(err); + return err; + } + +TInt CSconImsiReader::GetNetworkStatusL( CTelephony::TRegistrationStatus& aRegistrationStatus ) + { + TRACE_FUNC_ENTRY; + TBuf temp; + CSconImsiReader* self = new (ELeave) CSconImsiReader(temp, aRegistrationStatus); + CleanupStack::PushL(self); + self->ConstructL(); + + self->RequestNetworkStatus(); + + TInt err = self->iStatus.Int(); + CleanupStack::PopAndDestroy(self); + TRACE_FUNC_RET(err); + return err; + } + +void CSconImsiReader::ConstructL() + { + TRACE_FUNC_ENTRY; + iTelephony = CTelephony::NewL(); + CActiveScheduler::Add(this); + TRACE_FUNC_EXIT; + } + +void CSconImsiReader::RequestImsi() + { + iImsiReaderStatus = ERequestingImsi; + iTelephony->GetSubscriberId(iStatus,iSubscriberIdV1Pckg); + SetActive(); + CActiveScheduler::Start(); + } + +void CSconImsiReader::RequestNetworkStatus() + { + iImsiReaderStatus = ERequestingNetworkStatus; + iTelephony->GetNetworkRegistrationStatus(iStatus, iNetworkRegistrationV1Pckg); + SetActive(); + CActiveScheduler::Start(); + } + +CSconImsiReader::~CSconImsiReader() + { + TRACE_FUNC_ENTRY; + delete iTelephony; + TRACE_FUNC_EXIT; + } + +CSconImsiReader::CSconImsiReader(TDes& aImsi, CTelephony::TRegistrationStatus& aRegistrationStatus): CActive(EPriorityStandard), + iImsi(aImsi), iNetworkStatus(aRegistrationStatus), iSubscriberIdV1Pckg(iSubscriberIdV1), iNetworkRegistrationV1Pckg(iNetworkRegistrationV1) + { + } + +void CSconImsiReader::RunL() + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("iStatus: %d", iStatus.Int() ); + if ( iStatus == KErrNone ) + { + if ( iImsiReaderStatus == ERequestingImsi ) + { + iImsi = iSubscriberIdV1.iSubscriberId; + LOGGER_WRITE_1("iImsi: %S", &iImsi); + } + else if ( iImsiReaderStatus == ERequestingNetworkStatus ) + { + iNetworkStatus = iNetworkRegistrationV1.iRegStatus; + LOGGER_WRITE_1( "iNetworkStatus: %d", (TInt)iNetworkStatus); + } + } + CActiveScheduler::Stop(); + TRACE_FUNC_EXIT; + } + +void CSconImsiReader::DoCancel() + { + TRACE_FUNC_ENTRY; + if ( iImsiReaderStatus == ERequestingImsi ) + { + iTelephony->CancelAsync( CTelephony::EGetSubscriberIdCancel ); + } + else if ( iImsiReaderStatus == ERequestingNetworkStatus ) + { + iTelephony->CancelAsync( CTelephony::EGetNetworkRegistrationStatusCancel ); + } + TRACE_FUNC_EXIT; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/pcconn/src/sconpcconnserver.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/pcconn/src/sconpcconnserver.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,3028 @@ +/* +* Copyright (c) 2005-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: PC Connectivity server +* +*/ + + +#include // For RMemReadStream +#include +#include +#include + +#include "sconpcconnclientserver.h" +#include "sconpcconnserver.h" +#include "sconpcd.h" +#include "sconcsc.h" +#include "sconconmlhandler.h" +#include "sconimsireader.h" +#include "sconoviaccounthandler.h" +#include "sconfolderlister.h" +#include "sconbtengine.h" +#include "debug.h" + +#ifdef DEBUG_XML +#include +_LIT8( KTimeFormat, "%02d:%02d:%02d.%03d" ); +_LIT8( KXmlBegin, "\nXML:\n" ); +#endif + +_LIT( KSCONGetMetadataRequest, "METADATA:" ); +_LIT8( KSCONSyncRequest, "SYNC:" ); +_LIT( KSCONReadImsi, "READIMSI"); +_LIT( KSCONReadNetworkInfo, "READNETWORKINFO"); +_LIT( KSCONReadOviAccount, "READOVIACCOUNT"); +_LIT( KSCONListPath, "LISTP:"); +_LIT( KSCONReadBtInfo, "READBTINFO" ); +_LIT( KSCONSetBtPower, "SETBTPOWER:" ); +_LIT( KSCONSetBtName, "SETBTNAME:" ); +_LIT( KSCONSetBtAuthorized, "SETBTAUTHORIZED:" ); + +//------------------------------------------------------------ +// Global functions +//------------------------------------------------------------ + +// ----------------------------------------------------------------------------- +// E32Main() +// Entry point +// ----------------------------------------------------------------------------- +// +TInt E32Main() + { + TRACE_FUNC_ENTRY; + __UHEAP_MARK; + TInt error( KErrNone ); + error = CSConPCConnServer::RunServer(); + __UHEAP_MARKEND; + TRACE_FUNC_EXIT; + return error; + } + +// ----------------------------------------------------------------------------- +// PanicServer() +// Panics the server with panic reason aPanic +// ----------------------------------------------------------------------------- +// +GLDEF_C void PanicServer(TPCConnServPanic aPanic) + { + LOGGER_WRITE_1( "CSConPCConnSession::PanicServer() : Panic code %d", aPanic ); + _LIT(KTxtServerPanic,"PCConn server panic"); + User::Panic(KTxtServerPanic,aPanic); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::CSConPCConnServer () +// Default constructor - can not leave +// ----------------------------------------------------------------------------- +// +CSConPCConnServer::CSConPCConnServer () : CServer2( EPriorityStandard) + { + LOGGER_WRITE( "* * * * CSConPCConnServer * * * *" ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::~CSConPCConnServer() +// Default destructor +// ----------------------------------------------------------------------------- +// +EXPORT_C CSConPCConnServer::~CSConPCConnServer() + { + TRACE_FUNC; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::NewLC() +// Creates a new instance of CSConPCConnServer +// ----------------------------------------------------------------------------- +// +EXPORT_C CSConPCConnServer* CSConPCConnServer::NewLC() + { + TRACE_FUNC_ENTRY; + CSConPCConnServer* self = new (ELeave) CSConPCConnServer(); + CleanupStack::PushL( self ); + self->StartL( KSConPCConnServerName ); + TRACE_FUNC_EXIT; + return self; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::NewSessionL() +// Creates a new session to the client +// ----------------------------------------------------------------------------- +// +CSession2* CSConPCConnServer::NewSessionL( + const TVersion &aVersion, const RMessage2& /*aMessage*/ ) const + { + TRACE_FUNC_ENTRY; + + // check version + TVersion version( KSConPCConnServerVersionMajor, + KSConPCConnServerVersionMinor, + KSConPCConnServerVersionBuild); + + if (!User::QueryVersionSupported(version, aVersion)) + { + User::Leave(KErrNotSupported); + } + + // check client identity + RThread client; + Message().Client( client ); + TSecureId clientId = client.SecureId(); + + if ( clientId != KSConPCConnClientSecureId ) + { + LOGGER_WRITE( "CSConPCConnServer::NewSessionL() : Secure ID does not match" ); +#ifndef __WINS__ + LOGGER_WRITE( "Leave KErrAccessDenied"); + User::Leave( KErrAccessDenied ); +#else + // does not leave on WINS environment. Easier to run module tests. + LOGGER_WRITE( "Not leaving on WINS environment" ); +#endif + } + + TRACE_FUNC_EXIT; + return CSConPCConnSession::NewL( *CONST_CAST( CSConPCConnServer*, this)); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::RunServer() +// Starts the server +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnServer::RunServer() + { + TRACE_FUNC_ENTRY; + + CTrapCleanup* cleanup = CTrapCleanup::New(); + TInt ret = KErrNoMemory; + if( cleanup ) + { + TRAP( ret, CSConPCConnServer::RunServerL( ) ); + delete cleanup; + } + if( ret != KErrNone ) + { + // Signal the client that server creation failed + RProcess::Rendezvous( ret ); + } + TRACE_FUNC_EXIT; + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::RunServerL() +// Starts the server +// ----------------------------------------------------------------------------- +// +void CSConPCConnServer::RunServerL() + { + // Create and install the active scheduler we need + TRACE_FUNC_ENTRY; + CActiveScheduler *as=new (ELeave)CActiveScheduler; + CleanupStack::PushL( as ); + CActiveScheduler::Install( as ); + + // Create server + CSConPCConnServer* server = CSConPCConnServer::NewLC(); + + // Initialisation complete, now signal the client + User::LeaveIfError( RThread().RenameMe( KSConPCConnServerName ) ); + RProcess::Rendezvous( KErrNone ); + + // Ready to run + CActiveScheduler::Start(); + + // Cleanup the scheduler + CleanupStack::PopAndDestroy( 2, as ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::IncSessionCount() +// Increments session count +// ----------------------------------------------------------------------------- +// +void CSConPCConnServer::IncSessionCount() + { + TRACE_FUNC_ENTRY; + iSessionCount++; + LOGGER_WRITE_1( "There are now %d sessions", iSessionCount ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnServer::DecSessionCount() +// Decrements session count +// ----------------------------------------------------------------------------- +// +void CSConPCConnServer::DecSessionCount() + { + TRACE_FUNC_ENTRY; + iSessionCount--; + LOGGER_WRITE_1( "There are still %d sessions", iSessionCount ); + if ( iSessionCount < 1 ) + { + Cancel(); + CActiveScheduler::Stop(); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::CSConPCConnSession() +// Default constructor +// ----------------------------------------------------------------------------- +// +CSConPCConnSession::CSConPCConnSession ( + CSConPCConnServer& aServer ) : iServer (aServer) + { + TRACE_FUNC_ENTRY; + iServer.IncSessionCount(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::CSConPCConnSession() +// Default destructor - frees resources +// ----------------------------------------------------------------------------- +// +CSConPCConnSession::~CSConPCConnSession() + { + TRACE_FUNC_ENTRY; + + iServer.DecSessionCount(); + + if ( iConMLHandler ) + { + delete iConMLHandler; + iConMLHandler = NULL; + iConMLHandlerLib.Close(); + } + + if ( iPCDHandler ) + { + delete iPCDHandler; + iPCDHandler = NULL; + iPCDlib.Close(); + } + + if ( iCSCHandler ) + { + delete iCSCHandler; + iCSCHandler = NULL; + iCSClib.Close(); + } + + if ( iBuffer ) + { + delete iBuffer; + iBuffer = NULL; + } + + iChunk.Close(); + delete iFolderLister; + + iFs.Close(); + + delete iBtEngine; + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::NewL() +// Creates a new instance of CSConPCConnSession +// ----------------------------------------------------------------------------- +// +EXPORT_C CSConPCConnSession *CSConPCConnSession::NewL( + CSConPCConnServer& aServer) + { + TRACE_FUNC_ENTRY; + CSConPCConnSession* self = new ( ELeave ) CSConPCConnSession(aServer); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + TRACE_FUNC_EXIT; + return self; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::ConstructL() +// 2nd phase constructor +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::ConstructL() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + iResult = KErrNone; + + User::LeaveIfError( iFs.Connect() ); + +#ifdef DEBUG_XML + // create log file + + RFile file; + TInt err = file.Create ( iFs, KSConConMLDebugFile, EFileWrite ); + if( err == KErrNone ) + { + // file created, close it + file.Close(); + } +#endif + + // initialize buffer + iBuffer = CBufFlat::NewL ( KSConPCConnBufferMaxSize ); + + // load handlers + if ( !iPCDHandler ) + { + TRAP( ret, LoadPCDDllL() ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "CSConPCConnSession::ConstructL() : PCD load failed with error code %d", ret ); + User::Leave( ret ); + } + } + + if ( !iCSCHandler ) + { + TRAP( ret, LoadCSCDllL() ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "CSConPCConnSession::ConstructL() : CSC dll load failed with error code %d", ret ); + User::Leave ( ret ); + } + } + + // Load parser + if ( !iConMLHandler ) + { + TRAPD( ret, LoadConMLHandlerDllL() ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "CSConPCConnSession::ConstructL() : Parser dll load failed with error code %d", ret ); + User::Leave ( ret ); + } + } + + iFolderLister = CSconFolderLister::NewL( iFs ); + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::ServiceL() +// Gets the client's request +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::ServiceL( const RMessage2 &aMessage) + { + TRACE_FUNC_ENTRY; + TRAPD(err,DispatchRequestL(aMessage) ); + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "CSConPCConnSession::ServiceL() : leave code %d", err ); + PanicServer( E_DispatchRequest ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DispatchRequestL() +// Identifies an IPC command from the client +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::DispatchRequestL(const RMessage2 &aMessage) + { + TRACE_FUNC_ENTRY; + + TInt ret (KErrNone); + + switch (aMessage.Function()) + { + case EPutMessage: + LOGGER_WRITE( "CSConPCConnSession::DispatchRequestL() : EPutMessage" ); + ret = HandlePutMessageL(); + break; + + case EGetMessage: + LOGGER_WRITE( "CSConPCConnSession::DispatchRequestL() : EGetMessage" ); + ret = HandleGetMessageL(); + break; + + case EResetMessage: + LOGGER_WRITE( "CSConPCConnSession::DispatchRequestL() : EResetMessage" ); + ret = HandleResetMessage(); + break; + + case EChunkMessage: + LOGGER_WRITE( "CSConPCConnSession::DispatchRequestL() : EChunkMessage" ); + ret = HandleChunkMessage( aMessage ); + break; + + default: + PanicServer (E_BadRequest); + break; + } + + aMessage.Complete( ret ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HandlePutMessageL() +// Handles a PUT -type message from the client +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::HandlePutMessageL() + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1( "CSConPCConnSession::HandlePutMessageL() : begin : Heap count : %d", User::Heap().Count() ); + TInt ret ( KErrNone ); + + if ( !iPCDHandler ) + { + TRAP( ret, LoadPCDDllL() ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "CSConPCConnSession::HandlePutMessageL (): PCD dll load failed with error code %d", ret ); + return ( ret ); + } + } + + if ( ! iConMLHandler ) + { + TRAP ( ret, LoadConMLHandlerDllL() ); + if ( ret != KErrNone ) + { + LOGGER_WRITE_1( "CSConPCConnSession::HandlePutMessageL (): ConML Handler dll load failed with error code %d", ret ); + return ( ret ); + } + } + + TInt length ( 0 ); + + RMemReadStream buf( iChunk.Base(), iChunk.Size() ); + + + iBuffer->Reset(); + + length = buf.ReadInt32L(); + HBufC8* name8 = HBufC8::NewLC( length ); + TPtr8 namePtr8 = name8->Des(); + buf.ReadL( namePtr8, length); + + const TUint8* ptr8 = namePtr8.Ptr(); + const TUint16* ptr16 = reinterpret_cast( ptr8 ); + TPtrC namePtr; + namePtr.Set( ptr16, length/2 ); + + length = buf.ReadInt32L(); + HBufC8* type = HBufC8::NewLC( length ); + TPtr8 typePtr = type->Des(); + buf.ReadL( typePtr, length); + + // WBXML Document + length = buf.ReadInt32L(); + HBufC8* data = HBufC8::NewLC( length ); + TPtr8 dataPtr = data->Des(); + + buf.ReadL( dataPtr, length ); + iBuffer->ResizeL( length ); + iBuffer->Write( 0, dataPtr ); + + buf.Close(); + +#ifdef DEBUG_XML + + RFile file; + if ( file.Open( iFs, KSConConMLDebugFile, EFileWrite ) == KErrNone ) + { + RFileWriteStream fws; + TInt fileSize; + file.Size( fileSize ); + + TTime now; + now.HomeTime(); + TDateTime time = now.DateTime(); + TBuf8<16> timeLine; + timeLine.Format (KTimeFormat, time.Hour(), time.Minute(), + time.Second(), time.MicroSecond() ); + + fws.Attach( file, fileSize ); + fws.PushL(); + fws.WriteL( timeLine ); + _LIT8( KPutMessage, "__________PUT-MESSAGE \nWBXML:\n" ); + fws.WriteL( KPutMessage ); + fws.WriteL( iBuffer->Ptr(0), iBuffer->Size() ); + TRAP_IGNORE( fws.CommitL() ); + fws.Close(); + + CleanupStack::PopAndDestroy( &fws ); + } + file.Close(); +#endif + if ( ( ( typePtr.CompareC( KSConPCDWBXMLObjectType)== KErrNone ) || + ( typePtr.CompareC( KSConPCDWBXMLObjectType2 )== KErrNone ) ) + && namePtr8.Find(KSCONSyncRequest) == 0 ) + { + LOGGER_WRITE_1("Sync request: %S", &namePtr); + RBufReadStream stream( *iBuffer ); + + CleanupClosePushL( stream ); + TRAP( ret, iPCDHandler->HandlePutSyncRequestL( namePtr8, stream )); + if ( ret ) + { + LOGGER_WRITE_1("HandlePutSyncRequestL() Leaved with %d", ret); + } + + CleanupStack::PopAndDestroy( &stream ); + } + else if ( ( typePtr.Compare( KSConPCDWBXMLObjectType ) == KErrNone) || + ( typePtr.Compare( KSConPCDWBXMLObjectType2 )== KErrNone) ) + { + LOGGER_WRITE( "CSConPCConnSession::HandlePutMessageL() : Object type PCD " ); + TRAPD( err, ret = iConMLHandler->ParseDocumentL( *iBuffer, this ) ); + if ( err != KErrNone ) + { + ret = err; + } + if ( ret == KErrNone ) + { + // Possible error code returned from PCCS + ret = iResult; + } + } + else + { + LOGGER_WRITE( "Object type not regognized " ); + ret = KErrNotSupported; + } + CleanupStack::PopAndDestroy( data ); + CleanupStack::PopAndDestroy( type ); + CleanupStack::PopAndDestroy( name8 ); + LOGGER_WRITE_1( "CSConPCConnSession::HandlePutMessageL() end : Heap count : %d", User::Heap().Count() ); + LOGGER_WRITE_1( "CSConPCConnSession::HandlePutMessageL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HandleGetMessageL() +// Handles a GET -type message from the client +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::HandleGetMessageL() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + + if ( !iCSCHandler ) + { + TRAP( ret, LoadCSCDllL() ); + if ( ret != KErrNone) + { + LOGGER_WRITE_1( "CSConPCConnSession::HandleGetMessageL() : CSC dll load failed with error code %d", ret ); + return ret; + } + } + + TInt32 length ( 0 ); + RMemReadStream readBuf( iChunk.Base(), iChunk.Size() ); + iBuffer->Reset(); + + length = readBuf.ReadInt32L(); + HBufC8* name = HBufC8::NewLC( length ); + TPtr8 namePtr8 = name->Des(); + readBuf.ReadL( namePtr8, length); + namePtr8.SetLength( length ); + LOGGER_WRITE8_1("namePtr: %S", &namePtr8); + + const TUint8* ptr8 = namePtr8.Ptr(); + const TUint16* ptr16 = reinterpret_cast( ptr8 ); + TPtrC namePtr; + namePtr.Set( ptr16, length/2 ); + + length = readBuf.ReadInt32L(); + HBufC8* type = HBufC8::NewLC( length ); + TPtr8 typePtr = type->Des(); + readBuf.ReadL( typePtr, length); + + readBuf.Close(); + + if ( typePtr.Compare( KSConCapabilityObjectType ) == KErrNone ) + { + ret = iCSCHandler->CapabilityObject( *iBuffer ); + +#ifdef DEBUG_XML + + RFile file; + if ( file.Open(iFs, KSConConMLDebugFile, EFileWrite ) == KErrNone ) + { + RFileWriteStream fws; + TInt fileSize; + file.Size ( fileSize ); + TTime now; + now.HomeTime(); + TDateTime time = now.DateTime(); + TBuf8<16> timeLine; + timeLine.Format( KTimeFormat, time.Hour(), time.Minute(), + time.Second(), time.MicroSecond() ); + + fws.Attach ( file, fileSize); + fws.PushL(); + fws.WriteL( timeLine ); + _LIT8( KGetMessage, "__________GET -MESSAGE - Capability Object \n " ); + fws.WriteL( KGetMessage ); + fws.WriteL( iBuffer->Ptr(0), iBuffer->Size() ); + TRAP_IGNORE( fws.CommitL() ); + fws.Close(); + + CleanupStack::PopAndDestroy( &fws ); + } + file.Close(); +#endif + + } + else if ( typePtr.CompareC( KSConPCDWBXMLObjectType) == KErrNone ) + { + if ( namePtr8.Find(KSCONSyncRequest) == 0 ) // 8-bit search + { + LOGGER_WRITE("Sync request"); + + RBufWriteStream stream( *iBuffer ); + + CleanupClosePushL( stream ); + + TRAP( ret, iPCDHandler->HandleGetSyncRequestL( namePtr8, stream, iChunk.MaxSize() - sizeof(TInt32) )); + if ( ret ) + { + LOGGER_WRITE_1("HandleGetSyncRequestL() Leaved with %d", ret); + } + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + + LOGGER_WRITE_1("iBuffer size: %d", iBuffer->Size()); + + } + else if ( namePtr.Find(KSCONReadImsi) == 0 ) // 16-bit search + { + LOGGER_WRITE("Read IMSI"); + TBuf imsi; + ret = CSconImsiReader::GetImsiL( imsi ); + + if ( ret == KErrNone ) + { + TBuf8 imsi8; + User::LeaveIfError( CnvUtfConverter::ConvertFromUnicodeToUtf8(imsi8,imsi) ); + + iBuffer->ResizeL( imsi8.Length() ); + iBuffer->Write( 0, imsi8 ); + } + else + { + // Change error code more generic + ret = KErrNotFound; + } + } + else if ( namePtr.Find(KSCONReadNetworkInfo) == 0 ) // 16-bit search + { + LOGGER_WRITE("Read NetworkInfo"); + CTelephony::TRegistrationStatus regStatus; + ret = CSconImsiReader::GetNetworkStatusL( regStatus ); + + if ( ret == KErrNone ) + { + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + stream.WriteInt8L( regStatus ); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + else + { + // Change error code more generic + ret = KErrNotFound; + } + } + else if ( namePtr.Find(KSCONReadOviAccount) == 0 ) + { + LOGGER_WRITE("Read Ovi account"); + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + + ret = ReadOviAccountInfoL( stream ); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + + } + else if ( namePtr.Find(KSCONListPath) == 0 ) + { + LOGGER_WRITE("List path"); + // LISTP:0:pathname + if ( namePtr.Length() > KSCONListPath().Length()+2) + { + TPtrC pathname = namePtr.Mid( KSCONListPath().Length()+2 ); + + const TUint16 levelsChar = namePtr[ KSCONListPath().Length() ]; + TInt level(KErrNotFound); + if ( levelsChar >= TChar('0') ) + { + level = levelsChar - TChar('0'); + } + + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + TRAP( ret, iFolderLister->GenerateFolderListL( stream, pathname, level )); + LOGGER_WRITE_1("GenerateFolderListL leaved with err: %d", ret); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + else + { + ret = KErrArgument; + } + + } + else if ( namePtr.Find(KSCONReadBtInfo) == 0 ) + { + LOGGER_WRITE( "Read BT info"); + if ( !iBtEngine ) + { + iBtEngine = CSconBtEngine::NewL(); + } + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + TRAP( ret, iBtEngine->ReadBTInfoL( stream ) ); + LOGGER_WRITE_1("ReadBTInfoL leaved with err: %d", ret); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + else if ( namePtr.Find(KSCONSetBtPower) == 0 ) + { + LOGGER_WRITE( "Change BT Power state"); + if ( namePtr.Length() == KSCONSetBtPower().Length()+1 ) + { + const TUint16 lastChar = namePtr[ KSCONSetBtPower().Length() ]; + TBool changeBtOn; + if ( lastChar == TChar('0') ) + { + changeBtOn = EFalse; + } + else if ( lastChar == TChar('1') ) + { + changeBtOn = ETrue; + } + else + { + ret = KErrArgument; + } + + if ( !ret ) + { + if ( !iBtEngine ) + { + iBtEngine = CSconBtEngine::NewL(); + } + TInt err = iBtEngine->SetBtPowerState( changeBtOn ); + + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + stream.WriteInt32L( err ); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + } + else + { + ret = KErrArgument; + } + } + else if ( namePtr.Find(KSCONSetBtName) == 0 ) + { + LOGGER_WRITE( "Set BT Name"); + TPtrC btName = namePtr.Mid( KSCONSetBtName().Length() ); + TInt err = iBtEngine->SetBtName( btName ); + + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + stream.WriteInt32L( err ); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + else if ( namePtr.Find(KSCONSetBtAuthorized) == 0 ) + { + LOGGER_WRITE( "Set BT Authorized"); + ret = KErrArgument; + // SETBTAUTHORIZED:0:00245f8d6a26 + // 1. param = auth. state ("0"=off, "1"=true) + // 2. param = bt address (hex string) + + if ( namePtr.Length() > KSCONSetBtAuthorized().Length()+2) + { + TPtrC btAddr = namePtr.Mid( KSCONSetBtAuthorized().Length()+2 ); + + const TUint16 authStateChar = namePtr[ KSCONSetBtAuthorized().Length() ]; + TBool authorize(EFalse); + if ( authStateChar == TChar('0') ) + { + authorize = EFalse; + ret = KErrNone; + } + else if ( authStateChar == TChar('1') ) + { + authorize = ETrue; + ret = KErrNone; + } + + if ( !iBtEngine ) + { + iBtEngine = CSconBtEngine::NewL(); + } + TRAPD(err, iBtEngine->SetBtAuthorizedL( btAddr, authorize ) ); + + RBufWriteStream stream( *iBuffer ); + CleanupClosePushL( stream ); + stream.WriteInt32L( err ); + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + } + + } + else + { + ret = HandleWBXMLGetRequestL( namePtr ); + } + } + else + { + LOGGER_WRITE( "CSConPCConnSession::HandleGetMessageL() : Header type not regognized " ); + ret = KErrNotSupported; + } + + CleanupStack::PopAndDestroy( 2 ); // name, type + + if ( ret != KErrNone ) + { + return ret; + } + + length = iBuffer->Size(); + + if ( sizeof(TInt32) + length > iChunk.Size() ) + { + // need to resize chunk + TInt err = iChunk.Adjust( sizeof(TInt32) + length ); + LOGGER_WRITE_2("iChunk.Adjust( %d ) err: %d", sizeof(TInt32) + length, err); + if ( err ) + { + iBuffer->Reset(); + LOGGER_WRITE_1( "CSConPCConnSession::HandleGetMessageL() : returned %d", ret ); + return err; + } + } + + // copy data to chunk + RMemWriteStream writeBuf ( iChunk.Base(), iChunk.Size() ); + + if ( length > 0 ) + { + writeBuf.WriteInt32L( length ); + writeBuf.WriteL( iBuffer->Ptr(0), length ); + writeBuf.CommitL(); + } + else + { + writeBuf.WriteInt32L( 0 ); + } + writeBuf.CommitL(); + writeBuf.Close(); + iBuffer->Reset(); + LOGGER_WRITE_1( "CSConPCConnSession::HandleGetMessageL() : returned %d", ret ); + return ( ret ); + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HandleWBXMLGetRequestL() +// Handles a ConML(wbxml) Get request from the client +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::HandleWBXMLGetRequestL( const TDesC& aFileName ) + { + TRACE_FUNC_ENTRY; + TInt ret(KErrNone); + if ( aFileName.Find(KSCONGetMetadataRequest) == 0 ) + { + // ConML get metadata request --> Create metadata task + LOGGER_WRITE( "ConML GetMetadataRequest" ); + TPtrC filename = aFileName.Mid( KSCONGetMetadataRequest().Length() ); + + TSConMethodName method ( EGetMetadata ); + CSConTask* task = CSConTask::NewLC( method ); + + if ( filename.Length() > task->iGetMetadataParams->iFilename.MaxLength() ) + { + User::Leave( KErrTooBig ); + } + task->iGetMetadataParams->iFilename = filename; + + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1("iPCDHandler->PutTaskL ret: %d", ret); + } + else if ( aFileName.Length() > 0 ) + { + LOGGER_WRITE("Error: aFilename does not match to any definitions"); + TRACE_FUNC_RET( KErrArgument ); + return KErrArgument; + } + + // Get reply + LOGGER_WRITE( "CSConPCConnSession::HandleGetMessageL() before ConML GetReplyL" ); + CSConStatusReply* reply = iPCDHandler->GetReply(); + CleanupStack::PushL( reply ); + + ConML_ConMLPtr_t content = new ( ELeave ) ConML_ConML_t(); + CleanupStack::PushL( content ); + + AppendStatusL( content, reply ); + ret = iConMLHandler->GenerateDocument( content ); + + CleanupStack::PopAndDestroy( content ); + CleanupStack::PopAndDestroy( reply ); + + TPtrC8 ptr( iConMLHandler->WBXMLDocument() ); + LOGGER_WRITE_1("ptr.Size(): %d", ptr.Size()); + iBuffer->ResizeL( ptr.Size() ); + iBuffer->Write( 0, ptr ); + +#ifdef DEBUG_XML + RFile file; + if ( file.Open( iFs, KSConConMLDebugFile, EFileWrite) == KErrNone ) + { + RFileWriteStream fws; + TInt fileSize; + file.Size ( fileSize ); + fws.Attach ( file, fileSize); + fws.PushL(); + TTime now; + now.HomeTime(); + TDateTime time = now.DateTime(); + TBuf8<16> timeLine; + timeLine.Format( KTimeFormat, time.Hour(), time.Minute(), + time.Second(), time.MicroSecond() ); + + fws.WriteL( timeLine ); + _LIT8( KGetMessage, "__________GET -MESSAGE" ); + fws.WriteL( KGetMessage ); + fws.WriteL(KXmlBegin); + fws.WriteL(iConMLHandler->XMLDocument().Ptr(), + iConMLHandler->XMLDocument().Length()); + fws.WriteL(_L("\n\n")); + TRAP_IGNORE( fws.CommitL() ); + fws.Close(); + CleanupStack::PopAndDestroy( &fws ); + } + + file.Close(); +#endif + TRACE_FUNC_RET(ret); + return ret; + } + + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::ReadOviAccountInfoL() +// Reads ovi account information to stream +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::ReadOviAccountInfoL( RWriteStream& aAccountInfoStream ) + { + TRACE_FUNC_ENTRY; + RLibrary oviaccounthandlerLib; + CleanupClosePushL( oviaccounthandlerLib ); + // Dynamically load DLL + TInt err = oviaccounthandlerLib.Load( KSconOviAccountHandlerDllName ); + if ( err ) + { + LOGGER_WRITE_1("oviaccounthandlerLib.Load err: %d", err); + err = KErrNotSupported; + } + else if( oviaccounthandlerLib.Type()[1] != KSconOviAccountHandlerDllUid ) + { + LOGGER_WRITE_1( "KSconOviAccountHandlerDllUid incorrect... (0x%08X)",oviaccounthandlerLib.Type()[1].iUid ); + err = KErrNotSupported; + } + + if ( err == KErrNone ) + { + TSConCreateCSconOviAccountHandlerFunc CreateCSconOviAccountHandlerL = + (TSConCreateCSconOviAccountHandlerFunc)oviaccounthandlerLib.Lookup(1); + + CSconOviAccountHandler* oviAccountHandler = (CSconOviAccountHandler*)CreateCSconOviAccountHandlerL(); + + TRAP(err, oviAccountHandler->GetOviAccountDetailsL( aAccountInfoStream ) ); + LOGGER_WRITE_1("GetOviAccountDetailsL err: %d", err); + + delete oviAccountHandler; + oviAccountHandler = NULL; + + if ( err ) + { + // change error code + err = KErrNotFound; + } + } + else + { + err = KErrNotSupported; + } + + CleanupStack::PopAndDestroy( &oviaccounthandlerLib ); + TRACE_FUNC_EXIT; + return err; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HandleResetMessage() +// Resets the PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::HandleResetMessage() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + + // reset PCD + if ( iPCDHandler ) + { + iPCDHandler->ResetPCD(); + } + + LOGGER_WRITE_1( "CSConPCConnSession::HandleResetMessage() : ret %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HandleChunkMessage( const RMessage2& aMessage ) +// Receives the chunk handle from the client +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::HandleChunkMessage( const RMessage2& aMessage ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + + ret = iChunk.Open( aMessage, 0, EFalse ); + + LOGGER_WRITE_1( "CSConPCConnSession::HandleChunkMessageL() : ret %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::LoadPCDDllL() +// Loads the PCCS service +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::LoadPCDDllL() + { + TRACE_FUNC_ENTRY; + + // Dynamically load DLL + User::LeaveIfError( iPCDlib.Load( KSConPCDLibName ) ); + if( iPCDlib.Type()[1] != KSConPCDUid ) + { + LOGGER_WRITE( "CSConPCConnSession::LoadPCDDllL() : KSConPCDUidValue incorrect..." ); + iPCDlib.Close(); + User::Leave( KErrNotFound ); + } + TSConCreateCSConPCDFunc CreateCSConPCDL = + (TSConCreateCSConPCDFunc)iPCDlib.Lookup(1); + + iPCDHandler = (CSConPCD*)CreateCSConPCDL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::LoadCSCDllL() +// Loads the CSC service +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::LoadCSCDllL() + { + TRACE_FUNC_ENTRY; + // Dynamically load DLL + User::LeaveIfError( iCSClib.Load( KSConCSCLibName ) ); + if( iCSClib.Type()[1] != KSConCSCUid ) + { + LOGGER_WRITE( "CSConPCConnSession::LoadCSCDllL() : KSConCSCUidValue incorrect" ); + iCSClib.Close(); + User::Leave( KErrNotFound ); + } + TSConCreateCSConCSCFunc CreateCSConCSCL = + (TSConCreateCSConCSCFunc)iCSClib.Lookup(1); + + iCSCHandler = (CSConCSC*)CreateCSConCSCL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::LoadConMLHandlerDllL() +// Loads the ConML handler +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::LoadConMLHandlerDllL() + { + TRACE_FUNC_ENTRY; + // Dynamically load DLL + User::LeaveIfError( iConMLHandlerLib.Load( KSConConMLHandlerLibName ) ); + if ( iConMLHandlerLib.Type()[1] != KSConConMLHandlerUid ) + { + LOGGER_WRITE( "CSConPCConnSession::LoadConMLHandlerDllL() : KSConConMLHandlerUidValue incorrect" ); + iConMLHandlerLib.Close(); + User::Leave( KErrNotFound ); + } + TSConCreateCSConConMLHandlerFunc CreateCSConConMLHandlerL = + (TSConCreateCSConConMLHandlerFunc)iConMLHandlerLib.Lookup(1); + + iConMLHandler = (CSConConMLHandler*)CreateCSConConMLHandlerL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::ConMLL() +// Callback function for ConML handler - parsed data processing starts +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::ConMLL( ConML_ConMLPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + +#ifdef DEBUG_XML + iConMLHandler->GenerateDocument( aContent ); + RFile file; + if ( file.Open(iFs, KSConConMLDebugFile, EFileWrite) == KErrNone ) + { + RFileWriteStream fws; + TInt fileSize; + file.Size( fileSize ); + fws.Attach ( file, fileSize ); + fws.PushL(); + + TTime now; + now.HomeTime(); + TDateTime time = now.DateTime(); + TBuf8<16> timeLine; + timeLine.Format (KTimeFormat, time.Hour(), time.Minute(), + time.Second(), time.MicroSecond() ); + + fws.WriteL( timeLine ); + _LIT8( KPutMessage, "__________PUT-MESSAGE" ); + fws.WriteL( KPutMessage ); + fws.WriteL( KXmlBegin ); + fws.WriteL( iConMLHandler->XMLDocument().Ptr(), + iConMLHandler->XMLDocument().Length()); + fws.WriteL(_L("\n\n")); + TRAP_IGNORE( fws.CommitL() ); + fws.Close(); + CleanupStack::PopAndDestroy( &fws ); + } + file.Close(); + +#endif + + + if ( aContent ) + { + if ( aContent->execute ) + { + ret = OptionsFromExecuteL( aContent->execute ); + } + else if ( aContent->cancel ) + { + ret = TaskCancelL( aContent->cancel ); + } + else if ( aContent->getStatus ) + { + ret = TaskGetStatusL ( aContent->getStatus ); + } + else + { + LOGGER_WRITE( "CSConPCConnSession::ConML() : No appropriate content in ConML -element " ); + ret = KErrArgument; + } + } + else + { + ret = KErrArgument; + } + + // store result for later use + iResult = ret; + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::OptionsFromExecuteL() +// Handles data of an execute -element +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::OptionsFromExecuteL(ConML_ExecutePtr_t aContent ) + { + TRACE_FUNC_ENTRY; + + TInt ret ( KErrNone ); + if ( aContent->updateDeviceInfo ) + { + ret = TaskUpdateDeviceInfoL( aContent->updateDeviceInfo); + } + else if ( aContent->listInstalledApps ) + { + ret = TaskListInstalledAppsL( aContent->listInstalledApps); + } + else if ( aContent->install ) + { + ret = TaskInstallL( aContent->install ); + } + else if ( aContent->unInstall ) + { + ret = TaskUnInstallL( aContent->unInstall ); + } + else if ( aContent->listDataOwners ) + { + ret = TaskListDataOwnersL(); + } + else if ( aContent->setBurMode ) + { + ret = TaskSetBURModeL( aContent->setBurMode ); + } + else if ( aContent->getDataSize ) + { + ret = TaskGetDataSizeL( aContent->getDataSize ); + } + else if ( aContent->requestData ) + { + ret = TaskRequestDataL( aContent->requestData ); + } + else if ( aContent->listPublicFiles ) + { + ret = TaskListPublicFilesL( aContent->listPublicFiles ); + } + else if ( aContent->reboot ) + { + ret = TaskRebootL(); + } + else if ( aContent->getDataOwnerStatus ) + { + ret = TaskGetDataOwnerStatusL( aContent->getDataOwnerStatus ); + } + else if ( aContent->supplyData ) + { + ret = TaskSupplyDataL( aContent->supplyData ); + } + else if ( aContent->getMetadata ) + { + ret = TaskGetMetadataL( aContent->getMetadata ); + } + else + { + LOGGER_WRITE( "CSConPCConnSession::OptionsFromExecute() : No content " ); + ret = KErrNotSupported; + } + LOGGER_WRITE_1( "CSConPCConnSession::OptionsFromExecute() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskCancelL(ConML_CancelPtr_t aContent) +// Sends a Cancel -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskCancelL( ConML_CancelPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( ECancel ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent->all ) + { + task->iCancelTaskAll = ETrue; + } + if ( aContent->id ) + { + task->iCancelTaskId = ( DesToInt( aContent->id->Data() )); + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskCancelL() : returned %d", ret ); + return ret; + } + + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskGetStatusL() +// Sends a Get Status -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskGetStatusL( ConML_GetStatusPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EGetStatus ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent->all ) + { + task->iGetStatusParams->iAll = ETrue; + } + if ( aContent->id) + { + task->iGetStatusParams->iTaskId = ( DesToInt( aContent->id->Data() )); + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskGetStatusL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskInstallL() +// Sends an Install -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskInstallL( ConML_InstallPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EInstall ); + CSConTask* task = CSConTask::NewLC( method); + task->iInstallParams->iMode = EUnknown; + if ( aContent->name ) + { + // Unicode conversion from 8-bit to 16-bit + CnvUtfConverter::ConvertToUnicodeFromUtf8(task->iInstallParams->iPath, + aContent->name->Data()); + } + if ( aContent->instParams ) + { + if ( aContent->instParams->param ) + { + for ( ConML_ParamListPtr_t p = aContent->instParams->param; + p && p->data; p = p->next) + { + LOGGER_WRITE( "CSConPCConnSession::TaskInstallL() : Parameters found " ); + if ( p->data->name ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskInstallL() : name param found " ); + TPtrC8 silent(KParamNameSilent); + + TInt comp = Mem::Compare((TUint8*)p->data->name->content, (TInt)p->data->name->length, silent.Ptr(), silent.Length()); + if( comp == 0) + { + // "Silent"-param found + LOGGER_WRITE( "CSConPCConnSession::TaskInstallL() : Silent-param found " ); + if ( p->data->value ) + { + TPtrC8 dataValue((TUint8*)p->data->value->content, (TInt)p->data->value->length); + TInt value = DesToInt( dataValue ); + if (value == 1) + { + LOGGER_WRITE( "CSConPCConnSession::TaskInstallL() : ESilentInstall " ); + task->iInstallParams->iMode = ESilentInstall; + } + else if( value == 0 ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskInstallL() : EUnsilentInstall " ); + task->iInstallParams->iMode = EUnsilentInstall; + } + } + } + } + } + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskInstallL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskUnInstallL() +// Sends an Uninstall -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskUnInstallL( ConML_UnInstallPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EUninstall ); + CSConTask* task = CSConTask::NewLC( method ); + task->iUninstallParams->iMode = EUnknown; + + if ( aContent->applications->application) + { + for ( ConML_ApplicationListPtr_t p = + aContent->applications->application; p && p->data; p = p->next ) + { + if ( p->data ) + { + if ( p->data->name ) + { + // get application name + HBufC* nameBuf = CnvUtfConverter::ConvertToUnicodeFromUtf8L( p->data->name->Data() ); + task->iUninstallParams->iName.Copy( nameBuf->Des() ); + delete nameBuf; + nameBuf = NULL; + } + if ( p->data->uid ) + { + // parse uid: UID # Type # Size # Version # Vendor # Parent app. name # + // only UID and Vendor are needed from whole uid-field. + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : start parsing uid " ); + + TPtrC8 buf( p->data->uid->Data() ); + + RArray arr(6); + CleanupClosePushL( arr ); + TBuf8<1> separator(KSConAppInfoSeparator); + + SplitL(buf, separator[0], arr); + if ( arr.Count() >= 5 ) + { + task->iUninstallParams->iUid = DesToUid( arr[0] ); + task->iUninstallParams->iType = (TSConAppType)DesToInt( arr[1] ); + HBufC* vendorBuf = CnvUtfConverter::ConvertToUnicodeFromUtf8L( arr[4] ); + task->iUninstallParams->iVendor.Copy( vendorBuf->Des() ); + delete vendorBuf; + vendorBuf = NULL; + } + CleanupStack::PopAndDestroy( &arr ); + + + } // endif p->data->uid + } + } + } + + if ( aContent->instParams) + { + if ( aContent->instParams->param ) + { + for ( ConML_ParamListPtr_t p = aContent->instParams->param; + p && p->data; p = p->next ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : Parameters found " ); + if ( p->data->name ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : name param found " ); + TPtrC8 silent(KParamNameSilent); + + TInt comp = Mem::Compare((TUint8*)p->data->name->content, (TInt)p->data->name->length, silent.Ptr(), silent.Length()); + if( comp == 0) + { + // "Silent"-param found + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : Silent-param found " ); + if ( p->data->value ) + { + TPtrC8 dataValue((TUint8*)p->data->value->content, (TInt)p->data->value->length); + TInt value = DesToInt( dataValue ); + if ( value == 1 ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : ESilentInstall " ); + task->iUninstallParams->iMode = ESilentInstall; + } + else if ( value == 0 ) + { + LOGGER_WRITE( "CSConPCConnSession::TaskUnInstallL() : EUnsilentInstall " ); + task->iUninstallParams->iMode = EUnsilentInstall; + } + } + } + } + } + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskUnInstallL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::SplitL(const TDesC& aText, const TChar aSeparator, +// RArray& aArray) +// Function splits string (eg "name1, name2, name3") into substrings. +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::SplitL(const TDesC8& aText, const TChar aSeparator, + RArray& aArray) + { + TRACE_FUNC_ENTRY; + TPtrC8 ptr; + ptr.Set(aText); + + for (;;) + { + TInt pos=ptr.Locate(aSeparator); + if (pos==KErrNotFound) + { + aArray.AppendL(ptr); + break; + } + + TPtrC8 subStr=ptr.Left(pos); // get pos characters starting from position 0 + aArray.AppendL(subStr); + + if (!(ptr.Length()>pos+1)) + { + break; + } + + ptr.Set(ptr.Mid(pos+1));// get all characters starting from position pos+1 + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskListInstalledAppsL() +// Sends a List installed apps -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskListInstalledAppsL( + ConML_ListInstalledAppsPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EListInstalledApps ); + CSConTask* task = CSConTask::NewLC( method ); + if( aContent-> drives ) + { + task->iListAppsParams->iDriveList = DriveList( aContent->drives->drive); + } + if ( aContent->all ) + { + task->iListAppsParams->iAllApps = ETrue; + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskListInstalledAppsL() : returned %d", ret); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskListDataOwnersL() +// Sends a List data owners -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskListDataOwnersL() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EListDataOwners ); + CSConTask* task = CSConTask::NewLC( method ); + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskListDataOwnersL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskSetBURModeL() +// Sends a Set BUR mode -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskSetBURModeL(ConML_SetBURModePtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( ESetBURMode ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent->drives ) + { + task->iBURModeParams->iDriveList = DriveList( aContent->drives->drive); + } + if ( aContent->partialType ) + { + TInt intValue = DesToInt( aContent->partialType->Data() ); + task->iBURModeParams->iPartialType = static_cast (intValue) ; + } + if ( aContent->incType ) + { + TInt intValue = DesToInt( aContent->incType->Data() ); + task->iBURModeParams->iIncType = static_cast (intValue) ; + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskSetBURModeL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskGetDataSizeL() +// Sends a Get data size -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskGetDataSizeL(ConML_GetDataSizePtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EGetDataSize ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent->dataOwners ) + { + for ( ConML_SIDListPtr_t p = aContent->dataOwners->sid; + p && p->data; p=p->next ) + { + CSConDataOwner* dataOwner = new (ELeave) CSConDataOwner(); + CleanupStack::PushL( dataOwner ); + if ( p->data->type ) + { + dataOwner->iType = TSConDOType (DesToInt( + p->data->type->Data() )); + } + if (p->data->uid ) + { + if( !IsJavaHash( p->data->uid->Data() ) ) + { + dataOwner->iUid = DesToUid( p->data->uid->Data() ); + } + else + { + TPtr hashPtr = DesToHashLC( p->data->uid->Data() ); + dataOwner->iJavaHash = HBufC::NewL( hashPtr.Size() ); + dataOwner->iJavaHash->Des().Copy( hashPtr ); + CleanupStack::PopAndDestroy(); //DesToHashLC() + } + } + if ( p->data->drives ) + { + dataOwner->iDriveList = DriveList ( p->data->drives->drive ); + } + if ( p->data->transferDataType ) + { + TInt intValue = DesToInt( p->data->transferDataType->Data() ); + dataOwner->iTransDataType = static_cast (intValue); + } + task->iGetDataSizeParams->iDataOwners.AppendL( dataOwner ); + CleanupStack::Pop( dataOwner ); + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskGetDataSizeL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskRequestDataL() +// Sends a Request data -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskRequestDataL(ConML_RequestDataPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( ERequestData ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent ) + { + if ( aContent->sid ) + { + for ( ConML_SIDListPtr_t p=aContent->sid; p && p->data; p=p->next ) + { + if ( p->data->type ) + { + task->iRequestDataParams->iDataOwner->iType = + TSConDOType ( DesToInt ( p->data->type->Data() ) ); + } + if ( p->data->uid ) + { + if( !IsJavaHash( p->data->uid->Data() ) ) + { + task->iRequestDataParams->iDataOwner->iUid = DesToUid( + p->data->uid->Data() ); + } + else + { + TPtr hashPtr = DesToHashLC( p->data->uid->Data() ); + task->iRequestDataParams->iDataOwner->iJavaHash = HBufC::NewL( hashPtr.Size() ); + task->iRequestDataParams->iDataOwner->iJavaHash->Des().Copy( hashPtr ); + CleanupStack::PopAndDestroy(); //DesToHashLC() + } + } + if ( p->data->drives ) + { + task->iRequestDataParams->iDataOwner->iDriveList = + DriveList ( p->data->drives->drive ); + } + if ( p->data->transferDataType ) + { + TInt intValue = DesToInt( p->data->transferDataType->Data() ); + task->iRequestDataParams->iDataOwner->iTransDataType = + static_cast (intValue); + } + } + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskRequestDataL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskUpdateDeviceInfoL() +// Sends a Update device info -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskUpdateDeviceInfoL( + ConML_UpdateDeviceInfoPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EUpdateDeviceInfo ); + CSConTask* task = CSConTask::NewLC( method ); + + if ( aContent->deviceInfo) + { + ConML_DeviceInfoPtr_t dPtr = aContent->deviceInfo; + if ( dPtr->version ) + { + task->iDevInfoParams->iVersion.Copy( dPtr->version->Data()); + } + if ( dPtr->maxObjectSize ) + { + task->iDevInfoParams->iMaxObjectSize = DesToInt( + dPtr->maxObjectSize->Data()); + } + if ( dPtr->supportedMethods ) + { + ConML_SupportedMethodsPtr_t smPtr = dPtr->supportedMethods; + if ( smPtr->install ) + { + task->iDevInfoParams->iInstallSupp = ETrue; + } + if ( smPtr->unInstall ) + { + task->iDevInfoParams->iUninstallSupp = ETrue; + } + if ( smPtr->listInstalledApps ) + { + task->iDevInfoParams->iInstAppsSupp = ETrue; + } + if ( smPtr->listDataOwners ) + { + task->iDevInfoParams->iDataOwnersSupp = ETrue; + } + if ( smPtr->setBurMode ) + { + task->iDevInfoParams->iSetBURModeSupp = ETrue; + } + if ( smPtr->getDataSize ) + { + task->iDevInfoParams->iGetSizeSupp = ETrue; + } + if ( smPtr->requestData ) + { + task->iDevInfoParams->iReqDataSupp = ETrue; + } + if ( smPtr->supplyData ) + { + task->iDevInfoParams->iSupplyDataSupp = ETrue; + } + if ( smPtr->reboot ) + { + task->iDevInfoParams->iRebootSupp = ETrue; + } + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskUpdateDeviceInfoL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskListPublicFilesL() +// Sends a List public files -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskListPublicFilesL( + ConML_ListPublicFilesPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EListPublicFiles ); + CSConTask* task = CSConTask::NewLC( method ); + if ( aContent->sid ) + { + for ( ConML_SIDListPtr_t p = aContent->sid; p && p->data; p = p->next ) + { + CSConDataOwner* dataOwner = new (ELeave) CSConDataOwner(); + CleanupStack::PushL( dataOwner ); + if ( p->data->type ) + { + dataOwner->iType = TSConDOType ( DesToInt( + p->data->type->Data() ) ); + } + if ( p->data->uid ) + { + if( !IsJavaHash( p->data->uid->Data() ) ) + { + dataOwner->iUid = DesToUid( p->data->uid->Data() ); + } + else + { + TPtr hashPtr = DesToHashLC( p->data->uid->Data() ); + dataOwner->iJavaHash = HBufC::NewL( hashPtr.Size() ); + dataOwner->iJavaHash->Des().Copy( hashPtr ); + CleanupStack::PopAndDestroy(); //DesToHashLC() + } + } + if ( p->data->drives ) + { + dataOwner->iDriveList = DriveList ( p->data->drives->drive ); + } + if ( p->data->packageInfo && p->data->packageInfo->name ) + { + // Unicode conversion from 8-bit to 16-bit + CnvUtfConverter::ConvertToUnicodeFromUtf8( + dataOwner->iPackageName, + p->data->packageInfo->name->Data()); + } + task->iPubFilesParams->iDataOwners.AppendL( dataOwner ); + CleanupStack::Pop( dataOwner ); + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskListPublicFilesL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskSupplyDataL() +// Sends a Supply data -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskSupplyDataL ( ConML_SupplyDataPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( ESupplyData ); + CSConTask* task = CSConTask::NewLC( method ); + if (aContent ) + { + for ( ConML_SIDListPtr_t p = aContent->sid; p && p->data; p = p->next ) + { + if ( p->data->type ) + { + task->iSupplyDataParams->iDataOwner->iType = + TSConDOType ( DesToInt( p->data->type->Data() ) ); + } + if ( p->data->uid ) + { + if( !IsJavaHash( p->data->uid->Data() ) ) + { + task->iSupplyDataParams->iDataOwner->iUid = DesToUid( + p->data->uid->Data() ); + } + else + { + TPtr hashPtr = DesToHashLC( p->data->uid->Data() ); + task->iSupplyDataParams->iDataOwner->iJavaHash = HBufC::NewL( hashPtr.Size() ); + task->iSupplyDataParams->iDataOwner->iJavaHash->Des().Copy( hashPtr ); + CleanupStack::PopAndDestroy(); //DesToHashLC() + } + } + if ( p->data->drives ) + { + task->iSupplyDataParams->iDataOwner->iDriveList = + DriveList ( p->data->drives->drive ); + } + if ( p->data->transferDataType ) + { + TInt intValue = DesToInt ( p->data->transferDataType->Data() ); + task->iSupplyDataParams->iDataOwner->iTransDataType = + static_cast (intValue); + } + if ( p->data->data ) + { + task->iSupplyDataParams->iRestoreData = HBufC8::NewL( + p->data->data->Data().Size() ); + *task->iSupplyDataParams->iRestoreData = p->data->data->Data(); + } + if ( p->data->moreData ) + { + task->iSupplyDataParams->iMoreData = ETrue; + } + else + { + task->iSupplyDataParams->iMoreData = EFalse; + } + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskSupplyDataL() : returned %d", ret ); + return ret; +} + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskGetDataOwnerStatusL() +// Sends a Get data owner status -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskGetDataOwnerStatusL + ( ConML_GetDataOwnerStatusPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EGetDataOwnerStatus ); + CSConTask* task = CSConTask::NewLC( method ); + + if ( aContent->dataOwners ) + { + for ( ConML_SIDListPtr_t p = aContent->dataOwners->sid; + p && p->data; p=p->next ) + { + CSConDataOwner* dataOwner = new (ELeave) CSConDataOwner(); + CleanupStack::PushL( dataOwner ); + if ( p->data->type ) + { + dataOwner->iType = TSConDOType (DesToInt( + p->data->type->Data() )); + } + if ( p->data->uid ) + { + if( !IsJavaHash( p->data->uid->Data() ) ) + { + dataOwner->iUid = DesToUid( p->data->uid->Data() ); + } + else + { + TPtr hashPtr = DesToHashLC( p->data->uid->Data() ); + dataOwner->iJavaHash = HBufC::NewL( hashPtr.Size() ); + dataOwner->iJavaHash->Des().Copy( hashPtr ); + CleanupStack::PopAndDestroy(); //DesToHashLC() + } + } + task->iGetDataOwnerParams->iDataOwners.AppendL( dataOwner ); + CleanupStack::Pop( dataOwner ); + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskGetDataOwnerStatusL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskRebootL() +// Sends a Reboot -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskRebootL( ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EReboot ); + CSConTask* task = CSConTask::NewLC( method ); + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskRebootL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskGetMetadataL() +// Sends a GetMetadata -task to PCCS service +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::TaskGetMetadataL( ConML_GetMetadataPtr_t aContent ) + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + TSConMethodName method ( EGetMetadata ); + CSConTask* task = CSConTask::NewLC( method ); + if( aContent ) + { + if ( aContent->filename ) + { + // Unicode conversion from 8-bit to 16-bit + CnvUtfConverter::ConvertToUnicodeFromUtf8(task->iGetMetadataParams->iFilename, + aContent->filename->Data()); + } + } + ret = iPCDHandler->PutTaskL( task ); + CleanupStack::Pop( task ); + LOGGER_WRITE_1( "CSConPCConnSession::TaskGetMetadataL() : returned %d", ret ); + return ret; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::TaskRebootL() +// Appends a status element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendStatusL( + ConML_ConMLPtr_t aContent, CSConStatusReply* reply ) + { + TRACE_FUNC_ENTRY; + + if ( !reply ) + { + LOGGER_WRITE( "CSConPCConnSession::AppendStatus() : No data in reply!" ); + return; + } + aContent->status = new ( ELeave ) ConML_Status_t(); + + if ( reply->iTasks.Count() > 0 ) + { + for ( TInt i=0; i < reply->iTasks.Count(); i ++) + { + ConML_TaskListPtr_t task = new ( ELeave ) ConML_TaskList_t(); + CleanupStack::PushL( task ); + GenericListAddL ( &aContent->status->task, task ); + CleanupStack::Pop(); // task + + task->data = new ( ELeave ) ConML_Task_t(); + task->data->id = new ( ELeave ) pcdata_t(); + task->data->id->SetDataL ( IntToDesLC(reply->iTasks[i]->iTaskId) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + TSConMethodName method ( reply->iTasks[i]->iMethod ); + + switch ( method ) + { + case EUpdateDeviceInfo: + task->data->updateDeviceInfo = + new ( ELeave ) ConML_UpdateDeviceInfo_t(); + task->data->updateDeviceInfo->results = + new ( ELeave ) ConML_Results_t(); + AppendUpdateDeviceInfoResultsL( + task->data->updateDeviceInfo->results, + reply->iTasks[i]->iDevInfoParams ); + break; + + case ESetBURMode: + task->data->setBurMode = + new ( ELeave ) ConML_SetBURMode_t(); + task->data->setBurMode->results = + new ( ELeave) ConML_Results_t(); + AppendSetBURModeResultsL( + task->data->setBurMode->results, + reply->iTasks[i]->iBURModeParams ); + break; + + case EListInstalledApps: + task->data->listInstalledApps = + new ( ELeave ) ConML_ListInstalledApps_t(); + task->data->listInstalledApps->results = + new ( ELeave ) ConML_Results_t(); + AppendListInstalledAppsResultsL( + task->data->listInstalledApps->results, + reply->iTasks[i]->iListAppsParams); + break; + + case EInstall: + task->data->install = new ( ELeave ) ConML_Install_t(); + task->data->install->results = + new ( ELeave ) ConML_Results_t(); + AppendInstallResultsL( + task->data->install->results, + reply->iTasks[i]->iInstallParams ); + break; + + case EUninstall: + task->data->unInstall = new ( ELeave ) ConML_UnInstall_t(); + task->data->unInstall->results = + new ( ELeave ) ConML_Results_t(); + AppendUninstallResultsL( + task->data->unInstall->results, + reply->iTasks[i]->iUninstallParams ); + break; + + case EListDataOwners: + task->data->listDataOwners = + new ( ELeave ) ConML_ListDataOwners_t(); + task->data->listDataOwners->results = + new ( ELeave ) ConML_Results_t(); + AppendListDataOwnersResultsL( + task->data->listDataOwners->results, + reply->iTasks[i]->iListDataOwnersParams ); + break; + + case EGetDataOwnerStatus: + task->data->getDataOwnerStatus = + new ( ELeave ) ConML_GetDataOwnerStatus_t(); + task->data->getDataOwnerStatus->results = + new ( ELeave ) ConML_Results_t(); + AppendGetDataOwnerStatusResultsL( + task->data->getDataOwnerStatus->results, + reply->iTasks[i]->iGetDataOwnerParams); + break; + + case EGetDataSize: + task->data->getDataSize = + new ( ELeave ) ConML_GetDataSize_t(); + task->data->getDataSize->results = + new ( ELeave ) ConML_Results_t(); + AppendGetDataSizeResultsL( + task->data->getDataSize->results, + reply->iTasks[i]->iGetDataSizeParams ); + break; + + case EListPublicFiles: + task->data->listPublicFiles = + new ( ELeave ) ConML_ListPublicFiles_t(); + task->data->listPublicFiles->results = + new ( ELeave ) ConML_Results_t(); + AppendListPublicFilesResultsL ( + task->data->listPublicFiles->results, + reply->iTasks[i]->iPubFilesParams ); + break; + + case ERequestData: + task->data->requestData = + new ( ELeave ) ConML_RequestData_t(); + task->data->requestData->results = + new ( ELeave ) ConML_Results_t(); + AppendRequestDataResultsL( + task->data->requestData->results, + reply->iTasks[i]->iRequestDataParams ); + break; + + case ESupplyData: + task->data->supplyData = + new ( ELeave ) ConML_SupplyData_t(); + task->data->supplyData->results = + new ( ELeave ) ConML_Results_t(); + AppendSupplyDataResultsL ( + task->data->supplyData->results, + reply->iTasks[i]->iSupplyDataParams ); + break; + + case EGetMetadata: + task->data->getMetadata = + new ( ELeave ) ConML_GetMetadata_t(); + task->data->getMetadata->results = + new ( ELeave ) ConML_Results_t(); + AppendGetMetadataResultsL ( + task->data->getMetadata->results, + reply->iTasks[i]->iGetMetadataParams ); + break; + + default: + LOGGER_WRITE_1( "CSConPCConnSession:: AppendStatus() : Unknown method %d ", method ); + break; + } + } + } + else + { + LOGGER_WRITE( "CSConPCConnSession::AppendStatus() : No Task " ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendUpdateDeviceInfoResultsL() +// Appends a update device info -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendUpdateDeviceInfoResultsL + ( ConML_ResultsPtr_t aContent, CSConUpdateDeviceInfo* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL ( aContent, aResult->iProgress ); + + aContent->deviceInfo = new ( ELeave ) ConML_DeviceInfo_t(); + aContent->deviceInfo->version = new ( ELeave ) pcdata_t(); + aContent->deviceInfo->version->SetDataL ( aResult->iVersion ); + + aContent->deviceInfo->supportedMethods = + new ( ELeave ) ConML_SupportedMethods_t(); + + if ( aResult->iInstallSupp ) + { + aContent->deviceInfo->supportedMethods->install = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iUninstallSupp ) + { + aContent->deviceInfo->supportedMethods->unInstall = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iInstAppsSupp ) + { + aContent->deviceInfo->supportedMethods->listInstalledApps = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iDataOwnersSupp ) + { + aContent->deviceInfo->supportedMethods->listDataOwners = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iSetBURModeSupp ) + { + aContent->deviceInfo->supportedMethods->setBurMode = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iGetSizeSupp ) + { + aContent->deviceInfo->supportedMethods->getDataSize = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iReqDataSupp ) + { + aContent->deviceInfo->supportedMethods->requestData = + new (ELeave ) pcdata_t(); + } + if ( aResult->iSupplyDataSupp ) + { + aContent->deviceInfo->supportedMethods->supplyData = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iRebootSupp ) + { + aContent->deviceInfo->supportedMethods->reboot = + new ( ELeave ) pcdata_t(); + } + aContent->deviceInfo->maxObjectSize = new ( ELeave ) pcdata_t(); + aContent->deviceInfo->maxObjectSize->SetDataL ( IntToDesLC( + aResult->iMaxObjectSize )); + CleanupStack::PopAndDestroy(); // IntToDesLC + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendSetBURModeResultsL() +// Appends a Set BUR mode -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendSetBURModeResultsL ( + ConML_ResultsPtr_t aContent, CSConSetBURMode* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL ( aContent, aResult->iProgress ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendListInstalledAppsResultsL() +// Appends a List installed apps -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendListInstalledAppsResultsL ( + ConML_ResultsPtr_t aContent, CSConListInstApps* aResult ) + { + TRACE_FUNC_ENTRY; + + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL ( aContent, aResult->iProgress ); + + if ( aResult->iApps.Count() > 0 ) + { + // 6 * KMaxFileName should be enought + // ( 5 items of TFileName and uid + type + size + 7* "#" ) + HBufC8* buf = HBufC8::NewLC( 6 * KMaxFileName ); + TPtr8 ptrBuf = buf->Des(); + + aContent->applications = new ( ELeave ) ConML_Applications_t(); + for ( TInt i=0; iiApps.Count(); i++) + { + ConML_ApplicationListPtr_t app = + new ( ELeave )ConML_ApplicationList_t(); + CleanupStack::PushL ( app ); + GenericListAddL ( &aContent->applications->application, app ); + CleanupStack::Pop(); // app + + app->data = new ( ELeave ) ConML_Application_t(); + app->data->name = new ( ELeave ) pcdata_t(); + app->data->name->SetDataL( BufToDesLC( + aResult->iApps[i]->iName)); + CleanupStack::PopAndDestroy(); // BufToDesLC + + // create uid: UID # Type # Size # Version # Vendor # Parent app. name # WidgetBundleId # + LOGGER_WRITE( "CSConPCConnSession::AppendListInstalledAppsResultsL() : Create Uid" ); + + ptrBuf.Copy( UidToDesLC( aResult->iApps[i]->iUid ) ); + CleanupStack::PopAndDestroy(); // UidToDesLC + + ptrBuf.Append( KSConAppInfoSeparator ); + + ptrBuf.Append( IntToDesLC(aResult->iApps[i]->iType )); + CleanupStack::PopAndDestroy(); // IntToDesLC + + ptrBuf.Append( KSConAppInfoSeparator ); + + ptrBuf.Append( IntToDesLC(aResult->iApps[i]->iSize ) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + ptrBuf.Append( KSConAppInfoSeparator ); + ptrBuf.Append( aResult->iApps[i]->iVersion ); + + ptrBuf.Append( KSConAppInfoSeparator ); + ptrBuf.Append( BufToDesLC( aResult->iApps[i]->iVendor ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + + ptrBuf.Append( KSConAppInfoSeparator ); + ptrBuf.Append( BufToDesLC( aResult->iApps[i]->iParentName ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + + ptrBuf.Append( KSConAppInfoSeparator ); + if (aResult->iApps[i]->iWidgetBundleId) + { + ptrBuf.Append( BufToDesLC( *aResult->iApps[i]->iWidgetBundleId ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + } + + ptrBuf.Append( KSConAppInfoSeparator ); + + LOGGER_WRITE( "CSConPCConnSession::AppendListInstalledAppsResultsL() : set data" ); + app->data->uid = new ( ELeave ) pcdata_t(); + app->data->uid->SetDataL( *buf ); + + LOGGER_WRITE( "CSConPCConnSession::AppendListInstalledAppsResultsL() : Info added" ); + } + CleanupStack::PopAndDestroy(buf); + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendListPublicFilesResultsL() +// Appends a List public files -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendListPublicFilesResultsL ( + ConML_ResultsPtr_t aContent, CSConListPublicFiles* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL ( aContent, aResult->iProgress ); + + if ( aResult->iFiles.Count() > 0 ) + { + aContent->files = new ( ELeave ) ConML_Files_t(); + for ( TInt i=0;iiFiles.Count(); i++ ) + { + ConML_FileListPtr_t file = new ( ELeave ) ConML_FileList_t(); + CleanupStack::PushL( file ); + GenericListAddL ( &aContent->files->file, file ); + CleanupStack::Pop(); // file + + file->data = new ( ELeave ) ConML_File_t(); + file->data->name = new ( ELeave ) pcdata_t(); + file->data->name->SetDataL( BufToDesLC ( + aResult->iFiles[i]->iPath ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + + file->data->modified = new ( ELeave ) pcdata_t(); + file->data->modified->SetDataL( BufToDesLC ( + aResult->iFiles[i]->iModified ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + + file->data->size = new ( ELeave ) pcdata_t(); + file->data->size->SetDataL( IntToDesLC ( + aResult->iFiles[i]->iSize ) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + file->data->userPerm = new ( ELeave ) pcdata_t(); + switch ( aResult->iFiles[i]->iUserPerm ) + { + case EPermReadOnly: + file->data->userPerm->SetDataL ( KSConPermReadOnly ); + break; + + case EPermNormal: + file->data->userPerm->SetDataL ( KSConPermNormal ); + break; + + default: + LOGGER_WRITE( "CSConPCConnSession:: AppendListPublicFilesResultsL() : Unknown userPerm! " ); + break; + } + } + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendRequestDataResultsL() +// Appends a Request data -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendRequestDataResultsL( + ConML_ResultsPtr_t aContent, CSConRequestData* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL ( aContent, aResult->iProgress ); + + if ( aResult->iMoreData ) + { + aContent->moreData = new ( ELeave ) pcdata_t(); + } + if ( aResult->iBackupData ) + { + aContent->data = new ( ELeave ) pcdata_t(); + aContent->data->SetDataL( aResult->iBackupData->Des() ); + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendSupplyDataResultsL() +// Appends a Supply data -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendSupplyDataResultsL( + ConML_ResultsPtr_t aContent, CSConSupplyData* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL( aContent, aResult->iProgress ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendInstallResultsL() +// Appends an Install -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendInstallResultsL( + ConML_ResultsPtr_t aContent, CSConInstall* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL( aContent, aResult->iProgress ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendUninstallResultsL() +// Appends an Uninstall -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendUninstallResultsL( + ConML_ResultsPtr_t aContent, CSConUninstall* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + LOGGER_WRITE( "CSConPCConnSession::AppendUninstallResultsL() Complete" ); + aContent->complete = new ( ELeave ) pcdata_t(); + } + LOGGER_WRITE_1( "CSConPCConnSession::AppendUninstallResultsL() iProgress: %d", aResult->iProgress ); + AppendProgressL( aContent, aResult->iProgress ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendListDataOwnersResultsL() +// Appends a List data owners -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendListDataOwnersResultsL ( + ConML_ResultsPtr_t aContent, CSConListDataOwners* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL( aContent, aResult->iProgress ); + + if ( aResult->iDataOwners.Count() > 0 ) + { + aContent->dataOwners = new ( ELeave ) ConML_DataOwners_t(); + for ( TInt i=0; i < aResult->iDataOwners.Count(); i ++) + { + ConML_SIDListPtr_t sid = new ( ELeave ) ConML_SIDList_t(); + CleanupStack::PushL( sid ); + GenericListAddL ( &aContent->dataOwners->sid, sid ); + CleanupStack::Pop(); + + sid->data = new ( ELeave ) ConML_SID_t(); + + sid->data->type = new ( ELeave ) pcdata_t(); + sid->data->type->SetDataL ( IntToDesLC ( + aResult->iDataOwners[i]->iType) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + sid->data->uid = new ( ELeave ) pcdata_t(); + + if( aResult->iDataOwners[i]->iUid.iUid ) + { + sid->data->uid->SetDataL ( UidToDesLC ( + aResult->iDataOwners[i]->iUid ) ); + CleanupStack::PopAndDestroy(); // UidToDesLC + } + + if( aResult->iDataOwners[i]->iJavaHash ) + { + sid->data->uid->SetDataL ( HashToDesLC ( + aResult->iDataOwners[i]->iJavaHash->Des() ) ); + CleanupStack::PopAndDestroy(); // HashToDesLC + } + + if ( HasDrives ( aResult->iDataOwners[i]->iDriveList ) ) + { + sid->data->drives = new ( ELeave ) ConML_Drives_t(); + AppendDrivesL ( sid->data->drives, + aResult->iDataOwners[i]->iDriveList ); + } + + if ( aResult->iDataOwners[i]->iPackageName.Length() > 0 ) + { + sid->data->packageInfo = + new ( ELeave ) ConML_PackageInfo_t(); + sid->data->packageInfo->name = new ( ELeave ) pcdata_t(); + sid->data->packageInfo->name->SetDataL ( BufToDesLC ( + aResult->iDataOwners[i]->iPackageName ) ); + + CleanupStack::PopAndDestroy(); // BufToDesLC + } + + if ( aResult->iDataOwners[i]->iHasFiles || + aResult->iDataOwners[i]->iSupportsInc || + aResult->iDataOwners[i]->iDelayToPrep || + aResult->iDataOwners[i]->iReqReboot ) + { + sid->data->burOptions = new ( ELeave ) ConML_BUROptions_t(); + if ( aResult->iDataOwners[i]->iHasFiles ) + { + sid->data->burOptions->hasFiles = + new ( ELeave ) pcdata_t(); + sid->data->burOptions->hasFiles->SetDataL( IntToDesLC( + aResult->iDataOwners[i]->iHasFiles )); + + CleanupStack::PopAndDestroy(); // IntToDesLC + } + if ( aResult->iDataOwners[i]->iSupportsInc ) + { + sid->data->burOptions->supportsInc = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iDataOwners[i]->iDelayToPrep ) + { + sid->data->burOptions->delayToPrepareData = + new ( ELeave ) pcdata_t(); + } + if ( aResult->iDataOwners[i]->iReqReboot ) + { + sid->data->burOptions->requiresReboot = + new ( ELeave ) pcdata_t(); + } + } + } + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendGetDataOwnerStatusResultsL() +// Appends a Get data owner status -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendGetDataOwnerStatusResultsL + ( ConML_ResultsPtr_t aContent, CSConGetDataOwnerStatus* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL( aContent, aResult->iProgress ); + + if ( aResult->iDataOwners.Count() > 0 ) + { + aContent->dataOwners = new ( ELeave ) ConML_DataOwners_t(); + for ( TInt i=0; i < aResult->iDataOwners.Count(); i ++) + { + ConML_SIDListPtr_t sid = new ( ELeave ) ConML_SIDList_t(); + CleanupStack::PushL( sid ); + GenericListAddL ( &aContent->dataOwners->sid, sid ); + CleanupStack::Pop(); + + sid->data = new ( ELeave ) ConML_SID_t(); + + sid->data->type = new ( ELeave ) pcdata_t(); + sid->data->type->SetDataL ( IntToDesLC ( + aResult->iDataOwners[i]->iType) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + sid->data->uid = new ( ELeave ) pcdata_t(); + sid->data->uid->SetDataL ( UidToDesLC ( + aResult->iDataOwners[i]->iUid ) ); + CleanupStack::PopAndDestroy(); // UidToDesLC + + sid->data->dataOwnerStatus = new ( ELeave ) pcdata_t(); + sid->data->dataOwnerStatus->SetDataL ( IntToDesLC( + aResult->iDataOwners[i]->iDataOwnStatus )); + + CleanupStack::PopAndDestroy(); // IntToDesLC + } + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendGetDataSizeResultsL() +// Appends a Get data owner size -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendGetDataSizeResultsL ( + ConML_ResultsPtr_t aContent, CSConGetDataSize* aResult ) + { + TRACE_FUNC_ENTRY; + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + } + AppendProgressL( aContent, aResult->iProgress ); + + if ( aResult->iDataOwners.Count() > 0 ) + { + aContent->dataOwners = new ( ELeave ) ConML_DataOwners_t(); + + for ( TInt i=0; i< aResult->iDataOwners.Count(); i++ ) + { + ConML_SIDListPtr_t sid = new ( ELeave ) ConML_SIDList_t(); + CleanupStack::PushL( sid ); + GenericListAddL ( &aContent->dataOwners->sid, sid ); + CleanupStack::Pop(); + + sid->data = new ( ELeave ) ConML_SID_t(); + + sid->data->type = new ( ELeave ) pcdata_t(); + sid->data->type->SetDataL ( IntToDesLC ( + aResult->iDataOwners[i]->iType) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + sid->data->uid = new ( ELeave ) pcdata_t(); + + if( aResult->iDataOwners[i]->iUid.iUid ) + { + sid->data->uid->SetDataL ( UidToDesLC ( + aResult->iDataOwners[i]->iUid ) ); + CleanupStack::PopAndDestroy(); // UidToDesLC + } + + if( aResult->iDataOwners[i]->iJavaHash ) + { + sid->data->uid->SetDataL ( HashToDesLC ( + aResult->iDataOwners[i]->iJavaHash->Des() ) ); + CleanupStack::PopAndDestroy(); // HashToDesLC + } + + if ( HasDrives ( aResult->iDataOwners[i]->iDriveList ) ) + { + sid->data->drives = new ( ELeave ) ConML_Drives_t(); + AppendDrivesL ( sid->data->drives, + aResult->iDataOwners[i]->iDriveList ); + } + + sid->data->size = new ( ELeave ) pcdata_t(); + sid->data->size->SetDataL( IntToDesLC( + aResult->iDataOwners[i]->iSize ) ); + CleanupStack::PopAndDestroy(); // IntToDesLC + + sid->data->transferDataType = new ( ELeave ) pcdata_t(); + sid->data->transferDataType->SetDataL( IntToDesLC( + aResult->iDataOwners[i]->iTransDataType ) ); + + CleanupStack::PopAndDestroy(); // IntToDesLC + } + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendGetMetadataResultsL() +// Appends a GetMetadata -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendGetMetadataResultsL( + ConML_ResultsPtr_t aContent, CSConGetMetadata* aResult ) + { + TRACE_FUNC_ENTRY; + + if ( aResult ) + { + if ( aResult->iComplete ) + { + aContent->complete = new ( ELeave ) pcdata_t(); + + // add filename only if task is completed + aContent->filename = new ( ELeave ) pcdata_t(); + aContent->filename->SetDataL( BufToDesLC(aResult->iFilename ) ); + CleanupStack::PopAndDestroy(); // BufToDesLC + } + AppendProgressL( aContent, aResult->iProgress ); + + if ( aResult->iData ) + { + aContent->data = new ( ELeave ) pcdata_t(); + aContent->data->SetDataL( aResult->iData->Des() ); + } + + if ( aResult->iMoreData ) + { + aContent->moreData = new ( ELeave ) pcdata_t(); + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendProgressL() +// Appends a Progress -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendProgressL ( + ConML_ResultsPtr_t aContent, TInt progress ) + { + TRACE_FUNC_ENTRY; + aContent->progress = new ( ELeave ) ConML_Progress_t(); + aContent->progress->value = new ( ELeave ) pcdata_t(); + aContent->progress->value->SetDataL ( IntToDesLC ( progress )); + CleanupStack::PopAndDestroy(); // IntToDesLC + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::AppendDrivesL() +// Appends a Drives -element from the reply data of PCCS +// ----------------------------------------------------------------------------- +// +void CSConPCConnSession::AppendDrivesL( + ConML_DrivesPtr_t aContent, TDriveList aDrives ) + { + TRACE_FUNC_ENTRY; + + for ( TInt i = 0; idrive, drive ); + CleanupStack::Pop(); // drive + + drive->data = new ( ELeave ) ConML_Drive_t(); + drive->data->name = new ( ELeave ) pcdata_t(); + drive->data->name->SetDataL( DriveNumToDesLC(i+KSConFirstDrive )); + CleanupStack::PopAndDestroy(); // IntToDesLC + } + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DriveList() +// Converts an Drives -element to TDriveList +// ----------------------------------------------------------------------------- +// +TDriveList CSConPCConnSession::DriveList( ConML_DriveListPtr_t aContent ) + { + TBuf8 driveBuf; + TDriveList driveList; + + for ( ConML_DriveListPtr_t p = aContent; p && p->data; p = p->next ) + { + if ( p->data->name ) + { + driveBuf.Append( p->data->name->Data() ); + } + } + + for ( TInt i = 0; iDes(); + ptrBuf.Num(anInt); + return *buf; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DriveNumToDesLC() +// Convers a drive number to equivalent drive letter +// ----------------------------------------------------------------------------- +// +TDesC8& CSConPCConnSession::DriveNumToDesLC( const TInt& anInt ) + { + TChar mark ( anInt ); + HBufC8* buf = HBufC8::NewLC(1); + TPtr8 ptrBuf = buf->Des(); + ptrBuf.Append(mark); + return *buf; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::BufToDesLC() +// converts a buffer to descriptor +// ----------------------------------------------------------------------------- +// +TDesC8& CSConPCConnSession::BufToDesLC( const TDesC& aBuf) + { + HBufC8* buf = CnvUtfConverter::ConvertFromUnicodeToUtf8L( aBuf ); + CleanupStack::PushL( buf ); + return *buf; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::UidToDesLC() +// converts an UID to a descriptor +// ----------------------------------------------------------------------------- +// +TDesC8& CSConPCConnSession::UidToDesLC( const TUid& aUid ) + { + HBufC8* buf = HBufC8::NewLC(10); + TPtr8 ptrBuf = buf->Des(); + ptrBuf.Copy (aUid.Name().Mid(1, 8) ); + return *buf; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DesToUid() +// converts a descriptor to a UID value +// ----------------------------------------------------------------------------- +// +TUid CSConPCConnSession::DesToUid ( const TDesC8& aDes ) + { + TLex8 lex( aDes ); + TUint32 value; + lex.Val( value, EHex ); + TUid uid = TUid::Uid( value ); + return uid; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DesToInt() +// converts a descriptor to a integer value +// ----------------------------------------------------------------------------- +// +TInt CSConPCConnSession::DesToInt( const TDesC8& aDes) + { + TLex8 lex(aDes); + TInt value = 0; + lex.Val(value); + return value; + } + +// ----------------------------------------------------------------------------- +// CSConPCConnSession::HasDrives() +// Returns ETrue if at least one drive is found from the given TDriveList +// ----------------------------------------------------------------------------- +// +TBool CSConPCConnSession::HasDrives( TDriveList& aDrive ) + { + TBool hasDrives ( EFalse ); + for ( TInt i = 0; iDes(); + // Unicode conversion from 16-bit to 8-bit + CnvUtfConverter::ConvertFromUnicodeToUtf8(ptrBuf, aBuf); + //Add JAVA_ identifier to the begining of the hash + ptrBuf.Insert(0, KSConJavaHashId); + return *buf; + } +// ----------------------------------------------------------------------------- +// CSConPCConnSession::DesToHashLC() +// converts descriptor to Java hash +// ----------------------------------------------------------------------------- +// +TPtr CSConPCConnSession::DesToHashLC( const TDesC8& aDes ) + { + HBufC* buf = HBufC::NewLC(aDes.Size()); + TPtr ptrBuf = buf->Des(); + // Unicode conversion from 8-bit to 16-bit + CnvUtfConverter::ConvertToUnicodeFromUtf8(ptrBuf, aDes); + //Delete JAVA_ + ptrBuf.Delete(0, KSConJavaHashId().Length()); + return ptrBuf; + } +// ----------------------------------------------------------------------------- +// CSConPCConnSession::IsJavaHash() +// Returns ETrue if descriptor is Java hash, else EFalse +// ----------------------------------------------------------------------------- +// +TBool CSConPCConnSession::IsJavaHash( const TDesC8& aDes ) + { + if ( aDes.FindC(KSConJavaHashId) == 0 ) + { + return ETrue; + } + else + { + return EFalse; + } + } + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/group/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/group/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,27 @@ +/* +* Copyright (c) 2009-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Build information file for project SyncServer +* +*/ + + +PRJ_EXPORTS +../rom/sconsyncserver.iby CORE_APP_LAYER_IBY_EXPORT_PATH(sconsyncserver.iby) + +PRJ_PLATFORMS +DEFAULT + +PRJ_MMPFILES +sconsyncserver.mmp + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/group/sconsyncserver.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/group/sconsyncserver.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,61 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: sconsyncserver mmp file +* +*/ + + +#include +#include + + +TARGET sconsyncserver.exe +TARGETTYPE exe + +// Same capabilities than in DS Ui application +CAPABILITY LocalServices ReadUserData WriteUserData ReadDeviceData WriteDeviceData NetworkServices UserEnvironment ProtServ SwEvent NetworkControl Location + +UID 0x0 0x2001A964 +VENDORID VID_DEFAULT + +EPOCSTACKSIZE 0x2000 +EPOCHEAPSIZE 0x500 0x800000 // minimum and maximum heap sizes + +SOURCEPATH ../src +SOURCE sconsyncserver.cpp +SOURCE sconsyncsession.cpp +SOURCE sconsyncrelationship.cpp +SOURCE sconasynchandler.cpp +SOURCE cscontimeout.cpp + +// common components (dataproviderinfo) +SOURCEPATH ../../../clients/syncclient/src +USERINCLUDE ../../../clients/syncclient/inc +SOURCE scondataproviderinfo.cpp + +USERINCLUDE ..\inc + +// Default system include paths for middleware layer modules. +MW_LAYER_SYSTEMINCLUDE + +DEBUGLIBRARY flogger.lib +LIBRARY euser.lib +LIBRARY efsrv.lib +LIBRARY bafl.lib +LIBRARY ecom.lib +LIBRARY estor.lib // CDictionaryFileStore +LIBRARY smldataprovider.lib +LIBRARY nsmlchangefinder.lib +LIBRARY smlstoreformat.lib +LIBRARY charconv.lib diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/cscontimeout.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/cscontimeout.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,79 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCSconTimeOut header file +* +*/ + + +#ifndef CSCONTIMEOUT_H +#define CSCONTIMEOUT_H + +#include // For CActive, link against: euser.lib +#include // For RTimer, link against: euser.lib + +class MTimeOutObserver + { +public: + virtual void TimeOut() = 0; + }; + +class CCSconTimeOut : public CActive + { +public: + // Cancel and destroy + ~CCSconTimeOut(); + + // Two-phased constructor. + static CCSconTimeOut* NewL( MTimeOutObserver& aTimeOutObserver ); + +public: + // New functions + // Function for making the timeout request + void Start(TTimeIntervalMicroSeconds32 aDelay); + +private: + // C++ constructor + CCSconTimeOut( MTimeOutObserver& aTimeOutObserver ); + + // Second-phase constructor + void ConstructL(); + +private: + // From CActive + // Handle completion + void RunL(); + + // How to cancel me + void DoCancel(); + + // Override to handle leaves from RunL(). Default implementation causes + // the active scheduler to panic. + TInt RunError(TInt aError); + +private: + enum TCSconTimeOutState + { + EUninitialized, // Uninitialized + EInitialized, // Initalized + EError + // Error condition + }; + +private: + TInt iState; // State of the active object + RTimer iTimer; // Provides async timing service + MTimeOutObserver& iTimeOutObserver; + }; + +#endif // CSCONTIMEOUT_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/debug.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/debug.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,130 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Debug utility for SyncServer +* +*/ + + +#ifndef _SECON_DEBUG_H +#define _SECON_DEBUG_H + +#ifdef _DEBUG + + // File logging + #define __FLOGGING__ + + #include + #ifdef __FLOGGING__ + #include + #include + #endif + + NONSHARABLE_CLASS(TOverflowTruncate16) : public TDes16Overflow + { + public: + void Overflow(TDes16& /*aDes*/) {} + }; + + NONSHARABLE_CLASS(TOverflowTruncate8) : public TDes8Overflow + { + public: + void Overflow(TDes8& /*aDes*/) {} + }; + + _LIT( KLogDir, "SECON" ); + _LIT( KLogFile, "SeconDebug.txt" ); + + _LIT(KTracePrefix16, "[SeConSync] "); + _LIT8(KTracePrefix8, "[SeConSync] "); + _LIT8(KFuncEntryFormat8, "%S : Begin"); + _LIT8(KFuncExitFormat8, "%S : End"); + _LIT8(KFuncFormat8, "><%S"); + + const TInt KMaxLogLineLength = 512; + + // old function loggin macros + #define FLOG(a) {FPrint(a);} + #define FLOG_1(a,b) {FPrint(a,b);} + #define FLOG_2(a,b,c) {FPrint(a,b,c);} + #define FTRACE(a) {a;} + #define LOGGER_ENTERFN( name ) {TRACE_FUNC_ENTRY;} + #define LOGGER_LEAVEFN( name ) {TRACE_FUNC_EXIT;} + + #define LOGGER_WRITE( text ) {_LIT( KTemp, text ); FPrint( KTemp );} + #define LOGGER_WRITE_1( text,par1 ) {_LIT( KTemp, text ); FPrint( KTemp, par1 );} + #define LOGGER_WRITE8_1( text,par1 ) {_LIT8( KTemp, text ); FPrint( KTemp, par1 );} + #define LOGGER_WRITE_2( text,par1,par2 ) {_LIT( KTemp, text ); FPrint( KTemp, par1, par2 );} + #define LOGGER_WRITE_3( text,par1,par2,par3 ) {_LIT( KTemp, text ); FPrint( KTemp, par1, par2, par3 );} + + // New function logging macros + #define TRACE_FUNC_ENTRY {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncEntryFormat8, &ptr8);} + #define TRACE_FUNC_EXIT {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncExitFormat8, &ptr8);} + #define TRACE_FUNC {TPtrC8 ptr8((TUint8*)__PRETTY_FUNCTION__); FPrint(KFuncFormat8, &ptr8);} + + // Declare the FPrint function + inline void FPrint( TRefByValue aFmt, ...) + { + VA_LIST list; + VA_START(list,aFmt); + #ifdef __FLOGGING__ + RFileLogger::WriteFormat( KLogDir, KLogFile, EFileLoggingModeAppend, aFmt, list ); + #endif + TBuf16 theFinalString; + theFinalString.Append(KTracePrefix16); + TOverflowTruncate16 overflow; + theFinalString.AppendFormatList(aFmt,list,&overflow); + RDebug::Print(theFinalString); + } + + // Declare the FPrint function + inline void FPrint(TRefByValue aFmt, ...) + { + VA_LIST list; + VA_START(list, aFmt); + #ifdef __FLOGGING__ + RFileLogger::WriteFormat(KLogDir, KLogFile, EFileLoggingModeAppend, aFmt, list); + #endif + TOverflowTruncate8 overflow; + TBuf8 buf8; + buf8.Append(KTracePrefix8); + buf8.AppendFormatList(aFmt, list, &overflow); + TBuf16 buf16(buf8.Length()); + buf16.Copy(buf8); + TRefByValue tmpFmt(_L("%S")); + RDebug::Print(tmpFmt, &buf16); + } +#else + + // No loggings --> reduced code size + #define FLOG(a) + #define FLOG_1(a,b) + #define FLOG_2(a,b,c) + #define FTRACE(a) + #define LOGGER_ENTERFN( name ) + #define LOGGER_LEAVEFN( name ) + #define LOGGER_WRITE( text ) + #define LOGGER_WRITE_1( text, par1 ) + #define LOGGER_WRITE8_1( text, par1 ) + #define LOGGER_WRITE_2( text, par1, par2 ) + #define LOGGER_WRITE_3( text, par1, par2, par3 ) + #define TRACE_FUNC_ENTRY + #define TRACE_FUNC_EXIT + #define TRACE_FUNC + +#endif //_DEBUG + +#endif // SECON_DEBUG_H + +// End of file + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/logdatastoreformat.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/logdatastoreformat.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,98 @@ +/* +* Copyright (c) 2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Simple class for tracing datastore format +* +*/ + +#ifndef LOGDATASTOREFORMAT_H_ +#define LOGDATASTOREFORMAT_H_ + +// +#include "debug.h" + +NONSHARABLE_CLASS(TLogDataStoreFormat) + { + public: +#ifndef _DEBUG +// does nothing on release version +static void TLogDataStoreFormat::LogDataStoreFormatL( const TDesC& /*aLogInfo*/, const CSmlDataStoreFormat& /*aDataStoreFormat*/ ) + { + } +#else +static void TLogDataStoreFormat::LogDataStoreFormatL( const TDesC& aLogInfo, const CSmlDataStoreFormat& aDataStoreFormat ) + { + LOGGER_WRITE_1("LogDataStoreFormatL, aLogInfo: %S", &aLogInfo); + LOGGER_WRITE_1("DisplayName: %S", &aDataStoreFormat.DisplayName()); + TBool hasMaxSize = aDataStoreFormat.IsSupported( CSmlDataStoreFormat::EOptionHasMaxSize ); + TBool hasMaxItems = aDataStoreFormat.IsSupported( CSmlDataStoreFormat::EOptionHasMaxItems ); + TBool hierarcial = aDataStoreFormat.IsSupported( CSmlDataStoreFormat::EOptionHierarchial ); + LOGGER_WRITE_1("hasMaxSize: %d", (TInt)hasMaxSize); + LOGGER_WRITE_1("hasMaxItems: %d", (TInt)hasMaxItems); + LOGGER_WRITE_1("hierarcial: %d", (TInt)hierarcial); + LOGGER_WRITE_1("MimeFormatCount: %d", aDataStoreFormat.MimeFormatCount()); + for ( TInt i = 0; i < aDataStoreFormat.MimeFormatCount(); i++) + { + LOGGER_WRITE_1(" MimeFormat(%d)",i); + const CSmlMimeFormat& mimeformat = aDataStoreFormat.MimeFormat(i); + LOGGER_WRITE8_1(" MimeType: %S", &mimeformat.MimeType().DesC()); + LOGGER_WRITE8_1(" MimeVersion: %S", &mimeformat.MimeVersion().DesC()); + LOGGER_WRITE_1( " FieldLevel, bool: %d", (TInt) mimeformat.FieldLevel()); + LOGGER_WRITE_1( " PropertyCount: %d", mimeformat.PropertyCount()); + for ( TInt j=0; j +#include + +#include +#include + +#include "cscontimeout.h" + +class CSmlDataStore; +class CSconSyncRelationship; +class CSmlDataProvider; +class CNSmlDataItemUidSet; +class CSmlDataStoreFormat; + +NONSHARABLE_CLASS ( CSconAsyncHandler ): public CActive, MTimeOutObserver +{ +public: + static CSconAsyncHandler* NewL(); + ~CSconAsyncHandler(); + void HandleServiceL( const RMessage2& aMessage ); + +private: // From CActive + void RunL(); + TInt RunError(TInt aError); + void DoCancel(); + +private: // From MTimeOutObserver + void TimeOut(); + +private: + + CSconAsyncHandler(); + void ConstructL(); + + void HandleChunkMessage(); + void ListAllImplementationsL(); + void OpenStoreL(); + + void OpenItemL(); + void OpenItemCompletedL( TInt aError ); + + void CreateItemL(); + void CreateItemCompletedL( TInt aError ); + void ReplaceItemL(); + void ReplaceItemCompletedL( TInt aError ); + void MoveItemL(); + void DeleteItemL(); + void SoftDeleteItemL(); + void DeleteAllItemsL(); + void ReadParentL(); + void ReadParentCompletedL( TInt aError ); + + void HasHistoryL(); + void AddedItemsL(); + void DeletedItemsL(); + void SoftDeletedItemsL(); + void ModifiedItemsL(); + void MovedItemsL(); + //void ListChangesL(); + void ResetChangeInfoL(); + void CommitChangeInfoL(); + void CloseStore(); + + void SetSyncTimeStampL(); + void GetSyncTimeStampL(); + + void ExportStoreFormatL(); + void SetRemoteStoreFormatL(); + + void LeaveIfNoInstanceL(); + + void DoCloseStore(); + + void CleanOldStoresL(); + void CompleteRequest( TInt aError ); +private: + RChunk iChunk; + + RStringPool iStringPool; + CSmlDataStoreFormat* iStoreFormat; + CSmlDataProvider* iDataProvider; + CSmlDataStore* iDataStore; + CSconSyncRelationship* iContext; + RFs iFs; + RMessage2 iMessage; + + // for committing changes + CNSmlDataItemUidSet* iItems; + + // for opening item + TBool iFieldChange; + TInt iSize; + TInt iParent; + TBuf8<64> iMimeType; + TBuf8<64> iMimeVer; + + // for creating item + TSmlDbItemUid iNewItem; + HBufC8* iWriteData; + TBool iCommitInProgress; + + CCSconTimeOut* iTimeOut; + TBool iForceCancel; +}; + +#endif /*SCONASYNCHANDLER_H_*/ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/sconsyncclientserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/sconsyncclientserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,64 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Sync Client-Server header +* +*/ + + +#ifndef SCONSYNCCLIENTSERVER_H +#define SCONSYNCCLIENTSERVER_H + +#include + +_LIT(KSconSyncServerName, "sconsyncserver"); +_LIT(KSconSyncServerExe, "sconsyncserver.exe"); + + +enum TService +{ + ESendChunkHandle, + ECancelRequest, + EListImplementations, + + EOpenStore, + EOpenItem, + ECreateItem, + EReplaceItem, + EMoveItem, + EDeleteItem, + ESoftDeleteItem, + EDeleteAllItems, + EReadParent, + + EHasHistory, + EAddedItems, + EDeletedItems, + ESoftDeletedItems, + EModifiedItems, + EMovedItems, + + //EListChanges, + EResetChangeInfo, + ECommitChangeInfo, + + ECloseStore, + ESetSyncTimeStamp, + EGetSyncTimeStamp, + EExportStoreFormat, + ESetRemoteStoreFormat, + + EMaxService // Not an actual service +}; + +#endif // SCONSYNCCLIENTSERVER_H diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/sconsyncrelationship.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/sconsyncrelationship.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,90 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncRelationship header +* +*/ + + +#ifndef SCONSYNCRELATIONSHIP_H_ +#define SCONSYNCRELATIONSHIP_H_ + +#include +#include +#include +#include +#include + +class CDictionaryFileStore; + +NONSHARABLE_CLASS ( CSconSyncRelationship ) : public CBase, public MSmlSyncRelationship + { +public: + /** + * Creates CSconSyncRelationship object. + * @param aFs reference to open RFs connection + * @param aRelationUid uniqueID for each server-client pair + * @return new CSconSyncRelationship object + */ + static CSconSyncRelationship* NewL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aProviderId ); + ~CSconSyncRelationship(); + + static void SetTimeStampL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aId ); + static void GetTimeStampL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aId, TDateTime& aTimeStamp ); + +public: // From MSmlSyncRelationship + + /** + * Returns the unique identifier for the synchronisation relationship. + * + * @return A unique identifier for the sync relationship. + */ + TSmlSyncTaskKey SyncTaskKey() const; + + /** + * Opens a specified stream for reading, and places an item on the cleanup stack to close it. + * + * @param aReadStream On return, an open read stream + * @param aStreamUid The UID of the stream to open for reading. + */ + void OpenReadStreamLC(RReadStream& aReadStream, TUid aStreamUid); + + /** + * Opens the specified stream, or creates a new one if it does not exist, and places an item on the cleanup stack to close it. + * + * @param aWriteStream On return, an open write stream + * @param aStreamUid The UID of the stream to open or create + */ + void OpenWriteStreamLC(RWriteStream& aWriteStream, TUid aStreamUid); + + /** + * Tests if the specified stream identified exists in the store. + * + * @param aStreamUid The stream UID + * @return Non-zero if the stream exists, otherwise EFalse. + */ + TBool IsStreamPresentL(TUid aStreamUid) const; + +private: + CSconSyncRelationship( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aProviderId ); + void ConstructL(); + +private: + + CDictionaryFileStore* iDictionaryStore; + RFs& iFs; + TUid iID; + TSmlDataProviderId iProviderId; + }; + +#endif /*SCONSYNCRELATIONSHIP_H_*/ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/sconsyncserver.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/sconsyncserver.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,46 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncServer header +* +*/ + + +#ifndef __SCONSYNCSERVER_H__ +#define __SCONSYNCSERVER_H__ + +#include + +class CSconSyncServer : public CPolicyServer +{ +public: + static CSconSyncServer* NewL(); + static CSconSyncServer* NewLC(); + virtual ~CSconSyncServer(); + + void AddSession(); + void RemoveSession(); + +private: + CSconSyncServer(); + void ConstructL(); + + CSession2* NewSessionL(const TVersion& aVersion,const RMessage2& aMessage) const; + TInt RunError(TInt aError); + +private: + TInt iSessionCount; + +}; + +#endif // __SCONSYNCSERVER_H__ \ No newline at end of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/inc/sconsyncsession.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/inc/sconsyncsession.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,47 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncSession header +* +*/ + + +#ifndef __SCONSYNCSESSION_H__ +#define __SCONSYNCSESSION_H__ + +#include + + +class CSconSyncServer; +class CSconAsyncHandler; + +class CSconSyncSession : public CSession2 + { +public: + static CSconSyncSession* NewL(); + + void CreateL(); + +private: + CSconSyncSession(); + ~CSconSyncSession(); + void ConstructL(); + + CSconSyncServer& Server(); + void ServiceL(const RMessage2& aMessage); + +private: + CSconAsyncHandler* iAsyncHandler; + }; + +#endif // __SCONSYNCSESSION_H__ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/rom/sconsyncserver.iby --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/rom/sconsyncserver.iby Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,26 @@ +/* +* Copyright (c) 2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: IBY file for SconSyncServer +* +*/ + +#ifndef _SCONSYNCSERVER_IBY_ +#define _SCONSYNCSERVER_IBY_ + +#include + +//file content +file=ABI_DIR\BUILD_DIR\sconsyncserver.exe PROGRAMS_DIR\sconsyncserver.exe + +#endif diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/src/cscontimeout.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/src/cscontimeout.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,85 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCSconTimeOut implementation +* +*/ + +#include "cscontimeout.h" + +CCSconTimeOut::CCSconTimeOut( MTimeOutObserver& aTimeOutObserver ) : + CActive(EPriorityStandard), // Standard priority + iTimeOutObserver(aTimeOutObserver) + { + } + + +CCSconTimeOut* CCSconTimeOut::NewL( MTimeOutObserver& aTimeOutObserver ) + { + CCSconTimeOut* self = new (ELeave) CCSconTimeOut( aTimeOutObserver ); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +void CCSconTimeOut::ConstructL() + { + User::LeaveIfError(iTimer.CreateLocal()); // Initialize timer + CActiveScheduler::Add(this); // Add to scheduler + } + +CCSconTimeOut::~CCSconTimeOut() + { + Cancel(); // Cancel any request, if outstanding + iTimer.Close(); // Destroy the RTimer object + // Delete instance variables if any + } + +void CCSconTimeOut::DoCancel() + { + iTimer.Cancel(); + } + +void CCSconTimeOut::Start(TTimeIntervalMicroSeconds32 aDelay) + { + Cancel(); // Cancel any request, just to be sure + iState = EUninitialized; + iTimer.After(iStatus, aDelay); // Set for later + SetActive(); // Tell scheduler a request is active + } + +void CCSconTimeOut::RunL() + { + /*if (iState == EUninitialized) + { + // Do something the first time RunL() is called + iState = EInitialized; + } + else if (iState != EError) + { + // Do something + } + iTimer.After(iStatus, 1000000); // Set for 1 sec later + SetActive(); // Tell scheduler a request is active*/ + if ( iState == KErrNone ) + { + iTimeOutObserver.TimeOut(); + } + + } + +TInt CCSconTimeOut::RunError(TInt aError) + { + return aError; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/src/sconasynchandler.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/src/sconasynchandler.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1179 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconAsyncHandler implementation +* +*/ + + +#include "sconasynchandler.h" + +#include +#include +#include +#include +#include +#include +#include + +#include "sconsyncclientserver.h" +#include "sconsyncrelationship.h" +#include "scondataproviderinfo.h" +#include "debug.h" +#include "logdatastoreformat.h" + +// Data Store interface implementation Uid. +// Load all plugins with this uid. +const TUid KDSEcomIFUid = {0x101F4D3A}; + +const TInt KDefaultExpandSize = 1024; + +// one store per computer, max store count. +const TInt KMaxStoresCount = 10; + +const TInt KDefaultTimeOutInMicroSeconds = 30 * 1000000; // 30 seconds +const TInt KDeleteAllTimeOutInMicroSeconds = 300 * 1000000; // 5 minutes +const TInt KOpenStoreTimeOutInMicroSeconds = 180 * 1000000; // 180 seconds + +CSconAsyncHandler::~CSconAsyncHandler() + { + TRACE_FUNC_ENTRY; + Cancel(); + DoCloseStore(); + delete iItems; + delete iWriteData; + delete iDataStore; + delete iDataProvider; + delete iContext; + delete iStoreFormat; + iStringPool.Close(); + iFs.Close(); + REComSession::FinalClose(); + iChunk.Close(); + delete iTimeOut; + TRACE_FUNC_EXIT; + } + +CSconAsyncHandler::CSconAsyncHandler(): CActive( EPriorityStandard ) + { + TRACE_FUNC; + CActiveScheduler::Add( this ); + } + +CSconAsyncHandler* CSconAsyncHandler::NewL() + { + TRACE_FUNC; + CSconAsyncHandler* self = new(ELeave) CSconAsyncHandler(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +void CSconAsyncHandler::ConstructL() + { + TRACE_FUNC; + User::LeaveIfError( iFs.Connect() ); + TInt err = iFs.CreatePrivatePath( EDriveC ); + LOGGER_WRITE_1("CreatePrivatePath err: %d", err); + iStringPool.OpenL(); + iTimeOut = CCSconTimeOut::NewL( *this ); + } + +// ----------------------------------------------------------------------------- +// CSconAsyncHandler::HandleServiceL() +// Handles the client request +// ----------------------------------------------------------------------------- +// +void CSconAsyncHandler::HandleServiceL( const RMessage2& aMessage ) + { + TRACE_FUNC_ENTRY; + if ( aMessage.Function() == ECancelRequest ) + { + LOGGER_WRITE("ECancelRequest"); + if ( IsActive() ) + { + Cancel(); + LOGGER_WRITE("iMessage.Complete( KErrCancel )"); + CompleteRequest( KErrCancel ); + } + + LOGGER_WRITE("aMessage.Complete( KErrNone )"); + aMessage.Complete( KErrNone ); + TRACE_FUNC_EXIT; + return; + } + + iTimeOut->Start( KDefaultTimeOutInMicroSeconds ); + + iMessage = aMessage; + switch ( aMessage.Function() ) + { + case ESendChunkHandle: + LOGGER_WRITE( "CSconSyncSession::ServiceL() : ESendChunkHandle" ); + HandleChunkMessage(); + break; + + case EListImplementations: + LOGGER_WRITE( "CSconSyncSession::ServiceL() : EListImplementations" ); + ListAllImplementationsL(); + break; + + case EOpenStore: + LOGGER_WRITE( "CSconSyncSession::ServiceL() : EOpenStore" ); + iTimeOut->Start( KOpenStoreTimeOutInMicroSeconds ); + OpenStoreL(); + break; + + case EOpenItem: + OpenItemL(); + break; + case ECreateItem: + CreateItemL(); + break; + case EReplaceItem: + ReplaceItemL(); + break; + case EMoveItem: + MoveItemL(); + break; + case EDeleteItem: + DeleteItemL(); + break; + case ESoftDeleteItem: + SoftDeleteItemL(); + break; + case EDeleteAllItems: + iTimeOut->Start( KDeleteAllTimeOutInMicroSeconds ); + DeleteAllItemsL(); + break; + case EReadParent: + ReadParentL(); + break; + + case EHasHistory: + HasHistoryL(); + break; + case EAddedItems: + AddedItemsL(); + break; + case EDeletedItems: + DeletedItemsL(); + break; + case ESoftDeletedItems: + SoftDeletedItemsL(); + break; + case EModifiedItems: + ModifiedItemsL(); + break; + case EMovedItems: + MovedItemsL(); + break; + case EResetChangeInfo: + ResetChangeInfoL(); + break; + case ECommitChangeInfo: + CommitChangeInfoL(); + break; + case ECloseStore: + CloseStore(); + break; + case ESetSyncTimeStamp: + SetSyncTimeStampL(); + break; + case EGetSyncTimeStamp: + GetSyncTimeStampL(); + break; + case EExportStoreFormat: + ExportStoreFormatL(); + break; + case ESetRemoteStoreFormat: + SetRemoteStoreFormatL(); + break; + + default: + aMessage.Complete(KErrNotSupported); + break; + } + TRACE_FUNC_EXIT; + } + + +void CSconAsyncHandler::RunL() + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("iStatus.Int(): %d", iStatus.Int()); + switch ( iMessage.Function() ) + { + case EOpenStore: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EOpenStore" ); + CompleteRequest( iStatus.Int() ); + break; + + case EOpenItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EOpenItem" ); + OpenItemCompletedL( iStatus.Int() ); + break; + + case ECreateItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : ECreateItem" ); + if (!iCommitInProgress) + { + // Write data to item + CreateItemCompletedL( iStatus.Int() ); + } + else + { + // commit is done, all ready + LOGGER_WRITE( "CSconAsyncHandler::RunL() : ECreateItem, commit done" ); + TPckg pckg(iNewItem); + iMessage.WriteL( 0, pckg, 0); + CompleteRequest( iStatus.Int() ); + } + break; + + case EReplaceItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EReplaceItem" ); + if (!iCommitInProgress) + { + // Write data to item + ReplaceItemCompletedL( iStatus.Int() ); + } + else + { + // commit is done, all ready + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EReplaceItem, commit done" ); + CompleteRequest( iStatus.Int() ); + } + break; + + case EMoveItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EMoveItem" ); + CompleteRequest( iStatus.Int() ); + break; + + case EDeleteItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EDeleteItem" ); + CompleteRequest( iStatus.Int() ); + break; + + case ESoftDeleteItem: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : ESoftDeleteItem" ); + CompleteRequest( iStatus.Int() ); + break; + + case EDeleteAllItems: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EDeleteAllItems" ); + CompleteRequest( iStatus.Int() ); + break; + + case EReadParent: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EReadParent" ); + ReadParentCompletedL( iStatus.Int() ); + break; + + case EResetChangeInfo: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : EResetChangeInfo" ); + CompleteRequest( iStatus.Int() ); + break; + + case ECommitChangeInfo: + LOGGER_WRITE( "CSconAsyncHandler::RunL() : ECommitChangeInfo" ); + delete iItems; + iItems = NULL; + CompleteRequest( iStatus.Int() ); + break; + + default: + LOGGER_WRITE("Not asynchronous function") + CompleteRequest( KErrNotSupported ); + break; + } + TRACE_FUNC_EXIT; + } + +TInt CSconAsyncHandler::RunError(TInt aError) + { + LOGGER_WRITE_1("CSconAsyncHandler::RunError() aError: %d", aError); + delete iItems; + iItems = NULL; + delete iWriteData; + iWriteData = NULL; + + if ( IsActive() ) + { + LOGGER_WRITE("IsActive"); + //iDataStore->CancelRequest(); + Cancel(); + } + + if ( iDataStore && iMessage.Function() == EOpenItem ) + { + LOGGER_WRITE( "CSconAsyncHandler::RunError() : EOpenItem" ); + iDataStore->CloseItem(); + } + + CompleteRequest( aError ); + aError = KErrNone; + LOGGER_WRITE_1("CSconAsyncHandler::RunError() : Return %d", aError); + return aError; + //return KErrNone;//aError; + } + +void CSconAsyncHandler::DoCancel() + { + TRACE_FUNC_ENTRY; + iDataStore->CancelRequest(); + iTimeOut->Cancel(); + + if ( iStatus == KRequestPending ) + { + LOGGER_WRITE( "iStatus == KRequestPending" ); + } + + if ( iDataStore && iMessage.Function() == EOpenItem ) + { + LOGGER_WRITE( "CSconAsyncHandler::RunError() : EOpenItem" ); + iDataStore->CloseItem(); + } + + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::TimeOut() + { + TRACE_FUNC_ENTRY; + if ( IsActive() ) + { + Cancel(); + CompleteRequest( KErrCancel ); + } + TRACE_FUNC_EXIT; + } + + +void CSconAsyncHandler::HandleChunkMessage() + { + TRACE_FUNC_ENTRY; + TInt ret ( KErrNone ); + + ret = iChunk.Open( iMessage, 0, EFalse ); + + LOGGER_WRITE_1( "CSconAsyncHandler::HandleChunkMessageL() : ret %d", ret ); + CompleteRequest( ret ); + } + + + +void CSconAsyncHandler::ListAllImplementationsL() + { + TRACE_FUNC_ENTRY; + + RImplInfoPtrArray implInfoArray; + CleanupResetAndDestroyPushL( implInfoArray ); + REComSession::ListImplementationsL( KDSEcomIFUid, implInfoArray ); + + const TInt KDataproviderInfoSize = 250; // 250 bytes should be enought + TInt requiredSize = implInfoArray.Count() * KDataproviderInfoSize; + if ( iChunk.Size() < requiredSize ) + { + User::LeaveIfError( iChunk.Adjust( requiredSize ) ); + } + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + + RSconDataProviderInfoArray dpInfoArray; + CleanupResetAndDestroyPushL( dpInfoArray ); + + // Collect information from dataproviders + for ( TInt i=0; i < implInfoArray.Count(); i++ ) + { + LOGGER_WRITE_1("implInfoArray: %d",i); + CImplementationInformation& implInfo = *implInfoArray[i]; + + CSmlDataProvider* dp(NULL); + TRAPD( err, dp = CSmlDataProvider::NewL( implInfo.ImplementationUid().iUid ) ); + LOGGER_WRITE_2("CSmlDataProvider::NewL, uid(0x%08x) err: %d",implInfo.ImplementationUid().iUid, err ); + if ( !err ) + { + CleanupStack::PushL( dp ); + + CSconDataproviderInfo *dpInfo = CSconDataproviderInfo::NewL(); + CleanupStack::PushL( dpInfo ); + + dpInfo->SetImplementationUid( implInfo.ImplementationUid() ); + LOGGER_WRITE_1("ImplementationUid: 0x%08x", implInfo.ImplementationUid().iUid ); + dpInfo->SetDisplayNameL( implInfo.DisplayName() ); + LOGGER_WRITE_1("DisplayName: %S", &implInfo.DisplayName() ); + + dpInfo->SetDefaultStoreL( dp->DefaultStoreL() ); + LOGGER_WRITE_1("DefaultStoreL: %S", &dp->DefaultStoreL() ); + CDesCArray* stores = dp->ListStoresLC(); + dpInfo->SetStoresL( *stores ); + CleanupStack::PopAndDestroy( stores ); + + dpInfoArray.AppendL( dpInfo ); + CleanupStack::Pop( dpInfo ); + + CleanupStack::PopAndDestroy( dp ); + } + } + + // Wrtie to stream + stream.WriteUint16L( dpInfoArray.Count() ); + for ( TInt i = 0; i < dpInfoArray.Count(); i++ ) + { + CSconDataproviderInfo& dpInfo = *dpInfoArray[i]; + dpInfo.ExternalizeL( stream ); + } + + stream.CommitL(); + + CleanupStack::PopAndDestroy( &dpInfoArray ); + CleanupStack::PopAndDestroy( &stream ); + CleanupStack::PopAndDestroy( &implInfoArray ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::OpenStoreL() + { + TRACE_FUNC_ENTRY; + if ( iDataStore ) + { + LOGGER_WRITE("Warning: Previous DataStore was not closed properly."); + DoCloseStore(); + } + + // copy data from the chunk + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + TSmlDataProviderId providerId = readStream.ReadUint32L(); + LOGGER_WRITE_1("providerId: 0x%08x", providerId); + + TInt len = readStream.ReadUint32L(); + HBufC* storeName = HBufC::NewLC(len); + TPtr storeNamePtr = storeName->Des(); + readStream.ReadL(storeNamePtr, len); + LOGGER_WRITE_1("storeName: %S", &storeNamePtr); + + TInt contextUid = readStream.ReadUint32L(); + + LOGGER_WRITE_1("contextIdentifier: 0x%08x", contextUid); + + LOGGER_WRITE("Open provider"); + delete iDataProvider; + iDataProvider = NULL; + iDataProvider = CSmlDataProvider::NewL( providerId ); + + delete iContext; + iContext = NULL; + + delete iStoreFormat; + iStoreFormat = NULL; + + LOGGER_WRITE("Create context"); + iContext = CSconSyncRelationship::NewL( iFs, TUid::Uid(contextUid), providerId ); + + + LOGGER_WRITE("Create NewStoreInstanceLC"); + iDataStore = iDataProvider->NewStoreInstanceLC(); + CleanupStack::Pop( iDataStore ); + + SetActive(); + iStatus = KRequestPending; + LOGGER_WRITE("OpenL"); + TRAPD(err, iDataStore->OpenL(storeNamePtr,*iContext, iStatus)); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->OpenL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + + CleanupStack::PopAndDestroy( storeName ); + CleanupStack::PopAndDestroy( &readStream ); + + TRACE_FUNC_EXIT; + } + + +void CSconAsyncHandler::OpenItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + if ( IsActive() ) + { + LOGGER_WRITE("Was still in Active"); + Cancel(); + } + + TSmlDbItemUid itemUid = iMessage.Int0(); + LOGGER_WRITE_1("Open item: %d", itemUid); + + // set default values + iFieldChange = EFalse; + iSize = 0; + iParent = 0; + iMimeType.Copy(KNullDesC); + iMimeVer.Copy(KNullDesC); + + SetActive(); + LOGGER_WRITE("iDataStore->OpenItemL"); + iStatus = KRequestPending; + TRAPD( err, iDataStore->OpenItemL(itemUid,iFieldChange,iSize,iParent,iMimeType,iMimeVer,iStatus)); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->OpenItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::OpenItemCompletedL( TInt aError ) + { + TRACE_FUNC_ENTRY; + // item opened, now read it + if ( aError ) + { + CompleteRequest( aError ); + return; + } + LeaveIfNoInstanceL(); + + LOGGER_WRITE_1("item size: %d", iSize); + + TInt totalObjectSize( 0 ); + totalObjectSize+= sizeof(TInt32); // data length + totalObjectSize+= iSize; // data + totalObjectSize+= sizeof(TInt8); // iFieldChange + totalObjectSize+= sizeof(TInt32); // iParent + totalObjectSize+= sizeof(TInt32); // iMimeType + totalObjectSize+= iMimeType.Length(); // iMimeType + totalObjectSize+= sizeof(TInt32); // iMimeVer + totalObjectSize+= iMimeVer.Length(); // iMimeType + + LOGGER_WRITE_1("iChunk.Size(): %d", iChunk.Size()); + LOGGER_WRITE_1("iChunk.MaxSize(): %d", iChunk.MaxSize()); + LOGGER_WRITE_1("totalObjectSize: %d", totalObjectSize); + + if ( iChunk.Size() < totalObjectSize ) + { + LOGGER_WRITE("adjust chunk"); + TInt err = iChunk.Adjust( totalObjectSize ); + LOGGER_WRITE_1("Chunk.Adjust err: %d", err); + User::LeaveIfError( err ); + } + LOGGER_WRITE_1("new Chunk size: %d", iChunk.Size()); + LOGGER_WRITE_1("new ChunkMaxSize(): %d", iChunk.MaxSize()); + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + + LOGGER_WRITE("ReadItemL"); + HBufC8* tempBuf = HBufC8::NewLC(iSize); + TPtr8 tempPtr = tempBuf->Des(); + + TUint8* ptr = (TUint8*) tempPtr.Ptr(); + + TPtr8 tempPtr2( ptr, 0, iSize ); + LOGGER_WRITE_1( "tempPtr2.Size(): %d", tempPtr2.Size()); + iDataStore->ReadItemL( tempPtr2 ); + LOGGER_WRITE("ReadItemL -ok"); + + LOGGER_WRITE_1("readed Length: %d", tempPtr2.Length() ); + LOGGER_WRITE_1("readed Size: %d", tempPtr2.Size() ); + + LOGGER_WRITE8_1("iMimeType: %S", &iMimeType ); + LOGGER_WRITE_1("iMimeType.Length(): %d", iMimeType.Length() ); + LOGGER_WRITE_1("iMimeType Size: %d", iMimeType.Size() ); + + LOGGER_WRITE8_1("iMimeVer: %S", &iMimeVer ); + LOGGER_WRITE_1("iMimeVer.Length(): %d", iMimeVer.Length() ); + LOGGER_WRITE_1("iMimeVer Size: %d", iMimeVer.Size() ); + + iDataStore->CloseItem(); + LOGGER_WRITE("Write to chunk"); + stream.WriteInt32L( tempPtr2.Length() ); + stream.WriteL( tempPtr2 ); + CleanupStack::PopAndDestroy( tempBuf ); + + stream.WriteInt8L( (TInt)iFieldChange ); + stream.WriteInt32L( iParent ); + stream.WriteInt32L( iMimeType.Length() ); + stream.WriteL( iMimeType ); + stream.WriteInt32L( iMimeVer.Length() ); + stream.WriteL( iMimeVer ); + + stream.CommitL(); + LOGGER_WRITE("Writed ok"); + CleanupStack::PopAndDestroy( &stream ); + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CreateItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + iCommitInProgress = EFalse; + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + TSmlDbItemUid parent = readStream.ReadUint32L(); + TInt len = readStream.ReadUint32L(); + readStream.ReadL(iMimeType, len); + len = readStream.ReadUint32L(); + readStream.ReadL(iMimeVer, len); + len = readStream.ReadUint32L(); + delete iWriteData; + iWriteData = NULL; + iWriteData = HBufC8::New(len); + TPtr8 dataPtr = iWriteData->Des(); + readStream.ReadL(dataPtr, len); + CleanupStack::PopAndDestroy( &readStream ); + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->CreateItemL( iNewItem, dataPtr.Size(), parent, iMimeType, iMimeVer, iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->CreateItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CreateItemCompletedL( TInt aError ) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( aError ); + LeaveIfNoInstanceL(); + // CreateItem completed, now we must write the data to the created item and commit it. + + iDataStore->WriteItemL( iWriteData->Des() ); + delete iWriteData; + iWriteData = NULL; + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->CommitItemL( iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->CommitItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + iCommitInProgress = ETrue; + + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ReplaceItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + + iCommitInProgress = EFalse; + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + TSmlDbItemUid uid = readStream.ReadUint32L(); + TSmlDbItemUid parent = readStream.ReadUint32L(); + TBool fieldChange = readStream.ReadUint8L(); + TInt len = readStream.ReadUint32L(); + delete iWriteData; + iWriteData = NULL; + iWriteData = HBufC8::New(len); + TPtr8 dataPtr = iWriteData->Des(); + readStream.ReadL(dataPtr, len); + + CleanupStack::PopAndDestroy( &readStream ); + SetActive(); + iStatus = KRequestPending; + TRAPD(err,iDataStore->ReplaceItemL( uid,dataPtr.Size(),parent,fieldChange, iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->CommitItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ReplaceItemCompletedL( TInt aError ) + { + TRACE_FUNC_ENTRY; + User::LeaveIfError( aError ); + LeaveIfNoInstanceL(); + // CreateItem completed, now we must write the data to the created item and commit it. + + iDataStore->WriteItemL( iWriteData->Des() ); + delete iWriteData; + iWriteData = NULL; + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->CommitItemL( iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->CommitItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + iCommitInProgress = ETrue; + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::MoveItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + TSmlDbItemUid uid = iMessage.Int0(); + TSmlDbItemUid newParent = iMessage.Int1(); + LOGGER_WRITE_1( "uid: %d", uid ); + LOGGER_WRITE_1( "newParent: %d", newParent ); + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->MoveItemL( uid, newParent, iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->MoveItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::DeleteItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + + TSmlDbItemUid uid = iMessage.Int0(); + LOGGER_WRITE_1( "uid: %d", uid ); + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->DeleteItemL( uid, iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->DeleteItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::SoftDeleteItemL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + + TSmlDbItemUid uid = iMessage.Int0(); + LOGGER_WRITE_1( "uid: %d", uid ); + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->SoftDeleteItemL( uid, iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->SoftDeleteItemL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::DeleteAllItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->DeleteAllItemsL( iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->DeleteAllItemsL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ReadParentL() + { + TRACE_FUNC_ENTRY; + OpenItemL(); + + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ReadParentCompletedL( TInt aError ) + { + TRACE_FUNC_ENTRY; + // item opened, now read it + if ( aError ) + { + CompleteRequest( aError ); + return; + } + LeaveIfNoInstanceL(); + + iDataStore->CloseItem(); + + TPckg pckg(iParent); + iMessage.WriteL( 1, pckg, 0); + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::HasHistoryL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + TBool hasHistory = iDataStore->HasSyncHistory(); + + TPckgC pckg(hasHistory); + iMessage.WriteL( 0, pckg, 0); + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::AddedItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + const MSmlDataItemUidSet& items = iDataStore->AddedItems(); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + items.ExternalizeL( stream ); + CleanupStack::PopAndDestroy( &stream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::DeletedItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + const MSmlDataItemUidSet& items = iDataStore->DeletedItems(); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + items.ExternalizeL( stream ); + CleanupStack::PopAndDestroy( &stream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::SoftDeletedItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + const MSmlDataItemUidSet& items = iDataStore->SoftDeletedItems(); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + items.ExternalizeL( stream ); + CleanupStack::PopAndDestroy( &stream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ModifiedItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + const MSmlDataItemUidSet& items = iDataStore->ModifiedItems(); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + items.ExternalizeL( stream ); + CleanupStack::PopAndDestroy( &stream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::MovedItemsL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + const MSmlDataItemUidSet& items = iDataStore->MovedItems(); + + RMemWriteStream stream ( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( stream ); + items.ExternalizeL( stream ); + CleanupStack::PopAndDestroy( &stream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ResetChangeInfoL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->ResetChangeInfoL( iStatus )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->ResetChangeInfoL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CommitChangeInfoL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + if ( iItems ) + { + delete iItems; + iItems = NULL; + } + iItems = new (ELeave) CNSmlDataItemUidSet(); + iItems->InternalizeL( readStream ); + + CleanupStack::PopAndDestroy( &readStream ); + + SetActive(); + iStatus = KRequestPending; + TRAPD(err, iDataStore->CommitChangeInfoL( iStatus, *iItems )); + if ( err ) + { + // we are on active state, call request completed (RunL) + LOGGER_WRITE_1("iDataStore->CommitChangeInfoL leaved with err: %d", err); + TRequestStatus* status = &iStatus; + User::RequestComplete( status, err ); + } + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CloseStore() + { + TRACE_FUNC_ENTRY; + DoCloseStore(); + REComSession::FinalClose(); + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::SetSyncTimeStampL() + { + TRACE_FUNC_ENTRY; + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + TInt relationId = readStream.ReadInt32L(); + TInt providerId = readStream.ReadInt32L(); + CleanupStack::PopAndDestroy( &readStream ); + + CSconSyncRelationship::SetTimeStampL( iFs, TUid::Uid(relationId), providerId); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::GetSyncTimeStampL() + { + TRACE_FUNC_ENTRY; + TInt providerId = iMessage.Int0(); + TInt relationId = iMessage.Int1(); + + TDateTime time; + CSconSyncRelationship::GetTimeStampL( iFs, TUid::Uid(relationId), providerId, time); + + // write timestamp + TPckgC timeBuf(time); + iMessage.WriteL( 2, timeBuf, 0); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::ExportStoreFormatL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + if ( !iDataProvider ) + { + User::Leave( KErrNotReady ); + } + CBufFlat* buffer = CBufFlat::NewL( KDefaultExpandSize ); + CleanupStack::PushL( buffer ); + RBufWriteStream stream( *buffer ); + CleanupClosePushL( stream ); + + const CSmlDataStoreFormat& storeFormat = iDataProvider->StoreFormatL(); + TRAP_IGNORE( TLogDataStoreFormat::LogDataStoreFormatL( _L("iDataProvider->StoreFormatL()"), storeFormat )); + + storeFormat.ExternalizeL( stream ); + + stream.CommitL(); + CleanupStack::PopAndDestroy( &stream ); + buffer->Compress(); + + RMemWriteStream chunkStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( chunkStream ); + + chunkStream.WriteInt32L( buffer->Size() ); + chunkStream.WriteL( buffer->Ptr(0), buffer->Size()); + chunkStream.CommitL(); + CleanupStack::PopAndDestroy( &chunkStream ); + + CleanupStack::PopAndDestroy( buffer ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::SetRemoteStoreFormatL() + { + TRACE_FUNC_ENTRY; + LeaveIfNoInstanceL(); + + RMemReadStream readStream( iChunk.Base(), iChunk.Size() ); + CleanupClosePushL( readStream ); + + if ( iStoreFormat ) + { + delete iStoreFormat; + iStoreFormat = NULL; + } + iStoreFormat = CSmlDataStoreFormat::NewLC( iStringPool, readStream); + CleanupStack::Pop( iStoreFormat ); + TRAP_IGNORE( TLogDataStoreFormat::LogDataStoreFormatL( _L("iDataProvider->SetRemoteStoreFormatL()"), *iStoreFormat )); + iDataStore->SetRemoteStoreFormatL( *iStoreFormat ); + + CleanupStack::PopAndDestroy( &readStream ); + + CompleteRequest( KErrNone ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::LeaveIfNoInstanceL() + { + if ( !iDataStore ) + { + LOGGER_WRITE("DataStore instance was not ready, leaving KErrNotReady"); + User::Leave( KErrNotReady ); + } + } + +void CSconAsyncHandler::DoCloseStore() + { + TRACE_FUNC_ENTRY; + delete iItems; + iItems = NULL; + delete iWriteData; + iWriteData = NULL; + if ( iDataProvider && iContext ) + { + TInt providerId = iDataProvider->Identifier(); + TInt contextId = iContext->SyncTaskKey(); + TRAP_IGNORE( CSconSyncRelationship::SetTimeStampL( iFs, TUid::Uid(contextId), providerId) ); + } + delete iDataStore; + iDataStore = NULL; + delete iDataProvider; + iDataProvider = NULL; + delete iContext; + iContext = NULL; + delete iStoreFormat; + iStoreFormat = NULL; + + CleanOldStoresL(); + + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CleanOldStoresL() + { + TRACE_FUNC_ENTRY; + TFileName path; + User::LeaveIfError( iFs.PrivatePath( path ) ); + CDir* dir; + iFs.GetDir( path, KEntryAttNormal, ESortByDate, dir ); + CleanupStack::PushL( dir ); + TInt storesCount(0); + LOGGER_WRITE_1("count: %d", dir->Count() ); + for ( TInt i=dir->Count()-1; i >= 0; i-- ) + { + LOGGER_WRITE_1("dir[%d]", i); + TEntry entry = (*dir)[i]; + LOGGER_WRITE_1("file: %S", &entry.iName); + _LIT(KContextStoreName, "contextstore"); + _LIT(KTimeStoreName, "timestore"); + if ( entry.iName.Find(KContextStoreName) == 0 ) + { + storesCount++; + LOGGER_WRITE_1("storeNro: %d", storesCount); +#ifdef _DEBUG + TTime time = entry.iModified; + TDateTime dt = time.DateTime(); + _LIT(KFormat, "%d.%d %02d:%02d"); + TFileName mod; + mod.Format(KFormat, dt.Day()+1, dt.Month()+1, dt.Hour()+1,dt.Minute() ); + LOGGER_WRITE_1("time: %S", &mod); +#endif + if ( storesCount > KMaxStoresCount ) + { + LOGGER_WRITE_1("delete contextstore: '%S'", &entry.iName ); + iFs.Delete( entry.iName ); + TFileName timeStoreFile; + timeStoreFile = entry.iName.Right(15); + timeStoreFile.Insert(0, KTimeStoreName); + LOGGER_WRITE_1("delete timeStoreFile: %S", &timeStoreFile); + iFs.Delete( timeStoreFile ); + } + } + + } + CleanupStack::PopAndDestroy( dir ); + TRACE_FUNC_EXIT; + } + +void CSconAsyncHandler::CompleteRequest( TInt aError ) + { + TRACE_FUNC; + iTimeOut->Cancel(); + LOGGER_WRITE_1("iMessage.Complete( %d )", aError); + iMessage.Complete( aError ); + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/src/sconsyncrelationship.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/src/sconsyncrelationship.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,181 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncRelationship implementation +* +*/ + + +#include "sconsyncrelationship.h" +#include +#include + +#include "debug.h" + +_LIT(KContextStore, "contextstore_0x%08x.dat"); +_LIT(KTimeStore, "timestore_0x%08x.dat"); + +CSconSyncRelationship::~CSconSyncRelationship() + { + TRACE_FUNC_ENTRY; + if ( iDictionaryStore ) + { + iDictionaryStore->Commit(); + delete iDictionaryStore; + } + TRACE_FUNC_EXIT; + } + +CSconSyncRelationship::CSconSyncRelationship( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aProviderId ) + : iFs(aFs), iID(aRelationUid), iProviderId(aProviderId) + { + TRACE_FUNC; + + } + +CSconSyncRelationship* CSconSyncRelationship::NewL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aProviderId ) + { + TRACE_FUNC_ENTRY; + CSconSyncRelationship* self = new (ELeave) CSconSyncRelationship( aFs, aRelationUid, aProviderId ); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + TRACE_FUNC_EXIT; + return self; + } + +void CSconSyncRelationship::SetTimeStampL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aId ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aRelationUid: 0x%08x", aRelationUid.iUid ); + LOGGER_WRITE_1("aId: 0x%08x", aId ); + aFs.SetSessionToPrivate( EDriveC ); + TFileName file; + file.Format(KTimeStore, aRelationUid.iUid); + CDictionaryFileStore* dictionaryStore = CDictionaryFileStore::OpenLC(aFs, file, TUid::Uid(0x0001)); + + RDictionaryWriteStream stream; + stream.AssignLC( *dictionaryStore, TUid::Uid(aId) ); + + TTime time; + time.UniversalTime(); + + TDateTime dateTime = time.DateTime(); + TPckgBuf timeBuf(dateTime); + + stream.WriteL( timeBuf ); + stream.CommitL(); + + CleanupStack::PopAndDestroy( &stream ); //AssingLC + dictionaryStore->Commit(); + CleanupStack::PopAndDestroy( dictionaryStore ); + TRACE_FUNC_EXIT; + } + +void CSconSyncRelationship::GetTimeStampL( RFs& aFs, TUid aRelationUid, TSmlDataProviderId aId, TDateTime& aTimeStamp ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aRelationUid: 0x%08x", aRelationUid.iUid ); + LOGGER_WRITE_1("aId: 0x%08x", aId ); + User::LeaveIfError( aFs.SetSessionToPrivate( EDriveC ) ); + TFileName file; + file.Format(KTimeStore, aRelationUid.iUid); + CDictionaryFileStore* dictionaryStore = CDictionaryFileStore::OpenLC(aFs, file, TUid::Uid(0x0001)); + TBool present = dictionaryStore->IsPresentL( TUid::Uid(aId) ); + if ( !present ) + { + LOGGER_WRITE("Stream was not present"); + User::Leave(KErrNotFound); + } + RDictionaryReadStream stream; + stream.OpenLC( *dictionaryStore, TUid::Uid(aId) ); + TPckgBuf timeBuf; + stream.ReadL( timeBuf ); + aTimeStamp = timeBuf(); + CleanupStack::PopAndDestroy(); //OpenLC + CleanupStack::PopAndDestroy( dictionaryStore ); + + TRACE_FUNC_EXIT; + } + +void CSconSyncRelationship::ConstructL() + { + TRACE_FUNC_ENTRY; + iFs.SetSessionToPrivate( EDriveC ); + TFileName file; + file.Format(KContextStore, iID.iUid); + iDictionaryStore = CDictionaryFileStore::OpenL( + iFs, file, TUid::Uid(0x0001)); + + TRACE_FUNC_EXIT; + } + + +TSmlSyncTaskKey CSconSyncRelationship::SyncTaskKey() const + { + TRACE_FUNC; + return static_cast(iID.iUid); + } + +void CSconSyncRelationship::OpenReadStreamLC(RReadStream& aReadStream, TUid aStreamUid) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aStreamUid: 0x%08x", aStreamUid); + TUid streamUid(aStreamUid); + if ( aStreamUid.iUid == KNSmlDefaultSnapshotStreamUID ) + { + LOGGER_WRITE_1(" Default stream uid was used, use provider uid (0x%08x) as stream uid", iProviderId); + streamUid.iUid = iProviderId; + } + if ( !IsStreamPresentL( streamUid ) ) + { + LOGGER_WRITE("Stream was not present"); + User::Leave(KErrNotFound); + } + + + static_cast(aReadStream).OpenLC( + *iDictionaryStore, streamUid ); + TRACE_FUNC_EXIT; + } + +void CSconSyncRelationship::OpenWriteStreamLC(RWriteStream& aWriteStream, TUid aStreamUid) + { + TRACE_FUNC_ENTRY; + + LOGGER_WRITE_1("aStreamUid: 0x%08x", aStreamUid); + TUid streamUid(aStreamUid); + if ( aStreamUid.iUid == KNSmlDefaultSnapshotStreamUID ) + { + LOGGER_WRITE_1(" Default stream uid was used, use provider uid (0x%08x) as stream uid", iProviderId); + streamUid.iUid = iProviderId; + } + static_cast(aWriteStream).AssignLC( + *iDictionaryStore, streamUid ); + TRACE_FUNC_EXIT; + } + +TBool CSconSyncRelationship::IsStreamPresentL(TUid aStreamUid) const + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aStreamUid: 0x%08x", aStreamUid.iUid ); + TUid streamUid(aStreamUid); + if ( aStreamUid.iUid == KNSmlDefaultSnapshotStreamUID ) + { + LOGGER_WRITE_1(" Default stream uid was used, use provider uid (0x%08x) as stream uid", iProviderId); + streamUid.iUid = iProviderId; + } + TBool present = iDictionaryStore->IsPresentL( streamUid ); + LOGGER_WRITE_1("CSconSyncRelationship::IsStreamPresentL() return: %d",(TInt)present); + return present; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/src/sconsyncserver.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/src/sconsyncserver.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,177 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncServer implementation +* +*/ + + +#include "sconsyncserver.h" +#include "sconsyncclientserver.h" + +#include "sconsyncsession.h" +#include "debug.h" + +const TInt KSConPCConnServerUid = 0x101F99F6; + +// Security policy +const TUint KServerPolicyRangeCount = 2; + +const TInt KServerPolicyRanges[KServerPolicyRangeCount] = + { + 0, // range is 0 inclusive + EMaxService // range is 1-KMaxTInt inclusive + }; + +const TUint8 KServerPolicyElementsIndex[KServerPolicyRangeCount] = + { + 0, // applies to 0th range + CPolicyServer::ENotSupported // applies to 1st range + }; + +const CPolicyServer::TPolicyElement KServerPolicyElements[] = + { + { _INIT_SECURITY_POLICY_S0(KSConPCConnServerUid) /*_INIT_SECURITY_POLICY_C1(ECapabilityReadDeviceData)*/, CPolicyServer::EFailClient } + }; + +const CPolicyServer::TPolicy KServerPolicy = + { + 0 /*CPolicyServer::EAlwaysPass*/, // specifies all connect attempts should pass + KServerPolicyRangeCount, + KServerPolicyRanges, + KServerPolicyElementsIndex, + KServerPolicyElements + }; + + +CSconSyncServer* CSconSyncServer::NewL() + { + CSconSyncServer* self = NewLC(); + CleanupStack::Pop(self); + return self; + } + +CSconSyncServer* CSconSyncServer::NewLC() + { + CSconSyncServer* self = new(ELeave) CSconSyncServer(); + CleanupStack::PushL(self); + self->ConstructL(); + return self; + } + +CSconSyncServer::CSconSyncServer() : + CPolicyServer(EPriorityStandard, KServerPolicy, ESharableSessions) + { + } + +void CSconSyncServer::ConstructL() + { + TRACE_FUNC_ENTRY; + TInt error = Start(KSconSyncServerName); + + if (error != KErrNone) + { + User::Panic(KSconSyncServerName, error); + } + TRACE_FUNC_EXIT; + } + +CSconSyncServer::~CSconSyncServer() + { + TRACE_FUNC; + } + +CSession2* CSconSyncServer::NewSessionL(const TVersion& aVersion, const RMessage2& /*aMessage*/) const + { + TRACE_FUNC; + TVersion v(1,0,0); + if ( !User::QueryVersionSupported(v,aVersion) ) + { + TVersionName vname = aVersion.Name(); + LOGGER_WRITE_1("Client has wrong version: %S", &vname); + User::Leave( KErrNotSupported ); + } + + return CSconSyncSession::NewL(); + } + +TInt CSconSyncServer::RunError(TInt aError) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aError: %d", aError); + // Bad descriptor implies bad client + if (aError == KErrBadDescriptor) + { + Message().Panic(KSconSyncServerName, aError); + } + else + { + Message().Complete(aError); + } + + // Continue handling requests + ReStart(); + TRACE_FUNC_EXIT; + return KErrNone; + } + +void CSconSyncServer::AddSession() + { + ++iSessionCount; + LOGGER_WRITE_1("CSconSyncServer::AddSession(), iSessionCount: %d", iSessionCount); + } + +void CSconSyncServer::RemoveSession() + { + --iSessionCount; + LOGGER_WRITE_1("CSconSyncServer::RemoveSession(), iSessionCount: %d", iSessionCount); + if (iSessionCount == 0) + { + CActiveScheduler::Stop(); + } + } + +LOCAL_C void ExeMainL() + { + TRACE_FUNC_ENTRY; + // Install active scheduler + CActiveScheduler* scheduler = new(ELeave) CActiveScheduler; + CleanupStack::PushL(scheduler); + CActiveScheduler::Install(scheduler); + + CSconSyncServer::NewLC(); + + User::LeaveIfError(User::RenameThread(KSconSyncServerName)); + RProcess::Rendezvous(KErrNone); + + CActiveScheduler::Start(); + + CleanupStack::PopAndDestroy(); // CSconSyncServer + CleanupStack::PopAndDestroy(); // CActiveScheduler + TRACE_FUNC_EXIT; + } + +GLDEF_C TInt E32Main() + { + TRACE_FUNC_ENTRY; + __UHEAP_MARK; + CTrapCleanup* cleanup = CTrapCleanup::New(); + + TRAPD(error, ExeMainL()); + __ASSERT_ALWAYS(!error, User::Panic(KSconSyncServerName, error)); + + delete cleanup; + __UHEAP_MARKEND; + TRACE_FUNC_EXIT; + return 0; + } diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/servers/syncserver/src/sconsyncsession.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/servers/syncserver/src/sconsyncsession.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,96 @@ +/* +* Copyright (c) 2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSconSyncSession implementation +* +*/ + + +#include "sconsyncsession.h" + +#include "sconsyncserver.h" +#include "sconsyncclientserver.h" +#include "sconasynchandler.h" +#include "debug.h" + + +CSconSyncSession::CSconSyncSession() + { + TRACE_FUNC; + } + +CSconSyncSession* CSconSyncSession::NewL() + { + TRACE_FUNC; + CSconSyncSession* self = new(ELeave) CSconSyncSession(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +void CSconSyncSession::ConstructL() + { + TRACE_FUNC_ENTRY; + iAsyncHandler = CSconAsyncHandler::NewL(); + TRACE_FUNC_EXIT; + } + +void CSconSyncSession::CreateL() + { + TRACE_FUNC; + Server().AddSession(); + } + +CSconSyncSession::~CSconSyncSession() + { + TRACE_FUNC_ENTRY; + delete iAsyncHandler; + + Server().RemoveSession(); + + TRACE_FUNC_EXIT; + } + +CSconSyncServer& CSconSyncSession::Server() + { + return *static_cast(const_cast(CSession2::Server())); + } + + +// ----------------------------------------------------------------------------- +// CSconSyncSession::ServiceL() +// Handles the client request +// ----------------------------------------------------------------------------- +// +void CSconSyncSession::ServiceL(const RMessage2& aMessage) + { + TRACE_FUNC_ENTRY; + + TRAPD( err, iAsyncHandler->HandleServiceL( aMessage )); + if ( err ) + { + LOGGER_WRITE_1("iAsyncHandler->HandleServiceL leaved: %d", err); + if ( iAsyncHandler->IsActive() ) + { + LOGGER_WRITE(" and it was active -> Cancel it"); + iAsyncHandler->Cancel(); + } + // do server error processing + User::Leave( err ); + } + + TRACE_FUNC_EXIT; + } + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/101F9698.xml Binary file connectivitymodules/SeCon/services/csc/bld/101F9698.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/101F99F6.xml Binary file connectivitymodules/SeCon/services/csc/bld/101F99F6.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/bld.inf --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/bld/bld.inf Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,30 @@ +/* +* Copyright (c) 2005-2010 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Capability Object Module bld.inf file +* +*/ + + +#include + +PRJ_PLATFORMS +DEFAULT + +PRJ_EXPORTS +./101F9698.xml Z:/private/101F99F6/capability/101F9698.xml +./fwdcomp.xml Z:/private/101F99F6/capability/fwdcomp.xml +./101F99F6.xml Z:/private/101F99F6/capability/101F99F6.xml + +PRJ_MMPFILES +sconcsc.mmp diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/def/bwinscwu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/bld/def/bwinscwu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,3 @@ +EXPORTS + ?CreateCSConCSCL@@YAPAVCSConCSC@@XZ @ 1 NONAME ; class CSConCSC * CreateCSConCSCL(void) + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/def/eabiuu.def --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/bld/def/eabiuu.def Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,5 @@ +EXPORTS + _Z15CreateCSConCSCLv @ 1 NONAME + _ZTI8CSConCSC @ 2 NONAME ; ## + _ZTV8CSConCSC @ 3 NONAME ; ## + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/fwdcomp.xml Binary file connectivitymodules/SeCon/services/csc/bld/fwdcomp.xml has changed diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/bld/sconcsc.mmp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/bld/sconcsc.mmp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,79 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Capability Object Module mmp file +* +*/ + + +// To get the MW_LAYER_SYSTEMINCLUDE-definition +#include +#include + +VENDORID VID_DEFAULT + +CAPABILITY CAP_GENERAL_DLL + +TARGETPATH sys/bin + +TARGET sconcsc.dll +TARGETTYPE DLL +UID 0x10009D8D 0x101F9698 + +#if defined(ARMCC) +DEFFILE ./def/eabiu +#elif defined(WINSCW) +DEFFILE ./def/bwinscw +#elif defined(WINS) +DEFFILE ./def/bwins +#elif defined(ARM) +DEFFILE ./def/bmarm +#endif + +SOURCEPATH ../src +SOURCE sconcsc.cpp +SOURCE capinfo.cpp +SOURCE caputils.cpp +SOURCE caplist.cpp +SOURCE stringlist.cpp +SOURCE capparser.cpp +SOURCE sconsyncservice.cpp +SOURCE sconversioninfo.cpp + +USERINCLUDE ../inc +USERINCLUDE ../../../inc + +// Default system include paths for middleware layer modules. +//MW_LAYER_SYSTEMINCLUDE +APP_LAYER_SYSTEMINCLUDE + +DEBUGLIBRARY flogger.lib +LIBRARY euser.lib +LIBRARY efsrv.lib +LIBRARY bafl.lib +LIBRARY sysutil.lib +LIBRARY etel.lib +LIBRARY etelmm.lib +LIBRARY hal.lib +LIBRARY platformenv.lib +LIBRARY charconv.lib +LIBRARY centralrepository.lib +LIBRARY apgrfx.lib +LIBRARY apparc.lib +LIBRARY sisregistryclient.lib +LIBRARY SyncMLClientAPI.lib +LIBRARY javaregistryclient.lib +LIBRARY sysversioninfo.lib +LIBRARY Etel3rdParty.lib +LIBRARY platformver.lib + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/capability.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/capability.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,483 @@ +/* +* Copyright (c) 2002-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Capability service controller +* +*/ + + +#ifndef _CAPABILITY_H_ +#define _CAPABILITY_H_ + +#include + +// +// string sizes +// +const TInt KBufSize(128); +const TInt KTagSize(64); +const TInt KMaxSize(512); + +const TInt KNestingLimit(10); + +// +// this directory contains xml-format files for +// Service-elements +// +_LIT(KCapabilityDirC, "c:\\private\\101F99F6\\capability\\"); +_LIT(KCapabilityDirCImport, "c:\\private\\101F99F6\\import\\"); +_LIT(KCapabilityDirZ, "z:\\private\\101F99F6\\capability\\"); + +// +// folder service constants +// +_LIT(KFolderServiceName, "Folder-Browsing"); +_LIT(KFolderServiceUid, "F9EC7BC4-953c-11d2-984E-525400DC9E09"); +_LIT(KFolderServiceVersion, "1.0"); +_LIT(KFolderServiceType, "x-obex/folder-listing"); +_LIT(KFolderMemoryTypeTag, "MemType"); +_LIT(KFolderNameTag, "Folder"); + +_LIT(KFolderImages, "Images"); +_LIT(KFolderGraphics, "Graphics"); +_LIT(KFolderTones, "Tones"); +_LIT(KFolderMusic, "Music"); +_LIT(KFolderVideos, "Videos"); +_LIT(KFolderInstalls, "Installs"); + +_LIT( KSyncSolutionsServiceName, "SyncSolutions" ); +_LIT( KSyncSolutionsServiceVersion, "1.0" ); +_LIT( KSyncCalendar, "Calendar" ); +_LIT( KSyncContacts, "Contacts" ); +_LIT( KSyncSms, "Sms" ); +_LIT( KSyncBookmark, "Bookmark" ); + +_LIT( KDesktopSync, "DesktopSync" ); + +enum TFolderTypes + { + EFolderImages, + EFolderGraphics, + EFolderTones, + EFolderMusic, + EFolderVideos, + EFolderInstalls + }; + + +// +// misc capabily document strings +// +_LIT(KServiceHeader, ""); +_LIT(KXmlVersion, ""); +_LIT(KComment1, ""); +_LIT(KDocType, ""); +_LIT(KRootBegin, ""); +_LIT(KRootEnd, ""); +_LIT(KCommentBegin, ""); +_LIT(KFormatText, " "); +_LIT(KXmlExtension, ".xml"); + + +// +// manufacturers +// +_LIT(KManufacturerNokia, "Nokia"); +_LIT(KManufacturerEricsson, "Ericsson"); +_LIT(KManufacturerMotorola, "Motorola"); +_LIT(KManufacturerPanasonic, "Panasonic"); +_LIT(KManufacturerPsion, "Psion"); +_LIT(KManufacturerIntel, "Intel"); +_LIT(KManufacturerCogent, "Cogent"); +_LIT(KManufacturerCirrus, "Cirrus"); +_LIT(KManufacturerLinkup, "Linkup"); +_LIT(KManufacturerTexasInstruments, "TexasInstruments"); + + +// +// media types (TMediaType in e32std.h) +// +_LIT(KMediaMMC, "MMC"); // memory card +_LIT(KMediaFlash, "DEV"); // device memory + +// +// TElementType contains all element types used in +// capabilty xml document +// +// +enum TElementType + { + ECapability, + EGeneral, + EManufacturer, + EModel, + ESN, + EOEM, + ESW, + EFW, + EHW, + ELanguage, + EMemory, + EMemType, + ELocation, + EFree, + EUsed, + EShared, + EFileSize, + EFolderSize, + EFileNLen, + EFolderNLen, + ECaseSenN, + + EExt, + EXNam, + EXVal, + + EObject, + EType, + EName_Ext, + ESize, + + EAccess, + EProtocol, + EEndpoint, + ETarget, + + EInbox, + EService, + EName, + EUUID, + EVersion, + + EAttVersion, + EAttDate, + + EAttCurrentNetwork, + EAttHomeNetwork, + EAttCountryCode + }; + + + + +// +// KXmlTokens contains all tokens (=tags) used in +// capabilty xml document +// +// + +typedef const TText* TTag; +NONSHARABLE_STRUCT( TXmlToken ) + { + TInt id; + TTag tag; + }; + +const TXmlToken KXmlTokens[] = + { + {ECapability, _S("Capability")}, + {EGeneral, _S("General")}, + {EManufacturer, _S("Manufacturer")}, + {EModel, _S("Model")}, + {ESN, _S("SN")}, + {EOEM, _S("OEM")}, + {ESW, _S("SW")}, + {EFW, _S("FW")}, + {EHW, _S("HW")}, + {ELanguage, _S("Language")}, + {EMemory, _S("Memory")}, + {EMemType, _S("MemType")}, + {ELocation, _S("Location")}, + {EFree, _S("Free")}, + {EUsed, _S("Used")}, + {EShared, _S("Shared")}, + {EFileSize, _S("FileSize")}, + {EFolderSize, _S("FolderSize")}, + {EFileNLen, _S("FileNLen")}, + {EFolderNLen, _S("FolderNLen")}, + {ECaseSenN, _S("CaseSenN")}, + {EExt, _S("Ext")}, + {EXNam, _S("XNam")}, + {EXVal, _S("XVal")}, + {EObject, _S("Object")}, + {EType, _S("Type")}, + {EName_Ext, _S("Name_Ext")}, + {ESize, _S("Size")}, + {EAccess, _S("Access")}, + {EProtocol, _S("Protocol")}, + {EEndpoint, _S("Endpoint")}, + {ETarget, _S("Target")}, + {EInbox, _S("Inbox")}, + {EService, _S("Service")}, + {EName, _S("Name")}, + {EUUID, _S("UUID")}, + {EVersion, _S("Version")}, + {EXNam, _S("XNam")}, + {EXVal, _S("XVal")}, + {EAttVersion, _S("Version")}, + {EAttDate, _S("Date")}, + {EAttCurrentNetwork,_S("CurrentNetwork")}, + {EAttHomeNetwork, _S("HomeNetwork")}, + {EAttCountryCode, _S("CountryCode")} + }; + +#define NUMXMLTOKENS (sizeof(KXmlTokens)/sizeof(TXmlToken)) + + + + +// +// string array to convert symbian TLanguage enums to +// ISO 639 language codes +// +// See "http://www.sil.org/iso639-3/default.asp" +// + +typedef const TText* TLangString; +NONSHARABLE_STRUCT( TLangStringStruct ) + { + TInt id; + TLangString lang; + }; + +/** + * Language mapping table. + */ +const TLangStringStruct KLangStrings[] = + { + {ELangEnglish, _S("en")}, + {ELangFrench, _S("fr")}, + {ELangGerman, _S("de")}, + {ELangSpanish, _S("es")}, + {ELangItalian, _S("it")}, + {ELangSwedish, _S("sv")}, + {ELangDanish, _S("da")}, + {ELangNorwegian, _S("no")}, + {ELangFinnish, _S("fi")}, + + {ELangAmerican, _S("en_US")}, + {ELangSwissFrench, _S("fr_CH")}, + {ELangSwissGerman, _S("de_CH")}, + {ELangPortuguese, _S("pt")}, + {ELangTurkish, _S("tr")}, + {ELangIcelandic, _S("is")}, + {ELangRussian, _S("ru")}, + {ELangHungarian, _S("hu")}, + {ELangDutch, _S("nl")}, + + {ELangBelgianFlemish, _S("nl_BE")}, + {ELangAustralian, _S("aus")}, + {ELangBelgianFrench, _S("fr_BE")}, + {ELangAustrian, _S("de_AT")}, + {ELangNewZealand, _S("en_NZ")}, + {ELangInternationalFrench, _S("fr")}, + {ELangCzech, _S("cs")}, + {ELangSlovak, _S("sk")}, + {ELangPolish, _S("pl")}, + + {ELangSlovenian, _S("sl")}, + {ELangTaiwanChinese, _S("zh_TW")}, + {ELangHongKongChinese, _S("zh_HK")}, + {ELangPrcChinese, _S("zh_CN")}, + {ELangJapanese, _S("ja")}, + {ELangThai, _S("th")}, + {ELangAfrikaans, _S("af")}, + {ELangAlbanian, _S("sq")}, + {ELangAmharic, _S("am")}, + + {ELangArabic, _S("ar")}, + {ELangArmenian, _S("hy")}, + {ELangTagalog, _S("tl")}, + {ELangBelarussian, _S("be")}, + {ELangBengali, _S("bn")}, + {ELangBulgarian, _S("bg")}, + {ELangBurmese, _S("my")}, + {ELangCatalan, _S("ca")}, + {ELangCroatian, _S("hr")}, + + {ELangCanadianEnglish, _S("en_CA")}, + {ELangInternationalEnglish, _S("en")}, + {ELangSouthAfricanEnglish, _S("en_ZA")}, + {ELangEstonian, _S("et")}, + {ELangFarsi, _S("fa")}, + {ELangCanadianFrench, _S("fr_CA")}, + {ELangScotsGaelic, _S("gd")}, + {ELangGeorgian, _S("ka")}, + {ELangGreek, _S("el")}, + + {ELangCyprusGreek, _S("el_CY")}, + {ELangGujarati, _S("gu")}, + {ELangHebrew, _S("he")}, + {ELangHindi, _S("hi")}, + {ELangIndonesian, _S("id")}, + {ELangIrish, _S("ga")}, + {ELangSwissItalian, _S("it_CH")}, + {ELangKannada, _S("kn")}, + {ELangKazakh, _S("kk")}, + + {ELangKhmer, _S("km")}, + {ELangKorean, _S("ko")}, + {ELangLao, _S("lo")}, + {ELangLatvian, _S("lv")}, + {ELangLithuanian, _S("lt")}, + {ELangMacedonian, _S("mk")}, + {ELangMalay, _S("ms")}, + {ELangMalayalam, _S("ml")}, + {ELangMarathi, _S("mr")}, + + {ELangMoldavian, _S("mo")}, + {ELangMongolian, _S("mn")}, + {ELangNorwegianNynorsk, _S("nn")}, + {ELangBrazilianPortuguese, _S("pt_BR")}, + {ELangPunjabi, _S("pa")}, + {ELangRomanian, _S("ro")}, + {ELangSerbian, _S("sr")}, + {ELangSinhalese, _S("si")}, + {ELangSomali, _S("so")}, + + {ELangInternationalSpanish, _S("es")}, + {ELangLatinAmericanSpanish, _S("es_US")}, + {ELangSwahili, _S("sw")}, + {ELangFinlandSwedish, _S("sv_FI")}, + {ELangReserved1, _S("en")}, + {ELangTamil, _S("ta")}, + {ELangTelugu, _S("te")}, + {ELangTibetan, _S("bo")}, + {ELangTigrinya, _S("ti")}, + + {ELangCyprusTurkish, _S("tr_CY")}, + {ELangTurkmen, _S("tk")}, + {ELangUkrainian, _S("uk")}, + {ELangUrdu, _S("ur")}, + {ELangReserved2, _S("en")}, + {ELangVietnamese, _S("vi")}, + {ELangWelsh, _S("cy")}, + {ELangZulu, _S("zu")}, + {ELangOther, _S("other")}, + + {ELangManufacturerEnglish, _S("en")}, + {ELangSouthSotho, _S("st")}, + {ELangBasque, _S("eu")}, + {ELangGalician, _S("gl")}, + {ELangJavanese, _S("jv")}, + {ELangMaithili, _S("bh")}, + {ELangAzerbaijani_Latin, _S("az")}, + {ELangAzerbaijani_Cyrillic, _S("az")}, + {ELangOriya, _S("or")}, + {ELangBhojpuri, _S("bh")}, + {ELangSundanese, _S("su")}, + {ELangKurdish_Latin, _S("ku")}, + {ELangKurdish_Arabic, _S("ku")}, + {ELangPashto, _S("ps")}, + {ELangHausa, _S("ha")}, + {ELangOromo, _S("om")}, + {ELangUzbek_Latin, _S("uz")}, + {ELangUzbek_Cyrillic, _S("uz")}, + {ELangSindhi_Arabic, _S("sd")}, + {ELangSindhi_Devanagari, _S("sd")}, + {ELangYoruba, _S("yo")}, + {ELangCebuano, _S("ceb")}, + {ELangIgbo, _S("ig")}, + {ELangMalagasy, _S("mg")}, + {ELangNepali, _S("ne")}, + {ELangAssamese, _S("as")}, + {ELangShona, _S("sn")}, + {ELangZhuang, _S("za")}, + {ELangMadurese, _S("mad")}, + + {ELangEnglish_Apac, _S("en")}, + {ELangEnglish_Taiwan, _S("en")}, + {ELangEnglish_HongKong, _S("en")}, + {ELangEnglish_Prc, _S("en")}, + {ELangEnglish_Japan, _S("en")}, + {ELangEnglish_Thailand, _S("en")}, + + {ELangFulfulde, _S("ff")}, + {ELangTamazight, _S("ber")}, + {ELangBolivianQuechua, _S("qu")}, + {ELangPeruQuechua, _S("qu")}, + {ELangEcuadorQuechua, _S("qu")}, + {ELangTajik_Cyrillic, _S("tg")}, + {ELangTajik_PersoArabic, _S("tg")}, + {ELangNyanja, _S("ny")}, + {ELangHaitianCreole, _S("ht")}, + {ELangLombard, _S("lmo")}, + {ELangKoongo, _S("kg")}, + {ELangAkan, _S("ak")}, + {ELangHmong, _S("hmn")}, + {ELangYi, _S("ii")}, + {ELangTshiluba, _S("lu")}, + {ELangIlocano, _S("ilo")}, + {ELangUyghur, _S("ug")}, + {ELangNeapolitan, _S("nap")}, + {ELangRwanda, _S("rw")}, + {ELangXhosa, _S("xh")}, + {ELangBalochi, _S("bal")}, + {ElangHiligaynon, _S("hil")}, + {ELangMinangkabau, _S("min")}, + {ELangMakhuwa, _S("vmw")}, + {ELangSantali, _S("sat")}, + {ELangGikuyu, _S("ki")}, + {ELangMoore, _S("mos")}, + {ELangGuarani, _S("gnHI")}, + {ELangRundi, _S("ru")}, + {ELangRomani_Latin, _S("rom")}, + {ELangRomani_Cyrillic, _S("rom")}, + {ELangTswana, _S("tn")}, + {ELangKanuri, _S("kr")}, + {ELangKashmiri_Devanagari, _S("ks")}, + {ELangKashmiri_PersoArabic, _S("ks")}, + {ELangUmbundu, _S("umb")}, + {ELangKonkani, _S("kok")}, + {ELangBalinese, _S("ban")}, + {ELangNorthernSotho, _S("nso")}, + {ELangWolof, _S("wo")}, + {ELangBemba, _S("bmy")}, + {ELangTsonga, _S("ts")}, + {ELangYiddish, _S("yi")}, + {ELangKirghiz, _S("ky")}, + {ELangGanda, _S("lg")}, + {ELangSoga, _S("xog")}, + {ELangMbundu, _S("kmb")}, + {ELangBambara, _S("bm")}, + {ELangCentralAymara, _S("ay")}, + {ELangZarma, _S("dje")}, + {ELangLingala, _S("ln")}, + {ELangBashkir, _S("ba")}, + {ELangChuvash, _S("cv")}, + {ELangSwati, _S("ss")}, + {ELangTatar, _S("tt")}, + {ELangSouthernNdebele, _S("nr")}, + {ELangSardinian, _S("sc")}, + {ELangScots, _S("sco")}, + {ELangMeitei, _S("mni")}, + {ELangWalloon, _S("wa")}, + {ELangKabardian, _S("kbd")}, + {ELangMazanderani, _S("mzn")}, + {ELangGilaki, _S("glk")}, + {ELangShan, _S("shn")}, + {ELangLuyia, _S("luy")}, + {ELanguageLuo, _S("luo")}, + {ELangSukuma, _S(" suk")}, + {ELangAceh, _S("ace")}, + {ELangMalay_Apac, _S("ms")} + }; + +#define NUMLANGSTRINGS (sizeof(KLangStrings)/sizeof(TLangStringStruct)) + + + + +#endif // capability.h + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/capinfo.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/capinfo.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,94 @@ +/* +* Copyright (c) 2002-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Capability service controller +* +*/ + + +#ifndef _CAPINFO_H_ +#define _CAPINFO_H_ + +#include +#include + +#include "caputils.h" + +// +// CCapInfo creates capability document +// +// + +class CCapList; +class CStringList; +class TSConSolutionInfo; +class CSconVersionInfo; + +NONSHARABLE_CLASS( CCapInfo ) : public CBase +{ +public: + static CCapInfo* NewL(); + ~CCapInfo(); +private: + CCapInfo(); + void ConstructL(); + +public: + void CapabilityDocumentL( CBufFlat* aBuf ); + +private: + CCapList* CapList(); + void SetCapabilityBuf( CBufFlat* aBuf ); + + void GeneralInfoL(); + void MemoryInfoL(); + void WriteMemoryInfoL( TMemoryInfo& aInfo ); + void ServiceInfoL( const TDesC& aDir, const RArray& aExcludeList, + RArray& aFilesAdded ); + void FolderServiceL(); + + void SyncSolutionsServiceL(); + void WriteSyncSolutionsServiceL( const TSConSolutionInfo& aCalendar, + const TSConSolutionInfo& aContact, + const TSConSolutionInfo& aSms, + const TSConSolutionInfo& aBookmark ); + void WriteSolutionTagL( const TDesC& aContentName, const TSConSolutionInfo& aSolution ); + + void WriteFolderL( const TDesC& aType, const TDesC& aFullName, const TDesC& aMemory ); + + void WriteValueL( TInt aId, const TDesC& aValue ); + void WriteBigValueL( TInt aId, const TDesC& aValue ); + void WriteValueL( TInt aId, TInt64 aValue ); + void WriteTagL( TInt aId, TInt aType ); + void WriteAttributeL( TInt aId, const TDesC& aVersion, const TDesC& aDate ); + void WriteL( const TDesC& aText ); + + void WriteFromListL( CStringList* aList ); + void WriteNewLineL(); + + void FormatElement( TDes& aText ); + void AddFormatText( TDes& aText, TInt aNum ) const; + +private: + RFs iFsSession; // has + CCapList* iCapList; // has + HBufC8* iHeapBuf; // has + TBuf iBuf; + TIdStack iIdStack; + + CBufFlat* iCapabilityBuf; // uses + CSconVersionInfo* iSconInfo; +}; + +#endif // CCapability + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/caplist.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/caplist.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,107 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCapList header file. +* +*/ + + +#ifndef _CAPLIST_H_ +#define _CAPLIST_H_ + +// INCLUDES + +#include +#include +#include "stringlist.h" + +// +// Class CCapList +// +NONSHARABLE_CLASS( CCapList ) : public CBase +{ +public: + /** + * Two-phase constructor. + * @return CCapList instance + */ + static CCapList* NewL(); + /** + * Destructor + * @return none + */ + ~CCapList(); + +private: + /** + * Constructor + * @return none + */ + CCapList(); + /** + * Initializes the member data + * @return none + */ + void ConstructL(); + /** + * Operator = + * @param aList The data to be copied + * @return none + */ + void operator=(const CCapList& aList); // not allowed + +public: + /** + * Returns the list + * @return The CStringList object + */ + CStringList* List(); + +public: + /** + * Find element + * @param aId + * @param aType + * @param aIndex (Default=0) + * @return position + */ + TInt Find(TInt aId, TInt aType, TInt aIndex=0); + /** + * Find from mark + * @param aId + * @param aType + * @return position + */ + TInt FindFromMark(TInt aId, TInt aType); + /** + * Finds service xml-file identification header. This header must be the first + * line in every service file. + * @return ETrue if service header found + */ + TBool FindServiceHeader(); + /** + * Find service + * @param aList The source list + * @return ETrue if Service is found + */ + TBool FindServiceL(CStringList* aList); + +private: + CStringList* iList; // has +}; + +#endif + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/capparser.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/capparser.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,296 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CapParser header file +* +*/ + + + +#ifndef _CAPPARSER_H_ +#define _CAPPARSER_H_ + +// INCLUDES + +#include +#include + +// +// Class CapParser +// +NONSHARABLE_CLASS( CapParser ) + { + +public: + /** + * Parses element's id and type (eg. "" -> EMemory, EElementBegin) + * @param aText + * @param aId + * @param aType + * @return none + */ + static void ParseElement(const TDesC& aText, TInt& aId, TInt& aType); + +public: + /** + * Constructs element with value (eg. "23456"). + * @param aText + * @param aId + * @param aValue + * @return none + */ + static void MakeElementL(TDes& aText, TInt aId, const TDesC& aValue); + /** + * Constructs element without value (eg. "" or ""). + * @param aText + * @param aId + * @param aType + * @return none + */ + static void MakeElementL(TDes& aText, TInt aId, TInt aType); + /** + * Constructs element with attributes "Version" and "Date"(eg. + * ""). + * @param aText + * @param aId + * @param aVersion + * @param aDate + * @return none + */ + static void MakeElementL(TDes& aText, TInt aId, const TDesC& aVersion, + const TDesC& aDate); + /** + * Constructs element with attributes + * @param aText + * @param aId + * @param aAttributes + * @return none + */ + static void MakeElementL(TDes& aText, TInt aId, CDesCArrayFlat* aAttributes); + +public: + /** + * Returns capability element id (eg. EMemory). + * @param aText + * @return none + */ + static TInt ElementId(const TDesC& aText); + /** + * Returns capability element tag (eg. "Memory"). + * @param aText + * @param aId + * @return none + */ + static void GetTagL(TDes& aText, TInt aId); + +private: + /** + * Replaces special characters to xml compliant. + * @param aText + * @param aValue + * @return none + */ + static void ReplaceSpecialCharsL( TDes& aText, const TDesC& aValue ); + }; + + +// +// Class TXmlParser +// +NONSHARABLE_CLASS( TXmlParser ) + { + +public: + enum TElementType + { + EElementValue, + EElementBegin, + EElementEnd, + EElementEmpty, + EElementAtt, + EElementComment, + EElementVersion, + EElementDocType, + EElementUnknown + }; + + +public: + /** + * Sets a tag + * @param aText The tag + * @return none + */ + void Set(const TDesC& aText); + /** + * Returns type + * @return type + */ + TInt Type() const; + /** + * Returns a pointer to a tag + * @return The tag pointer + */ + TPtrC Tag() const; + /** + * Gets the tag + * @param aText The tag buffer + * @return none + */ + void GetTag(TDes& aText) const; + +private: + /** + * Parses value (eg. en) + * @return Operation success + */ + TBool ElementValue(); + /** + * Parses beginning tag (eg. ) + * @return Operation success + */ + TBool ElementBegin(); + /** + * Parses ending tag (eg. ) + * @return Operation success + */ + TBool ElementEnd(); + /** + * Parses empty element (eg. ) + * @return Operation success + */ + TBool ElementEmpty(); + /** + * Parses attribute element (eg. ) + * Note: Attribute values cannot contain equals (=) or quotations (") + * @return Operation success + */ + TBool ElementAtt(); + /** + * Identifies comment element (""). + * @return Operation success + */ + TBool ElementComment(); + /** + * Parses unknown elements + * @return Operation success + */ + TBool ElementUnknown(); + /** + * Identifies version element ("") + * @return Operation success + */ + TBool ElementVersion(); + /** + * Identifies document type element + * (""). + * @return Operation success + */ + TBool ElementDocType(); + +private: + /** + * Inits the parser + * @return none + */ + void Init(); + /** + * Parses xml-element. + * @return none + */ + void Parse(); + +public: + /** + * Validates the character + * @param aChar The char to be validated. + * @return ETrue if the char is valid + */ + static TBool ValidChar(const TChar aChar); + /** + * Validates the tag + * @param aText The tag to be validated. + * @return ETrue if the tag is valid + */ + static TBool ValidTag(const TDesC& aText); + /** + * Returns the number of characters (aChar) + * @param aText The buffer + * @param aChar The character + * @return The number of characters + */ + static TInt Count(const TDesC& aText, const TChar aChar); + /** + * Returns the position of the first non space character + * @param aText The buffer + * @return The position + */ + static TInt FirstNonSpace(const TDesC& aText); + /** + * Returns the position of the last non space character + * @param aText The buffer + * @return The position + */ + static TInt LastNonSpace(const TDesC& aText); + /** + * Function returns a sub-string between aPos1 and aPos2 + * @param aText The buffer + * @param aText Start position + * @param aText End position + * @return The pointer to the substring + */ + static TPtrC SubStr(const TDesC& aText, TInt aPos1, TInt aPos2); + /** + * Function performs string copy with length checking. + * @param aTarget Target buffer + * @param aSource Source buffer + * @return none + */ + static void StrCopy(TDes& aTarget, const TDesC& aSource); + +private: + /** + * Returns a string + * @return A pointer to a string + */ + TPtrC Str() const; + /** + * Trimmer function + * @return none + */ + void TrimOriginal(); + /** + * Function returns sub string between aPos1 and aPos2 + * @param aPos1 Start position + * @param aPos2 End posiotion + * @return none + */ + TPtrC SubStr(TInt pos1, TInt pos2); + +private: + TPtrC iOriginal; + TPtrC iText; + TPtrC iTag; + TPtrC iValue; + TInt iType; + + TInt iSlash; + TInt iFirst; + TInt iLast; + }; + +#endif + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/caputils.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/caputils.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,252 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CapUtil header file +* +*/ + + +// INCLUDES + +#ifndef _CAPUTILS_H_ +#define _CAPUTILS_H_ + +#include "capability.h" + +class RFs; + +// +// TMemoryInfo +// +NONSHARABLE_CLASS( TMemoryInfo ) + { +public: + TChar iDriveLetter; + TInt iDriveNum; + TBuf<16> iLocation; + TInt64 iFree; + TInt64 iUsed; + TBool iShared; + TInt64 iFileSize; + TInt64 iFolderSize; + TInt iFileNameSize; + TInt iFolderNameSize; + TBool iCaseSensitivity; + TUint iDriveStatus; + TInt iMemNr; + }; + +// +// CapUtil +// +NONSHARABLE_CLASS( CapUtil ) + { +public: + /** + * Gets default root path from pathinfo. + * @param aText + * @param aType + * @return none + */ + static void GetDefaultRootPathL( RFs& aFs, TDes& aRootPath ); + + /** + * Gets memory type. + * @param aFs + * @param aMemoryType + * @param aDrive + * @return none + */ + static void GetMemoryType( RFs& aFs, TDes& aMemoryType, const TInt aDrive ); + + /** + * Gets language + * @param aText + * @return none + */ + static void GetLanguage( TDes& aText ); + + /** + * Gets SW version, SW version date and device model from SysUtil. + * @param aVersion SW version + * @param aDate SW date + * @param aModel Device model + * @return none + */ + static void GetSWVersionL( TDes& aVersion, TDes& aDate, TDes& aModel ); + + /** + * Gets phone manufacturer from HAL. In case manufacturer is not known, + * empty value is used. + * @param aText Manufacturer + * @return none + */ + static void GetManufacturer( TDes& aText ); + + /** + * Get memory information for one drive. + * @param aFs RFs handle + * @param aDriveNumber drive number + * @param aInfo Memory information + * @return none + */ + static void GetMemoryInfoL( const RFs& aFs, const TInt aDriveNumber, TMemoryInfo& aInfo ); + + /** + * Initializes TMemoryInfo. + * @param aInfo TMemoryInfo to be initialized + * @return none + */ + static void InitMemoryInfo( TMemoryInfo& aInfo ); + + /** + * Get language string for aId. + * @param aId Language id + * @param aText Language text + * @return none + */ + static void GetLanguageString( TLanguage aId, TDes& aText ); + + /** + * Finds all files in aDir. + * @param aFs RFs handle + * @param aDir Directory + * @param aList List of files in directory + * @return none + */ + static void GetFileListL( const RFs& aFs, const TDesC& aDir, + RArray& aList ); + + + /** + * Gets operator name, country code, network ID + * @param aLongName + * @param aCountryCode + * @param aNetworkID + * @return none + */ + static void GetOperatorNameL( TDes& aLongName, TDes& aCountryCode, TDes& aNetworkID ); + + /** + * Creates a panic + * @param aReason Panic code + * @return none + */ + static void Panic( TInt aReason ); + + /** + * String copy with lenght check. + * @param aTarget Target string + * @param aSource Source string + * @return none + */ + static void StrCopy( TDes& aTarget, const TDesC& aSource ); + + /** + * Function converts �nteger to string. + * @param aText string + * @param aNum integer + * @return none + */ + static void IntToStr( TDes& aText, TInt64 aNum ); + + /** + * Function converts string to integer. If string cannot be converted, + * error code is returned. + * @param aText string + * @param aNum integer + * @return error code + */ + static TInt StrToInt( const TDesC& aText, TInt& aNum ); + + /** + * Function splits string (eg "name1, name2, name3") into substrings. + * @param aText string + * @param aSeparator separator character + * @param aArray substrings + * @return none + */ + static void SplitL( const TDesC& aText, const TChar aSeparator, + RArray& aArray ); + + /** + * Constructs capability date as string + * @param aText string + * @param aTime time object + * @return none + */ + static void CapabilityDate( TDes& aText, const TTime aTime ); + + /** + * Function parses date string of the format "dd-mm-yy". + * @param aText string + * @return time object + */ + static TTime ParseDateL( const TDesC& aText ); + + /** + * Function return TMonth presentation of integer + * @param aNum + * @return TMonth object + */ + static TMonth Month( TInt aNum ); + + /** + * Function checks file extension. + * @param aFile File name + * @param aExt extension + * @return boolean + */ + static TBool CheckFileType( const TDesC& aFile, const TDesC& aExt ); + }; + +// +// TIdStack +// +NONSHARABLE_CLASS( TIdStack ) + { +public: + + /** + * Push id to the stack + * @param aId Id number + * @return none + */ + void Push( TInt aId ); + + /** + * Pop id from the stack + * @return id + */ + TInt Pop(); + + /** + * Size of the stack + * @return size + */ + TInt Size() const; + + /** + * Reset the stack. + * @return none + */ + void Reset(); + +private: + TInt iPos; + TFixedArray iArray; + }; + +#endif // CapUtils.h + +// End of file diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/sconcsc.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/sconcsc.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,61 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSConCSC header file +* +*/ + + +// INCLUDES + +#ifndef _SCONCSC_H_ +#define _SCONCSC_H_ + +#include + +class CCapInfo; + +//============================================================ +// Class CSConCSC declaration +//============================================================ +class CSConCSC : public CBase +{ +public: + static CSConCSC* NewL(); + ~CSConCSC(); + +public: + // Creates capability object and places it into aBuf. + // Returns system error code + virtual TInt CapabilityObject( CBufFlat& aBuf ); + +private: + void CapabilityObjectL( CBufFlat& aBuf ); + + CSConCSC(); + virtual void ConstructL(); + +private: // data + CCapInfo* iCapInfo; + +}; + +IMPORT_C CSConCSC* CreateCSConCSCL(); +typedef CSConCSC* (*TSConCreateCSConCSCFunc) (); + + +#endif // SCONCSC + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/sconsyncservice.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/sconsyncservice.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,116 @@ +/* +* Copyright (c) 2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CSConSyncService header file. +* +*/ + + +#ifndef _SCONSYNCSERVICE_H_ +#define _SCONSYNCSERVICE_H_ + +#include +#include // RApaLsSession +#include + + +class TApaAppInfo; +class RApaLsSession; +class CRepository; + + +class TSConSolutionInfo + { + public: + TSConSolutionInfo():iTime(0){} + public: + TFileName iSolutionName; + TUint iUid; + TTime iTime; + }; + +/** + * This class provides information about active sync solutions. + * + * @code + * CSConSyncService *syncService = CSConSyncService::NewLC(); + * SConSolutionInfo solutionInfo; + * syncService->GetSolutionL( KSeconCalendarUid, solutionInfo ); + * CleanupStack::PopAndDestroy( syncService ); + * @endcode + * + * @since S60 v5.0 + */ +NONSHARABLE_CLASS( CSConSyncService ) : public CBase + { + public: + static CSConSyncService* NewLC(); + ~CSConSyncService(); + + /** + * Populate SolutionInfo according to content type. + * + * @since S60 v5.0 + * @param aSeconContentType Contenttype to be readed + * @param aSolutionInfo contains founded solution info, + * solution info is empty if not found + * @return none + */ + void GetSolutionL( const TUint aSeconContentType, TSConSolutionInfo& aSolutionInfo ); + + private: + + CSConSyncService(); + void ConstructL(); + + // Return correct providerId according to content type. + TSmlDataProviderId ProviderId( const TUint32 aSeconContentType ) const; + + // Parse time from text + TInt ParseTimestamp( TTime& aTime, const TDesC& aTimestamp ) const; + + // Get application caption. + void GetApplicationCaptionL( TDes& aCaption, const TUid aAppUid ); + + // Search UID from installed applications, return app caption + void GetInstPackageCaptionL( TDes& aCaption, const TUid aPackageUid ); + + // Gets last used profile for selected provider + void GetLastUsedProfileNameL( TDes& aProfileName, TTime& aTime, + const TSmlDataProviderId& aDataProviderId ); + + // Gets last sync time for certain profile and provider. + void GetLastSyncTimeL( TTime& aTime, const TSmlProfileId aSyncProfileId, + const TSmlDataProviderId aDataProviderId ); + + // Gets provider task id from profile + void GetProviderTaskL( TSmlTaskId& aProviderTask, + RSyncMLDataSyncProfile& aSyncProfile, + const TSmlDataProviderId aDataProviderId ) const; + + // Gets latest historyJob where task is correct. + const CSyncMLHistoryJob* LatestHistoryJob( RSyncMLHistoryLog& aHistoryLog, + TInt aTaskId ) const; + + // Returns ETrue if task exists in HistoryJob. + TBool TaskExist( const CSyncMLHistoryJob* aHistoryJob, TInt aTaskId ) const; + + private: // data + TBool iApaSessionConnected; + RApaLsSession iApaSession; + TBool iSyncSessionOpened; + RSyncMLSession iSyncSession; + CRepository* iRepository; + }; + +#endif // _SCONSYNCSERVICE_H_ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/sconversioninfo.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/sconversioninfo.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,116 @@ +/* +* Copyright (c) 2008-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: Handles version fetching +* +*/ + + +#ifndef SCONVERSIONINFO_H_ +#define SCONVERSIONINFO_H_ + +#include +#include +#include +#include +#include + +const TInt KSconSWVersionSize = 50; +const TInt KSconDateSize = 16; +const TInt KMaxLangSize = 5; + +NONSHARABLE_CLASS( CSconVersionInfo ) : public CBase +{ +public: + CSconVersionInfo(); + ~CSconVersionInfo(); + + static CSconVersionInfo* NewL(); + + /** + * + * @param aFs RFs session + * @return none. + */ + void FetchInfoL( RFs& aFs ); + + /** + * Is all data ready. + * @return ETrue if FetchInfoL has been called succesfully. + */ + TBool IsReady(); + + /** + * Get symbian version. FetchInfoL must be called first + * @param aSymbianVersion symbian version + * @return error code. + */ + TInt GetSymbianVersion( SysVersionInfo::TSymbianOSVersion& aSymbianVersion ); + + /** + * Get S60 platform version. FetchInfoL must be called first + * @param aS60Version S60 platform version + * @return error code. + */ + TInt GetS60Version( VersionInfo::TPlatformVersion& aS60Version ); + +public: // data + + /** Contains the manufacturer name. For example "Nokia". */ + HBufC* iManufacturer; + + /** Contains the phone model sales name. For example "N01". */ + HBufC* iModel; + + /** Contains the product code name. For example "RM-1". */ + HBufC* iProduct; + + /** Contains the product revision. For example "01". */ + HBufC* iRevision; + + TBuf< KSconDateSize > iDate; + + HBufC* iSWVersion; + + /** Phone serial number (IMEI or ESN), in character string format. */ + HBufC* iSerialNumber; + + TBuf iLanguage; + + HBufC* iSysVersionInfo; + + HBufC* iLangVersion; + + HBufC* iLangSWVersion; + + HBufC* iOPVersion; + + TSize iScreenSize; + + HBufC* iProductCode; + + TInt iDesktopSyncError; + TInt iDesktopSync; + +private: + TBool iInfoFetched; // ETrue if FetchInfoL has been called succesfully. + + TInt iSymbianVersionError; + SysVersionInfo::TSymbianOSVersion iSymbianVersion; + + TInt iS60VersionError; + VersionInfo::TPlatformVersion iS60Version; + +}; + +#endif /*SCONVERSIONINFO_H_*/ diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/inc/stringlist.h --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/inc/stringlist.h Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,142 @@ +/* +* Copyright (c) 2005-2007 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CStringList header file +* +*/ + + +#ifndef _STRINGLIST_H_ +#define _STRINGLIST_H_ + +// INCLUDES + +#include +#include // for CDesCArrayFlat +#include + +// +// CStringList is used for storing lines of text. +// +NONSHARABLE_CLASS( CStringList ) : public CBase +{ +public: + /** + * Two-phase constructor. The created instance is placed to cleanup stack + * @param aFileName Default KNullDesC + * @return CStringList instance + */ + static CStringList* NewLC(); + /** + * Two-phase constructor. + * @param aFileName Default KNullDesC + * @return CStringList instance + */ + static CStringList* NewL(); + /** + * Destructor + * @return none + */ + ~CStringList(); + +public: + /** + * Returns the count of lines + * @return The count + */ + TInt Count() const; + /** + * Returns pointer to the string + * @param aIndex The position + * @return String pointer + */ + TPtrC16 ReadPtr(TInt aIndex); + /** + * Copies a string / strings + * @param aSource Source buffer + * @param aStart A start position + * @param aStop A stop position + * @return none + */ + void CopyL(CStringList* aSource, TInt aStart, TInt aStop); + /** + * Resets iLines + * @return none + */ + void Reset(); + /** + * Returns the mark + * @return Mark value + */ + TInt Mark() const; + /** + * Sets mark + * @param aMark The mark value + * @return none + */ + void SetMark(TInt aMark); + /** + * Read strings from file. + * @param aText The tag buffer + * @return none + */ + void ReadFromFileL( RFs& aFs, const TDesC& aName ); + +private: + /** + * Default constuctor + * @return none + */ + CStringList(); + /** + * Initializes member data + * @param aFileName The file name + * @return none + */ + void ConstructL(); + /** + * Creates a panic + * @param aPanic Panic code + * @return none + */ + void Panic(TInt aPanic) const; + /** + * Copies the string + * @param aTarget Target string + * @param aSource Source string + * @return ETrue if successful + */ + TBool StrCopy(TDes& aTarget, const TDesC& aSource) const; + /** + * Writes a string + * @param aText The string + * @return none + */ + void WriteL(const TDesC& aText); + /** + * Internalizes from file + * @param aFileName The name of the file + * @return none + */ + void InternalizeL( RFs& aFs, const TDesC& aFileName ); + +private: + TInt iMark; + CDesCArrayFlat* iLines; +}; + +#endif + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/src/capinfo.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/src/capinfo.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,1031 @@ +/* +* Copyright (c) 2005-2009 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCapInfo implementation +* +*/ + + +// INCLUDE FILES + +#include +#include +#include // for PathInfo::SoundsPath +#include +#include "sconsyncservice.h" +#include "capinfo.h" +#include "caplist.h" +#include "capparser.h" +#include "caputils.h" +#include "stringlist.h" +#include "sconversioninfo.h" +#include "debug.h" + + +_LIT8( KLineFeed, "\r\n" ); + +const TInt KDefaultArrayGranularity = 5; + + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CCapInfo::NewL() +// Two-phase constructor +// ----------------------------------------------------------------------------- +// +CCapInfo* CCapInfo::NewL() + { + TRACE_FUNC_ENTRY; + CCapInfo* self = new (ELeave) CCapInfo(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop(self); + TRACE_FUNC_EXIT; + return self; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::~CCapInfo() +// Destructor +// ----------------------------------------------------------------------------- +// +CCapInfo::~CCapInfo() + { + TRACE_FUNC_ENTRY; + iFsSession.Close(); + delete iHeapBuf; + delete iCapList; + delete iSconInfo; + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::CapabilityDocumentL(CBufFlat* aBuf) +// Creates capability xml document end places it in aBuf +// ----------------------------------------------------------------------------- +// +void CCapInfo::CapabilityDocumentL(CBufFlat* aBuf) + { + TRACE_FUNC_ENTRY; + TInt err( KErrNone ); + + // set buffer where capability document is written + SetCapabilityBuf( aBuf ); + + WriteL( KXmlVersion ); + WriteL( KComment1 ); + WriteL( KDocType ); + WriteL( KRootBegin ); + + + // + // general + // + TRAP( err, GeneralInfoL() ); + if ( err != KErrNone ) + { + LOGGER_WRITE_1( "GeneralInfoL failed : %d", err ); + User::Leave( err ); + } + + + // + // services + // + // Search service files first from C-drive, and then from Z + // Do not add same files twice. + + RArray excludeList( KDefaultArrayGranularity ); + CleanupClosePushL( excludeList ); + RArray filesAdded( KDefaultArrayGranularity ); + CleanupClosePushL( filesAdded ); + + //read service files from C Import folder + TRAP( err, ServiceInfoL( KCapabilityDirCImport, excludeList, filesAdded ) ); + LOGGER_WRITE_1( "ServiceInfoL(KCapabilityDirCImport) returned : %d", err ); + for ( TInt i=0; iFetchInfoL( iFsSession )); + LOGGER_WRITE_1("sconInfo->FetchInfoL() Leaved: %d", err); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::CCapInfo() +// Constuctor +// ----------------------------------------------------------------------------- +// +CCapInfo::CCapInfo() + { + } + +// ----------------------------------------------------------------------------- +// CCapInfo::CapList() +// Returns caplist +// ----------------------------------------------------------------------------- +// +CCapList* CCapInfo::CapList() + { + TRACE_FUNC; + __ASSERT_DEBUG(iCapList, CapUtil::Panic(KErrGeneral)); + return iCapList; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::SetCapabilityBuf( CBufFlat* aBuf ) +// Set capability buffer +// ----------------------------------------------------------------------------- +// +void CCapInfo::SetCapabilityBuf( CBufFlat* aBuf ) + { + TRACE_FUNC; + iCapabilityBuf=aBuf; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::GeneralInfoL() +// Write general device capability information. +// ----------------------------------------------------------------------------- +// +void CCapInfo::GeneralInfoL() + { + TRACE_FUNC_ENTRY; + TInt err( KErrNone ); + TBuf buf; + TBuf longName; + TBuf coutryCode; + TBuf networkID; + + WriteTagL(EGeneral, TXmlParser::EElementBegin); + + if ( !iSconInfo->IsReady() ) + { + LOGGER_WRITE("iSconInfo wasn't ready, call iSconInfo->FetchInfoL"); + iSconInfo->FetchInfoL( iFsSession ); + } + + if ( iSconInfo->iManufacturer ) + { + WriteValueL( EManufacturer, *iSconInfo->iManufacturer ); + } + + if ( iSconInfo->iProduct ) + { + WriteValueL( EModel, *iSconInfo->iProduct ); + } + + // serial number + if ( iSconInfo->iSerialNumber ) + { + WriteValueL( ESN, *iSconInfo->iSerialNumber ); + } + + // software version + if ( iSconInfo->iSWVersion ) + { + WriteAttributeL( ESW, *iSconInfo->iSWVersion, iSconInfo->iDate ); + } + + // language + WriteValueL( ELanguage, iSconInfo->iLanguage ); + + // this must succeed - do not trap + MemoryInfoL(); + + // Operator + TRAP( err, CapUtil::GetOperatorNameL( longName, coutryCode, networkID ) ); + LOGGER_WRITE_1( "CapUtil::GGetOperatorNameL returned : %d", err ); + if( err == KErrNone ) + { + LOGGER_WRITE_3( "CSConFsHandler::GetOperatorNameL longName = %S coutryCode = %S networkID = %S", &longName, &coutryCode, &networkID ); + _LIT( KNetworkInfo, "NetworkInfo" ); + _LIT( KCurrentNetwork, "CurrentNetwork=" ); + _LIT( KCountryCode, "CountryCode=" ); + _LIT( KNetworkID, "NetworkID=" ); + + WriteTagL( EExt, TXmlParser::EElementBegin ); + WriteValueL( EXNam, KNetworkInfo ); + + // write CurrentNetwork + buf.Copy( KCurrentNetwork ); + buf.Append( longName ); + WriteValueL( EXVal, buf ); + + // write CountryCode + buf.Copy( KCountryCode ); + buf.Append( coutryCode ); + WriteValueL( EXVal, buf ); + + // write NetworkID + buf.Copy( KNetworkID ); + buf.Append( networkID ); + WriteValueL( EXVal, buf ); + + WriteTagL( EExt, TXmlParser::EElementEnd ); + } + + if ( iSconInfo->iModel ) + { + // print modelname (phone model sales name. For example "N01".) + WriteTagL( EExt, TXmlParser::EElementBegin ); + _LIT(KModelName, "ModelName"); + WriteValueL( EXNam, KModelName ); + WriteValueL( EXVal, *iSconInfo->iModel ); + WriteTagL( EExt, TXmlParser::EElementEnd ); + } + + if ( iSconInfo->iProductCode ) + { + // print productcode + WriteTagL( EExt, TXmlParser::EElementBegin ); + _LIT( KProductCode, "ProductCode" ); + WriteValueL( EXNam, KProductCode ); + WriteValueL( EXVal, *iSconInfo->iProductCode ); + WriteTagL( EExt, TXmlParser::EElementEnd ); + } + + + // print advanced info + WriteTagL( EExt, TXmlParser::EElementBegin ); + _LIT(KAdvancedDeviceInfo, "AdvancedDeviceInfo"); + WriteValueL( EXNam, KAdvancedDeviceInfo ); + + TBuf temp; + + if ( iSconInfo->iRevision ) + { + // product revision. For example "01" + _LIT( KRevision, "Revision=" ); + temp.Copy( KRevision ); + temp.Append( *iSconInfo->iRevision ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + + if ( iSconInfo->iSysVersionInfo ) + { + _LIT( KFWVersion, "FWVersion=" ); + temp.Copy( KFWVersion ); + temp.Append( *iSconInfo->iSysVersionInfo ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + SysVersionInfo::TSymbianOSVersion osVersion; + err = iSconInfo->GetSymbianVersion( osVersion ); + LOGGER_WRITE_1("TSymbianOSVersion info error: %d", err) + if ( !err ) + { + // Now osVersion contains the Symbian OS version information + _LIT( KSymbianOSVersion, "SymbianOSVersion=%d.%d" ); + temp.Format( KSymbianOSVersion, + osVersion.iMajorVersion, + osVersion.iMinorVersion ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + + WriteValueL( EXVal, temp ); + } + + VersionInfo::TPlatformVersion platformVersion; + err = iSconInfo->GetS60Version( platformVersion ); + if ( !err ) + { + _LIT( KS60Version, "S60PlatformVersion=%d.%d" ); + temp.Format( KS60Version, + platformVersion.iMajorVersion, + platformVersion.iMinorVersion ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + + if ( iSconInfo->iLangVersion ) + { + _LIT( KLangVersion, "LangVersion=" ); + temp.Copy( KLangVersion ); + temp.Append( *iSconInfo->iLangVersion ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + if ( iSconInfo->iLangSWVersion ) + { + _LIT( KLangSWVersion, "LangSWVersion=" ); + temp.Copy( KLangSWVersion ); + temp.Append( *iSconInfo->iLangSWVersion ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + if ( iSconInfo->iOPVersion ) + { + // CustomerVersion + _LIT( KOPVersion, "OPVersion=" ); + temp.Copy( KOPVersion ); + temp.Append( *iSconInfo->iOPVersion ); + LOGGER_WRITE_1( "CCapInfo::GeneralInfoL() : %S ", &temp ); + WriteValueL( EXVal, temp ); + } + + // screen size + LOGGER_WRITE_2("Size, width: %d, height: %d", + iSconInfo->iScreenSize.iWidth, + iSconInfo->iScreenSize.iHeight ); + _LIT( KWidth, "ScreenWidth=%d" ); + _LIT( KHeight, "ScreenHeight=%d" ); + + temp.Format( KWidth, iSconInfo->iScreenSize.iWidth ); + WriteValueL( EXVal, temp ); + + temp.Format( KHeight, iSconInfo->iScreenSize.iHeight ); + WriteValueL( EXVal, temp ); + + WriteTagL( EExt, TXmlParser::EElementEnd ); + // end of advanced info + + WriteTagL(EGeneral, TXmlParser::EElementEnd); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::MemoryInfoL() +// Create memory info for all drives (RAM excluded). +// ----------------------------------------------------------------------------- +// +void CCapInfo::MemoryInfoL() + { + TRACE_FUNC_ENTRY; + + TMemoryInfo info; + TInt devDriveCount = 0; + TInt mmcDriveCount = 0; + + //Write all drivers to folderlisting object + TDriveList driveList; + // Get all drives that are visible to the user. + TInt driveCount; + User::LeaveIfError( DriveInfo::GetUserVisibleDrives( iFsSession, driveList, driveCount ) ); + + for( TInt i = EDriveA; i < KMaxDrives; i++ ) + { + if( driveList[i] ) + { + TUint driveStatus; + TInt err = DriveInfo::GetDriveStatus( iFsSession, i, driveStatus ); + if( err ) + { + LOGGER_WRITE_1( "CCapInfo::MemoryInfoL() : DriveInfo::GetDriveStatus: %d", i); + continue; + } + + if( !(driveStatus & DriveInfo::EDrivePresent ) + || driveStatus & DriveInfo::EDriveCorrupt + || (driveStatus & DriveInfo::EDriveRemote) ) + { + LOGGER_WRITE_1( "skip drive %d", i); + continue; + } + + TRAP( err, CapUtil::GetMemoryInfoL( iFsSession, i, info )); + if ( err ) + { + LOGGER_WRITE_1( "CapUtil::GetMemoryInfoL() : Leaved with: %d", err); + continue; + } + + info.iDriveStatus = driveStatus; + if( driveStatus & DriveInfo::EDriveInternal ) + { + // if internal (DEV) drive, save drive number + devDriveCount++; + info.iMemNr = devDriveCount; + } + else if ( driveStatus & DriveInfo::EDriveRemovable ) + { + // if removable (MMC) drive, save drive number + mmcDriveCount++; + info.iMemNr = mmcDriveCount; + } + else + { + // was not internal or removable, skip. + LOGGER_WRITE( "CCapInfo::MemoryInfoL() : not internal or removable, skip." ); + continue; + } + + WriteMemoryInfoL(info); + + } + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::MemoryInfoL(TMemoryInfo& aInfo) +// Create memory info for all drives (RAM excluded). +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteMemoryInfoL(TMemoryInfo& aInfo) + { + TRACE_FUNC_ENTRY; + TBuf buf; + + WriteTagL(EMemory, TXmlParser::EElementBegin); + + if( aInfo.iDriveStatus & DriveInfo::EDriveInternal ) + { + buf = KMediaFlash; + } + else + { + buf = KMediaMMC; // memory card (MMC) + } + + if( aInfo.iMemNr > 1 ) + { + // append memory number DEV2, MMC2.. + buf.AppendNum( aInfo.iMemNr ); + } + + WriteValueL(EMemType, buf); + WriteValueL(ELocation, aInfo.iLocation); + WriteValueL(EFree, aInfo.iFree); + WriteValueL(EUsed, aInfo.iUsed); + + WriteValueL(EFileNLen, aInfo.iFileNameSize); + + WriteTagL(EMemory, TXmlParser::EElementEnd); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::ServiceInfoL(const TDesC& aDir) +// Reads service xml-files from directory and writes them into capability +// document. +// ----------------------------------------------------------------------------- +// +void CCapInfo::ServiceInfoL(const TDesC& aDir, const RArray& aExcludeList, + RArray& aFilesAdded) + { + TRACE_FUNC_ENTRY; + CCapList* capList=CapList(); + + RArray array( KDefaultArrayGranularity ); + CleanupClosePushL(array); + + CStringList* stringList=CStringList::NewLC(); + + CapUtil::GetFileListL(iFsSession, aDir, array); + + _LIT(KFormat, "%S%S"); + TFileName name; + TInt count=array.Count(); + for (TInt i=0; iList()->Reset(); + capList->List()->ReadFromFileL( iFsSession, name ); + if (capList->FindServiceL(stringList)) + { + WriteNewLineL(); + WriteFromListL(stringList); + + User::LeaveIfError( aFilesAdded.Append(array[i]) ); + LOGGER_WRITE_1( "File '%S' added to list", &array[i] ); + } + } + } + + CleanupStack::PopAndDestroy(stringList); + CleanupStack::PopAndDestroy(&array); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::FolderServiceL() +// Writes folder service. Notice that this service is created in code because +// pathinfo component is used to get folder names. +// ----------------------------------------------------------------------------- +// +void CCapInfo::FolderServiceL() + { + TRACE_FUNC_ENTRY; + TBuf rootPath; + TBuf memoryType(KNullDesC); + TFileName folderName; + _LIT( KFormat, "%S%S" ); + + WriteNewLineL(); + WriteTagL(EService, TXmlParser::EElementBegin); + + WriteValueL(EName, KFolderServiceName); + WriteValueL(EUUID, KFolderServiceUid); + WriteValueL(EVersion, KFolderServiceVersion); + + WriteTagL(EObject, TXmlParser::EElementBegin); + WriteValueL(EType, KFolderServiceType); + WriteTagL(EObject, TXmlParser::EElementEnd); + TInt drive; + TInt err; + + CapUtil::GetDefaultRootPathL( iFsSession, rootPath ); + if( rootPath.Length() > 0 ) + { + err = iFsSession.CharToDrive( rootPath[0], drive ); + if( err == KErrNone ) + { + CapUtil::GetMemoryType( iFsSession, memoryType, drive ); + } + } + + // EFolderImages + folderName.Format( KFormat, &rootPath, &PathInfo::ImagesPath() ); + WriteFolderL( KFolderImages, folderName, memoryType ); + + // EFolderGraphics + folderName.Format( KFormat, &rootPath, &PathInfo::ImagesPath() ); + WriteFolderL(KFolderGraphics, folderName, memoryType); + + // EFolderTones + folderName.Format( KFormat, &rootPath, &PathInfo::DigitalSoundsPath() ); + WriteFolderL(KFolderTones, folderName, memoryType); + + // EFolderMusic + folderName.Format( KFormat, &rootPath, &PathInfo::SoundsPath() ); + WriteFolderL(KFolderMusic, folderName, memoryType); + + // EFolderVideos + folderName.Format( KFormat, &rootPath, &PathInfo::VideosPath() ); + WriteFolderL(KFolderVideos, folderName, memoryType); + + // EFolderInstalls + folderName.Format( KFormat, &rootPath, &PathInfo::InstallsPath() ); + WriteFolderL(KFolderInstalls, folderName, memoryType); + + + WriteTagL(EService, TXmlParser::EElementEnd); + WriteNewLineL(); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::SyncSolutionsServiceL() +// Reads last used syncSolutions from cenrep and writes to capability object +// ----------------------------------------------------------------------------- +// +void CCapInfo::SyncSolutionsServiceL() + { + TRACE_FUNC_ENTRY; + TSConSolutionInfo calendar; + TSConSolutionInfo contact; + TSConSolutionInfo sms; + TSConSolutionInfo bookmark; + + CSConSyncService *syncService = CSConSyncService::NewLC(); + syncService->GetSolutionL( KSeconCalendarUid, calendar ); + syncService->GetSolutionL( KSeconContactsUid, contact ); + syncService->GetSolutionL( KSeconSmsUid, sms ); + syncService->GetSolutionL( KSeconBookmarkUid, bookmark ); + CleanupStack::PopAndDestroy( syncService ); + + WriteSyncSolutionsServiceL( calendar, contact, sms, bookmark ); + + TRACE_FUNC_EXIT; + } + + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteSyncSolutionsServiceL() +// Writes SyncSolutionsService data to capability object. +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteSyncSolutionsServiceL( const TSConSolutionInfo& aCalendar, + const TSConSolutionInfo& aContact, + const TSConSolutionInfo& aSms, + const TSConSolutionInfo& aBookmark) + { + TRACE_FUNC_ENTRY; + + WriteTagL( EService, TXmlParser::EElementBegin ); + + WriteValueL( EName, KSyncSolutionsServiceName ); + WriteValueL( EVersion, KSyncSolutionsServiceVersion ); + + if ( aCalendar.iUid != 0 ) + { + WriteSolutionTagL( KSyncCalendar, aCalendar ); + } + + if ( aContact.iUid != 0 ) + { + WriteSolutionTagL( KSyncContacts, aContact ); + } + + if ( aSms.iUid != 0 ) + { + WriteSolutionTagL( KSyncSms, aSms ); + } + + if ( aBookmark.iUid != 0 ) + { + WriteSolutionTagL( KSyncBookmark, aBookmark ); + } + + /* + * + * DesktopSync + * + * + * + */ + if ( !iSconInfo->iDesktopSyncError ) + { + WriteTagL( EExt, TXmlParser::EElementBegin ); + WriteValueL( EXNam, KDesktopSync ); + + TBuf buffer; + buffer.AppendNum( iSconInfo->iDesktopSync ); + + WriteValueL( EXVal, buffer ); + WriteTagL( EExt, TXmlParser::EElementEnd ); + } + + + + WriteTagL( EService, TXmlParser::EElementEnd ); + TRACE_FUNC_EXIT; + } + + + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteSolutionTagL() +// Writes SyncSolutionsService solution data to capability object. +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteSolutionTagL( const TDesC& aContentName, + const TSConSolutionInfo& aSolution ) + { + TRACE_FUNC_ENTRY; + _LIT( KFormatUID, "UID=0x%08x" ); + _LIT( KFormatName, "Name=%S" ); + _LIT( KFormatDate, "Timestamp=%04d%02d%02dT%02d%02d%02dZ" ); + + WriteTagL( EExt, TXmlParser::EElementBegin ); + WriteValueL( EXNam, aContentName ); + + TFileName temp; + temp.Format( KFormatUID, aSolution.iUid ); + WriteValueL( EXVal, temp ); + + temp.Format( KFormatName, &aSolution.iSolutionName ); + WriteValueL( EXVal, temp ); + + if ( aSolution.iTime.Int64() != 0 ) + { + // write time + TDateTime time = aSolution.iTime.DateTime(); + temp.Format( KFormatDate, time.Year(), time.Month() + 1, + time.Day() + 1, time.Hour(), time.Minute(), time.Second() ); + WriteValueL( EXVal, temp ); + + } + + + WriteTagL( EExt, TXmlParser::EElementEnd ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteFolderL(const TDesC& aType, const TDesC& aFullName, +// const TDesC& aMemory) +// Writes one folder name element. +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteFolderL(const TDesC& aType, const TDesC& aFullName, + const TDesC& aMemory) + { + TRACE_FUNC_ENTRY; + _LIT(KFormat, "%S=%S"); + + TBuf buf; + const TInt KReservedSize = 10; + if ( aFullName.Length() + KReservedSize > KBufSize ) + { + return; + } + buf.Format(KFormat, &KFolderNameTag, &aFullName); + + + WriteTagL(EExt, TXmlParser::EElementBegin); + + WriteValueL(EXNam, aType); + WriteValueL(EXVal, buf); + + buf.Format(KFormat, &KFolderMemoryTypeTag, &aMemory); + WriteValueL(EXVal, buf); + + + WriteTagL(EExt, TXmlParser::EElementEnd); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteL(const TDesC& aText) +// Writes one element to capability buffer. +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteL(const TDesC& aText) + { + if (aText.Length() > iBuf.MaxLength()) + { + User::Leave(KErrTooBig); + } + + + iBuf=aText; + iBuf.Trim(); + FormatElement(iBuf); + TPtr8 ptr = iHeapBuf->Des(); + + if ( iBuf.Length()+2 > ptr.MaxLength() ) + { + User::Leave(KErrTooBig); + } + + //unicode conversion + HBufC8* convBuf = HBufC8::NewLC( iBuf.Size() ); + TPtr8 convPtr = convBuf->Des(); + + CnvUtfConverter::ConvertFromUnicodeToUtf8(convPtr, iBuf); + + ptr.Copy(convPtr); + ptr.Append( KLineFeed ); // linefeed + + CleanupStack::PopAndDestroy( convBuf ); + + TInt pos=iCapabilityBuf->Size(); + iCapabilityBuf->InsertL(pos, ptr); + + iBuf=KNullDesC; + } + +void CCapInfo::WriteNewLineL() + { + TInt pos=iCapabilityBuf->Size(); + iCapabilityBuf->InsertL(pos, KLineFeed ); + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteValueL(TInt aId, const TDesC& aValue) +// Constructs element with value (eg en) +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteValueL(TInt aId, const TDesC& aValue) + { + // empty values not written to capability object + if (aValue.Length()<1) + { + LOGGER_WRITE( "WriteValueL: value is empty" ); + return; + } + + TBuf buf; + + TRAPD(err, CapParser::MakeElementL(buf, aId, aValue)); + if (err==KErrNone) + { + WriteL(buf); + } + else if (err==KErrTooBig) + { + WriteBigValueL(aId, aValue); + } + else + { + User::Leave(err); + } + + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteBigValueL(TInt aId, const TDesC& aValue) +// Constructs element with value +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteBigValueL(TInt aId, const TDesC& aValue) + { + HBufC* hBuf=HBufC::NewL(aValue.Length()+KBufSize); + CleanupStack::PushL(hBuf); + + TPtr pBuf(hBuf->Des()); + CapParser::MakeElementL(pBuf, aId, aValue); + WriteL(*hBuf); + + CleanupStack::PopAndDestroy(hBuf); + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteValueL(TInt aId, TInt64 aValue) +// Constructs element with integer value +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteValueL(TInt aId, TInt64 aValue) + { + TBuf buf; + TBuf value; + CapUtil::IntToStr(value, aValue); + CapParser::MakeElementL(buf, aId, value); + WriteL(buf); + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteTagL(TInt aId, TInt aType) +// Constructs element without value (eg ) +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteTagL(TInt aId, TInt aType) + { + TBuf buf; + CapParser::MakeElementL(buf, aId, aType); + WriteL(buf); + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteAttributeL(TInt aId, const TDesC& aVersion, const TDesC& aDate) +// Constructs element with attributes "Version" and "Date" +// (eg ) +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteAttributeL(TInt aId, const TDesC& aVersion, + const TDesC& aDate) + { + // empty values not written to capability object + if (aVersion.Length()<1 && aDate.Length()<1) + { + LOGGER_WRITE( "WriteAttributeL: attributes are empty" ); + return; + } + + TBuf buf; + CapParser::MakeElementL(buf, aId, aVersion, aDate); + WriteL(buf); + } + +// ----------------------------------------------------------------------------- +// CCapInfo::WriteFromListL(CStringList* aList) +// Writes elements from list to capability buffer. +// ----------------------------------------------------------------------------- +// +void CCapInfo::WriteFromListL(CStringList* aList) + { + TInt count=aList->Count(); + + for (TInt i=0; iReadPtr(i)); + } + } + +// ----------------------------------------------------------------------------- +// CCapInfo::FormatElement(TDes& aText) +// Function adds indentation spaces to capability elements to improve +// readability. +// ----------------------------------------------------------------------------- +// +void CCapInfo::FormatElement(TDes& aText) + { + TXmlParser parser; + + parser.Set(aText); + TInt type=parser.Type(); + TBuf tag; + parser.GetTag(tag); + + if (type==TXmlParser::EElementEnd) + { + TInt id1=CapParser::ElementId(tag); + TInt id2=iIdStack.Pop(); + + __ASSERT_DEBUG(id1==id2, CapUtil::Panic(KErrGeneral)); + id1=0; + id2=0; + } + + AddFormatText(aText, iIdStack.Size()); + + if (type==TXmlParser::EElementBegin) + { + TInt id1=CapParser::ElementId(tag); + iIdStack.Push(id1); + } + } + +// ----------------------------------------------------------------------------- +// CCapInfo::AddFormatText( TDes& aText, TInt aNum ) const +// Adds format text +// ----------------------------------------------------------------------------- +// +void CCapInfo::AddFormatText( TDes& aText, TInt aNum ) const + { + TBuf buf; + buf = KNullDesC; + + if ( aNum > KNestingLimit ) + { + aNum = KNestingLimit; + } + + for ( TInt i=0; ibuf.Length() ) + { + aText.Insert( 0, buf ); + } + } + +// End of file + + diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/src/caplist.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/src/caplist.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,219 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CCapList implementation +* +*/ + + +// INCLUDE FILES + +#include "caplist.h" +#include "caputils.h" +#include "capparser.h" +#include "capability.h" +#include "debug.h" + +// ============================= MEMBER FUNCTIONS =============================== + + +// ----------------------------------------------------------------------------- +// CCapList::NewL() +// Two-phase constructor. +// ----------------------------------------------------------------------------- +// +CCapList* CCapList::NewL() + { + CCapList* self = new(ELeave) CCapList(); + CleanupStack::PushL( self ); + self->ConstructL(); + CleanupStack::Pop( self ); + return self; + } + +// ----------------------------------------------------------------------------- +// CCapList::~CCapList() +// Gets phone serial number from etel. +// ----------------------------------------------------------------------------- +// +CCapList::~CCapList() + { + delete iList; + } + +// ----------------------------------------------------------------------------- +// CCapList::CCapList() +// Constructor +// ----------------------------------------------------------------------------- +// +CCapList::CCapList() + { + } + +// ----------------------------------------------------------------------------- +// CCapList::ConstructL() +// Initializes the member data +// ----------------------------------------------------------------------------- +// +void CCapList::ConstructL() + { + iList = CStringList::NewL(); + } + +// ----------------------------------------------------------------------------- +// CCapList::List() +// Returns the list +// ----------------------------------------------------------------------------- +// +CStringList* CCapList::List() + { + __ASSERT_DEBUG(iList, CapUtil::Panic(KErrGeneral)); + return iList; + } + +// ----------------------------------------------------------------------------- +// CCapList::FindFromMark(TInt aId, TInt aType) +// Find from mark +// ----------------------------------------------------------------------------- +// +TInt CCapList::FindFromMark(TInt aId, TInt aType) + { + TInt mark = List()->Mark(); + TInt count= List()->Count(); + + if ( mark >= count ) + { + return KErrNotFound; + } + + TInt index=Find(aId, aType, mark); + if ( index == KErrNotFound ) + { + return KErrNotFound; + } + + + __ASSERT_DEBUG(index>=mark, CapUtil::Panic(KErrGeneral)); + + List()->SetMark(index+1); + return index; + } + +// ----------------------------------------------------------------------------- +// CCapList::FindServiceHeader() +// Finds service xml-file identification header. This header must be the first +// line in every service file. +// ----------------------------------------------------------------------------- +// +TBool CCapList::FindServiceHeader() + { + TRACE_FUNC_ENTRY; + if (List()->Count()<1) + { + LOGGER_WRITE( "CCapList::FindServiceHeader() : returned EFalse" ); + return EFalse; + } + + TBuf buf; + TPtrC ptr=List()->ReadPtr(0); + CapUtil::StrCopy(buf, ptr); + buf.Trim(); + if (buf.Compare(KServiceHeader)==0) + { + LOGGER_WRITE( "CCapList::FindServiceHeader() : returned ETrue" ); + return ETrue; + } + else + { + LOGGER_WRITE( "CCapList::FindServiceHeader() : returned EFalse" ); + return EFalse; + } + } + +// ----------------------------------------------------------------------------- +// CCapList::FindServiceL(CStringList* aList) +// Find service +// ----------------------------------------------------------------------------- +// +TBool CCapList::FindServiceL(CStringList* aList) + { + TRACE_FUNC_ENTRY; + aList->Reset(); + List()->SetMark(0); + + if (!FindServiceHeader()) + { + LOGGER_WRITE( "CCapList::FindServiceL(CStringList* aList) : returned EFalse" ); + return EFalse; + } + + + for (;;) + { + TInt start=FindFromMark(EService, TXmlParser::EElementBegin); + TInt stop=FindFromMark(EService, TXmlParser::EElementEnd); + + if (start==KErrNotFound || stop==KErrNotFound || start>=stop) + { + break; + } + + aList->CopyL(List(), start, stop); + } + + if (aList->Count()>0) + { + LOGGER_WRITE( "CCapList::FindServiceL(CStringList* aList) : returned ETrue" ); + return ETrue; + } + + LOGGER_WRITE( "CCapList::FindServiceL(CStringList* aList) : returned EFalse" ); + return EFalse; + } + +// ----------------------------------------------------------------------------- +// CCapList::Find(TInt aId, TInt aType, TInt aIndex) +// Find element +// ----------------------------------------------------------------------------- +// +TInt CCapList::Find(TInt aId, TInt aType, TInt aIndex) + { + TInt count=List()->Count(); + if (aIndex<0 || aIndex>=count) + { + CapUtil::Panic(KErrArgument); + } + + for (TInt i=aIndex; iReadPtr(i); + + TInt id=0; + TInt type=0; + + CapParser::ParseElement(ptr, id, type); + if (type==TXmlParser::EElementUnknown) + { + continue; // invalid capability element + } + + if (id==aId && aType==type) + { + return i; + } + } + return KErrNotFound; + } + + +// End of files diff -r 0aa8cc770c8a -r 4a793f564d72 connectivitymodules/SeCon/services/csc/src/capparser.cpp --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/connectivitymodules/SeCon/services/csc/src/capparser.cpp Wed Sep 01 12:20:56 2010 +0100 @@ -0,0 +1,766 @@ +/* +* Copyright (c) 2005-2008 Nokia Corporation and/or its subsidiary(-ies). +* All rights reserved. +* This component and the accompanying materials are made available +* under the terms of "Eclipse Public License v1.0" +* which accompanies this distribution, and is available +* at the URL "http://www.eclipse.org/legal/epl-v10.html". +* +* Initial Contributors: +* Nokia Corporation - initial contribution. +* +* Contributors: +* +* Description: CapParser implementation +* +*/ + + +// INCLUDE FILES + +#include "capparser.h" +#include "caputils.h" + +const char KFind1 = '&'; +const char KFind2 = '<'; +const char KFind3 = '>'; +const char KFind4 = '"'; +const char KFind5 = '\''; + +_LIT( KReplace1, "&" ); +_LIT( KReplace2, "<" ); +_LIT( KReplace3, ">" ); +_LIT( KReplace4, """ ); +_LIT( KReplace5, "'" ); + +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CapParser::GetTagL(TDes& aText, TInt aId) +// Returns capability element tag (eg. "Memory") +// ----------------------------------------------------------------------------- +// +void CapParser::GetTagL(TDes& aText, TInt aId) + { + aText=KNullDesC; + + TInt count=NUMXMLTOKENS; + for (TInt i=0; ibuf; + TInt count=NUMXMLTOKENS; + for (TInt i=0; i" -> EMemory, EElementBegin) +// ----------------------------------------------------------------------------- +// +void CapParser::ParseElement(const TDesC& aText, TInt& aId, TInt& aType) + { + TXmlParser parse; + aId=KErrNotFound; + + parse.Set(aText); + aType=parse.Type(); + if (aType==TXmlParser::EElementUnknown) + { + return; + } + + TPtrC ptr=parse.Tag(); + aId=ElementId(ptr); + } + +// ----------------------------------------------------------------------------- +// CapParser::MakeElementL(TDes& aText, TInt aId, const TDesC& aValue) +// Constructs element with value (eg. "23456"). +// ----------------------------------------------------------------------------- +// +void CapParser::MakeElementL(TDes& aText, TInt aId, const TDesC& aValue) + { + aText=KNullDesC; + ReplaceSpecialCharsL( aText, aValue ); + + TBuf buf; + MakeElementL( buf, aId, TXmlParser::EElementBegin ); + + TInt len = aText.Length() + buf.Length() + buf.Length() + 1; + if ( len > aText.MaxLength()) + { + User::Leave(KErrTooBig); + } + + aText.Insert( 0, buf ); + MakeElementL( buf, aId, TXmlParser::EElementEnd ); + aText.Append( buf ); + } + +// ----------------------------------------------------------------------------- +// CapParser::MakeElementL(TDes& aText, TInt aId, TInt aType) +// Constructs element without value (eg. "" or ""). +// ----------------------------------------------------------------------------- +// +void CapParser::MakeElementL(TDes& aText, TInt aId, TInt aType) + { + _LIT(KFormat1, "<%S>"); + _LIT(KFormat2, ""); + _LIT(KFormat3, "<%S/>"); + + aText=KNullDesC; + TBuf buf; + GetTagL(buf, aId); + + switch(aType) + { + case TXmlParser::EElementBegin: + aText.Format(KFormat1, &buf); + break; + case TXmlParser::EElementEnd: + aText.Format(KFormat2, &buf); + break; + case TXmlParser::EElementEmpty: + aText.Format(KFormat3, &buf); + break; + default: + CapUtil::Panic(KErrArgument); + break; + } + } + +// ----------------------------------------------------------------------------- +// CapParser::MakeElementL(TDes& aText, TInt aId, const TDesC& aVersion, +// const TDesC& aDate) +// Constructs element with attributes "Version" and "Date"(eg. +// ""). +// ----------------------------------------------------------------------------- +// +void CapParser::MakeElementL(TDes& aText, TInt aId, const TDesC& aVersion, + const TDesC& aDate) + { + _LIT(KFormat1, "<%S %S=\"%S\" %S=\"%S\"/>"); + _LIT(KFormat2, "<%S %S=\"%S\"/>"); + + aText=KNullDesC; + + TBuf element; + TBuf versionTag; + TBuf dateTag; + + GetTagL(element, aId); + GetTagL(versionTag, EAttVersion); + GetTagL(dateTag, EAttDate); + + if (aDate.Length()>0) + { + aText.Format(KFormat1, &element, &versionTag, &aVersion, &dateTag, + &aDate); + } + else + { + aText.Format(KFormat2, &element, &versionTag, &aVersion); + } + } + +// ----------------------------------------------------------------------------- +// CapParser::ReplaceSpecialCharsL( TDes& aText, const TDesC& aValue ) +// Replaces special characters to xml compliant. +// ----------------------------------------------------------------------------- +// +void CapParser::ReplaceSpecialCharsL( TDes& aText, const TDesC& aValue ) + { + if ( aValue.Length() > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Copy( aValue ); + + //Replace special characters + for( TInt i = 0; i < aText.Length(); i++ ) + { + switch( aText[i] ) + { + case KFind1: + if ( aText.Length()+KReplace1().Length()-1 > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Replace( i, 1, KReplace1 ); + i+=KReplace1().Length()-1; + break; + case KFind2: + if ( aText.Length()+KReplace2().Length()-1 > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Replace( i, 1, KReplace2 ); + i+=KReplace2().Length()-1; + break; + case KFind3: + if ( aText.Length()+KReplace3().Length()-1 > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Replace( i, 1, KReplace3 ); + i+=KReplace3().Length()-1; + break; + case KFind4: + if ( aText.Length()+KReplace4().Length()-1 > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Replace( i, 1, KReplace4 ); + i+=KReplace4().Length()-1; + break; + case KFind5: + if ( aText.Length()+KReplace5().Length()-1 > aText.MaxLength() ) + { + User::Leave(KErrTooBig); + } + aText.Replace( i, 1, KReplace5 ); + i+=KReplace5().Length()-1; + break; + default: + break; + } + } + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Set(const TDesC& aText) +// Sets a tag +// ----------------------------------------------------------------------------- +// +void TXmlParser::Set(const TDesC& aText) + { + iOriginal.Set(aText); + TrimOriginal(); + Init(); + Parse(); + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Init() +// Inits the parser +// ----------------------------------------------------------------------------- +// +void TXmlParser::Init() + { + iType=EElementUnknown; + iTag.Set(KNullDesC); + iValue.Set(KNullDesC); + } + +// ----------------------------------------------------------------------------- +// TXmlParser::GetTag(TDes& aText) const +// Gets the tag +// ----------------------------------------------------------------------------- +// +void TXmlParser::GetTag(TDes& aText) const + { + StrCopy(aText, iTag); + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Tag() const +// Returns a pointer to a tag +// ----------------------------------------------------------------------------- +// +TPtrC TXmlParser::Tag() const + { + return iTag; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Type() const +// Returns type +// ----------------------------------------------------------------------------- +// +TInt TXmlParser::Type() const + { + return iType; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Parse() +// Parses xml-element. +// ----------------------------------------------------------------------------- +// +void TXmlParser::Parse() + { + iType=EElementUnknown; + + // this must be the first check + if (ElementUnknown()) + { + return; + } + + if (ElementBegin()) + { + return; + } + + if (ElementEnd()) + { + return; + } + + if (ElementValue()) + { + return; + } + + if (ElementComment()) + { + return; + } + + if (ElementDocType()) + { + return; + } + + if (ElementVersion()) + { + return; + } + + if (ElementEmpty()) + { + return; + } + + if (ElementAtt()) + { + return; + } + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementUnknown() +// Parses unknown elements +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementUnknown() + { + TPtrC str=Str(); + TInt len=str.Length(); + const TInt KXmlElementMinLength = 3; + if ( len < KXmlElementMinLength ) + { + return ETrue; // too short to be xml element + } + + + iFirst=str.Locate('<'); + iLast=str.LocateReverse('>'); + iSlash=str.LocateReverse('/'); + + if (iFirst!=0 || iLast!=len-1) + { + return ETrue; // first char must be "<" and last ">" + } + + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementBegin() +// Parses beginning tag (eg. ) +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementBegin() + { + TPtrC str=Str(); + + if (iSlash!=KErrNotFound) + { + return EFalse; + } + + // remove possible attributes + TInt pos=str.Locate(' '); + if (pos==KErrNotFound) + { + pos=iLast; + } + + TPtrC ptr=SubStr(iFirst, pos); + + if (!ValidTag(ptr)) + { + return EFalse; + } + + iType=EElementBegin; + iTag.Set(ptr); + + return ETrue; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementEnd() +// Parses ending tag (eg. ) +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementEnd() + { + if (iSlash!=iFirst+1) + { + return EFalse; + } + + TPtrC ptr=SubStr(iSlash, iLast); + if (!ValidTag(ptr)) + { + return EFalse; + } + + iType=EElementEnd; + iTag.Set(ptr); + return ETrue; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementValue() +// Parses value (eg. en) +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementValue() + { + TPtrC str=Str(); + + TInt pos1=str.Locate('>'); + TInt pos2=str.LocateReverse('<'); + + if (pos1) +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementEmpty() + { + if (iSlash!=iLast-1) + { + return EFalse; + } + + TPtrC ptr=SubStr(iFirst, iSlash); + if (!ValidTag(ptr)) + { + return EFalse; + } + + iType=EElementEmpty; + iTag.Set(ptr); + return ETrue; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementVersion() +// Identifies version element ("") +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementVersion() + { + TPtrC str=Str(); + + if ( str.Length()>=3 && str[1]=='?' && str[2]=='x') + { + iType=EElementVersion; + return ETrue; + } + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementDocType() +// Identifies document type element +// (""). +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementDocType() + { + TPtrC str=Str(); + const TInt KElementMinLength = 10; + if ( str.Length() < KElementMinLength ) + { + return EFalse; + } + + if (str[1]=='!' && str[2]=='D' && str[3]=='O' && str[4]=='C') + { + iType=EElementDocType; + return ETrue; + } + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementComment() +// Identifies comment element (""). +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementComment() + { + TPtrC str=Str(); + + if (str.Length()<7) + { + return EFalse; + } + + if (str[1]=='!' && str[2]=='-' && str[3]=='-') + { + iType=EElementComment; + return ETrue; + } + + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ElementAtt() +// Parses attribute element (eg. ) +// Note: Attribute values cannot contain equals (=) or quotations (") +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ElementAtt() + { + TPtrC str=Str(); + TInt num1=Count(str, '='); + TInt num2=Count(str, '"'); + TInt pos=str.Locate(' '); // find end of tag + + if (iSlash==iLast-1 && num1>0 && num2==(2*num1) && pos!=KErrNotFound) + { + TPtrC ptr1=SubStr(iFirst, pos); + if (!ValidTag(ptr1)) + { + return EFalse; + } + + iType=EElementAtt; + iTag.Set(ptr1); + TPtrC ptr2=SubStr(pos, iSlash); + iValue.Set(ptr2); + return ETrue; + } + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::Str() const +// Locates the position of the given character +// ----------------------------------------------------------------------------- +// +TPtrC TXmlParser::Str() const + { + return iText; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::FirstNonSpace(const TDesC& aText) +// Returns the position of the first non space character +// ----------------------------------------------------------------------------- +// +TInt TXmlParser::FirstNonSpace(const TDesC& aText) + { + TInt len=aText.Length(); + for (TInt i=0; i=0; i--) + { + TChar c=aText[i]; + if (!c.IsSpace()) + { + return i; + } + } + return KErrNotFound; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::SubStr(const TDesC& aText, TInt pos1, TInt pos2) +// Function returns a sub-string between aPos1 and aPos2 +// ----------------------------------------------------------------------------- +// +TPtrC TXmlParser::SubStr(const TDesC& aText, TInt pos1, TInt pos2) + { + if (pos1<0 || pos2>=aText.Length() || pos1>=pos2) + { + return TPtrC(); // return empty descriptor + } + + TInt len=pos2-pos1; + return aText.Mid(pos1+1, len-1); + } + +// ----------------------------------------------------------------------------- +// TXmlParser::SubStr(TInt pos1, TInt pos2) +// Function returns a sub-string between aPos1 and aPos2 +// ----------------------------------------------------------------------------- +// +TPtrC TXmlParser::SubStr(TInt pos1, TInt pos2) + { + TPtrC str=Str(); + return SubStr(str, pos1, pos2); + } + +// ----------------------------------------------------------------------------- +// TXmlParser::StrCopy(TDes& aTarget, const TDesC& aSource) +// Function performs string copy with length checking. +// ----------------------------------------------------------------------------- +// +void TXmlParser::StrCopy(TDes& aTarget, const TDesC& aSource) + { + TInt len=aTarget.MaxLength(); + if(lenfirst+1) + { + TPtrC ptr=iOriginal.Mid(first, last-first+1); + iText.Set(ptr); + } + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ValidChar(const TChar aChar) +// Validates the character +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ValidChar(const TChar aChar) + { + if (aChar >= 'A' && aChar <= 'Z') + { + return ETrue; + } + if (aChar >= 'a' && aChar <= 'z') + { + return ETrue; + } + + return EFalse; + } + +// ----------------------------------------------------------------------------- +// TXmlParser::ValidTag(const TDesC& aText) +// Validates the tag +// ----------------------------------------------------------------------------- +// +TBool TXmlParser::ValidTag(const TDesC& aText) + { + TInt len=aText.Length(); + for (TInt i=0; i +#include +#include +#include +#include // for etel +#include // for etel +#include +#include +#include +#include +#include + +#include "caputils.h" +#include "capability.h" +#include "debug.h" + +const TInt KPackageSize = 65536; +const TInt KDefaultArrayGranularity = 5; +// ============================= MEMBER FUNCTIONS =============================== + +// ----------------------------------------------------------------------------- +// CapUtil::GetDefaultRootPathL( RFs& aFs, TDes& aRootPath ) +// Gets default root path +// ----------------------------------------------------------------------------- +// +void CapUtil::GetDefaultRootPathL( RFs& aFs, TDes& aRootPath ) + { + TRACE_FUNC_ENTRY; + // Use the default mass storage if it is internal drive + TInt msDrive; + User::LeaveIfError( DriveInfo::GetDefaultDrive( DriveInfo::EDefaultMassStorage, msDrive ) ); + LOGGER_WRITE_1("drive: %d", msDrive); + + TUint msStatus( 0 ); + TInt err = DriveInfo::GetDriveStatus( aFs, msDrive, msStatus ); + LOGGER_WRITE_1("DriveInfo::GetDriveStatus err: %d", err); + + // if no errors, also check drive status + if( !err && !( msStatus & DriveInfo::EDrivePresent ) + || msStatus & DriveInfo::EDriveCorrupt ) + { + LOGGER_WRITE( "Internal mass storage not present or corrupted" ); + err = KErrNotFound; + } + + if ( !err && ( msStatus & DriveInfo::EDriveInternal ) ) + { + // Use internal mass storage + LOGGER_WRITE( "Use internal mass storage" ); + User::LeaveIfError( PathInfo::GetRootPath( aRootPath, msDrive ) ); + } + else + { + // Use phone memory + LOGGER_WRITE( "Use phone memory" ); + StrCopy( aRootPath, PathInfo::PhoneMemoryRootPath() ); + } + LOGGER_WRITE_1( "rootPath: %S", &aRootPath ); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CapUtil::GetMemoryType( RFs& aFs, TDes& aMemoryType, const TInt aDrive ) +// Gets drive memory type +// ----------------------------------------------------------------------------- +// +void CapUtil::GetMemoryType( RFs& aFs, TDes& aMemoryType, const TInt aDrive ) + { + TRACE_FUNC_ENTRY; + LOGGER_WRITE_1("aDrive: %d", aDrive); + aMemoryType = KNullDesC; + TUint driveStatus; + TInt err = DriveInfo::GetDriveStatus( aFs, aDrive, driveStatus ); + if( err ) + { + LOGGER_WRITE_1( "CapUtil::GetMemoryType() : DriveInfo::GetDriveStatus err: %d", err ); + return; + } + // search internal or removable drives + TBool searchInternalDrives; + if( driveStatus & DriveInfo::EDriveInternal ) + { + aMemoryType = KMediaFlash; + searchInternalDrives = ETrue; + } + else + { + aMemoryType = KMediaMMC; + searchInternalDrives = EFalse; + } + + TInt typeNumber(0); + TInt driveCount; + TDriveList driveList; + + err = DriveInfo::GetUserVisibleDrives( aFs, driveList, driveCount ); + if( err ) + { + LOGGER_WRITE_1( "CapUtil::GetMemoryType() : DriveInfo::GetUserVisibleDrives err: %d", err ); + return; + } + + for( TInt i = EDriveA; i <= aDrive; i++ ) + { + if( driveList[i] ) + { + TUint driveStatus; + err = DriveInfo::GetDriveStatus( aFs, i, driveStatus ); + if( err ) + { + LOGGER_WRITE_1( "CapUtil::GetMemoryType() : DriveInfo::GetDriveStatus err: %d", err ); + continue; + } + + if( !(driveStatus & DriveInfo::EDrivePresent ) + || driveStatus & DriveInfo::EDriveCorrupt ) + { + LOGGER_WRITE( "not present or corrupted" ); + continue; + } + + if( driveStatus & DriveInfo::EDriveInternal ) + { + if( searchInternalDrives ) + { + typeNumber++; + } + } + else if( driveStatus & DriveInfo::EDriveRemovable ) + { + if( !searchInternalDrives ) + { + typeNumber++; + } + } + } + } + + if( typeNumber > 1 ) + { + aMemoryType.AppendNum( typeNumber ); + } + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CapUtil::GetOperatornameL(TDes& aLongName, TDes& aCountryCode, TDes& aNetworkID) +// Gets phone operator name, country code, networkID. +// ----------------------------------------------------------------------------- +// +void CapUtil::GetOperatorNameL(TDes& aLongName, TDes& aCountryCode, TDes& aNetworkID) + { + TRACE_FUNC_ENTRY; + TUint32 networkCaps; + RTelServer::TPhoneInfo phoneInfo; + + RTelServer server; + RMobilePhone mobilePhone; + User::LeaveIfError( server.Connect() ); + CleanupClosePushL( server ); + + TInt numPhones; + User::LeaveIfError( server.EnumeratePhones( numPhones ) ); + server.GetPhoneInfo( 0, phoneInfo ); + + User::LeaveIfError( mobilePhone.Open( server, phoneInfo.iName ) ); + CleanupClosePushL( mobilePhone ); + User::LeaveIfError( mobilePhone.GetNetworkCaps( networkCaps ) ); + + RMobilePhone::TMobilePhoneNetworkInfoV1 mobilePhoneNetworkInfo; + RMobilePhone::TMobilePhoneNetworkInfoV1Pckg mobilePhoneNetworkInfoPckg( + mobilePhoneNetworkInfo ); + RMobilePhone::TMobilePhoneLocationAreaV1 mobilePhoneLocationArea; + + if (networkCaps & RMobilePhone::KCapsGetCurrentNetwork) + { + TRequestStatus status; + mobilePhone.GetCurrentNetwork( + status, mobilePhoneNetworkInfoPckg, mobilePhoneLocationArea ); + User::WaitForRequest( status ); + User::LeaveIfError( status.Int() ); + } + + CleanupStack::PopAndDestroy( &mobilePhone ); + CleanupStack::PopAndDestroy( &server ); + if ( mobilePhoneNetworkInfo.iLongName.Length() > 0 ) + { + StrCopy( aLongName, mobilePhoneNetworkInfo.iLongName ); + } + else if ( mobilePhoneNetworkInfo.iShortName.Length() > 0 ) + { + StrCopy( aLongName, mobilePhoneNetworkInfo.iShortName ); + } + else + { + StrCopy( aLongName, mobilePhoneNetworkInfo.iDisplayTag ); + } + StrCopy( aCountryCode, mobilePhoneNetworkInfo.iCountryCode ); + StrCopy( aNetworkID, mobilePhoneNetworkInfo.iNetworkId ); + + TRACE_FUNC_EXIT; + } +// ----------------------------------------------------------------------------- +// CapUtil::GetManufacturer(TDes& aText) +// Gets phone manufacturer from HAL. In case manufacturer is not known, +// ----------------------------------------------------------------------------- +// +void CapUtil::GetManufacturer(TDes& aText) + { + TRACE_FUNC_ENTRY; + TInt num(KErrNotFound); + + HAL::Get(HALData::EManufacturer, num); + + switch (num) + { + case HALData::EManufacturer_Ericsson: + aText=KManufacturerEricsson; + break; + case HALData::EManufacturer_Motorola: + aText=KManufacturerMotorola; + break; + case HALData::EManufacturer_Nokia: + aText=KManufacturerNokia; + break; + case HALData::EManufacturer_Panasonic: + aText=KManufacturerPanasonic; + break; + case HALData::EManufacturer_Psion: + aText=KManufacturerPsion; + break; + case HALData::EManufacturer_Intel: + aText=KManufacturerIntel; + break; + case HALData::EManufacturer_Cogent: + aText=KManufacturerCogent; + break; + case HALData::EManufacturer_Cirrus: + aText=KManufacturerCirrus; + break; + case HALData::EManufacturer_Linkup: + aText=KManufacturerLinkup; + break; + case HALData::EManufacturer_TexasInstruments: + aText=KManufacturerTexasInstruments; + break; + default: + aText=KNullDesC; + break; + } + + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CapUtil::GetLanguage(TDes& aText) +// Gets language +// ----------------------------------------------------------------------------- +// +void CapUtil::GetLanguage(TDes& aText) + { + TRACE_FUNC_ENTRY; + TLanguage lang=User::Language(); + GetLanguageString(lang, aText); + TRACE_FUNC_EXIT; + } + +// ----------------------------------------------------------------------------- +// CapUtil::GetSWVersionL(TDes& aVersion, TDes& aDate, TDes& aModel) +// Gets SW version, SW version date and device model from SysUtil. +// ----------------------------------------------------------------------------- +// +void CapUtil::GetSWVersionL(TDes& aVersion, TDes& aDate, TDes& aModel) + { + TRACE_FUNC_ENTRY; + TBuf